DK140943B - Fremgangsmåde til fremstilling af cephaloglycin. - Google Patents
Fremgangsmåde til fremstilling af cephaloglycin.Info
- Publication number
- DK140943B DK140943B DK24266AA DK24266A DK140943B DK 140943 B DK140943 B DK 140943B DK 24266A A DK24266A A DK 24266AA DK 24266 A DK24266 A DK 24266A DK 140943 B DK140943 B DK 140943B
- Authority
- DK
- Denmark
- Prior art keywords
- cephaloglycine
- preparation
- Prior art date
Links
- FUBBGQLTSCSAON-PBFPGSCMSA-N cefaloglycin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)COC(=O)C)C(O)=O)=CC=CC=C1 FUBBGQLTSCSAON-PBFPGSCMSA-N 0.000 title 1
- 229950004030 cefaloglycin Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/26—Methylene radicals, substituted by oxygen atoms; Lactones thereof with the 2-carboxyl group
- C07D501/32—Methylene radicals, substituted by oxygen atoms; Lactones thereof with the 2-carboxyl group with the 7-amino radical acylated by an araliphatic carboxylic acid, which is substituted on the aliphatic radical by hetero atoms
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US43804665A | 1965-03-08 | 1965-03-08 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK140943B true DK140943B (da) | 1979-12-10 |
| DK140943C DK140943C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1980-05-19 |
Family
ID=23738987
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK24266AA DK140943B (da) | 1965-03-08 | 1966-01-17 | Fremgangsmåde til fremstilling af cephaloglycin. |
Country Status (10)
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4123611A (en) * | 1970-10-21 | 1978-10-31 | President Of Osaka University | N-protected amino compounds |
| YU39709B (en) * | 1972-09-15 | 1985-04-30 | Bristol Myers Co | Process for producing cephalosporin |
| GB1438872A (en) * | 1972-11-17 | 1976-06-09 | Fujisawa Pharmaceutical Co | 7-beta-aminoacylamino-3-substituted-3-cephem-4-carboxylic acid derivatives and preparation thereof |
| US3880846A (en) * | 1972-12-19 | 1975-04-29 | Squibb & Sons Inc | Vinylaminoacetyl cephalosporins |
| FR2265391B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1974-04-02 | 1978-11-03 | Isf Spa | |
| AT342197B (de) * | 1975-02-20 | 1978-03-28 | Ciba Geigy Ag | Neues verfahren zur herstellung von 3-cephemverbindungen |
| US4492694A (en) * | 1983-04-12 | 1985-01-08 | Eli Lilly And Company | Indolylglycyl cephalosporin derivatives |
| US4490370A (en) * | 1983-04-12 | 1984-12-25 | Eli Lilly And Company | Naphthylglycyl cephalosporin derivatives |
| US4474780A (en) * | 1983-07-22 | 1984-10-02 | Eli Lilly And Company | Crystalline cephalosporin |
| HU208110B (en) * | 1989-07-27 | 1993-08-30 | Chinoin Gyogyszer Es Vegyeszet | Process for producing phenylglycine derivatives |
| HU207285B (en) * | 1989-07-27 | 1993-03-29 | Chinoin Gyogyszer Es Vegyeszet | Process for producing n-substituted phenyl-glycine derivatives |
| US5908929A (en) * | 1996-12-05 | 1999-06-01 | Vitara Chemicals Limited | Process for the manufacture of the antibiotic 7-(D-α-amino-α-phenylacetamido)-3-methyl-3-cephem-4-carboxylic acid (cephalexin) and pharmaceutically acceptable salts thereof |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3252973A (en) * | 1962-10-08 | 1966-05-24 | Lilly Co Eli | Acylation via carbodimides for penicillin and cephalosporin preparation |
| SE320074B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1964-01-16 | 1970-02-02 | Astra Ab |
-
1965
- 1965-03-08 US US438046A patent/US3518260A/en not_active Expired - Lifetime
-
1966
- 1966-01-14 SE SE00537/66A patent/SE354663B/xx unknown
- 1966-01-17 DK DK24266AA patent/DK140943B/da not_active IP Right Cessation
- 1966-01-17 GB GB2078/66A patent/GB1123333A/en not_active Expired
- 1966-01-17 BR BR176469/66A patent/BR6676469D0/pt unknown
- 1966-01-17 DE DE19661670600 patent/DE1670600A1/de active Pending
- 1966-01-18 NL NL6600636A patent/NL6600636A/xx unknown
- 1966-01-18 BE BE675298D patent/BE675298A/xx not_active IP Right Cessation
- 1966-01-18 CH CH61366A patent/CH480368A/de not_active IP Right Cessation
-
1970
- 1970-02-16 CY CY52770A patent/CY527A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6600636A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1966-09-09 |
| CH480368A (de) | 1969-10-31 |
| US3518260A (en) | 1970-06-30 |
| DK140943C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1980-05-19 |
| BE675298A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1966-07-18 |
| BR6676469D0 (pt) | 1973-09-06 |
| CY527A (en) | 1970-02-16 |
| DE1670600A1 (de) | 1970-08-06 |
| SE354663B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1973-03-19 |
| GB1123333A (en) | 1968-08-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK118769B (da) | Fremgangsmåde til fremstilling af O-methyl-S-methyl-phosphoroamidothioat. | |
| DK115474B (da) | Analogifremgangsmåde til fremstilling af N-p-chlorbenzoyl-5-fluorcytosin. | |
| DK118505B (da) | Fremgangsmåde til fremstilling af isoindolin-2-sulfonylurinstoffer. | |
| DK111892B (da) | Fremgangsmåde til fremstilling af pyrazinimidoyl-guanidinforbindelser. | |
| DK140943B (da) | Fremgangsmåde til fremstilling af cephaloglycin. | |
| DK118239B (da) | Fremgangsmåde til fremstilling af substituerede 4-hydroxykinoliner. | |
| DK135234B (da) | Analogifremgangsmåde til fremstilling af piperazin-phenylethanolforbindelser. | |
| DK120193B (da) | Fremgangsmåde til fremstilling af 3-amino-isoxazolderivater. | |
| DK117954B (da) | Fremgangsmåde til fremstilling af 3-amino-2-cyanoacrylamid. | |
| DK124886B (da) | Fremgangsnmåde til fremstilling af 1-hydroxy-benzimidazol-N-oxider. | |
| DK115348B (da) | Fremgangsmåde til fremstilling af adrenocorticotropt virksomme præparater med forlænget virkning. | |
| DK128075B (da) | Fremgangsmåde til fremstilling af d-α-tocopherol. | |
| DK115551B (da) | Fremgangsmåde til fremstilling af 6-aminouracil-5-carbonamid-N-sulfonamider. | |
| DK118670B (da) | Fremgangsmåde til fremstilling af cyanphenoler. | |
| DK118458B (da) | Fremgangsmåde til fremstilling af 5-halogen-2-amino-benzophenoniminer. | |
| DK118132B (da) | Fremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoler. | |
| DK114063B (da) | Fremgangsmåde til fremstilling af 1-methyl-2-isopropyl-5-nitro-imidazol. | |
| DK120344B (da) | Fremgangsmåde til fremstilling af 5-benzyl-pyrimidiner. | |
| DK122527B (da) | Fremgangsmåde til fremstilling af 3-nitro-2-oxo-tetrahydro-imidazoler. | |
| DK119980B (da) | Fremgangsmåde til fremstilling af 2-alkoxy-4-sulfanilamido-quinazolinderivater. | |
| DK114626B (da) | Fremgangsmåde til fremstilling af 2-substitueret-4-amino-5-acylamidometylpyrimidin. | |
| DK109140C (da) | Fremgangsmåde til fremstilling af 1-hydroksy-3-aminopyrrolidon-2-derivater. | |
| DK119058B (da) | Analogifremgangsmåde til fremstilling af 7-ethylaminopropyl-theophyllinderivater. | |
| DK114133B (da) | Fremgangsmåde til fremstilling af 6-ketosteroider. | |
| DK116733B (da) | Fremgangsmåde til fremstilling af steroid-17-butenolider. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |