DK118558B - Analogifremgangsmåde til fremstilling af N-Pyridylformiminoætere. - Google Patents
Analogifremgangsmåde til fremstilling af N-Pyridylformiminoætere.Info
- Publication number
- DK118558B DK118558B DK158168AA DK158168A DK118558B DK 118558 B DK118558 B DK 118558B DK 158168A A DK158168A A DK 158168AA DK 158168 A DK158168 A DK 158168A DK 118558 B DK118558 B DK 118558B
- Authority
- DK
- Denmark
- Prior art keywords
- pyridylformimino
- ethers
- preparation
- analogous process
- analogous
- Prior art date
Links
- IVPRHPMWTDXJOD-UHFFFAOYSA-N pyridin-2-yliminomethyl N-pyridin-2-ylmethanimidate Chemical class N1=C(C=CC=C1)N=COC=NC1=NC=CC=C1 IVPRHPMWTDXJOD-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUEE001380 | 1967-04-12 | ||
| US3059170A | 1970-04-21 | 1970-04-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK118558B true DK118558B (da) | 1970-09-07 |
Family
ID=26318444
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK158168AA DK118558B (da) | 1967-04-12 | 1968-04-09 | Analogifremgangsmåde til fremstilling af N-Pyridylformiminoætere. |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3590037A (cs) |
| CS (1) | CS151467B2 (cs) |
| DE (1) | DE1770156C3 (cs) |
| DK (1) | DK118558B (cs) |
| FR (1) | FR1565762A (cs) |
| GB (1) | GB1192995A (cs) |
| NL (1) | NL6805020A (cs) |
| SE (1) | SE347742B (cs) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2658762A1 (de) * | 1976-12-24 | 1978-06-29 | Hoechst Ag | Neue o-alkylierte oxime, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| US4558132A (en) * | 1982-07-02 | 1985-12-10 | A. H. Robins Company, Incorporated | Nitro, amino and aroylamino-N-phenylpyridinamines in a process for preparing pyrido[1,4]benzodiazepines |
| MY100846A (en) * | 1986-05-02 | 1991-03-15 | Stauffer Chemical Co | Fungicidal pyridyl imidates |
| US5070097A (en) * | 1987-11-17 | 1991-12-03 | Ici Americas Inc. | Quinolyl and isoquinolyl insecticidal compounds |
| US4994473A (en) * | 1987-11-17 | 1991-02-19 | Ici Americas Inc. | Pyridyl containing insecticides |
-
1968
- 1968-03-28 GB GB05049/68A patent/GB1192995A/en not_active Expired
- 1968-04-08 DE DE1770156A patent/DE1770156C3/de not_active Expired
- 1968-04-08 FR FR1565762D patent/FR1565762A/fr not_active Expired
- 1968-04-09 DK DK158168AA patent/DK118558B/da unknown
- 1968-04-09 NL NL6805020A patent/NL6805020A/xx unknown
- 1968-04-10 SE SE04914/68A patent/SE347742B/xx unknown
- 1968-04-11 CS CS2699A patent/CS151467B2/cs unknown
-
1970
- 1970-04-21 US US30591A patent/US3590037A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US3590037A (en) | 1971-06-29 |
| DE1770156B2 (de) | 1977-12-08 |
| CS151467B2 (cs) | 1973-10-19 |
| NL6805020A (cs) | 1968-10-14 |
| SE347742B (cs) | 1972-08-14 |
| DE1770156A1 (de) | 1971-09-23 |
| DE1770156C3 (de) | 1978-08-10 |
| FR1565762A (cs) | 1969-05-02 |
| GB1192995A (en) | 1970-05-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK133618B (da) | Analogifremgangsmåde til fremstilling af 1-hydroxyaryl-2-aminoalkanoler. | |
| DK137232B (da) | Analogifremgangsmåde til fremstilling af phenylethanolaminer. | |
| DK122222B (da) | Fremgangsmåde til fremstilling af alk-3-en-1-oler. | |
| DK120698B (da) | Analogifremgangsmåde til fremstilling af acetylguanidiner. | |
| DK133783B (da) | Fremgangsmåde til fremstilling af 7-halogen-7-desoxy-1-thio-alfa-D-galacto-octopyranosider. | |
| DK124080B (da) | Fremgangsmåde til fremstilling af D-6-metyl-8-cyanmetylergolin. | |
| DK118820B (da) | Analogifremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoliner. | |
| DK119307B (da) | Fremgangsmåde til fremstilling af ketonitriler. | |
| DK118883B (da) | Fremgangsmåde til fremstilling af alkylarylethere. | |
| DK123868B (da) | Analogifremgangsmåde til fremstilling af 3-hydroxycumarin-derivater. | |
| DK122758B (da) | Fremgangsmåde til fremstilling af α-methyl-multicyclo-methylaminer. | |
| DK122522B (da) | Fremgangsmåde til fremstilling af dichlorquinoliner. | |
| DK123100B (da) | Fremgangsmåde til fremstilling af N-tritylimidazoler. | |
| DK119663B (da) | Analogifremgangsmåde til fremstilling af 2-benzolsulfonamidopyrimidinforbindelser. | |
| DK118558B (da) | Analogifremgangsmåde til fremstilling af N-Pyridylformiminoætere. | |
| DK118507B (da) | Fremgangsmåde til fremstilling af 3-dimethylsulfamoylphenthiazinderivater. | |
| DK119976B (da) | Analogifremgangsmåde til fremstilling af 18-methyl-19-nor-17α-hydroxyprogesteroner og -17-estere deraf. | |
| DK117568B (da) | Analogifremgangsmåde til fremstilling af ftalazino-ftalazindioner. | |
| DK122666B (da) | Analogifremgangsmåde til fremstilling af hydrocortison-17-cyclopentancorboxylat. | |
| DK120948B (da) | Fremgangsmåde til fremstilling af (androst-17β-yl)-α-pyroner. | |
| DK119830B (da) | Analogifremgangsmåde til fremstilling af arylsulfonylsemicarbazider. | |
| DK126378B (da) | Analogifremgangsmåde til fremstilling af 17α-acyloxy-9α-chlor-11β-hydroxy-progesteroner. | |
| DK120994B (da) | Analogifremgangsmåde til fremstilling af N,N-dimethylaminoætyl-14β-hydroksy-5β-pregn-20-en-21-karboksylater. | |
| DK129842B (da) | Fremgangsmåde til fremstilling af 3-imino-1,2-benzisothiazoliner. | |
| DK125396B (da) | Analogifremgangsmåde til fremstilling af 5-nitro-2-furfurylidenamino-oxazolidinoner. |