DK129198B - Analogifremgangsmåde til fremstilling af antibiotisk aktive derivater af rifamycin SV. - Google Patents
Analogifremgangsmåde til fremstilling af antibiotisk aktive derivater af rifamycin SV.Info
- Publication number
- DK129198B DK129198B DK78568AA DK78568A DK129198B DK 129198 B DK129198 B DK 129198B DK 78568A A DK78568A A DK 78568AA DK 78568 A DK78568 A DK 78568A DK 129198 B DK129198 B DK 129198B
- Authority
- DK
- Denmark
- Prior art keywords
- rifamycin
- preparation
- active derivatives
- analogous process
- antibiotically active
- Prior art date
Links
- HJYYPODYNSCCOU-ODRIEIDWSA-N rifamycin SV Chemical class OC1=C(C(O)=C2C)C3=C(O)C=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O HJYYPODYNSCCOU-ODRIEIDWSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/12—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains three hetero rings
- C07D498/18—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB9755/67A GB1172155A (en) | 1967-03-01 | 1967-03-01 | New Rifamycins |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK129198B true DK129198B (da) | 1974-09-09 |
| DK129198C DK129198C (h) | 1975-03-03 |
Family
ID=9878162
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK78568AA DK129198B (da) | 1967-03-01 | 1968-02-28 | Analogifremgangsmåde til fremstilling af antibiotisk aktive derivater af rifamycin SV. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3625961A (h) |
| BE (1) | BE711546A (h) |
| CH (1) | CH482716A (h) |
| DE (1) | DE1695384A1 (h) |
| DK (1) | DK129198B (h) |
| ES (1) | ES351070A1 (h) |
| FI (1) | FI48275C (h) |
| FR (2) | FR1562297A (h) |
| GB (1) | GB1172155A (h) |
| IL (1) | IL29441A (h) |
| NL (1) | NL6802429A (h) |
| NO (1) | NO120734B (h) |
| SE (1) | SE337829B (h) |
| YU (1) | YU31945B (h) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1523198A (en) * | 1976-05-28 | 1978-08-31 | Lepetit Spa | Thiazolo-rifamycin derivatives |
| GB1523199A (en) * | 1976-05-28 | 1978-08-31 | Lepetit Spa | Rifamycin sv derivatives |
| EP0049683A3 (de) * | 1980-09-25 | 1982-09-01 | Ciba-Geigy Ag | Imidazo-Rifamycine, Verfahren zu ihrer Herstellung, diese enthaltende pharmazeutische Präparate sowie ihre Verwendung |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1090115A (en) * | 1964-04-02 | 1967-11-08 | Lepetit Spa | Mannich bases of rifamycin sv |
-
1967
- 1967-03-01 GB GB9755/67A patent/GB1172155A/en not_active Expired
-
1968
- 1968-02-05 US US702796A patent/US3625961A/en not_active Expired - Lifetime
- 1968-02-08 IL IL29441A patent/IL29441A/en unknown
- 1968-02-17 DE DE19681695384 patent/DE1695384A1/de not_active Withdrawn
- 1968-02-20 NL NL6802429A patent/NL6802429A/xx unknown
- 1968-02-23 FI FI680478A patent/FI48275C/fi active
- 1968-02-23 CH CH265968A patent/CH482716A/fr not_active IP Right Cessation
- 1968-02-26 NO NO0696/68A patent/NO120734B/no unknown
- 1968-02-28 SE SE02567/68A patent/SE337829B/xx unknown
- 1968-02-28 DK DK78568AA patent/DK129198B/da not_active IP Right Cessation
- 1968-02-29 ES ES351070A patent/ES351070A1/es not_active Expired
- 1968-03-01 FR FR1562297D patent/FR1562297A/fr not_active Expired
- 1968-03-01 BE BE711546D patent/BE711546A/xx not_active IP Right Cessation
- 1968-03-01 YU YU0486/68A patent/YU31945B/xx unknown
- 1968-05-28 FR FR153157A patent/FR7891M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3625961A (en) | 1971-12-07 |
| NL6802429A (h) | 1968-09-02 |
| FI48275C (fi) | 1974-08-12 |
| DE1695384A1 (de) | 1972-04-13 |
| GB1172155A (en) | 1969-11-26 |
| CH482716A (fr) | 1969-12-15 |
| BE711546A (h) | 1968-07-15 |
| FI48275B (h) | 1974-04-30 |
| FR1562297A (h) | 1969-04-04 |
| YU48668A (en) | 1973-08-31 |
| SE337829B (h) | 1971-08-23 |
| NO120734B (h) | 1970-11-30 |
| FR7891M (h) | 1970-05-04 |
| YU31945B (en) | 1974-02-28 |
| ES351070A1 (es) | 1969-06-01 |
| IL29441A (en) | 1971-05-26 |
| DK129198C (h) | 1975-03-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK115993B (da) | Fremgangsmåde til fremstilling af derivater af rifamycin SV. | |
| DK137232B (da) | Analogifremgangsmåde til fremstilling af phenylethanolaminer. | |
| DK120698B (da) | Analogifremgangsmåde til fremstilling af acetylguanidiner. | |
| DK124756B (da) | Analogifremgangsmåde til fremstilling af piperazinderivater. | |
| DK118820B (da) | Analogifremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoliner. | |
| DK118460B (da) | Analogifremgangsmåde til fremstilling af sulfonylurinstofderivater. | |
| DK123942C (da) | Analogifremgangsmåde til fremstilling af benzothiazepinderivater. | |
| DK123482B (da) | Analogifremgangsmåde til fremstilling af alkaloider. | |
| DK118081B (da) | Fremgangsmåde til fremstilling af isoksazolderivater. | |
| DK125850B (da) | Analogifremgangsmåde til fremstilling af heterocykliske forbindelser. | |
| DK134911B (da) | Fremgangsmåde til fremstilling af 3-formylrifamycin SV-derivater. | |
| DK123868B (da) | Analogifremgangsmåde til fremstilling af 3-hydroxycumarin-derivater. | |
| DK114697B (da) | Fremgangsmåde til fremstilling af 25-desacetylderivater af rifamyciner. | |
| DK134115B (da) | Analogifremgangsmåde til fremstilling af cephalosporinforbindelser. | |
| DK126595B (da) | Fremgangsmåde til fremstilling af 7-(pyridylmercaptoacetamido)-cephalosporansyrederivater. | |
| DK124407B (da) | Fremgangsmåde til fremstilling af tioderivater af rifamycin SV. | |
| DK124825B (da) | Analogifremgangsmåde til fremstilling af pyrazinderivater. | |
| DK118507B (da) | Fremgangsmåde til fremstilling af 3-dimethylsulfamoylphenthiazinderivater. | |
| DK129198B (da) | Analogifremgangsmåde til fremstilling af antibiotisk aktive derivater af rifamycin SV. | |
| DK119663B (da) | Analogifremgangsmåde til fremstilling af 2-benzolsulfonamidopyrimidinforbindelser. | |
| DK124214B (da) | Fremgangsmåde til fremstilling af pyrrolnitrinderivater. | |
| DK117627B (da) | Fremgangsmåde til fremstilling af rifamycin SV. | |
| DK122761B (da) | Analogifremgangsmåde til fremstilling af arylsulfonylurinstofderivater. | |
| DK117703B (da) | Analogifremgangsmåde til fremstilling af anticoccidielt aktive quinolinderivater. | |
| DK118291B (da) | Analogifremgangsmåde til fremstilling af 10α-alkoxy-9,10-dihydroergolinderivater. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |