DK137608B - Analogifremgangsmåde til fremstilling af cephalosporansyrederivater. - Google Patents
Analogifremgangsmåde til fremstilling af cephalosporansyrederivater.Info
- Publication number
- DK137608B DK137608B DK144771AA DK144771A DK137608B DK 137608 B DK137608 B DK 137608B DK 144771A A DK144771A A DK 144771AA DK 144771 A DK144771 A DK 144771A DK 137608 B DK137608 B DK 137608B
- Authority
- DK
- Denmark
- Prior art keywords
- preparation
- acid derivatives
- cephalosporanic acid
- analogous process
- analogous
- Prior art date
Links
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical class S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/26—Methylene radicals, substituted by oxygen atoms; Lactones thereof with the 2-carboxyl group
- C07D501/34—Methylene radicals, substituted by oxygen atoms; Lactones thereof with the 2-carboxyl group with the 7-amino radical acylated by carboxylic acids containing hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2344070A | 1970-03-27 | 1970-03-27 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK137608B true DK137608B (da) | 1978-04-03 |
| DK137608C DK137608C (enExample) | 1978-09-18 |
Family
ID=21815121
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK144771AA DK137608B (da) | 1970-03-27 | 1971-03-25 | Analogifremgangsmåde til fremstilling af cephalosporansyrederivater. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3631027A (enExample) |
| BE (1) | BE764920A (enExample) |
| CA (1) | CA921912A (enExample) |
| CH (1) | CH551449A (enExample) |
| DE (1) | DE2114840A1 (enExample) |
| DK (1) | DK137608B (enExample) |
| ES (1) | ES389463A1 (enExample) |
| FI (1) | FI52465C (enExample) |
| FR (1) | FR2085749B1 (enExample) |
| GB (1) | GB1346505A (enExample) |
| IE (1) | IE35016B1 (enExample) |
| NL (1) | NL7103956A (enExample) |
| NO (1) | NO139891C (enExample) |
| SE (1) | SE369721B (enExample) |
| ZA (1) | ZA711916B (enExample) |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL29235A (en) * | 1967-01-05 | 1971-10-20 | Bristol Myers Co | 7-(pyridylthioacetamido)cephalosporanic acid derivatives and their preparation |
| US3503967A (en) * | 1968-08-26 | 1970-03-31 | Bristol Myers Co | Process for the preparation of 7 - (alpha-(4 - pyridylthio)acetamido)cephalosporanic acid |
-
1970
- 1970-03-27 US US23440A patent/US3631027A/en not_active Expired - Lifetime
-
1971
- 1971-03-15 IE IE325/71A patent/IE35016B1/xx unknown
- 1971-03-18 CH CH396371A patent/CH551449A/xx not_active IP Right Cessation
- 1971-03-19 SE SE03633/71A patent/SE369721B/xx unknown
- 1971-03-23 ES ES389463A patent/ES389463A1/es not_active Expired
- 1971-03-23 CA CA108462A patent/CA921912A/en not_active Expired
- 1971-03-24 FI FI710839A patent/FI52465C/fi active
- 1971-03-24 NL NL7103956A patent/NL7103956A/xx not_active Application Discontinuation
- 1971-03-24 ZA ZA711916A patent/ZA711916B/xx unknown
- 1971-03-25 DK DK144771AA patent/DK137608B/da unknown
- 1971-03-26 BE BE764920A patent/BE764920A/xx unknown
- 1971-03-26 NO NO1153/71A patent/NO139891C/no unknown
- 1971-03-26 DE DE19712114840 patent/DE2114840A1/de active Pending
- 1971-03-29 FR FR7110984A patent/FR2085749B1/fr not_active Expired
- 1971-04-19 GB GB2448571*A patent/GB1346505A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FI52465B (enExample) | 1977-05-31 |
| SE369721B (enExample) | 1974-09-16 |
| BE764920A (fr) | 1971-09-27 |
| FI52465C (fi) | 1977-09-12 |
| ZA711916B (en) | 1971-12-29 |
| CA921912A (en) | 1973-02-27 |
| IE35016L (en) | 1971-09-27 |
| NO139891B (no) | 1979-02-19 |
| NL7103956A (enExample) | 1971-09-29 |
| ES389463A1 (es) | 1973-06-01 |
| IE35016B1 (en) | 1975-10-15 |
| NO139891C (no) | 1979-05-30 |
| GB1346505A (en) | 1974-02-13 |
| US3631027A (en) | 1971-12-28 |
| CH551449A (de) | 1974-07-15 |
| FR2085749A1 (enExample) | 1971-12-31 |
| FR2085749B1 (enExample) | 1975-01-17 |
| DE2114840A1 (de) | 1971-10-07 |
| DK137608C (enExample) | 1978-09-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK122965B (da) | Analogifremgangsmåde til fremstilling af derivater af thiazolylbenzoesyre. | |
| DK127927B (da) | Analogifremgangsmåde til fremstilling af kinolinderivater. | |
| DK129339B (da) | Analogifremgangsmåde til fremstilling af N-aminophenylamidiner. | |
| DK125251B (da) | Analogifremgangsmåde til fremstilling af thiazolylmalonsyrederivater. | |
| DK132434B (da) | Analogifremgangsmåde til fremstilling af derivater af 6-aminopenicillansyre. | |
| DK123471B (da) | Analogifremgangsmåde til fremstilling af benzyliden-amino-oxyalkylcarboxylsyrederivater. | |
| DK129707B (da) | Analogifremgangsmåde til fremstilling af imidazolderivater. | |
| DK134485B (da) | Analogifremgangsmåde til fremstilling af thiocarbaminsyrederivater. | |
| DK137189B (da) | Fremgangsmåde til fremstilling af quinolinderivater. | |
| DK126203B (da) | Analogifremgangsmåde til fremstilling af thiophenddikesyrederivater. | |
| DK133667B (da) | Fremgangsmåde til fremstilling af 5-cyklohexyl-6-halogenindan-1-karboxylsyrederivater. | |
| DK134154B (da) | Analogifremgangsmåde til fremstilling af 5-cyklohexyl-1-indankarboxylsyrederivater. | |
| DK138490B (da) | Fremgangsmåde til fremstilling af prostadiensyrederivater. | |
| DK126998B (da) | Analogifremgangsmåde til fremstilling af amino-s-triazolylbenzensulfonamidforbindelser. | |
| DK129993B (da) | Analogifremgangsmåde til fremstilling af indoleddikesyrederivater. | |
| DK137192B (da) | Analogifremgangsmåde til fremstilling af cephalosporansyrederivater. | |
| DK137181B (da) | Analogifremgangsmåde til fremstilling af 3-amino-kinolinderivater. | |
| DK129453B (da) | Analogifremgangsmåde til fremstilling af 1-aminoisoquinoliner. | |
| DK130742B (da) | Analogifremgangsmåde til fremstilling af 7-[(aminomethylphenylthio)-acetamido]cephalosporansyrederivater. | |
| DK137860B (da) | Analogifremgangsmåde til fremstilling af triazolobenzodiazepin-5N-oxydderivater. | |
| DK125388B (da) | Fremgangsmåde til fremstilling af phenylaminoethanolderivater. | |
| DK140942B (da) | Fremgangsmåde til fremstilling af 7-aminocephalosporansyre. | |
| DK129457B (da) | Fremgangsmåde til fremstilling af 6-aminopenicillansyre. | |
| DK123527B (da) | Fremgangsmåde til fremstilling af lumilysergsyrederivater. | |
| DK136187B (da) | Analogifremgangsmåde til fremstilling af imidazolderivater. |