DK126998B - Analogifremgangsmåde til fremstilling af amino-s-triazolylbenzensulfonamidforbindelser. - Google Patents
Analogifremgangsmåde til fremstilling af amino-s-triazolylbenzensulfonamidforbindelser.Info
- Publication number
- DK126998B DK126998B DK327871AA DK327871A DK126998B DK 126998 B DK126998 B DK 126998B DK 327871A A DK327871A A DK 327871AA DK 327871 A DK327871 A DK 327871A DK 126998 B DK126998 B DK 126998B
- Authority
- DK
- Denmark
- Prior art keywords
- triazolylbenzenesulfonamide
- amino
- compounds
- preparation
- analogous process
- Prior art date
Links
- OOQXXVQRAQTLBK-UHFFFAOYSA-N 3-amino-2-(1H-1,2,4-triazol-5-yl)benzenesulfonamide Chemical class NC=1C(=C(C=CC1)S(=O)(=O)N)C1=NNC=N1 OOQXXVQRAQTLBK-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/21—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/78—Halides of sulfonic acids
- C07C309/86—Halides of sulfonic acids having halosulfonyl groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/89—Halides of sulfonic acids having halosulfonyl groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing carboxyl groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D249/14—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US5272070A | 1970-07-06 | 1970-07-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK126998B true DK126998B (da) | 1973-09-10 |
Family
ID=21979480
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK327871AA DK126998B (da) | 1970-07-06 | 1971-07-02 | Analogifremgangsmåde til fremstilling af amino-s-triazolylbenzensulfonamidforbindelser. |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3666771A (enExample) |
| JP (1) | JPS5516144B1 (enExample) |
| AT (1) | AT304544B (enExample) |
| BE (1) | BE769472A (enExample) |
| CA (1) | CA920599A (enExample) |
| CH (1) | CH527206A (enExample) |
| DE (1) | DE2133038A1 (enExample) |
| DK (1) | DK126998B (enExample) |
| ES (1) | ES392819A1 (enExample) |
| FR (1) | FR2100863B1 (enExample) |
| GB (1) | GB1331161A (enExample) |
| IE (1) | IE35420B1 (enExample) |
| IL (1) | IL37210A (enExample) |
| NL (1) | NL148890B (enExample) |
| SE (1) | SE366753B (enExample) |
| ZA (1) | ZA713597B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4055572A (en) * | 1975-08-06 | 1977-10-25 | Ciba-Geigy Corporation | Process for the production of 3-hydroxy-1,2,4-triazole derivatives |
| DE2909675C3 (de) * | 1979-03-12 | 1981-11-19 | M.A.N. Maschinenfabrik Augsburg-Nürnberg AG, 4200 Oberhausen | Verfahren zur kondensatfreien Zwischenkühlung verdichteter Gase |
| JPH033363U (enExample) * | 1989-05-31 | 1991-01-14 | ||
| US5489598A (en) * | 1994-06-08 | 1996-02-06 | Warner-Lambert Company | Cytoprotection utilizing aryltriazol-3-thiones |
| IL118657A0 (en) * | 1996-06-14 | 1996-10-16 | Arad Dorit | Inhibitors for picornavirus proteases |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2989539A (en) * | 1961-06-20 | J-amino-x-phenylpyrazoles and method | ||
| US3679656A (en) * | 1968-05-20 | 1972-07-25 | Hodogaya Chemical Co Ltd | Quaternized 1,2,4-triazolium-3-azo dyestuffs |
| JPS4840447B1 (enExample) * | 1969-08-20 | 1973-11-30 |
-
1970
- 1970-07-06 US US52720A patent/US3666771A/en not_active Expired - Lifetime
-
1971
- 1971-06-02 CH CH977271A patent/CH527206A/fr unknown
- 1971-06-03 ZA ZA713597A patent/ZA713597B/xx unknown
- 1971-07-02 JP JP4815771A patent/JPS5516144B1/ja active Pending
- 1971-07-02 DK DK327871AA patent/DK126998B/da unknown
- 1971-07-02 FR FR7124310A patent/FR2100863B1/fr not_active Expired
- 1971-07-02 BE BE769472A patent/BE769472A/xx unknown
- 1971-07-02 NL NL717109197A patent/NL148890B/xx unknown
- 1971-07-02 IL IL37210A patent/IL37210A/xx unknown
- 1971-07-02 AT AT574471A patent/AT304544B/de not_active IP Right Cessation
- 1971-07-02 CA CA117268A patent/CA920599A/en not_active Expired
- 1971-07-02 GB GB3120071A patent/GB1331161A/en not_active Expired
- 1971-07-02 DE DE19712133038 patent/DE2133038A1/de active Pending
- 1971-07-02 IE IE847/71A patent/IE35420B1/xx unknown
- 1971-07-02 ES ES392819A patent/ES392819A1/es not_active Expired
- 1971-07-02 SE SE08569/71A patent/SE366753B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE35420L (en) | 1972-01-06 |
| GB1331161A (en) | 1973-09-26 |
| ES392819A1 (es) | 1973-08-16 |
| JPS5516144B1 (enExample) | 1980-04-30 |
| NL148890B (nl) | 1976-03-15 |
| IL37210A (en) | 1974-07-31 |
| AT304544B (de) | 1973-01-10 |
| ZA713597B (en) | 1973-01-31 |
| US3666771A (en) | 1972-05-30 |
| CA920599A (en) | 1973-02-06 |
| FR2100863A1 (enExample) | 1972-03-24 |
| SE366753B (enExample) | 1974-05-06 |
| CH527206A (fr) | 1972-08-31 |
| FR2100863B1 (enExample) | 1974-10-18 |
| IL37210A0 (en) | 1971-10-20 |
| DE2133038A1 (de) | 1972-01-13 |
| IE35420B1 (en) | 1976-02-04 |
| NL7109197A (enExample) | 1972-01-10 |
| BE769472A (fr) | 1971-11-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK129339B (da) | Analogifremgangsmåde til fremstilling af N-aminophenylamidiner. | |
| DK127119B (da) | Analogifremgangsmåde til fremstilling af 6-amino-9-benzylpurin-forbindelser. | |
| DK135455B (da) | Fremgangsmåde til fremstilling af 7-halogen-7-desoxythiolincosaminider. | |
| DK139576B (da) | Fremgangsmåde til isolering af alfa-6-desoxy-5-oxytetracyklin. | |
| DK134489B (da) | Fremgangsmåde til fremstilling af alkyl-7-desoxy-7(S)-substituerede-alfa-thiolincosaminider. | |
| DK128540B (da) | Analogifremgangsmåde til fremstilling af pyrazolodiazepinonforbindelser. | |
| DK130467B (da) | Fremgangsmåde til fremstilling af erythromycylaminer. | |
| DK126998B (da) | Analogifremgangsmåde til fremstilling af amino-s-triazolylbenzensulfonamidforbindelser. | |
| DK127977B (da) | Fremgangsmåde til fremstilling af 6α-methyl-19-nor-pregnener. | |
| DK129453B (da) | Analogifremgangsmåde til fremstilling af 1-aminoisoquinoliner. | |
| DK128205B (da) | Fremgangsmåde til fremstilling af 1-aryloxy-2-propanoler. | |
| DK137181B (da) | Analogifremgangsmåde til fremstilling af 3-amino-kinolinderivater. | |
| DK126323B (da) | Fremgangsmåde til fremstilling af 3β-hydroxy-5α-cardenolider eller -bufadienolider. | |
| DK138021B (da) | Fremgangsmåde til fremstilling af aminopenicilliner. | |
| DK126509B (da) | Fremgangsmåde til fremstilling af zearalenon. | |
| DK137860B (da) | Analogifremgangsmåde til fremstilling af triazolobenzodiazepin-5N-oxydderivater. | |
| DK135994B (da) | Analogifremgangsmåde til fremstilling af benzopyranforbindelser. | |
| DK125388B (da) | Fremgangsmåde til fremstilling af phenylaminoethanolderivater. | |
| DK124686B (da) | Analogifremgangsmåde til fremstilling af bis-thiachromonylforbindelser. | |
| DK129788B (da) | Analogifremgangsmåde til fremstilling af α-aminoalkyl-4-hydroxy-3-ureidobenzylalkoholer. | |
| DK127414B (da) | Analogifremgangsmåde til fremstilling af phenylhydrazider. | |
| DK127852B (da) | Analogifremgangsmåde til fremstilling af 22-substituerede cardenolidrhamnosider. | |
| DK129138B (da) | Fremgangsmåde til fremstilling af tuberactinomycin-N. | |
| DK129049B (da) | Analogifremgangsmåde til fremstilling af α-aminobenzylpenicillinderivater. | |
| DK128209B (da) | Analogifremgangsmåde til fremstilling af 19-nor-14-dehydrotestosteronderivater. |