DK137044B - Analogifremgangsmåde til fremstilling af 4,4-diphenylhexahydroazepinderivater eller syreadditionssalte deraf. - Google Patents
Analogifremgangsmåde til fremstilling af 4,4-diphenylhexahydroazepinderivater eller syreadditionssalte deraf.Info
- Publication number
- DK137044B DK137044B DK107571AA DK107571A DK137044B DK 137044 B DK137044 B DK 137044B DK 107571A A DK107571A A DK 107571AA DK 107571 A DK107571 A DK 107571A DK 137044 B DK137044 B DK 137044B
- Authority
- DK
- Denmark
- Prior art keywords
- diphenylhexahydroazepine
- derivatives
- preparation
- acid addition
- addition salts
- Prior art date
Links
- UVCIDNYZEUWNOK-UHFFFAOYSA-N 4,4-diphenylazepane Chemical class C1CCNCCC1(C=1C=CC=CC=1)C1=CC=CC=C1 UVCIDNYZEUWNOK-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/587—Unsaturated compounds containing a keto groups being part of a ring
- C07C49/657—Unsaturated compounds containing a keto groups being part of a ring containing six-membered aromatic rings
- C07C49/683—Unsaturated compounds containing a keto groups being part of a ring containing six-membered aromatic rings having unsaturation outside the aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/51—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition
- C07C45/52—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition by dehydration and rearrangement involving two hydroxy groups in the same molecule
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/62—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by hydrogenation of carbon-to-carbon double or triple bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/72—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction of compounds containing >C = O groups with the same or other compounds containing >C = O groups
- C07C45/74—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction of compounds containing >C = O groups with the same or other compounds containing >C = O groups combined with dehydration
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/20—Unsaturated compounds having —CHO groups bound to acyclic carbon atoms
- C07C47/228—Unsaturated compounds having —CHO groups bound to acyclic carbon atoms containing six-membered aromatic rings, e.g. phenylacetaldehyde
- C07C47/23—Unsaturated compounds having —CHO groups bound to acyclic carbon atoms containing six-membered aromatic rings, e.g. phenylacetaldehyde polycyclic
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US1791970A | 1970-03-09 | 1970-03-09 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK137044B true DK137044B (da) | 1978-01-09 |
| DK137044C DK137044C (env) | 1978-06-12 |
Family
ID=21785277
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK107571AA DK137044B (da) | 1970-03-09 | 1971-03-09 | Analogifremgangsmåde til fremstilling af 4,4-diphenylhexahydroazepinderivater eller syreadditionssalte deraf. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3666752A (env) |
| JP (1) | JPS5242799B1 (env) |
| BE (1) | BE764011A (env) |
| CH (2) | CH566316A5 (env) |
| DK (1) | DK137044B (env) |
| FR (1) | FR2085687B1 (env) |
| GB (1) | GB1343833A (env) |
| NL (1) | NL7102983A (env) |
| ZA (1) | ZA711447B (env) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3860653A (en) * | 1966-07-01 | 1975-01-14 | Hoffmann La Roche | Substituted 2-(phenyl)-cyclohexanones |
| JPS60182888U (ja) * | 1984-05-15 | 1985-12-04 | 太田 善久 | 霊位牌 |
| JPS62120873U (env) * | 1986-01-24 | 1987-07-31 | ||
| JPH0464285U (env) * | 1990-10-16 | 1992-06-02 | ||
| US8632922B2 (en) * | 2009-06-16 | 2014-01-21 | Shell Oil Company | Systems and processes for operating fuel cell systems |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2683145A (en) * | 1954-07-06 | Azacycloheptanones | ||
| US3468893A (en) * | 1966-03-14 | 1969-09-23 | Ciba Geigy Corp | 1-substituted-diphenyl-azacycloalkenes |
| IE33382B1 (en) * | 1968-08-16 | 1974-06-12 | Wyeth John & Brother Ltd | Hexahydroazepines |
-
1970
- 1970-03-09 US US17919A patent/US3666752A/en not_active Expired - Lifetime
-
1971
- 1971-03-05 NL NL7102983A patent/NL7102983A/xx not_active Application Discontinuation
- 1971-03-05 ZA ZA711447A patent/ZA711447B/xx unknown
- 1971-03-08 CH CH1608974A patent/CH566316A5/xx not_active IP Right Cessation
- 1971-03-08 CH CH336871A patent/CH560687A5/xx not_active IP Right Cessation
- 1971-03-08 FR FR7107982A patent/FR2085687B1/fr not_active Expired
- 1971-03-09 DK DK107571AA patent/DK137044B/da unknown
- 1971-03-09 BE BE764011A patent/BE764011A/xx unknown
- 1971-03-09 JP JP46012231A patent/JPS5242799B1/ja active Pending
- 1971-04-19 GB GB2355871*A patent/GB1343833A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1343833A (en) | 1974-01-16 |
| JPS5242799B1 (env) | 1977-10-26 |
| NL7102983A (env) | 1971-09-13 |
| CH566316A5 (env) | 1975-09-15 |
| FR2085687A1 (env) | 1971-12-31 |
| FR2085687B1 (env) | 1974-09-27 |
| BE764011A (fr) | 1971-09-09 |
| US3666752A (en) | 1972-05-30 |
| ZA711447B (en) | 1972-03-29 |
| DK137044C (env) | 1978-06-12 |
| CH560687A5 (env) | 1975-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK129446B (da) | Analogifremgangsmåde til fremstilling af fenoxyhydroxypropylaminer eller syreadditionssalte heraf. | |
| DK124547B (da) | Analogifremgangsmåde til fremstilling af (3-amino-2-hydroxy-propyloxy)-thiochromanderivater eller syreadditionssalte deraf. | |
| DK131858B (da) | Analogifremgangsmåde til fremstilling af 4-amino-6-arylpyrimidin-forbindelser eller syreadditionssalte deraf. | |
| DK125021B (da) | Analogifremgangsmåde til fremstilling af 1,2,3,4-tetrahydro-4-phenyl-isoquinolinderivater eller syreadditionssalte deraf eller de tilsvarende optisk aktive forbindelser. | |
| DK131721B (da) | Analogifremgangsmåde til fremstilling af adamantanylaminer eller 3,5,7-trimethylhomologe eller syreadditionssalte deraf. | |
| DK137382B (da) | Analogifremgangsmåde til fremstilling af 2,2-diaryl-4-(4'-aryl-4'-hydroxy-piperidin)butyramider eller syreadditionssalte deraf. | |
| DK131778B (da) | Fremgangsmåde til fremstilling af substituerede 3-hydroksymetylisokinolinderivater eller syreadditionssalte heraf. | |
| DK131857B (da) | Analogifremgangsmåde til fremstilling af 4-hydroxymethyl-1-phthalazonderivater eller syreadditionssalte deraf. | |
| DK125472B (da) | Analogifremgangsmåde til fremstilling af pyrimidopyridazinderivater eller syreadditionssalte deraf. | |
| DK127424B (da) | Analogifremgangsmåde til fremstilling af 4-aryl-1-(4,4-diarylbutyl)-4-hydroxypiperidiner eller syreadditionssalte deraf. | |
| DK137044B (da) | Analogifremgangsmåde til fremstilling af 4,4-diphenylhexahydroazepinderivater eller syreadditionssalte deraf. | |
| DK129164B (da) | Analogifremgangsmåde til fremstilling af 3-alkyl-5-aryloxymethylisoxazoler eller syreadditionssalte deraf. | |
| DK127431B (da) | Analogifremgangsmåde til fremstilling af thiepinderivater eller syreadditionssalte deraf. | |
| DK130288B (da) | Analogifremgangsmåde til fremstilling af alkanolaminderivater eller syreadditionssalte deraf. | |
| DK133677B (da) | Analogifremgangsmåde til fremstilling af 2-alkyl-4-(1-alkyl-4-piperidyliden)-benzocycloheptathiophenderivater eller syreadditionssalte deraf. | |
| DK137834B (da) | Analogifremgangsmåde til fremstilling af triazolobenzodiazepinderivater eller syreadditionssalte deraf. | |
| DK137925B (da) | Analogifremgangsmåde til fremstilling 1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocin-forbindelser eller syreadditionssalte deraf. | |
| DK121955B (da) | Analogifremgangsmåde til fremstilling af 1,4-substituerede phenylpiperaziner eller syreadditionssalte deraf. | |
| DK131570B (da) | Analogifremgangsmåde til fremstilling af thienylalkanderivater eller syreadditionssalte deraf. | |
| DK125593B (da) | Analogifremgangsmåde til fremstilling af 7-acyl-1,2,4,5-tetrahydro-(3H)-3-benzazepiner eller syreadditionssalte deraf. | |
| DK129839B (da) | Analogifremgangsmåde til fremstilling af N-vinylquinoloner eller syreadditionssalte deraf. | |
| DK136152B (da) | Analogifremgangsmåde til fremstilling af 1-aminomethylderivater af 2,2-diarylclopropaner eller syreadditionssalte deraf. | |
| DK135576B (da) | Analogifremgangsmåde til fremstilling af 1,4-methano- eller 1,4-ethano-tetrahydronaphthyloxyaminopropanoler eller syreadditionssalte deraf. | |
| DK137796B (da) | Fremgangsmåde til fremstilling af 1-aryloxy-3-aminopropanolderivater eller syreadditionssalte deraf. | |
| DK134404B (da) | Analogifremgangsmåde til fremstilling af benzocycloheptathiophenderivater eller syreadditionssalte deraf. |