DK131940C - Analogifremgangsmade til fremstilling af 2,6-diphenyl-3-methyl-2,3-dihydro-imidazo(2,1-b)thiazol eller syreadditionssalte deraf - Google Patents
Analogifremgangsmade til fremstilling af 2,6-diphenyl-3-methyl-2,3-dihydro-imidazo(2,1-b)thiazol eller syreadditionssalte derafInfo
- Publication number
- DK131940C DK131940C DK10269A DK10269A DK131940C DK 131940 C DK131940 C DK 131940C DK 10269 A DK10269 A DK 10269A DK 10269 A DK10269 A DK 10269A DK 131940 C DK131940 C DK 131940C
- Authority
- DK
- Denmark
- Prior art keywords
- imidazo
- thiazole
- dihydro
- diphenyl
- methyl
- Prior art date
Links
- GSVHGRUMXLIGFR-UHFFFAOYSA-N 3-methyl-2,6-diphenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole Chemical compound C=1N2C(C)C(C=3C=CC=CC=3)SC2=NC=1C1=CC=CC=C1 GSVHGRUMXLIGFR-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/08—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D277/12—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/18—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR135359 | 1968-01-09 | ||
| FR177067 | 1968-12-06 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK131940B DK131940B (da) | 1975-09-29 |
| DK131940C true DK131940C (da) | 1976-02-23 |
Family
ID=26181714
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK10269A DK131940C (da) | 1968-01-09 | 1969-01-08 | Analogifremgangsmade til fremstilling af 2,6-diphenyl-3-methyl-2,3-dihydro-imidazo(2,1-b)thiazol eller syreadditionssalte deraf |
Country Status (8)
| Country | Link |
|---|---|
| BE (1) | BE726629A (enFirst) |
| BR (1) | BR6905354D0 (enFirst) |
| CH (1) | CH501667A (enFirst) |
| DE (1) | DE1900974C3 (enFirst) |
| DK (1) | DK131940C (enFirst) |
| GB (1) | GB1180202A (enFirst) |
| NL (1) | NL164285C (enFirst) |
| SE (1) | SE362650B (enFirst) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4224334A (en) * | 1976-01-19 | 1980-09-23 | Diamond Shamrock Corporation | Antiinflammatory imidazothiazoles and thiazolopyrimidines |
| GB1541321A (en) * | 1976-03-10 | 1979-02-28 | Metabio | 2,3-dihydroimidazo(2,1-b)thiazole derivatives and process for their preparation |
| US4263311A (en) * | 1976-09-27 | 1981-04-21 | Smithkline Corporation | 5,6-Phenyl-2,3-dihydroimidazo [2,1-b] thiazoles |
| LU77703A1 (de) * | 1977-07-07 | 1979-03-26 | Ciba Geigy Ag | Verfahren zur herstellung von bicyclischen thia-diaza-verbindungen |
| ZA827736B (en) * | 1981-11-25 | 1983-08-31 | Pfizer | Bicyclic imidazole and imidazolines as ectoparasiticides and anthelmintics |
| US5002941A (en) * | 1985-12-12 | 1991-03-26 | Smithkline Beecham Corporation | Pyrrolo(1,2-a)imidazole and imidazo(1,2-a)pyridine derivatives and their use as 5-lipoxygenase pathway inhibitors |
| US5145858A (en) * | 1985-12-12 | 1992-09-08 | Smithkline Beecham Corp. | Pyrrolo [1,2-a] imidazole and imidazo [1,2a] pyridine derivatives and their use as 5-lipoxygenase pathway inhibitors |
| US4719218A (en) * | 1985-12-12 | 1988-01-12 | Smithkline Beckman Corporation | Pyrrolo[1,2-a]imidazole and pyrrolo[1,2-a]pyridine derivatives and their use as 5-lipoxygenase pathway inhibitor |
| US4751310A (en) * | 1985-12-12 | 1988-06-14 | Smithkline Beckman Corporation | Inhibition of the 5-lipoxygenase pathway |
| US5134150A (en) * | 1985-12-12 | 1992-07-28 | Smithkline Beecham Corporation | Inhibition of the 5-lipoxygenase pathway |
| ZW24186A1 (en) * | 1985-12-12 | 1987-07-08 | Smithkline Beckman Corp | Inhibition of the 5-lipoxygenase pathway |
-
1968
- 1968-12-31 NL NL6818870A patent/NL164285C/xx active
-
1969
- 1969-01-06 BR BR20535469A patent/BR6905354D0/pt unknown
- 1969-01-07 GB GB102169A patent/GB1180202A/en not_active Expired
- 1969-01-08 SE SE20769A patent/SE362650B/xx unknown
- 1969-01-08 CH CH16769A patent/CH501667A/fr not_active IP Right Cessation
- 1969-01-08 BE BE726629D patent/BE726629A/xx unknown
- 1969-01-08 DK DK10269A patent/DK131940C/da active
- 1969-01-09 DE DE19691900974 patent/DE1900974C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE1900974A1 (de) | 1969-07-31 |
| NL6818870A (enFirst) | 1969-07-11 |
| DE1900974B2 (de) | 1978-05-03 |
| DE1900974C3 (de) | 1979-01-18 |
| NL164285B (nl) | 1980-07-15 |
| BE726629A (enFirst) | 1969-07-08 |
| NL164285C (nl) | 1980-12-15 |
| GB1180202A (en) | 1970-02-04 |
| BR6905354D0 (pt) | 1973-02-08 |
| SE362650B (enFirst) | 1973-12-17 |
| CH501667A (fr) | 1971-01-15 |
| DK131940B (da) | 1975-09-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK112589B (da) | Fremgangsmåde til fremstilling af 2,3,5,6-tetrahydroimidazo[2,1-b]thiazoler eller syreadditionssalte deraf. | |
| DK134992C (da) | Analogifremgangsmade til fremstilling af penicilliner eller salte deraf | |
| DK135585C (da) | Analogifremgangsmade til fremstilling af cycloheptenderivatereller syreadditionssalte deraf | |
| DK132172C (da) | Analogifremgangsmade til fremstilling af 6,7-benzomorphaner eller salte deraf | |
| DK131858C (da) | Analogifremgangsmade til fremstilling af 4-amino-6-arylpyrimidin-forbindelser eller syreadditionssalte deraf | |
| DK131940C (da) | Analogifremgangsmade til fremstilling af 2,6-diphenyl-3-methyl-2,3-dihydro-imidazo(2,1-b)thiazol eller syreadditionssalte deraf | |
| DK131721C (da) | Analogifremgangsmade til fremstilling af adamantanylaminer eller 3,5,7-trimethylhomologe eller syreadditionssalte deraf | |
| DK136612C (da) | Analogifremgangsmaade til fremstilling af 3,20-dioxo-4-pregnen-21-syrederivater | |
| DK131993C (da) | Fremgangsmade til fremstilling af d1-2,3,5,6-tetrahydro-6-phenylimidazo(2,1-b)thiazol eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK131857C (da) | Analogifremgangsmade til fremstilling af 4-hydroxymethyl-1-phthalazonderivater eller syreadditionssalte deraf | |
| DK133679C (da) | Analogifremgangsmade til fremstilling af penicilliner eller salte deraf | |
| DK133153C (da) | Analogifremgangsmade til fremstilling af tetrahydrocyklopropadibenzazepinderivater eller salte deraf | |
| DK132627C (da) | Analogifremgangsmade til fremstilling af kromanderivater eller syreadditionssalte deraf | |
| DK132629C (da) | Analogifremgangsmade til fremstilling af 4-hydroxy-2h-1-benzothiopyran-3-carboxamid-1,1-dioxider | |
| DK134438B (da) | Analogifremgangsmade til fremstilling af penicilliner eller salte deraf | |
| DK133301C (da) | Analogifremgangsmade til fremstilling af penicillanforbindelser eller salte deraf | |
| DK137011C (da) | Analogifremgangsmaade til fremstilling af oxazoler eller salteheraf | |
| DK136823B (da) | Analogifremgangsmåde til fremstilling af racemiske eller optisk aktive derivater af imidazo(2,1-b)thiazol eller syreadditionssalte deraf. | |
| DK107874C (da) | Fremgangsmåde til fremstilling af imidazo-[2,1-b]-thiazol- eller benzothiazolforbindelser eller syreadditionssalte heraf. | |
| DK132755C (da) | Analogifremgangsmade til fremstilling af benzomorphanderivater eller syreadditionssalte deraf | |
| DK135941C (da) | Analogifremgangsmaade til fremstilling af 1-cyclopropyl-1-phenyl-3-amino-1-propanoler eller syreaddittionssalte deraf | |
| DK131727C (da) | Analogifremgangsmade til fremstilling af oxazinobenzoxaziner eller syreadditionssalte deraf | |
| DK131862C (da) | Analogifremgangsmade til fremstilling af penicilliner eller salte deraf | |
| DK132706C (da) | Fremgangsmade til fremstilling af forbindelser der indeholderet2,3,5,6-tetrahydro-imidazo(2,1-b)thiazol-ringsystem eller deres salte | |
| DK140762B (da) | Analogifremgangsmaade til fremstilling af 7,8-dihydropteridiner eller tautomere eller salte deraf |