DK127188B - Fremgangsmåde til rensning af cephalexin. - Google Patents
Fremgangsmåde til rensning af cephalexin.Info
- Publication number
- DK127188B DK127188B DK111171AA DK111171A DK127188B DK 127188 B DK127188 B DK 127188B DK 111171A A DK111171A A DK 111171AA DK 111171 A DK111171 A DK 111171A DK 127188 B DK127188 B DK 127188B
- Authority
- DK
- Denmark
- Prior art keywords
- cephalexin
- purifying
- purifying cephalexin
- Prior art date
Links
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 title 1
- 229940106164 cephalexin Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/22—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with radicals containing only hydrogen and carbon atoms, attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1175470 | 1970-03-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK127188B true DK127188B (da) | 1973-10-01 |
Family
ID=9992094
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK111171AA DK127188B (da) | 1970-03-11 | 1971-03-10 | Fremgangsmåde til rensning af cephalexin. |
Country Status (10)
| Country | Link |
|---|---|
| AT (1) | AT302528B (enEXAMPLES) |
| BE (1) | BE764055A (enEXAMPLES) |
| CH (1) | CH559754A5 (enEXAMPLES) |
| DE (1) | DE2111522A1 (enEXAMPLES) |
| DK (1) | DK127188B (enEXAMPLES) |
| FR (1) | FR2084422A5 (enEXAMPLES) |
| GB (1) | GB1327048A (enEXAMPLES) |
| NL (1) | NL7103177A (enEXAMPLES) |
| SE (1) | SE380268B (enEXAMPLES) |
| ZA (1) | ZA711555B (enEXAMPLES) |
-
1971
- 1971-03-10 DE DE19712111522 patent/DE2111522A1/de active Pending
- 1971-03-10 CH CH353671A patent/CH559754A5/xx not_active IP Right Cessation
- 1971-03-10 ZA ZA711555A patent/ZA711555B/xx unknown
- 1971-03-10 SE SE7103090A patent/SE380268B/xx unknown
- 1971-03-10 NL NL7103177A patent/NL7103177A/xx unknown
- 1971-03-10 BE BE764055A patent/BE764055A/xx unknown
- 1971-03-10 FR FR7108270A patent/FR2084422A5/fr not_active Expired
- 1971-03-10 AT AT207771A patent/AT302528B/de not_active IP Right Cessation
- 1971-03-10 DK DK111171AA patent/DK127188B/da unknown
- 1971-04-19 GB GB1175470A patent/GB1327048A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE380268B (sv) | 1975-11-03 |
| ZA711555B (en) | 1972-10-25 |
| NL7103177A (enEXAMPLES) | 1971-09-14 |
| CH559754A5 (enEXAMPLES) | 1975-03-14 |
| BE764055A (fr) | 1971-08-02 |
| DE2111522A1 (de) | 1971-09-30 |
| AT302528B (de) | 1972-10-25 |
| GB1327048A (en) | 1973-08-15 |
| FR2084422A5 (enEXAMPLES) | 1971-12-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK130874B (da) | Fremgangsmåde til fremstilling af mikrokapsler. | |
| FI46850C (fi) | L-asparaginaasin puhdistusmenetelmä. | |
| DK129464B (da) | Fremgangsmåde til isolering af cephalosporin C. | |
| DK133621B (da) | Fremgangsmåde til fremstilling af øl. | |
| DK134483B (da) | Fremgangsmåde til isolering af (+)-trans-chrysanthemsyre. | |
| DK129339B (da) | Analogifremgangsmåde til fremstilling af N-aminophenylamidiner. | |
| DK132049B (da) | Radiotelefonianlæg. | |
| DK135455B (da) | Fremgangsmåde til fremstilling af 7-halogen-7-desoxythiolincosaminider. | |
| DK134489B (da) | Fremgangsmåde til fremstilling af alkyl-7-desoxy-7(S)-substituerede-alfa-thiolincosaminider. | |
| NL7413230A (nl) | Facsimilestelsel. | |
| DK129503B (da) | Bruse til bruseanlæg. | |
| DK130467B (da) | Fremgangsmåde til fremstilling af erythromycylaminer. | |
| DK127977B (da) | Fremgangsmåde til fremstilling af 6α-methyl-19-nor-pregnener. | |
| DK131327B (da) | Fremgangsmåde til fremstilling af mikrokapsler. | |
| DK112606B (da) | Fremgangsmåde til rensning af insulin. | |
| DK129453B (da) | Analogifremgangsmåde til fremstilling af 1-aminoisoquinoliner. | |
| DK128205B (da) | Fremgangsmåde til fremstilling af 1-aryloxy-2-propanoler. | |
| DK127188B (da) | Fremgangsmåde til rensning af cephalexin. | |
| DK128942B (da) | Fremgangsmåde til fremstilling af L-asparaginase. | |
| DK126186B (da) | Fremgangsmåde til fremstilling af 13β-alkylgona-4,9-diener. | |
| DK125790B (da) | Fremgangsmåde til fremstilling af L-β-3,4-dihydroxyphenyl-α-alanin. | |
| DK136959B (da) | Fremgangsmåde til forbedring af en isomeringskatalysator. | |
| DK127852B (da) | Analogifremgangsmåde til fremstilling af 22-substituerede cardenolidrhamnosider. | |
| DK127414B (da) | Analogifremgangsmåde til fremstilling af phenylhydrazider. | |
| DK129138B (da) | Fremgangsmåde til fremstilling af tuberactinomycin-N. |