DK120491B - Analogifremgangsmåde til fremstilling af 4-butyl- eller 4-(3-oxobutyl)-1,2-diphenyl-3-(3,4,5-trimethoxybenzoyloxy)-pyrazolin-5-on. - Google Patents
Analogifremgangsmåde til fremstilling af 4-butyl- eller 4-(3-oxobutyl)-1,2-diphenyl-3-(3,4,5-trimethoxybenzoyloxy)-pyrazolin-5-on.Info
- Publication number
- DK120491B DK120491B DK252268AA DK252268A DK120491B DK 120491 B DK120491 B DK 120491B DK 252268A A DK252268A A DK 252268AA DK 252268 A DK252268 A DK 252268A DK 120491 B DK120491 B DK 120491B
- Authority
- DK
- Denmark
- Prior art keywords
- trimethoxybenzoyloxy
- pyrazolin
- oxobutyl
- diphenyl
- butyl
- Prior art date
Links
- NPACHMXGQKWFIO-UHFFFAOYSA-N [5-oxo-4-(3-oxobutyl)-1,2-diphenylpyrazol-3-yl] 3,4,5-trimethoxybenzoate Chemical compound COC1=C(OC)C(OC)=CC(C(=O)OC=2N(N(C=3C=CC=CC=3)C(=O)C=2CCC(C)=O)C=2C=CC=CC=2)=C1 NPACHMXGQKWFIO-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/28—Two oxygen or sulfur atoms
- C07D231/30—Two oxygen or sulfur atoms attached in positions 3 and 5
- C07D231/32—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR109213A FR6505M (enExample) | 1967-06-06 | 1967-06-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK120491B true DK120491B (da) | 1971-06-07 |
Family
ID=8632382
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK252268AA DK120491B (da) | 1967-06-06 | 1968-05-30 | Analogifremgangsmåde til fremstilling af 4-butyl- eller 4-(3-oxobutyl)-1,2-diphenyl-3-(3,4,5-trimethoxybenzoyloxy)-pyrazolin-5-on. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3607881A (enExample) |
| BE (1) | BE716160A (enExample) |
| CH (1) | CH476734A (enExample) |
| DE (1) | DE1767702A1 (enExample) |
| DK (1) | DK120491B (enExample) |
| ES (1) | ES353634A1 (enExample) |
| FR (1) | FR6505M (enExample) |
| GB (1) | GB1223875A (enExample) |
| SE (1) | SE361885B (enExample) |
| SU (1) | SU489325A3 (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4117232A (en) * | 1976-03-08 | 1978-09-26 | Interx Research Corporation | Transient pro-drug forms of phenylbutazone |
| GB1589816A (en) * | 1977-06-02 | 1981-05-20 | Sterwin Ag | Pharmacologically active esters of alkyl-dioxo-pyrazotidine derivatives |
| US5098477A (en) * | 1988-12-14 | 1992-03-24 | Ciba-Geigy Corporation | Inks, particularly for ink printing |
-
1967
- 1967-06-06 FR FR109213A patent/FR6505M/fr not_active Expired
-
1968
- 1968-04-27 ES ES353634A patent/ES353634A1/es not_active Expired
- 1968-05-02 GB GB20890/68A patent/GB1223875A/en not_active Expired
- 1968-05-05 US US734528A patent/US3607881A/en not_active Expired - Lifetime
- 1968-05-30 DK DK252268AA patent/DK120491B/da unknown
- 1968-05-31 CH CH806768A patent/CH476734A/fr not_active IP Right Cessation
- 1968-06-06 BE BE716160D patent/BE716160A/xx not_active IP Right Cessation
- 1968-06-06 DE DE19681767702 patent/DE1767702A1/de not_active Withdrawn
- 1968-06-06 SE SE07571/68A patent/SE361885B/xx unknown
- 1968-06-06 SU SU1257954A patent/SU489325A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| GB1223875A (en) | 1971-03-03 |
| SE361885B (enExample) | 1973-11-19 |
| SU489325A3 (ru) | 1975-10-25 |
| DE1767702A1 (de) | 1970-01-02 |
| FR6505M (enExample) | 1968-12-02 |
| US3607881A (en) | 1971-09-21 |
| CH476734A (fr) | 1969-08-15 |
| BE716160A (enExample) | 1968-11-04 |
| ES353634A1 (es) | 1969-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK122885B (da) | Analogifremgangsmåde til fremstilling af 1,4-dihydropyridinderivater. | |
| DK124826B (da) | Analogifremgangsmåde til fremstilling af 1,2,4-oxadiazolforbindelser. | |
| DK120698B (da) | Analogifremgangsmåde til fremstilling af acetylguanidiner. | |
| DK118820B (da) | Analogifremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoliner. | |
| DK115773B (da) | Fremgangsmåde til fremstilling af derivater af 2-(2-halogenanilino)-1,3-diazacyclopenten-(2). | |
| DK129234B (da) | Fremgangsmåde til fremstilling af levo-1-n-butyl-2',6'-pipecoloxylidid. | |
| DK123868B (da) | Analogifremgangsmåde til fremstilling af 3-hydroxycumarin-derivater. | |
| DK118507B (da) | Fremgangsmåde til fremstilling af 3-dimethylsulfamoylphenthiazinderivater. | |
| DK119166B (da) | Fremgangsmåde til fremstilling af 1,4-bezodiazepinderivater. | |
| DK120491B (da) | Analogifremgangsmåde til fremstilling af 4-butyl- eller 4-(3-oxobutyl)-1,2-diphenyl-3-(3,4,5-trimethoxybenzoyloxy)-pyrazolin-5-on. | |
| DK119559B (da) | Analogifremgangsmåde til fremstilling af 4-pyrimidyl-1,4-dihydropyridinderivater. | |
| DK126936B (da) | Fremgangsmåde til fremstilling af 3-oxo-13β-alkylgona-4,9,11-triener. | |
| DK118291B (da) | Analogifremgangsmåde til fremstilling af 10α-alkoxy-9,10-dihydroergolinderivater. | |
| DK119976B (da) | Analogifremgangsmåde til fremstilling af 18-methyl-19-nor-17α-hydroxyprogesteroner og -17-estere deraf. | |
| DK123476B (da) | Fremgangsmåde til fremstilling af 3-oxo-A-nor-B-homo-estra-5(10)-ener. | |
| DK135310B (da) | Analogifremgangsmåde til fremstilling af 1-(2-ethinylphenoxy)-2-hydroxy-3-butylaminopropaner. | |
| DK129842B (da) | Fremgangsmåde til fremstilling af 3-imino-1,2-benzisothiazoliner. | |
| DK117568B (da) | Analogifremgangsmåde til fremstilling af ftalazino-ftalazindioner. | |
| DK122666B (da) | Analogifremgangsmåde til fremstilling af hydrocortison-17-cyclopentancorboxylat. | |
| DK122175B (da) | Analogifremgangsmåde til fremstilling af 3-oxo-13β-alkyl-17α-allyl-17β-hydroxygona-4,9,11-triener. | |
| DK112319B (da) | Fremgangsmåde til fremstilling af 7-nitrosubstituerede 1,4-benzodiazepinoner. | |
| DK125136B (da) | Analogifremgangsmåde til fremstilling af 1,3-benzoxazinderivater. | |
| DK116941B (da) | Fremgangsmåde til fremstilling af 6-klor-Δ<4,6>-pregnadiener. | |
| DK116996B (da) | Fremgangsmåde til fremstilling af 14β-hydroxy-3-oxo-5β-card-20(22)-enolider. | |
| DK119012B (da) | Analogifremgangsmåde til fremstilling af thebainderivater. |