DK136975B - Analogifremgangsmåde til fremstilling af phenazinderivater. - Google Patents
Analogifremgangsmåde til fremstilling af phenazinderivater.Info
- Publication number
- DK136975B DK136975B DK159871AA DK159871A DK136975B DK 136975 B DK136975 B DK 136975B DK 159871A A DK159871A A DK 159871AA DK 159871 A DK159871 A DK 159871A DK 136975 B DK136975 B DK 136975B
- Authority
- DK
- Denmark
- Prior art keywords
- preparation
- analogous process
- phenazine derivatives
- phenazine
- derivatives
- Prior art date
Links
- 125000001791 phenazinyl group Chemical class C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/50—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to ring nitrogen atoms
- C07D241/52—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Saccharide Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK453172A DK134017B (da) | 1970-04-02 | 1972-09-14 | Phenazinderivater med plantefungicid virkning. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2529770A | 1970-04-02 | 1970-04-02 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK136975B true DK136975B (da) | 1977-12-27 |
| DK136975C DK136975C (enExample) | 1978-06-05 |
Family
ID=21825197
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK159871AA DK136975B (da) | 1970-04-02 | 1971-04-02 | Analogifremgangsmåde til fremstilling af phenazinderivater. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3678051A (enExample) |
| AT (2) | AT304562B (enExample) |
| BE (1) | BE765157A (enExample) |
| CA (1) | CA986935A (enExample) |
| CH (3) | CH558369A (enExample) |
| DD (1) | DD101270A5 (enExample) |
| DE (1) | DE2115660A1 (enExample) |
| DK (1) | DK136975B (enExample) |
| ES (1) | ES389788A1 (enExample) |
| FR (1) | FR2085793B1 (enExample) |
| GB (1) | GB1285314A (enExample) |
| HU (1) | HU162256B (enExample) |
| NL (1) | NL7104444A (enExample) |
| SE (2) | SE396603B (enExample) |
| ZA (1) | ZA711921B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4377579A (en) * | 1981-12-03 | 1983-03-22 | Minnesota Mining And Manufacturing Company | N-(Tetrazol-5-yl)phenazine-1-carboxamides |
| US5637591A (en) * | 1995-06-02 | 1997-06-10 | Fuji Immunopharmaceuticals Corp. | Antimicrobial and anticollagenase activity of phenazine-5, 10-dioxide and derivatives |
| AU5471998A (en) * | 1996-12-24 | 1998-07-17 | Queen's University At Kingston | Antimicrobial phenazine compounds |
| US20090042894A1 (en) * | 2007-07-13 | 2009-02-12 | Food Industry Research And Development Institute | Novel species of acrocarpospora, a method of preparing iodinin, and the uses of iodinin |
| GB201319363D0 (en) | 2013-11-01 | 2013-12-18 | Uni I Oslo | Compounds |
| GB201621520D0 (en) | 2016-12-16 | 2017-02-01 | Univ Oslo | Compounds |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3567728A (en) * | 1968-07-05 | 1971-03-02 | Pfizer | Process for the preparation of phenazine di-n-oxides and related compounds |
-
1970
- 1970-04-02 US US25297A patent/US3678051A/en not_active Expired - Lifetime
-
1971
- 1971-03-24 ZA ZA711921A patent/ZA711921B/xx unknown
- 1971-03-25 CH CH125774A patent/CH558369A/xx not_active IP Right Cessation
- 1971-03-25 CH CH441971A patent/CH560199A5/xx not_active IP Right Cessation
- 1971-03-25 CH CH125874A patent/CH560007A5/xx not_active IP Right Cessation
- 1971-03-31 DE DE19712115660 patent/DE2115660A1/de active Pending
- 1971-03-31 FR FR7111348A patent/FR2085793B1/fr not_active Expired
- 1971-04-01 AT AT276471A patent/AT304562B/de not_active IP Right Cessation
- 1971-04-01 CA CA109,336A patent/CA986935A/en not_active Expired
- 1971-04-01 AT AT227472A patent/AT318972B/de not_active IP Right Cessation
- 1971-04-01 DD DD154172A patent/DD101270A5/xx unknown
- 1971-04-01 ES ES389788A patent/ES389788A1/es not_active Expired
- 1971-04-01 BE BE765157A patent/BE765157A/xx unknown
- 1971-04-02 SE SE7310401A patent/SE396603B/xx unknown
- 1971-04-02 SE SE04335/71A patent/SE366986B/xx unknown
- 1971-04-02 NL NL7104444A patent/NL7104444A/xx not_active Application Discontinuation
- 1971-04-02 DK DK159871AA patent/DK136975B/da unknown
- 1971-04-02 HU HUHO1365A patent/HU162256B/hu unknown
- 1971-04-19 GB GB26104/71A patent/GB1285314A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2085793B1 (enExample) | 1974-08-23 |
| CH560007A5 (enExample) | 1975-03-27 |
| ES389788A1 (es) | 1973-06-01 |
| CH560199A5 (enExample) | 1975-03-27 |
| HU162256B (enExample) | 1973-01-29 |
| DK136975C (enExample) | 1978-06-05 |
| NL7104444A (enExample) | 1971-10-05 |
| CH558369A (de) | 1975-01-31 |
| GB1285314A (en) | 1972-08-16 |
| ZA711921B (en) | 1971-12-29 |
| SE396603B (sv) | 1977-09-26 |
| FR2085793A1 (enExample) | 1971-12-31 |
| AT304562B (de) | 1973-01-10 |
| CA986935A (en) | 1976-04-06 |
| DE2115660A1 (de) | 1971-10-21 |
| DD101270A5 (enExample) | 1973-11-05 |
| BE765157A (fr) | 1971-10-01 |
| US3678051A (en) | 1972-07-18 |
| SE366986B (enExample) | 1974-05-13 |
| AT318972B (de) | 1974-11-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK137451B (da) | Analogifremgangsmåde til fremstilling af derivater af 2-oxo-pyrrolidin. | |
| DK132174B (da) | Analogifremgangsmåde til fremstilling af 2,4-diamino-5-benzylpyrimider. | |
| DK129339B (da) | Analogifremgangsmåde til fremstilling af N-aminophenylamidiner. | |
| DK123357B (da) | Analogifremgangsmåde til fremstilling af N(6)-benzyl-adenosin-derivater. | |
| DK135455B (da) | Fremgangsmåde til fremstilling af 7-halogen-7-desoxythiolincosaminider. | |
| DK129707B (da) | Analogifremgangsmåde til fremstilling af imidazolderivater. | |
| DK124946B (da) | Analogifremgangsmåde til fremstilling af evomonosidderivater. | |
| DK134489B (da) | Fremgangsmåde til fremstilling af alkyl-7-desoxy-7(S)-substituerede-alfa-thiolincosaminider. | |
| DK136975B (da) | Analogifremgangsmåde til fremstilling af phenazinderivater. | |
| DK130467B (da) | Fremgangsmåde til fremstilling af erythromycylaminer. | |
| DK128895B (da) | Fremgangsmåde til fremstilling af pregnanderivater. | |
| DK128496B (da) | Fremgangsmåde til fremstilling af 5-fluoruracilderivater. | |
| DK134154B (da) | Analogifremgangsmåde til fremstilling af 5-cyklohexyl-1-indankarboxylsyrederivater. | |
| DK127977B (da) | Fremgangsmåde til fremstilling af 6α-methyl-19-nor-pregnener. | |
| DK126998B (da) | Analogifremgangsmåde til fremstilling af amino-s-triazolylbenzensulfonamidforbindelser. | |
| DK138490B (da) | Fremgangsmåde til fremstilling af prostadiensyrederivater. | |
| DK127812B (da) | Analogifremgangsmåde til fremstilling af 3,5-dibrom-zearalan. | |
| DK137181B (da) | Analogifremgangsmåde til fremstilling af 3-amino-kinolinderivater. | |
| DK128680B (da) | Analogifremgangsmåde til fremstilling af phenazinderivater. | |
| DK135425B (da) | Analogifremgangsmåde til fremstilling af 2-imidazolidonderivater. | |
| DK129453B (da) | Analogifremgangsmåde til fremstilling af 1-aminoisoquinoliner. | |
| DK129993B (da) | Analogifremgangsmåde til fremstilling af indoleddikesyrederivater. | |
| DK128205B (da) | Fremgangsmåde til fremstilling af 1-aryloxy-2-propanoler. | |
| DK126323B (da) | Fremgangsmåde til fremstilling af 3β-hydroxy-5α-cardenolider eller -bufadienolider. | |
| DK123096B (da) | Analogifremgangsmåde til fremstilling af neriifolinderivater. |