DK163060C - Fremgangsmaade til rensning af riboflavin - Google Patents
Fremgangsmaade til rensning af riboflavinInfo
- Publication number
- DK163060C DK163060C DK260285A DK260285A DK163060C DK 163060 C DK163060 C DK 163060C DK 260285 A DK260285 A DK 260285A DK 260285 A DK260285 A DK 260285A DK 163060 C DK163060 C DK 163060C
- Authority
- DK
- Denmark
- Prior art keywords
- riboflavin
- cleaning
- procedure
- cleaning riboflavin
- Prior art date
Links
- AUNGANRZJHBGPY-SCRDCRAPSA-N Riboflavin Chemical compound OC[C@@H](O)[C@@H](O)[C@@H](O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-SCRDCRAPSA-N 0.000 title 2
- AUNGANRZJHBGPY-UHFFFAOYSA-N D-Lyxoflavin Natural products OCC(O)C(O)C(O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-UHFFFAOYSA-N 0.000 title 1
- 238000004140 cleaning Methods 0.000 title 1
- 238000000034 method Methods 0.000 title 1
- 229960002477 riboflavin Drugs 0.000 title 1
- 235000019192 riboflavin Nutrition 0.000 title 1
- 239000002151 riboflavin Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D475/00—Heterocyclic compounds containing pteridine ring systems
- C07D475/12—Heterocyclic compounds containing pteridine ring systems containing pteridine ring systems condensed with carbocyclic rings or ring systems
- C07D475/14—Benz [g] pteridines, e.g. riboflavin
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3421714 | 1984-06-12 | ||
| DE19843421714 DE3421714A1 (de) | 1984-06-12 | 1984-06-12 | Verfahren zur reinigung von riboflavin |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| DK260285D0 DK260285D0 (da) | 1985-06-11 |
| DK260285A DK260285A (da) | 1985-12-13 |
| DK163060B DK163060B (da) | 1992-01-13 |
| DK163060C true DK163060C (da) | 1992-06-09 |
Family
ID=6238135
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK260285A DK163060C (da) | 1984-06-12 | 1985-06-11 | Fremgangsmaade til rensning af riboflavin |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4687847A (show.php) |
| EP (1) | EP0164704B1 (show.php) |
| JP (1) | JPS6110586A (show.php) |
| DE (2) | DE3421714A1 (show.php) |
| DK (1) | DK163060C (show.php) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3615834A1 (de) * | 1986-05-10 | 1987-11-12 | Basf Ag | Verbessertes verfahren zur herstellung von ribitylxylidin |
| ATE91686T1 (de) * | 1987-09-18 | 1993-08-15 | Hoffmann La Roche | Neue form des riboflavins. |
| US5103005A (en) * | 1989-07-21 | 1992-04-07 | Coors Biotech, Inc. | Method for recovery of riboflavin |
| DE4021274A1 (de) * | 1990-07-04 | 1992-01-09 | Basf Ag | Verfahren zur reinigung von fermentativ hergestelltem riboflavin |
| JP2814958B2 (ja) * | 1994-09-09 | 1998-10-27 | 株式会社神戸製鋼所 | 連続鋳造方法 |
| CA2282908A1 (en) * | 1998-10-19 | 2000-04-19 | F. Hoffmann-La Roche Ag | Purification and crystallization process for riboflavin |
| WO2005014594A1 (en) * | 2003-07-22 | 2005-02-17 | Dsm Ip Assets B.V. | Process for the purification of riboflavin |
| US20050136180A1 (en) * | 2003-12-19 | 2005-06-23 | 3M Innovative Properties Company | Method of coating a substrate with a fluoropolymer |
| CN110283175A (zh) * | 2019-06-29 | 2019-09-27 | 赤峰制药股份有限公司 | 一种高纯度核黄素的制备工艺 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2374661A (en) * | 1941-07-16 | 1945-05-01 | Roche Products Ltd | Manufacture of isoalloxazine derivatives |
| US2324800A (en) * | 1941-08-14 | 1943-07-20 | Pfizer Charles & Co | Purification of riboflavin |
| US2531439A (en) * | 1946-01-10 | 1950-11-28 | Nat Lead Co | Vitamin-enriched product and process of producing same |
| US2603633A (en) * | 1950-01-26 | 1952-07-15 | Commercial Solvents Corp | Crystalline form of riboflavin |
| US2822361A (en) * | 1954-06-22 | 1958-02-04 | Grain Processing Corp | Riboflavin recovery |
| US2797215A (en) * | 1955-04-28 | 1957-06-25 | Commercial Solvents Corp | Production of type a riboflavin crystals |
| US2807611A (en) * | 1955-10-13 | 1957-09-24 | Merck & Co Inc | Process for producing riboflavin |
| DE3247381A1 (de) * | 1982-12-22 | 1984-06-28 | Basf Ag, 6700 Ludwigshafen | Verbessertes verfahren zum reinigen von riboflavin |
| DE3302497A1 (de) * | 1983-01-26 | 1984-07-26 | Basf Ag, 6700 Ludwigshafen | Verbessertes verfahren zur herstellung von riboflavin |
-
1984
- 1984-06-12 DE DE19843421714 patent/DE3421714A1/de not_active Withdrawn
-
1985
- 1985-06-07 DE DE8585107062T patent/DE3574594D1/de not_active Expired - Lifetime
- 1985-06-07 EP EP85107062A patent/EP0164704B1/de not_active Expired
- 1985-06-10 US US06/743,157 patent/US4687847A/en not_active Expired - Lifetime
- 1985-06-11 DK DK260285A patent/DK163060C/da not_active IP Right Cessation
- 1985-06-12 JP JP60126393A patent/JPS6110586A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0164704A3 (en) | 1987-01-14 |
| JPS6110586A (ja) | 1986-01-18 |
| JPH0586396B2 (show.php) | 1993-12-10 |
| US4687847A (en) | 1987-08-18 |
| EP0164704A2 (de) | 1985-12-18 |
| EP0164704B1 (de) | 1989-12-06 |
| DK163060B (da) | 1992-01-13 |
| DE3421714A1 (de) | 1985-12-12 |
| DK260285D0 (da) | 1985-06-11 |
| DK260285A (da) | 1985-12-13 |
| DE3574594D1 (de) | 1990-01-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK407386D0 (da) | Fremgangsmaade til rensning af en interferon | |
| DK308085A (da) | Fremgangsmaade til ekstrudering af silicaholdige materialer | |
| DK162580C (da) | Fremgangsmaade til fremstilling af mikrokapsler | |
| DK162647C (da) | Fremgangsmaade til fremstilling af pyrido-imidazorifamyciner | |
| DK234689A (da) | Fremgangsmaade til rensning af polydekstrose | |
| DK382084A (da) | Fremgangsmaade til fremstilling af penemer | |
| DK162229C (da) | Fremgangsmaade til rensning af riboflavin | |
| DK163060C (da) | Fremgangsmaade til rensning af riboflavin | |
| DK222984A (da) | Fremgangsmaade til rensning af dextran-saccharase | |
| DK160829C (da) | Fremgangsmaade til fremstilling af pyrido-imidazorifamyciner | |
| DK156085D0 (da) | Fremgangsmaade til fremstilling af acetoxyazetidinoner | |
| DK304185D0 (da) | Fremgangsmaade til fremstilling af furanon | |
| DK138485A (da) | Fremgangsmaade til rensning af enzymholdig oploesning | |
| DK492586A (da) | Fremgangsmaade til rensning af kalveloebe | |
| DK162889D0 (da) | Fremgangsmaade til rensning af dipeptider | |
| DK570688D0 (da) | Fremgangsmaade til rensning af polyorganphosphanzenelastromerer | |
| DK162097C (da) | Fremgangsmaade til fremstilling af riboflavin | |
| DK625486D0 (da) | Fremgangsmaade til rensning af raeggas | |
| DK132084A (da) | Fremgangsmaade til fremstilling af mikrokapsler | |
| DK79685A (da) | Fremgangsmaade til fremstilling af riboflavin | |
| DK571784A (da) | Fremgangsmaade til rensning af soelvoverflader | |
| DK183184D0 (da) | Fremgangsmaade til rensning af en genstand | |
| DK293485D0 (da) | Fremgangsmaade til fremstilling af d-ribose | |
| DK568083D0 (da) | Fremgangsmaade til oprensning af diacetonesorbose | |
| BR6402096U (pt) | Conjunto de limpeza |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUP | Patent expired |