DK122610B - Analogifremgangsmåde til fremstilling af 2-amino-3-amidino-quinoxalin-di-N-oxider eller syreadditionssalte deraf. - Google Patents
Analogifremgangsmåde til fremstilling af 2-amino-3-amidino-quinoxalin-di-N-oxider eller syreadditionssalte deraf.Info
- Publication number
- DK122610B DK122610B DK399268AA DK399268A DK122610B DK 122610 B DK122610 B DK 122610B DK 399268A A DK399268A A DK 399268AA DK 399268 A DK399268 A DK 399268A DK 122610 B DK122610 B DK 122610B
- Authority
- DK
- Denmark
- Prior art keywords
- amidino
- quinoxaline
- oxides
- amino
- preparation
- Prior art date
Links
- HJENIULGCJDZJE-UHFFFAOYSA-N 3-aminoquinoxaline-2-carboximidamide Chemical compound NC1=NC2=CC=CC=C2N=C1C(N)=N HJENIULGCJDZJE-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/50—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to ring nitrogen atoms
- C07D241/52—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1670909A DE1670909B2 (de) | 1967-08-17 | 1967-08-17 | 2-Amino-3-amidino-chinoxalin-di-Noxide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK122610B true DK122610B (da) | 1972-03-20 |
Family
ID=7106142
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK399268AA DK122610B (da) | 1967-08-17 | 1968-08-16 | Analogifremgangsmåde til fremstilling af 2-amino-3-amidino-quinoxalin-di-N-oxider eller syreadditionssalte deraf. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3639397A (enExample) |
| AT (1) | AT278804B (enExample) |
| BE (1) | BE719565A (enExample) |
| CH (1) | CH512498A (enExample) |
| DE (1) | DE1670909B2 (enExample) |
| DK (1) | DK122610B (enExample) |
| ES (1) | ES357347A1 (enExample) |
| FI (1) | FI52080C (enExample) |
| FR (1) | FR1601119A (enExample) |
| GB (1) | GB1170387A (enExample) |
| IL (1) | IL30441A (enExample) |
| NL (1) | NL6811717A (enExample) |
| NO (1) | NO122015B (enExample) |
| SE (1) | SE344328B (enExample) |
| YU (2) | YU32932B (enExample) |
-
1963
- 1963-08-14 YU YU1931/68A patent/YU32932B/xx unknown
-
1967
- 1967-08-17 DE DE1670909A patent/DE1670909B2/de not_active Withdrawn
-
1968
- 1968-07-24 CH CH1107168A patent/CH512498A/de not_active IP Right Cessation
- 1968-07-26 IL IL30441A patent/IL30441A/en unknown
- 1968-07-29 US US748153A patent/US3639397A/en not_active Expired - Lifetime
- 1968-08-14 YU YU01931/68A patent/YU193168A/xx unknown
- 1968-08-14 SE SE10950/68A patent/SE344328B/xx unknown
- 1968-08-15 NO NO3213/68A patent/NO122015B/no unknown
- 1968-08-16 DK DK399268AA patent/DK122610B/da unknown
- 1968-08-16 NL NL6811717A patent/NL6811717A/xx not_active Application Discontinuation
- 1968-08-16 FI FI682325A patent/FI52080C/fi active
- 1968-08-16 BE BE719565D patent/BE719565A/xx unknown
- 1968-08-16 FR FR1601119D patent/FR1601119A/fr not_active Expired
- 1968-08-16 AT AT803468A patent/AT278804B/de not_active IP Right Cessation
- 1968-08-16 GB GB39261/68A patent/GB1170387A/en not_active Expired
- 1968-08-17 ES ES357347A patent/ES357347A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FI52080C (fi) | 1977-06-10 |
| YU193168A (en) | 1975-06-30 |
| NL6811717A (enExample) | 1969-02-19 |
| GB1170387A (en) | 1969-11-12 |
| BE719565A (enExample) | 1969-02-17 |
| AT278804B (de) | 1970-02-10 |
| IL30441A (en) | 1972-08-30 |
| IL30441A0 (en) | 1968-09-26 |
| NO122015B (enExample) | 1971-05-10 |
| SE344328B (enExample) | 1972-04-10 |
| FI52080B (enExample) | 1977-02-28 |
| DE1670909B2 (de) | 1978-06-01 |
| YU32932B (en) | 1975-12-31 |
| CH512498A (de) | 1971-09-15 |
| FR1601119A (enExample) | 1970-08-10 |
| DE1670909A1 (de) | 1971-03-18 |
| ES357347A1 (es) | 1970-03-16 |
| US3639397A (en) | 1972-02-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK125417B (da) | Analogifremgangsmåde til fremstilling af amino-dihalogenphenylethylaminer eller syreadditionssalte deraf. | |
| DK124884B (da) | Analogifremgangsmåde til fremstilling af 2-brom-α-ergokryptin eller syreadditionssalte deraf. | |
| DK120750B (da) | Analogifremgangsmåde til fremstilling af azaspiroalkandion-forbindelser eller syreadditionssalte deraf. | |
| DK124942B (da) | Analogifremgangsmåde til fremstilling af alkanolaminderivater eller syreadditionssalte deraf. | |
| DK115473B (da) | Fremgangsmåde til fremstilling af 2,3,4,5-tetrahydro-1H-3-benzazepiner eller syreadditionssalte deraf. | |
| DK123022B (da) | Analogifremgangsmåde til fremstilling af amino-monohalogen-phenylethanolaminer eller syreadditionssalte deraf. | |
| DK120389B (da) | Fremgangsmåde til fremstilling af 2-cycloalkylaminooxazoliner eller syreadditionssalte deraf. | |
| DK132411B (da) | Analogifremgangsmåde til fremstilling af pyrrylaminoketonderivater eller syreadditionssalte deraf. | |
| DK118607B (da) | Analogifremgangsmåde til fremstilling af 2-phenylhydrazino-imidazolin-2-forbindelser eller syreadditionssalte deraf. | |
| DK129238B (da) | Fremgangsmåde til fremstilling af morphinanderivater eller syreadditionssalte deraf. | |
| DK117427B (da) | Fremgangsmåde til fremstilling af phenoxypropanolaminer eller syreadditionssalte deraf. | |
| DK127644B (da) | Analogifremgangsmåde til fremstilling af ergopeptiner eller syreadditionssalte deraf. | |
| DK115849B (da) | Fremgangsmåde til fremstilling af substituerede 2-anilinomethyl-imidazoliner eller syreaddtitionssalte heraf. | |
| DK120155B (da) | Analogifremgangsmåde til fremstilling af aminopropiofenoner eller syreadditionssalte deraf. | |
| DK116662B (da) | Fremgangsmåde til fremstilling af pyrazinamider eller syreadditionssalte deraf. | |
| DK127331B (da) | Analogifremgangsmåde til fremstilling af aryloxyisoalkyl-Δ<2>-imidazoliner eller syreadditionssalte heraf. | |
| DK130587B (da) | Analogifremgangsmåde til fremstilling af difenylpyridazoner eller syreadditionssalt deraf. | |
| DK137674B (da) | Analogifremgangsmåde til fremstilling af monophenylsubstituerede oxazoler eller syreadditionssalte deraf. | |
| DK125129B (da) | Analogifremgangsmåde til fremstilling af oximderivater eller syreadditionssalte deraf. | |
| DK115840B (da) | Fremgangsmåde til fremstilling af phenylcyclohexylalkylaminer eller syreadditionssalte deraf. | |
| DK126781B (da) | Analogifremgangsmåde til fremstilling af pyrrolidinoguanidinforbindelser eller syreadditionssalte deraf. | |
| DK140591B (da) | Analogifremgangsmåde til fremstilling af cyclopeptider eller syreadditionssalte deraf. | |
| DK128813B (da) | Analogifremgangsmåde til fremstilling af basisk substituerede thiophthalaner eller syreadditionssalte deraf. | |
| DK115776B (da) | Analogifremgangsmåde til fremstilling af 2-(thrichlorbenzyl)-2-imidazoliner eller syreadditionssalte deraf. | |
| DK121555B (da) | Analogifremgangsmåde til fremstilling af 5-nitro-furfural-piperazinalkanoylhydrazoner eller syreadditionssalte deraf. |