DK124407B - Fremgangsmåde til fremstilling af tioderivater af rifamycin SV. - Google Patents
Fremgangsmåde til fremstilling af tioderivater af rifamycin SV.Info
- Publication number
- DK124407B DK124407B DK527867AA DK527867A DK124407B DK 124407 B DK124407 B DK 124407B DK 527867A A DK527867A A DK 527867AA DK 527867 A DK527867 A DK 527867A DK 124407 B DK124407 B DK 124407B
- Authority
- DK
- Denmark
- Prior art keywords
- rifamycin
- preparation
- thio derivatives
- thio
- derivatives
- Prior art date
Links
- HJYYPODYNSCCOU-ZDHWWVNNSA-N Rifamycin SV Natural products COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c(NC(=O)C(=C/C=C/C(C)C(O)C(C)C(O)C(C)C(OC(=O)C)C1C)C)cc(O)c4c3C2=O HJYYPODYNSCCOU-ZDHWWVNNSA-N 0.000 title 1
- 229940109171 rifamycin sv Drugs 0.000 title 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/08—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Fertilizers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB47899/66A GB1165179A (en) | 1966-10-25 | 1966-10-25 | Derivatives of Rifamycin SV |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK124407B true DK124407B (da) | 1972-10-16 |
Family
ID=10446646
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK527867AA DK124407B (da) | 1966-10-25 | 1967-10-23 | Fremgangsmåde til fremstilling af tioderivater af rifamycin SV. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3625960A (enExample) |
| AT (1) | AT272520B (enExample) |
| BE (1) | BE705621A (enExample) |
| CH (1) | CH476754A (enExample) |
| DE (1) | DE1695374A1 (enExample) |
| DK (1) | DK124407B (enExample) |
| ES (1) | ES346409A1 (enExample) |
| FI (1) | FI45558C (enExample) |
| FR (1) | FR8471M (enExample) |
| GB (1) | GB1165179A (enExample) |
| IL (1) | IL28775A (enExample) |
| NL (1) | NL6714241A (enExample) |
| NO (1) | NO119279B (enExample) |
| SE (1) | SE346000B (enExample) |
| YU (1) | YU33198B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4013789A (en) * | 1974-01-09 | 1977-03-22 | Pfizer Inc. | Mixture of antibiotics produced by new species of micromonospora |
| US3914218A (en) * | 1974-01-09 | 1975-10-21 | Pfizer | 3-Methylthiorifamycins |
| US3923791A (en) * | 1974-04-01 | 1975-12-02 | Pfizer | Preparation of thioethers of rifamycin S and rifamycin SV |
| US4062944A (en) * | 1975-05-29 | 1977-12-13 | Pfizer Inc. | Mixture of antibiotics produced by new species of micromonospora |
| GB1523199A (en) * | 1976-05-28 | 1978-08-31 | Lepetit Spa | Rifamycin sv derivatives |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL130099C (enExample) * | 1963-10-11 | |||
| GB1090115A (en) * | 1964-04-02 | 1967-11-08 | Lepetit Spa | Mannich bases of rifamycin sv |
| FR208F (enExample) * | 1964-07-31 |
-
1966
- 1966-10-25 GB GB47899/66A patent/GB1165179A/en not_active Expired
-
1967
- 1967-10-16 IL IL28775A patent/IL28775A/en unknown
- 1967-10-16 US US675341A patent/US3625960A/en not_active Expired - Lifetime
- 1967-10-19 NL NL6714241A patent/NL6714241A/xx unknown
- 1967-10-21 DE DE19671695374 patent/DE1695374A1/de active Pending
- 1967-10-23 DK DK527867AA patent/DK124407B/da not_active IP Right Cessation
- 1967-10-24 FI FI672855A patent/FI45558C/fi active
- 1967-10-24 SE SE14536/67A patent/SE346000B/xx unknown
- 1967-10-24 NO NO170244A patent/NO119279B/no unknown
- 1967-10-24 AT AT960567A patent/AT272520B/de active
- 1967-10-25 YU YU2080/67A patent/YU33198B/xx unknown
- 1967-10-25 BE BE705621D patent/BE705621A/xx not_active IP Right Cessation
- 1967-10-25 ES ES346409A patent/ES346409A1/es not_active Expired
- 1967-10-25 CH CH1487767A patent/CH476754A/fr not_active IP Right Cessation
-
1968
- 1968-01-24 FR FR137268A patent/FR8471M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FI45558C (fi) | 1972-07-10 |
| IL28775A (en) | 1971-10-20 |
| BE705621A (enExample) | 1968-03-01 |
| NL6714241A (enExample) | 1968-04-26 |
| SE346000B (enExample) | 1972-06-19 |
| CH476754A (fr) | 1969-08-15 |
| DE1695374A1 (de) | 1972-03-09 |
| YU33198B (en) | 1976-06-30 |
| US3625960A (en) | 1971-12-07 |
| AT272520B (de) | 1969-07-10 |
| YU208067A (en) | 1975-12-31 |
| FI45558B (enExample) | 1972-04-04 |
| FR8471M (enExample) | 1972-06-09 |
| GB1165179A (en) | 1969-09-24 |
| ES346409A1 (es) | 1968-12-16 |
| NO119279B (enExample) | 1970-04-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK115993B (da) | Fremgangsmåde til fremstilling af derivater af rifamycin SV. | |
| DK118460B (da) | Analogifremgangsmåde til fremstilling af sulfonylurinstofderivater. | |
| DK118820B (da) | Analogifremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoliner. | |
| DK121804B (da) | Analogifremgangsmåde til fremstilling af 4-hydroxycumarinderivater. | |
| DK123942C (da) | Analogifremgangsmåde til fremstilling af benzothiazepinderivater. | |
| DK134911B (da) | Fremgangsmåde til fremstilling af 3-formylrifamycin SV-derivater. | |
| DK117706B (da) | Fremgangsmåde til fremstilling af pyrrolinderivater. | |
| DK130585B (da) | Analogifremgangsmåde til fremstilling af imidazolderivater. | |
| DK114697B (da) | Fremgangsmåde til fremstilling af 25-desacetylderivater af rifamyciner. | |
| DK123868B (da) | Analogifremgangsmåde til fremstilling af 3-hydroxycumarin-derivater. | |
| DK124407B (da) | Fremgangsmåde til fremstilling af tioderivater af rifamycin SV. | |
| DK134115B (da) | Analogifremgangsmåde til fremstilling af cephalosporinforbindelser. | |
| DK120193B (da) | Fremgangsmåde til fremstilling af 3-amino-isoxazolderivater. | |
| DK118507B (da) | Fremgangsmåde til fremstilling af 3-dimethylsulfamoylphenthiazinderivater. | |
| DK124825B (da) | Analogifremgangsmåde til fremstilling af pyrazinderivater. | |
| DK123414B (da) | Analogifremgangsmåde til fremstilling af pteridiner. | |
| DK117961B (da) | Analogifremgangsmåde til fremstilling af guanidinderivater. | |
| DK129198B (da) | Analogifremgangsmåde til fremstilling af antibiotisk aktive derivater af rifamycin SV. | |
| DK125892B (da) | Analogifremgangsmåde til fremstilling af pteridiner. | |
| DK122761B (da) | Analogifremgangsmåde til fremstilling af arylsulfonylurinstofderivater. | |
| DK118132B (da) | Fremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoler. | |
| DK114270B (da) | Fremgangsmåde til fremstilling af benzazolderivater. | |
| DK117627B (da) | Fremgangsmåde til fremstilling af rifamycin SV. | |
| DK119980B (da) | Fremgangsmåde til fremstilling af 2-alkoxy-4-sulfanilamido-quinazolinderivater. | |
| DK120239B (da) | Fremgangsmåde til fremstilling af piperazin-fenylætanolderivater. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |