DK207175A - Fremgangsmade til fremstilling af cephalosporiner med alfa-acylaminoeddikesyresidekede - Google Patents
Fremgangsmade til fremstilling af cephalosporiner med alfa-acylaminoeddikesyresidekedeInfo
- Publication number
- DK207175A DK207175A DK207175A DK207175A DK207175A DK 207175 A DK207175 A DK 207175A DK 207175 A DK207175 A DK 207175A DK 207175 A DK207175 A DK 207175A DK 207175 A DK207175 A DK 207175A
- Authority
- DK
- Denmark
- Prior art keywords
- acylamine
- cephalosporins
- alfa
- procedure
- preparation
- Prior art date
Links
- 229930186147 Cephalosporin Natural products 0.000 title 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 title 1
- 229940124587 cephalosporin Drugs 0.000 title 1
- HOKIDJSKDBPKTQ-GLXFQSAKSA-N cephalosporin C Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CCC[C@@H](N)C(O)=O)[C@@H]12 HOKIDJSKDBPKTQ-GLXFQSAKSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
- C07D285/125—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
- C07D285/135—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Fodder In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH649474A CH606001A5 (enExample) | 1974-05-13 | 1974-05-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK207175A true DK207175A (da) | 1975-11-14 |
Family
ID=4310503
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK207175A DK207175A (da) | 1974-05-13 | 1975-05-12 | Fremgangsmade til fremstilling af cephalosporiner med alfa-acylaminoeddikesyresidekede |
Country Status (12)
| Country | Link |
|---|---|
| US (2) | US4041161A (enExample) |
| JP (1) | JPS50154286A (enExample) |
| AT (1) | AT339479B (enExample) |
| BE (1) | BE828933A (enExample) |
| CA (1) | CA1076103A (enExample) |
| CH (1) | CH606001A5 (enExample) |
| DE (1) | DE2520561A1 (enExample) |
| DK (1) | DK207175A (enExample) |
| FR (1) | FR2270881B1 (enExample) |
| GB (1) | GB1495676A (enExample) |
| NL (1) | NL7505605A (enExample) |
| SE (1) | SE7504999L (enExample) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH606001A5 (enExample) * | 1974-05-13 | 1978-10-13 | Ciba Geigy Ag | |
| CA1074784A (en) * | 1974-09-06 | 1980-04-01 | Sumitomo Chemical Company | N-ACYLAMINO-.alpha.-ARYLACETAMIDO CEPHALOSPORINS |
| US4160087A (en) * | 1974-09-06 | 1979-07-03 | Sumitomo Chemical Company, Limited | N-acylamino-α-arylacetamido cephalosporins |
| JPS51115491A (en) * | 1975-04-03 | 1976-10-12 | Sumitomo Chem Co Ltd | Method for preparing 77* *44hydroxyy1*5 naphthyridinee33carboxyamino ** phenylacetamido*cephalosporins |
| JPS5268193A (en) * | 1975-11-28 | 1977-06-06 | Sumitomo Chem Co Ltd | Synthesis of novel cephalosporin derivatives |
| US4145418A (en) * | 1976-01-06 | 1979-03-20 | Takeda Chemical Industries, Ltd. | Thienopyridine substituted cephalosporins |
| US4302454A (en) * | 1976-03-03 | 1981-11-24 | Sumitomo Chemical Company, Limited | Cephalosporins |
| DE2715385A1 (de) * | 1976-04-14 | 1977-11-10 | Takeda Chemical Industries Ltd | Cephalosporinderivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel |
| FR2362146A1 (fr) * | 1976-08-17 | 1978-03-17 | Fujisawa Pharmaceutical Co | Procede de preparation de composes d'acide 7-(n-substitue-2-phenylglycinamido)-3-substitue-3-cephem-4-carboxylique et nouveaux produits ainsi obtenus, a activite antibacterienne |
| US4338439A (en) | 1976-08-26 | 1982-07-06 | Eli Lilly And Company | 7-[2-[(Substituted benzoyl]amino]acetamido]cephalosporins |
| US4338436A (en) | 1976-08-26 | 1982-07-06 | Eli Lilly And Company | 7-[2-[(Substituted benzoyl)amino]acetamido]cephalosporins |
| JPS5344585A (en) * | 1976-10-02 | 1978-04-21 | Meiji Seika Kaisha Ltd | Cephalosporin derivatives and their preparation |
| US4138554A (en) * | 1977-04-05 | 1979-02-06 | Bristol-Myers Company | 7-[D-α-(4-Hydroxy-1,5-naphthyridine-3-carboxamido)-α-phenyl (and p-hydroxyphenyl)acetamido]-3-carbamoyloxymethyl-3-cephem-4-carboxylic acids |
| EP0001041A3 (en) * | 1977-07-27 | 1979-06-27 | Sandoz Ag | Alpha(pyridonecarboxylamino)-alpha substituted acetamido penicillins and -cephalosporins, process for their preparation, their use in pharmaceuticals; pyridones used in the process |
| JPS5492991A (en) * | 1977-12-28 | 1979-07-23 | Dainippon Pharmaceut Co Ltd | N-acyl cephalosporin derivative and its salt |
| US4198504A (en) * | 1978-11-02 | 1980-04-15 | Bristol-Myers Company | [3-(Pyridinium)-7-(naphthyiridinyl carbonylamino)acetamido]cephalosporanic acid derivatives |
| US4216215A (en) * | 1978-11-06 | 1980-08-05 | Pfizer Inc. | 7[(Furanyl-2-acetamido)-2-acetamido]cephalosporin derivatives |
| GB2045238B (en) * | 1978-11-28 | 1982-12-01 | Mitsui Toatsu Chemicals | Cephalosporins |
| JPS5572195A (en) * | 1978-11-28 | 1980-05-30 | Mitsui Toatsu Chem Inc | Novel cephalosporin and antibacterial comprising it as active constituent |
| US4267180A (en) * | 1979-03-12 | 1981-05-12 | Warner-Lambert Company | Novel antibacterial amide compounds and process means for producing the same |
| IT1127208B (it) * | 1979-11-09 | 1986-05-21 | Simes | Nuovi derivati penicillanici e cefalosporanici,procedimento per la loro preparazione e relative composizioni farmaceutiche |
| JPS56158791A (en) * | 1980-05-10 | 1981-12-07 | Taisho Pharmaceut Co Ltd | Cephalosporin compound |
| US4468394A (en) * | 1981-04-02 | 1984-08-28 | Eisai Co., Ltd. | Cephalosporin compounds |
| WO1984001949A1 (fr) * | 1982-11-10 | 1984-05-24 | Kyoto Pharma Ind | Derives de cephalosporine, leur procede de preparation et agent prophylactique de traitement contre les infections bacteriennes |
| US4531396A (en) * | 1983-05-26 | 1985-07-30 | United Technologies Corporation | Forging die package |
| US4758557A (en) * | 1985-06-26 | 1988-07-19 | Meiji Seika Kaisha, Ltd. | Cephalosporin derivatives and bactericides containing the same |
| US7767826B2 (en) * | 2007-10-05 | 2010-08-03 | Pharmatech International, Inc. | Process for the synthesis of L-(+)-ergothioneine |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3687949A (en) * | 1969-01-21 | 1972-08-29 | Bristol Myers Co | Synthetic cephalosporins |
| US3912728A (en) * | 1972-06-22 | 1975-10-14 | Rit Rech Ind Therapeut | 7-(3-Substituted ureido and -thioureido) cephalosporins |
| CH606001A5 (enExample) * | 1974-05-13 | 1978-10-13 | Ciba Geigy Ag | |
| US4160087A (en) * | 1974-09-06 | 1979-07-03 | Sumitomo Chemical Company, Limited | N-acylamino-α-arylacetamido cephalosporins |
| US4117126A (en) * | 1975-04-03 | 1978-09-26 | Sumitomo Chemical Company, Ltd. | 7-(α-(4-Hydroxy-1,5-naphthyridine-3-carbonamido)-α-phenylacetamido) cephalosporin derivatives |
-
1974
- 1974-05-13 CH CH649474A patent/CH606001A5/xx not_active IP Right Cessation
-
1975
- 1975-04-29 SE SE7504999A patent/SE7504999L/xx not_active Application Discontinuation
- 1975-05-09 CA CA226,651A patent/CA1076103A/en not_active Expired
- 1975-05-09 DE DE19752520561 patent/DE2520561A1/de active Pending
- 1975-05-09 US US05/576,398 patent/US4041161A/en not_active Expired - Lifetime
- 1975-05-09 FR FR7514534A patent/FR2270881B1/fr not_active Expired
- 1975-05-09 GB GB19621/75A patent/GB1495676A/en not_active Expired
- 1975-05-12 DK DK207175A patent/DK207175A/da not_active Application Discontinuation
- 1975-05-12 BE BE156230A patent/BE828933A/xx unknown
- 1975-05-12 AT AT359275A patent/AT339479B/de not_active IP Right Cessation
- 1975-05-13 JP JP50056691A patent/JPS50154286A/ja active Pending
- 1975-05-13 NL NL7505605A patent/NL7505605A/xx not_active Application Discontinuation
-
1979
- 1979-02-12 US US06/011,359 patent/US4265892A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AU8104475A (en) | 1976-11-18 |
| FR2270881B1 (enExample) | 1979-08-17 |
| ATA359275A (de) | 1977-02-15 |
| CH606001A5 (enExample) | 1978-10-13 |
| US4265892A (en) | 1981-05-05 |
| CA1076103A (en) | 1980-04-22 |
| NL7505605A (nl) | 1975-11-17 |
| JPS50154286A (enExample) | 1975-12-12 |
| DE2520561A1 (de) | 1975-11-27 |
| GB1495676A (en) | 1977-12-21 |
| US4041161A (en) | 1977-08-09 |
| SE7504999L (sv) | 1975-11-14 |
| FR2270881A1 (enExample) | 1975-12-12 |
| BE828933A (fr) | 1975-11-12 |
| AT339479B (de) | 1977-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK207175A (da) | Fremgangsmade til fremstilling af cephalosporiner med alfa-acylaminoeddikesyresidekede | |
| DK137082B (da) | Analogifremgangsmade til fremstilling af 3-aminoidazolcarboxylsyrederivater | |
| RO77320A (ro) | Procedeu pentru purificarea sarurilor acidului clavulanic | |
| DK239075A (da) | Fremgangsmade til fremstilling af iodbenzenderivater | |
| DK289175A (da) | Fremgangsmade til fremstilling af cyclohexylestere af vincaminsyrederivater | |
| DK573475A (da) | Fremgangsmade til fremstilling af substituerede phenyleddikesyrer | |
| DK163075A (da) | Fremgangsmade til fremstilling af aryloxoheptansyrer | |
| DK591975A (da) | Fremgangsmade til fremstilling af phenyleddikesyrederivater | |
| DK416975A (da) | Fremgangsmade til fremstilling af 5-fluor-2-methyl-1-(paramethylsulfinylbenzyliden)-indenyl-3-eddikesyre | |
| DK446978A (da) | Fremgangsmaade til fremstilling af cephalosporansyrederivater | |
| DK442577A (da) | Fremgangsmade til fremstilling af aminosyrederivater | |
| DK211075A (da) | Fremgangsmade til fremstilling af abietamidderivater | |
| DK499075A (da) | Fremgangsmade til fremstilling af cephalosporiner | |
| DK364775A (da) | Fremgangsmade for fremstilling af cephalosporiner | |
| DK271975A (da) | Fremgangsmade til fremstilling af acylderivater | |
| DK446575A (da) | Fremgangsmade til fremstilling af cephalosporansyrederivater | |
| DK143332C (da) | Fremgangsmaade til fremstilling af ortho-hydroxyalkylerede phenoler | |
| DK220375A (da) | Fremgangsmade til fremstilling af cephalosporiner | |
| DK545675A (da) | Fremgangsmade til fremstilling af polyalkylenoxider med urethanendegrupper | |
| DK153554C (da) | Fremgangsmaade til fremstilling af 7-aminocephalosporansyrederivater | |
| DK156221C (da) | Fremgangsmaade til fremstilling af penicillansyre- og cephalosporansyrederivater | |
| DK536176A (da) | Fremgangsmade til fremstilling af cephalosporiner | |
| DK198175A (da) | Fremgangsmade til fremstilling af indolkinolizidinderivater | |
| DK180375A (da) | Fremgangsmade til fremstilling af cephalosporiner | |
| DK140011C (da) | Fremgangsmaade til fremstilling af 5-sulfamoylantranilsyrer |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AHB | Application shelved due to non-payment |