DK119562B - Analogifremgangsmåde til fremstilling af bis-(p-chlorphenoxy)-eddikesyreestere eller syreadditionssalte eller kvaternære ammoniumforbindelser heraf. - Google Patents
Analogifremgangsmåde til fremstilling af bis-(p-chlorphenoxy)-eddikesyreestere eller syreadditionssalte eller kvaternære ammoniumforbindelser heraf.Info
- Publication number
- DK119562B DK119562B DK245867AA DK245867A DK119562B DK 119562 B DK119562 B DK 119562B DK 245867A A DK245867A A DK 245867AA DK 245867 A DK245867 A DK 245867A DK 119562 B DK119562 B DK 119562B
- Authority
- DK
- Denmark
- Prior art keywords
- chlorophenoxy
- bis
- preparation
- quaternary ammonium
- addition salts
- Prior art date
Links
- ZKNSZZXBPSICFK-UHFFFAOYSA-N 2,2-bis(4-chlorophenoxy)acetic acid Chemical class C=1C=C(Cl)C=CC=1OC(C(=O)O)OC1=CC=C(Cl)C=C1 ZKNSZZXBPSICFK-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/12—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/46—Oxygen atoms attached in position 4 having a hydrogen atom as the second substituent in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/02—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Hydrogenated Pyridines (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US54947566A | 1966-05-12 | 1966-05-12 | |
| US56875966A | 1966-07-29 | 1966-07-29 | |
| US59897066A | 1966-12-05 | 1966-12-05 | |
| US61532167A | 1967-02-13 | 1967-02-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK119562B true DK119562B (da) | 1971-01-25 |
Family
ID=27504740
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK245867AA DK119562B (da) | 1966-05-12 | 1967-05-10 | Analogifremgangsmåde til fremstilling af bis-(p-chlorphenoxy)-eddikesyreestere eller syreadditionssalte eller kvaternære ammoniumforbindelser heraf. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3534051A (fa) |
| AT (3) | AT294057B (fa) |
| BE (1) | BE698303A (fa) |
| CH (1) | CH482644A (fa) |
| CY (1) | CY687A (fa) |
| DE (1) | DE1695723A1 (fa) |
| DK (1) | DK119562B (fa) |
| ES (2) | ES340334A1 (fa) |
| FI (1) | FI46499C (fa) |
| FR (1) | FR7147M (fa) |
| GB (2) | GB1188109A (fa) |
| MY (1) | MY7300317A (fa) |
| NL (4) | NL142401B (fa) |
| SE (1) | SE334882B (fa) |
-
1967
- 1967-02-13 US US615321A patent/US3534051A/en not_active Expired - Lifetime
- 1967-04-20 CH CH567767A patent/CH482644A/de not_active IP Right Cessation
- 1967-04-24 GB GB49342/69A patent/GB1188109A/en not_active Expired
- 1967-04-24 GB GB08833/67A patent/GB1187501A/en not_active Expired
- 1967-05-05 NL NL676706300A patent/NL142401B/xx unknown
- 1967-05-10 ES ES340334A patent/ES340334A1/es not_active Expired
- 1967-05-10 AT AT960368A patent/AT294057B/de not_active IP Right Cessation
- 1967-05-10 AT AT960268A patent/AT294056B/de not_active IP Right Cessation
- 1967-05-10 DE DE19671695723 patent/DE1695723A1/de active Pending
- 1967-05-10 BE BE698303D patent/BE698303A/xx unknown
- 1967-05-10 FI FI671346A patent/FI46499C/fi active
- 1967-05-10 DK DK245867AA patent/DK119562B/da unknown
- 1967-05-10 AT AT437467A patent/AT289770B/de not_active IP Right Cessation
- 1967-05-11 SE SE06610/67A patent/SE334882B/xx unknown
- 1967-08-08 FR FR117186A patent/FR7147M/fr not_active Expired
- 1967-09-18 ES ES345156A patent/ES345156A1/es not_active Expired
-
1973
- 1973-06-04 CY CY68773A patent/CY687A/xx unknown
- 1973-12-31 MY MY1973317A patent/MY7300317A/xx unknown
-
1974
- 1974-04-17 NL NL7405178A patent/NL7405178A/xx unknown
- 1974-04-17 NL NL7405180A patent/NL7405180A/xx unknown
- 1974-04-17 NL NL7405179A patent/NL7405179A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL142401B (nl) | 1974-06-17 |
| CH482644A (de) | 1969-12-15 |
| CY687A (en) | 1973-06-04 |
| BE698303A (fa) | 1967-11-10 |
| NL7405180A (fa) | 1974-06-25 |
| ES340334A1 (es) | 1968-06-01 |
| SE334882B (fa) | 1971-05-10 |
| AT294056B (de) | 1971-11-10 |
| NL7405178A (fa) | 1974-06-25 |
| ES345156A1 (es) | 1969-01-16 |
| US3534051A (en) | 1970-10-13 |
| FI46499B (fi) | 1973-01-02 |
| GB1188109A (en) | 1970-04-15 |
| FI46499C (fi) | 1973-04-10 |
| NL6706300A (fa) | 1967-11-13 |
| FR7147M (fa) | 1969-08-04 |
| AT294057B (de) | 1971-11-10 |
| GB1187501A (en) | 1970-04-08 |
| MY7300317A (en) | 1973-12-31 |
| DE1695723A1 (de) | 1972-03-02 |
| NL7405179A (fa) | 1974-06-25 |
| AT289770B (de) | 1971-05-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK120750B (da) | Analogifremgangsmåde til fremstilling af azaspiroalkandion-forbindelser eller syreadditionssalte deraf. | |
| DK125417B (da) | Analogifremgangsmåde til fremstilling af amino-dihalogenphenylethylaminer eller syreadditionssalte deraf. | |
| DK134160B (da) | Fremgangsmåde til fremstilling af homopyrimidazolderivater eller syreadditionssalte eller kvaternære ammoniumsalte deraf. | |
| DK123022B (da) | Analogifremgangsmåde til fremstilling af amino-monohalogen-phenylethanolaminer eller syreadditionssalte deraf. | |
| DK106796C (da) | Fremgangsmåde til fremstilling af 3-hydroxy-5-aminomethyl-isoxazol eller syreadditionssalte deraf. | |
| DK121302B (da) | Fremgangsmåde til fremstilling af imidazolderivater eller syreadditionssalte deraf. | |
| DK120389B (da) | Fremgangsmåde til fremstilling af 2-cycloalkylaminooxazoliner eller syreadditionssalte deraf. | |
| DK120341B (da) | Analogifremgangsmåde til fremstilling af benzoxacinforbindelser eller syreadditionssalte eller kvaternære ammoniumforbindelser heraf. | |
| DK132411B (da) | Analogifremgangsmåde til fremstilling af pyrrylaminoketonderivater eller syreadditionssalte deraf. | |
| DK122670B (da) | Analogifremgangsmåde til fremstilling af kvarternære ammoniumsalte af ribonukleinsyre. | |
| DK118607B (da) | Analogifremgangsmåde til fremstilling af 2-phenylhydrazino-imidazolin-2-forbindelser eller syreadditionssalte deraf. | |
| DK126594B (da) | Analogifremgangsmåde til fremstilling af 3-morpholino-N<6>-cyclohexylcarbonylsydnonimin eller syreadditionssalte deraf. | |
| DK115849B (da) | Fremgangsmåde til fremstilling af substituerede 2-anilinomethyl-imidazoliner eller syreaddtitionssalte heraf. | |
| DK116662B (da) | Fremgangsmåde til fremstilling af pyrazinamider eller syreadditionssalte deraf. | |
| DK106335C (da) | Fremgangsmåde til fremstilling af derivater af 16-hydroxymethylenyohimbanforbindelser eller syreadditionssalte deraf. | |
| DK111324B (da) | Fremgangsmåde til fremstilling af piperidincarboxylsyreestere eller syreadditionssalte eller kvaternære ammoniumforbindelser deraf. | |
| DK107936C (da) | Fremgangsmåde til fremstilling af kvaternære ammoniumsalte af cyclopentyleddikesyreestere. | |
| DK124944B (da) | Analogifremgangsmåde til fremstilling af substituerede 2-arylalkyloxybenzamider eller syreadditionssalte eller kvaternære ammoniumsalter deraf. | |
| DK107166C (da) | Fremgangsmåde til fremstilling af basiske propiophenonderivater eller syreadditionssalte eller kvaternære ammoniumderivater deraf. | |
| DK137492B (da) | Analogifremgangsmåde til fremstilling af benz-cycloaliphatyloxy-4-hydroxy-3-quinolincarboxylsyreester eller O-estere eller salte deraf. | |
| DK130587B (da) | Analogifremgangsmåde til fremstilling af difenylpyridazoner eller syreadditionssalt deraf. | |
| DK119562B (da) | Analogifremgangsmåde til fremstilling af bis-(p-chlorphenoxy)-eddikesyreestere eller syreadditionssalte eller kvaternære ammoniumforbindelser heraf. | |
| DK126781B (da) | Analogifremgangsmåde til fremstilling af pyrrolidinoguanidinforbindelser eller syreadditionssalte deraf. | |
| DK129792B (da) | Analogifremgangsmåde til fremstilling af hydroxyisoquinuclidinestere eller syreadditionssalte eller kvaternære ammoniumsalte heraf. | |
| DK116213B (da) | Fremgangsmåde til fremstilling af dibenzocycloheptenylestre eller syreadditionssalte heraf. |