DK137125B - Fremgangsmåde til fremstilling af 2-substituerede 6,7-benzomorphan-derivater eller syreadditionssalte deraf. - Google Patents
Fremgangsmåde til fremstilling af 2-substituerede 6,7-benzomorphan-derivater eller syreadditionssalte deraf.Info
- Publication number
- DK137125B DK137125B DK280571AA DK280571A DK137125B DK 137125 B DK137125 B DK 137125B DK 280571A A DK280571A A DK 280571AA DK 280571 A DK280571 A DK 280571A DK 137125 B DK137125 B DK 137125B
- Authority
- DK
- Denmark
- Prior art keywords
- substituted
- preparation
- acid addition
- addition salts
- benzomorphan derivatives
- Prior art date
Links
- NSLKFRGZLUIUKO-QWRGUYRKSA-N 6,7-benzomorphan Chemical class C1C2=CC=CC=C2[C@H]2CCN[C@@H]1C2 NSLKFRGZLUIUKO-QWRGUYRKSA-N 0.000 title 1
- 239000002253 acid Chemical class 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/22—Bridged ring systems
- C07D221/26—Benzomorphans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5066670 | 1970-06-10 | ||
| JP5066570 | 1970-06-10 | ||
| JP5764970 | 1970-06-30 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK137125B true DK137125B (da) | 1978-01-23 |
| DK137125C DK137125C (enExample) | 1978-06-26 |
Family
ID=27294040
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK280571AA DK137125B (da) | 1970-06-10 | 1971-06-09 | Fremgangsmåde til fremstilling af 2-substituerede 6,7-benzomorphan-derivater eller syreadditionssalte deraf. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3953441A (enExample) |
| BE (1) | BE768309A (enExample) |
| CA (1) | CA941372A (enExample) |
| CH (1) | CH571499A5 (enExample) |
| DE (1) | DE2128525C3 (enExample) |
| DK (1) | DK137125B (enExample) |
| ES (1) | ES392077A1 (enExample) |
| FI (1) | FI53312C (enExample) |
| FR (1) | FR2100743B1 (enExample) |
| GB (1) | GB1329504A (enExample) |
| NL (1) | NL7107926A (enExample) |
| NO (1) | NO137441C (enExample) |
| PH (1) | PH9845A (enExample) |
| SE (1) | SE401503B (enExample) |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3093650A (en) * | 1963-06-11 | Alternative synthesis of | ||
| US2959594A (en) * | 1960-11-08 | Iso-benzmorphan derivatives | ||
| US3639407A (en) * | 1965-05-05 | 1972-02-01 | Geigy Chem Corp | Novel 1 2 3 4 5 6-hexahydro-6-phenyl-2 6-methano-3-benzazocines |
| US3553223A (en) * | 1968-01-05 | 1971-01-05 | Hoffmann La Roche | Acid catalyzed cyclization of tetrahydropyridines containing an electron withdrawing group on the nitrogen |
| US3558638A (en) * | 1968-10-03 | 1971-01-26 | Geigy Chem Corp | 3-cyano-1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocines |
| BE742763A (enExample) * | 1968-12-06 | 1970-05-14 | ||
| GB1276719A (en) * | 1968-12-26 | 1972-06-07 | Sumitomo Chemical Co | Benzomorphan derivatives and their salts |
| US3631051A (en) * | 1969-05-28 | 1971-12-28 | Sumitomo Chemical Co | Process for producing 2-substituted 6 7-benzomorphan derivatives |
| FR2014144A1 (en) * | 1969-05-30 | 1970-04-17 | Sumitomo Chemical Co | Subst 6,7-benzomorphane derivatives |
-
1971
- 1971-06-03 NO NO2095/71A patent/NO137441C/no unknown
- 1971-06-07 US US05/150,841 patent/US3953441A/en not_active Expired - Lifetime
- 1971-06-08 FI FI1602/71A patent/FI53312C/fi active
- 1971-06-08 CH CH835571A patent/CH571499A5/xx not_active IP Right Cessation
- 1971-06-08 DE DE2128525A patent/DE2128525C3/de not_active Expired
- 1971-06-08 GB GB1942571*[A patent/GB1329504A/en not_active Expired
- 1971-06-09 NL NL7107926A patent/NL7107926A/xx unknown
- 1971-06-09 ES ES392077A patent/ES392077A1/es not_active Expired
- 1971-06-09 CA CA115,231A patent/CA941372A/en not_active Expired
- 1971-06-09 PH PH12527A patent/PH9845A/en unknown
- 1971-06-09 SE SE7107485A patent/SE401503B/xx unknown
- 1971-06-09 BE BE768309A patent/BE768309A/xx unknown
- 1971-06-09 DK DK280571AA patent/DK137125B/da unknown
- 1971-06-09 FR FR7120906A patent/FR2100743B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1329504A (en) | 1973-09-12 |
| BE768309A (fr) | 1971-11-03 |
| NO137441B (no) | 1977-11-21 |
| DE2128525B2 (de) | 1974-11-28 |
| FI53312B (enExample) | 1977-12-30 |
| FR2100743B1 (enExample) | 1975-03-14 |
| DK137125C (enExample) | 1978-06-26 |
| SE401503B (sv) | 1978-05-16 |
| FI53312C (fi) | 1978-04-10 |
| NL7107926A (enExample) | 1971-12-14 |
| DE2128525A1 (de) | 1972-01-05 |
| CH571499A5 (enExample) | 1976-01-15 |
| NO137441C (no) | 1978-03-01 |
| ES392077A1 (es) | 1973-11-01 |
| CA941372A (en) | 1974-02-05 |
| DE2128525C3 (de) | 1975-07-10 |
| FR2100743A1 (enExample) | 1972-03-24 |
| US3953441A (en) | 1976-04-27 |
| PH9845A (en) | 1976-04-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK129446B (da) | Analogifremgangsmåde til fremstilling af fenoxyhydroxypropylaminer eller syreadditionssalte heraf. | |
| DK124547B (da) | Analogifremgangsmåde til fremstilling af (3-amino-2-hydroxy-propyloxy)-thiochromanderivater eller syreadditionssalte deraf. | |
| DK131858B (da) | Analogifremgangsmåde til fremstilling af 4-amino-6-arylpyrimidin-forbindelser eller syreadditionssalte deraf. | |
| DK125021B (da) | Analogifremgangsmåde til fremstilling af 1,2,3,4-tetrahydro-4-phenyl-isoquinolinderivater eller syreadditionssalte deraf eller de tilsvarende optisk aktive forbindelser. | |
| DK128078B (da) | Analogifremgangsmåde til fremstilling af 1,2,3,4-tetrahydroisoquinolinderivater eller salte deraf. | |
| DK126043B (da) | Analogifremgangsmåde til fremstilling af 2-substituerede adenosinderivater eller syreadditionssalte deraf. | |
| DK135130B (da) | Analogifremgangsmåde til fremstilling af 2-substituerede adenosinderivater eller syreadditionssalte deraf. | |
| DK130681B (da) | Analogifremgangsmåde til fremstilling af 5-ætyl-2,3,5,8-tetrahydro-8-okso-furo-[2,3-g]-kinolin-7-karboksylsyre eller salte deraf. | |
| DK131721B (da) | Analogifremgangsmåde til fremstilling af adamantanylaminer eller 3,5,7-trimethylhomologe eller syreadditionssalte deraf. | |
| DK137382B (da) | Analogifremgangsmåde til fremstilling af 2,2-diaryl-4-(4'-aryl-4'-hydroxy-piperidin)butyramider eller syreadditionssalte deraf. | |
| DK125245B (da) | Fremgangsmåde til fremstilling af γpiperidinobutyrophenonderivater eller syreadditionssalte deraf. | |
| DK121367B (da) | Analogifremgangsmåde til fremstilling af 3,3-difenylallylaminderivater eller syreadditionssalte deraf. | |
| DK129994B (da) | Analogifremgangsmåde til fremstilling af 1-trimethoxybenzyl-6,7-dialkanoyl-1,2,3,4-tetrahydroisoquinoliner eller syreadditionssalte deraf. | |
| DK137044B (da) | Analogifremgangsmåde til fremstilling af 4,4-diphenylhexahydroazepinderivater eller syreadditionssalte deraf. | |
| DK127424B (da) | Analogifremgangsmåde til fremstilling af 4-aryl-1-(4,4-diarylbutyl)-4-hydroxypiperidiner eller syreadditionssalte deraf. | |
| DK129164B (da) | Analogifremgangsmåde til fremstilling af 3-alkyl-5-aryloxymethylisoxazoler eller syreadditionssalte deraf. | |
| DK127431B (da) | Analogifremgangsmåde til fremstilling af thiepinderivater eller syreadditionssalte deraf. | |
| DK115627B (da) | Fremgangsmåde til fremstilling af derivater af 2-anilino-1,3-diazacyclopenten-(2) eller syreadditionssalte heraf. | |
| DK137834B (da) | Analogifremgangsmåde til fremstilling af triazolobenzodiazepinderivater eller syreadditionssalte deraf. | |
| DK137925B (da) | Analogifremgangsmåde til fremstilling 1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocin-forbindelser eller syreadditionssalte deraf. | |
| DK137125B (da) | Fremgangsmåde til fremstilling af 2-substituerede 6,7-benzomorphan-derivater eller syreadditionssalte deraf. | |
| DK131570B (da) | Analogifremgangsmåde til fremstilling af thienylalkanderivater eller syreadditionssalte deraf. | |
| DK136064B (da) | Fremgangsmåde til fremstilling af 3,4-dihydroisoquinolinderivater eller syreadditionssalte eller kvaternære salte deraf. | |
| DK125593B (da) | Analogifremgangsmåde til fremstilling af 7-acyl-1,2,4,5-tetrahydro-(3H)-3-benzazepiner eller syreadditionssalte deraf. | |
| DK134173B (da) | Analogifremgangsmåde til fremstilling af benzomorphanderivater eller syreadditionssalte deraf. |