DK127972B - Analogifremgangsmåde til fremstilling af decylesteren af prostaglandin A2. - Google Patents
Analogifremgangsmåde til fremstilling af decylesteren af prostaglandin A2.Info
- Publication number
- DK127972B DK127972B DK176971A DK176971A DK127972B DK 127972 B DK127972 B DK 127972B DK 176971 A DK176971 A DK 176971A DK 176971 A DK176971 A DK 176971A DK 127972 B DK127972 B DK 127972B
- Authority
- DK
- Denmark
- Prior art keywords
- prostaglandin
- preparation
- decyl ester
- analogous process
- analogous
- Prior art date
Links
- MYHXHCUNDDAEOZ-UHFFFAOYSA-N Prostaglandin A&2% Natural products CCCCCC(O)C=CC1C=CC(=O)C1CC=CCCCC(O)=O MYHXHCUNDDAEOZ-UHFFFAOYSA-N 0.000 title 1
- -1 decyl ester Chemical class 0.000 title 1
- MYHXHCUNDDAEOZ-FOSBLDSVSA-N prostaglandin A2 Chemical compound CCCCC[C@H](O)\C=C\[C@H]1C=CC(=O)[C@@H]1C\C=C/CCCC(O)=O MYHXHCUNDDAEOZ-FOSBLDSVSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Drying Of Solid Materials (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3219270 | 1970-04-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK127972B true DK127972B (da) | 1974-02-11 |
Family
ID=12352025
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK176971A DK127972B (da) | 1970-04-15 | 1971-04-14 | Analogifremgangsmåde til fremstilling af decylesteren af prostaglandin A2. |
Country Status (10)
| Country | Link |
|---|---|
| BE (1) | BE765641A (en:Method) |
| CH (1) | CH560665A5 (en:Method) |
| DE (1) | DE2117188C3 (en:Method) |
| DK (1) | DK127972B (en:Method) |
| ES (1) | ES390168A1 (en:Method) |
| FR (1) | FR2092048A1 (en:Method) |
| HU (1) | HU162629B (en:Method) |
| NL (1) | NL7104975A (en:Method) |
| NO (1) | NO131246C (en:Method) |
| SU (1) | SU371719A3 (en:Method) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3069322A (en) * | 1958-05-28 | 1962-12-18 | Bergstrom Sune | Pge and pgf |
-
1971
- 1971-04-08 DE DE19712117188 patent/DE2117188C3/de not_active Expired
- 1971-04-12 SU SU1646351A patent/SU371719A3/ru active
- 1971-04-13 BE BE765641A patent/BE765641A/xx unknown
- 1971-04-13 HU HUOO000169 patent/HU162629B/hu unknown
- 1971-04-14 ES ES390168A patent/ES390168A1/es not_active Expired
- 1971-04-14 NO NO138871A patent/NO131246C/no unknown
- 1971-04-14 CH CH534271A patent/CH560665A5/xx not_active IP Right Cessation
- 1971-04-14 NL NL7104975A patent/NL7104975A/xx unknown
- 1971-04-14 DK DK176971A patent/DK127972B/da unknown
- 1971-04-15 FR FR7113323A patent/FR2092048A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| HU162629B (en:Method) | 1973-03-28 |
| DE2117188B2 (en:Method) | 1974-06-06 |
| CH560665A5 (en:Method) | 1975-04-15 |
| FR2092048A1 (en) | 1972-01-21 |
| ES390168A1 (es) | 1974-05-16 |
| FR2092048B1 (en:Method) | 1974-05-24 |
| SU371719A3 (en:Method) | 1973-02-22 |
| NO131246C (en:Method) | 1975-04-30 |
| DE2117188C3 (de) | 1975-02-06 |
| NO131246B (en:Method) | 1975-01-20 |
| DE2117188A1 (en:Method) | 1971-11-04 |
| BE765641A (fr) | 1971-08-30 |
| NL7104975A (en:Method) | 1971-10-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK128733B (da) | Fremgangsmåde til fremstilling af prostaglandinestere. | |
| DK129352B (da) | Analogifremgangsmåde til fremstilling af 3-octadecyloxy-propanol-(1)-phosphorsyre-monocholinester. | |
| DK131426B (da) | Fremgangsmåde til fremstilling af prostaglandin F1-forbindelser. | |
| DK129339B (da) | Analogifremgangsmåde til fremstilling af N-aminophenylamidiner. | |
| DK135455B (da) | Fremgangsmåde til fremstilling af 7-halogen-7-desoxythiolincosaminider. | |
| DK124195B (da) | Fremgangsmåde til fremstilling af cis-chrysantheminsyrer. | |
| DK130467B (da) | Fremgangsmåde til fremstilling af erythromycylaminer. | |
| DK126998B (da) | Analogifremgangsmåde til fremstilling af amino-s-triazolylbenzensulfonamidforbindelser. | |
| DK127977B (da) | Fremgangsmåde til fremstilling af 6α-methyl-19-nor-pregnener. | |
| DK134154B (da) | Analogifremgangsmåde til fremstilling af 5-cyklohexyl-1-indankarboxylsyrederivater. | |
| DK138490B (da) | Fremgangsmåde til fremstilling af prostadiensyrederivater. | |
| DK129045B (da) | Analogifremgangsmåde til fremstilling af (p-fluorpheny)-pyridincarboxylsyrer. | |
| DK129453B (da) | Analogifremgangsmåde til fremstilling af 1-aminoisoquinoliner. | |
| DK127596B (da) | Fremgangsmåde til fremstilling af 2-cyan-3,4,5,6-tetrahalogen-benzoesyrealkylestere. | |
| DK116795B (da) | Fremgangsmåde til fremstilling af γ-chloraceteddikesyreestere. | |
| DK128205B (da) | Fremgangsmåde til fremstilling af 1-aryloxy-2-propanoler. | |
| DK129993B (da) | Analogifremgangsmåde til fremstilling af indoleddikesyrederivater. | |
| DK135425B (da) | Analogifremgangsmåde til fremstilling af 2-imidazolidonderivater. | |
| DK138021B (da) | Fremgangsmåde til fremstilling af aminopenicilliner. | |
| DK128530B (da) | Analogifremgangsmåde til fremstilling af ω-homo-prostaglandin-E1-heptylester. | |
| DK129788B (da) | Analogifremgangsmåde til fremstilling af α-aminoalkyl-4-hydroxy-3-ureidobenzylalkoholer. | |
| DK127972B (da) | Analogifremgangsmåde til fremstilling af decylesteren af prostaglandin A2. | |
| DK129457B (da) | Fremgangsmåde til fremstilling af 6-aminopenicillansyre. | |
| DK132026B (da) | Fremgangsmåde til fremstilling af 6-aminoacylamidopenicillansyrer. | |
| DK127852B (da) | Analogifremgangsmåde til fremstilling af 22-substituerede cardenolidrhamnosider. |