DK124035B - Fremgangsmåde til fremstilling af α-carboxybenzylpencillin eller salte deraf. - Google Patents
Fremgangsmåde til fremstilling af α-carboxybenzylpencillin eller salte deraf.Info
- Publication number
- DK124035B DK124035B DK545369AA DK545369A DK124035B DK 124035 B DK124035 B DK 124035B DK 545369A A DK545369A A DK 545369AA DK 545369 A DK545369 A DK 545369A DK 124035 B DK124035 B DK 124035B
- Authority
- DK
- Denmark
- Prior art keywords
- carboxybenzylpencillin
- salts
- preparation
- Prior art date
Links
- FPPNZSSZRUTDAP-UWFZAAFLSA-N carbenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)C(C(O)=O)C1=CC=CC=C1 FPPNZSSZRUTDAP-UWFZAAFLSA-N 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/84—Unsaturated compounds containing keto groups containing six membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5020468 | 1968-10-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK124035B true DK124035B (da) | 1972-09-04 |
Family
ID=10455063
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK545369AA DK124035B (da) | 1968-10-23 | 1969-10-14 | Fremgangsmåde til fremstilling af α-carboxybenzylpencillin eller salte deraf. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3641001A (enExample) |
| AT (1) | AT289297B (enExample) |
| BE (1) | BE740647A (enExample) |
| CH (1) | CH539652A (enExample) |
| DE (1) | DE1952021A1 (enExample) |
| DK (1) | DK124035B (enExample) |
| ES (1) | ES372627A1 (enExample) |
| FR (1) | FR2021368A1 (enExample) |
| GB (1) | GB1234426A (enExample) |
| NL (1) | NL6915421A (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU163235B (enExample) * | 1970-08-18 | 1973-07-28 | ||
| GB1377661A (en) * | 1971-06-05 | 1974-12-18 | Yamanouchi Pharma Co Ltd | Oxofuryl ester derivatives of penicillin and cephalosporin |
| GB1364672A (en) * | 1971-06-09 | 1974-08-29 | Beecham Group Ltd | Penicillins |
-
1968
- 1968-10-23 GB GB5020468A patent/GB1234426A/en not_active Expired
-
1969
- 1969-10-09 US US865182A patent/US3641001A/en not_active Expired - Lifetime
- 1969-10-10 NL NL6915421A patent/NL6915421A/xx unknown
- 1969-10-14 DK DK545369AA patent/DK124035B/da unknown
- 1969-10-15 DE DE19691952021 patent/DE1952021A1/de active Pending
- 1969-10-17 ES ES372627A patent/ES372627A1/es not_active Expired
- 1969-10-21 AT AT991269A patent/AT289297B/de not_active IP Right Cessation
- 1969-10-22 BE BE740647D patent/BE740647A/xx unknown
- 1969-10-22 CH CH1577969A patent/CH539652A/de not_active IP Right Cessation
- 1969-10-22 FR FR6936170A patent/FR2021368A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| ES372627A1 (es) | 1971-11-01 |
| CH539652A (de) | 1973-07-31 |
| AT289297B (de) | 1971-04-13 |
| US3641001A (en) | 1972-02-08 |
| DE1952021A1 (de) | 1970-05-14 |
| GB1234426A (enExample) | 1971-06-03 |
| NL6915421A (enExample) | 1970-04-27 |
| BE740647A (enExample) | 1970-04-22 |
| FR2021368A1 (enExample) | 1970-07-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK137988B (da) | Analogifremgangsmåde til fremstilling af isothiocyano-benzazoler eller salte deraf. | |
| DK128005B (da) | Analogifremgangsmåde til fremstilling af bis-chromoner eller salte, amider eller estere deraf. | |
| DK126788B (da) | Analogifremgangsmåde til fremstilling af γ-morpholino-p-amino-butyrophenoner eller salte deraf. | |
| DK129650B (da) | Analogifremgangsmåde til fremstilling af 1-phenoxy-2-hydroxy-3-amino-propaner eller salte deraf. | |
| DK118457B (da) | Analogifremgangsmåde til fremstilling af bis-guanylhydrazoner af diphenylurinstoffer eller salte deraf. | |
| DK118666B (da) | Fremgangsmåde til fremstilling af 3-amino-4-carboxamidopyrazol eller salte deraf. | |
| DK137758B (da) | Analogifremgangsmåde til fremstilling af 2-(5-nitro-2-imidazolyl)-benzimidazoler eller salte deraf. | |
| DK113439B (da) | Fremgangsmåde til fremstilling af 1-isopropylamino-2-hydroxy-3-(o-alkoxymethyl-phenoxy)-propaner eller salte deraf. | |
| DK124827B (da) | Analogifremgangsmåde til fremstilling af carboxyacylaminopenicilliner eller salte deraf. | |
| DK107095C (da) | Fremgangsmåde til fremstilling af azcycloalkanderivater eller salte deraf. | |
| DK124035B (da) | Fremgangsmåde til fremstilling af α-carboxybenzylpencillin eller salte deraf. | |
| DK123716B (da) | Analogifremgangsmåde til fremstilling af 1-cyloalkylmethyl-3-alkyl-3-(m-oxyphenyl)-pyrrolidinforbindelser eller salte deraf. | |
| DK123242B (da) | Analogifremgangsmåde til fremstilling af 3-(5-nitro-2-imidazolylmetylenamino)-2-oksazolidinoner eller salte deraf. | |
| DK131862B (da) | Analogifremgangsmåde til fremstilling af penicilliner eller salte deraf. | |
| DK124545B (da) | Analogifremgangsmåde til fremstilling af bisimidazolyl-bisphenylmethaner eller salte deraf. | |
| DK120029B (da) | Analogifremgangsmåde til fremstilling af substituerede 3-aminoacylaminothiophener eller salte deraf. | |
| DK112528B (da) | Fremgangsmåde til fremstilling af tropanyl-2-phenylacrylatderivater eller salte deraf. | |
| DK116874B (da) | Fremgangsmåde til fremstilling af α-aminopenicilliner eller salte deraf. | |
| DK128650B (da) | Analogifremgangsmåde til fremstilling af N-propionyl-ε-aminocapronsyre eller salte heraf. | |
| DK123599B (da) | Fremgangsmåde til fremstilling af (-)-norscopolamin eller salte deraf. | |
| DK109600C (da) | Fremgangsmåde til fremstilling af 4-p-aminobenzensulfonylamidopyrimidiner eller salte deraf. | |
| DK117419B (da) | Analogifremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. | |
| DK137010B (da) | Fremgangsmåde til fremstilling af 3-amino-4-carbamoyl-pyrazoler eller salte heraf. | |
| DK123982B (da) | Analogifremgangsmåde til fremstilling af thienyloxymethylpenicilliner eller salte deraf. | |
| DK134910B (da) | Analogifremgangsmåde til fremstilling af 7-trifluormethylquinoloner eller salte deraf. |