DK133977B - Fremgangsmåde til fremstilling af 2-chlor-5-sulfamoylbenzoesyrer. - Google Patents
Fremgangsmåde til fremstilling af 2-chlor-5-sulfamoylbenzoesyrer.Info
- Publication number
- DK133977B DK133977B DK418074AA DK418074A DK133977B DK 133977 B DK133977 B DK 133977B DK 418074A A DK418074A A DK 418074AA DK 418074 A DK418074 A DK 418074A DK 133977 B DK133977 B DK 133977B
- Authority
- DK
- Denmark
- Prior art keywords
- chloro
- preparation
- sulfamoylbenzoic acids
- sulfamoylbenzoic
- acids
- Prior art date
Links
- LWDSANAOYPHQAW-UHFFFAOYSA-N 2-chloro-5-sulfamoylbenzoic acid Chemical class NS(=O)(=O)C1=CC=C(Cl)C(C(O)=O)=C1 LWDSANAOYPHQAW-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/22—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with hetero atoms directly attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/92—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with a hetero atom directly attached to the ring nitrogen atom
- C07D211/96—Sulfur atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US400704A US3879402A (en) | 1973-09-26 | 1973-09-26 | Process for preparing 2-chloro-5-sulfamoylbenzoic acids |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK418074A DK418074A (enExample) | 1975-05-20 |
| DK133977B true DK133977B (da) | 1976-08-23 |
Family
ID=23584675
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK418074AA DK133977B (da) | 1973-09-26 | 1974-08-06 | Fremgangsmåde til fremstilling af 2-chlor-5-sulfamoylbenzoesyrer. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3879402A (enExample) |
| JP (1) | JPS5726510B2 (enExample) |
| AR (1) | AR202421A1 (enExample) |
| AT (1) | AT332861B (enExample) |
| CA (1) | CA1022552A (enExample) |
| DD (1) | DD114596A5 (enExample) |
| DK (1) | DK133977B (enExample) |
| ES (1) | ES429000A1 (enExample) |
| FI (1) | FI234274A7 (enExample) |
| GB (1) | GB1415996A (enExample) |
| LU (1) | LU70683A1 (enExample) |
| NL (1) | NL7410541A (enExample) |
| RO (1) | RO70372A (enExample) |
| SE (1) | SE7409629L (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4138399A (en) * | 1970-09-14 | 1979-02-06 | Pfizer Inc. | Sulfamylbenzoic acid |
| US4006007A (en) * | 1975-01-02 | 1977-02-01 | Monsanto Company | N-(Substituted phenyl) derivatives of saccharin |
| WO1983000044A1 (fr) * | 1981-06-22 | 1983-01-06 | Mochida Pharm Co Ltd | Nouveaux derives d'acide aminosulfonyle benzoique et leur procede de preparation |
| DE3732374A1 (de) * | 1987-09-25 | 1989-04-06 | Basf Lacke & Farben | Zink-, blei- und/oder calciumsalze von carbonsaeuren und deren verwendung als korrosionsschutzmittel |
| US7262318B2 (en) * | 2004-03-10 | 2007-08-28 | Pfizer, Inc. | Substituted heteroaryl- and phenylsulfamoyl compounds |
| US20050288340A1 (en) * | 2004-06-29 | 2005-12-29 | Pfizer Inc | Substituted heteroaryl- and phenylsulfamoyl compounds |
| US20110129542A1 (en) * | 2007-08-15 | 2011-06-02 | Schering Corporation | Substituted azepine- and diazepine-sulfonamides useful to inhibit 11beta-hydroxysteroid dehydrogenase type-1 |
| CN109293539A (zh) * | 2018-10-26 | 2019-02-01 | 天津德凯化工股份有限公司 | 一种提高染料固色率和溶解度的中间体及其制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1249383A (en) * | 1968-04-22 | 1971-10-13 | Pfizer | Benzylthio-benzylsulphinyl- and benzylsulfonylbenzoic acid derivatives |
-
1973
- 1973-09-26 US US400704A patent/US3879402A/en not_active Expired - Lifetime
-
1974
- 1974-04-29 GB GB1875674A patent/GB1415996A/en not_active Expired
- 1974-07-18 CA CA205,023A patent/CA1022552A/en not_active Expired
- 1974-07-24 SE SE7409629A patent/SE7409629L/xx not_active Application Discontinuation
- 1974-08-06 ES ES429000A patent/ES429000A1/es not_active Expired
- 1974-08-06 NL NL7410541A patent/NL7410541A/xx not_active Application Discontinuation
- 1974-08-06 FI FI2342/74A patent/FI234274A7/fi unknown
- 1974-08-06 DD DD180362A patent/DD114596A5/xx unknown
- 1974-08-06 DK DK418074AA patent/DK133977B/da unknown
- 1974-08-06 RO RO7479676A patent/RO70372A/ro unknown
- 1974-08-07 LU LU70683A patent/LU70683A1/xx unknown
- 1974-08-07 AR AR255081A patent/AR202421A1/es active
- 1974-08-07 JP JP9068274A patent/JPS5726510B2/ja not_active Expired
- 1974-08-07 AT AT647774A patent/AT332861B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AR202421A1 (es) | 1975-06-06 |
| RO70372A (ro) | 1980-07-15 |
| US3879402A (en) | 1975-04-22 |
| FI234274A7 (enExample) | 1975-03-27 |
| AT332861B (de) | 1976-10-25 |
| JPS5058029A (enExample) | 1975-05-20 |
| GB1415996A (en) | 1975-12-03 |
| JPS5726510B2 (enExample) | 1982-06-04 |
| DK418074A (enExample) | 1975-05-20 |
| CA1022552A (en) | 1977-12-13 |
| LU70683A1 (enExample) | 1975-05-21 |
| ATA647774A (de) | 1976-02-15 |
| NL7410541A (nl) | 1975-04-01 |
| DD114596A5 (enExample) | 1975-08-12 |
| ES429000A1 (es) | 1977-01-16 |
| SE7409629L (enExample) | 1975-03-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK134345B (da) | Analogifremgangsmåde til fremstilling af 4-hydroxymethyl-1-phthalazonderivater. | |
| DK135376B (da) | Fremgangsmåde til fremstilling af piperazinylquinazolin-forbindelser. | |
| DK140484B (da) | Fremgangsmåde til fremstilling af zeaxanthin. | |
| DK135766B (da) | Analogifremgangsmåde til fremstilling af isoquinoliner. | |
| DK134031B (da) | Fremgangsmåde til fremstilling af et endo-beta-glucanase-præparat. | |
| DK139361C (da) | Analogifremgangsmaade til fremstilling af 17alfa-hydroxy-3,20-dioxo-4-pregnen-21-syrer | |
| DK139678B (da) | Fremgangsmåde til fremstilling af 2,2,6,6-tetramethyl-4-oxopiperidin. | |
| DK140406B (da) | Fremgangsmåde til fremstilling af 2,2,6,6-tetramethyl-4-oxopiperidin. | |
| DK137389B (da) | Analogifremgangsmåde til fremstilling af 11beta-substituerede delta4-østrener. | |
| DK133977B (da) | Fremgangsmåde til fremstilling af 2-chlor-5-sulfamoylbenzoesyrer. | |
| DK134279B (da) | Analogifremgangsmåde til fremstilling af cycloalkylphenoxycarboxylsyrederivater. | |
| DK137577B (da) | Fremgangsmåde til fremstilling af zeaxanthin. | |
| DK140411B (da) | Fremgangsmåde til fremstilling af deacetoxycephalosporin C. | |
| DK131633B (da) | Fremgangsmåde til fremstilling af 3-(17beta-4-androsten-3-on-17beta-yl)-propiolacton. | |
| DK139716B (da) | Analogifremgangsmåde til fremstilling af 4-aminoamfetaminderivater. | |
| DK137043B (da) | Analogifremgangsmåde til fremstilling af nitrocarbostyrilforbindelser. | |
| DK140557B (da) | Analogifremgangsmåde til fremstilling af sultiner af 17-hydroxy-3-oxo-17alfa-pregn-4-en-21-sulfinsyrer. | |
| DK130959B (da) | Analogifremgangsmåde til fremstilling af benzamidoacetohydroxamsyrer. | |
| DK133667B (da) | Fremgangsmåde til fremstilling af 5-cyklohexyl-6-halogenindan-1-karboxylsyrederivater. | |
| DK131575B (da) | Analogifremgangsmåde til fremstilling af 2beta-hydroxy-3alfa-aminosteroider. | |
| DK134994B (da) | Analogifremgangsmåde til fremstilling af poly(5-hydroxycytidylsyrer). | |
| DK135943B (da) | Fremgangsmåde til fremstilling af propanolaminderivater. | |
| DK129657B (da) | Analogifremgangsmåde til fremstilling af 3-methylpyrazol-5-carboxamider. | |
| DK136619B (da) | Fremgangsmåde til fremstilling af dihydrokanadensolid. | |
| DK135120B (da) | Analogifremgangsmåde til fremstilling af imidazolidinderivater. |