DK139939B - Analogifremgangsmåde til fremstilling af benzoylbenzoesyrederivater. - Google Patents
Analogifremgangsmåde til fremstilling af benzoylbenzoesyrederivater.Info
- Publication number
- DK139939B DK139939B DK323874AA DK323874A DK139939B DK 139939 B DK139939 B DK 139939B DK 323874A A DK323874A A DK 323874AA DK 323874 A DK323874 A DK 323874A DK 139939 B DK139939 B DK 139939B
- Authority
- DK
- Denmark
- Prior art keywords
- preparation
- acid derivatives
- benzoylbenzoic acid
- analogous process
- analogous
- Prior art date
Links
- FGTYTUFKXYPTML-UHFFFAOYSA-N 2-benzoylbenzoic acid Chemical class OC(=O)C1=CC=CC=C1C(=O)C1=CC=CC=C1 FGTYTUFKXYPTML-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C231/00—Preparation of carboxylic acid amides
- C07C231/08—Preparation of carboxylic acid amides from amides by reaction at nitrogen atoms of carboxamide groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2987573A GB1443714A (en) | 1973-06-22 | 1973-06-22 | Benzoyl-benzoic acid derivatives |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK323874A DK323874A (de) | 1975-03-17 |
| DK139939B true DK139939B (da) | 1979-05-21 |
| DK139939C DK139939C (de) | 1979-10-22 |
Family
ID=10298620
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK323874AA DK139939B (da) | 1973-06-22 | 1974-06-18 | Analogifremgangsmåde til fremstilling af benzoylbenzoesyrederivater. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3989745A (de) |
| JP (1) | JPS5069054A (de) |
| BE (1) | BE816712A (de) |
| CA (1) | CA1027949A (de) |
| CH (1) | CH596153A5 (de) |
| DE (1) | DE2429960A1 (de) |
| DK (1) | DK139939B (de) |
| ES (1) | ES427582A1 (de) |
| FR (1) | FR2233996B1 (de) |
| GB (1) | GB1443714A (de) |
| IE (1) | IE39440B1 (de) |
| LU (1) | LU70379A1 (de) |
| NL (1) | NL7407781A (de) |
| SE (1) | SE411040B (de) |
| ZA (1) | ZA743609B (de) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8604114B2 (en) * | 2009-12-24 | 2013-12-10 | Exxonmobil Research And Engineering Company | Aromatic acylation with cyclic anhydride for plasticizer production |
-
1973
- 1973-06-22 GB GB2987573A patent/GB1443714A/en not_active Expired
-
1974
- 1974-05-29 IE IE1135/74A patent/IE39440B1/xx unknown
- 1974-06-06 ZA ZA00743609A patent/ZA743609B/xx unknown
- 1974-06-07 US US05/477,180 patent/US3989745A/en not_active Expired - Lifetime
- 1974-06-11 NL NL7407781A patent/NL7407781A/xx unknown
- 1974-06-18 DK DK323874AA patent/DK139939B/da unknown
- 1974-06-19 SE SE7408112A patent/SE411040B/xx unknown
- 1974-06-19 CA CA202,859A patent/CA1027949A/en not_active Expired
- 1974-06-21 FR FR7421726A patent/FR2233996B1/fr not_active Expired
- 1974-06-21 LU LU70379A patent/LU70379A1/xx unknown
- 1974-06-21 BE BE145754A patent/BE816712A/xx unknown
- 1974-06-21 CH CH855174A patent/CH596153A5/xx not_active IP Right Cessation
- 1974-06-21 JP JP49070315A patent/JPS5069054A/ja active Pending
- 1974-06-21 DE DE2429960A patent/DE2429960A1/de not_active Withdrawn
- 1974-06-22 ES ES427582A patent/ES427582A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IE39440L (en) | 1974-12-22 |
| FR2233996A1 (de) | 1975-01-17 |
| ZA743609B (en) | 1975-06-25 |
| SE411040B (sv) | 1979-11-26 |
| DK323874A (de) | 1975-03-17 |
| DK139939C (de) | 1979-10-22 |
| FR2233996B1 (de) | 1977-09-09 |
| CA1027949A (en) | 1978-03-14 |
| US3989745A (en) | 1976-11-02 |
| ES427582A1 (es) | 1976-07-16 |
| DE2429960A1 (de) | 1975-01-16 |
| NL7407781A (de) | 1974-12-24 |
| SE7408112L (de) | 1974-12-23 |
| AU7036574A (en) | 1976-01-08 |
| GB1443714A (en) | 1976-07-21 |
| JPS5069054A (de) | 1975-06-09 |
| CH596153A5 (de) | 1978-02-28 |
| LU70379A1 (de) | 1975-03-27 |
| BE816712A (fr) | 1974-12-23 |
| IE39440B1 (en) | 1978-10-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK138076B (da) | Analogifremgangsmåde til fremstilling af indolderivater eller syreadditionssalte deraf. | |
| DK134345B (da) | Analogifremgangsmåde til fremstilling af 4-hydroxymethyl-1-phthalazonderivater. | |
| DK135376B (da) | Fremgangsmåde til fremstilling af piperazinylquinazolin-forbindelser. | |
| DK137277B (da) | Analogifremgangsmåde til fremstilling af ferrocenforbindelser. | |
| DK139358B (da) | Analogifremgangsmåde til fremstilling af vincaminderivater eller syreadditionssalte deraf. | |
| DK140484B (da) | Fremgangsmåde til fremstilling af zeaxanthin. | |
| DK137679B (da) | Analogifremgangsmåde til fremstilling af thienotriazoldiazepinderivater eller syreadditionssalte deraf. | |
| DK134279B (da) | Analogifremgangsmåde til fremstilling af cycloalkylphenoxycarboxylsyrederivater. | |
| DK137389B (da) | Analogifremgangsmåde til fremstilling af 11beta-substituerede delta4-østrener. | |
| DK132434B (da) | Analogifremgangsmåde til fremstilling af derivater af 6-aminopenicillansyre. | |
| DK133977B (da) | Fremgangsmåde til fremstilling af 2-chlor-5-sulfamoylbenzoesyrer. | |
| DK134485B (da) | Analogifremgangsmåde til fremstilling af thiocarbaminsyrederivater. | |
| DK137577B (da) | Fremgangsmåde til fremstilling af zeaxanthin. | |
| DK139716B (da) | Analogifremgangsmåde til fremstilling af 4-aminoamfetaminderivater. | |
| DK133667B (da) | Fremgangsmåde til fremstilling af 5-cyklohexyl-6-halogenindan-1-karboxylsyrederivater. | |
| DK137043B (da) | Analogifremgangsmåde til fremstilling af nitrocarbostyrilforbindelser. | |
| DK126203B (da) | Analogifremgangsmåde til fremstilling af thiophenddikesyrederivater. | |
| DK140411B (da) | Fremgangsmåde til fremstilling af deacetoxycephalosporin C. | |
| DK140431B (da) | Analogifremgangsmåde til fremstilling af et N2-dansyl-L-arginin-derivat eller syreadditionssalte deraf. | |
| DK134154B (da) | Analogifremgangsmåde til fremstilling af 5-cyklohexyl-1-indankarboxylsyrederivater. | |
| DK138490B (da) | Fremgangsmåde til fremstilling af prostadiensyrederivater. | |
| DK137182B (da) | Analogifremgangsmåde til fremstilling af anthranilsyrederivater. | |
| DK136619B (da) | Fremgangsmåde til fremstilling af dihydrokanadensolid. | |
| DK135120B (da) | Analogifremgangsmåde til fremstilling af imidazolidinderivater. | |
| DK136953B (da) | Analogifremgangsmåde til fremstilling af pyrazol-4-eddikesyrederivater. |