DK118509B - Fremgangsmåde til fremstilling af 1,1-diphenyl-1-metoxy-3-benzylaminopropan eller salte heraf. - Google Patents
Fremgangsmåde til fremstilling af 1,1-diphenyl-1-metoxy-3-benzylaminopropan eller salte heraf.Info
- Publication number
- DK118509B DK118509B DK119966AA DK119966A DK118509B DK 118509 B DK118509 B DK 118509B DK 119966A A DK119966A A DK 119966AA DK 119966 A DK119966 A DK 119966A DK 118509 B DK118509 B DK 118509B
- Authority
- DK
- Denmark
- Prior art keywords
- benzylaminopropane
- diphenyl
- methoxy
- salts
- preparation
- Prior art date
Links
- DAHOFCRMBFZKDA-UHFFFAOYSA-N n-benzyl-3-methoxy-3,3-diphenylpropan-1-amine Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(OC)CCNCC1=CC=CC=C1 DAHOFCRMBFZKDA-UHFFFAOYSA-N 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/08—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to an acyclic carbon atom
- C07C217/10—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to an acyclic carbon atom to an acyclic carbon atom of a hydrocarbon radical containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/08—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to an acyclic carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT270365A AT255401B (de) | 1965-03-25 | 1965-03-25 | Verfahren zur Herstellung von neuen basischen Äthern und deren Salzen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK118509B true DK118509B (da) | 1970-08-31 |
Family
ID=3538958
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK119966AA DK118509B (da) | 1965-03-25 | 1966-03-08 | Fremgangsmåde til fremstilling af 1,1-diphenyl-1-metoxy-3-benzylaminopropan eller salte heraf. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3384662A (OSRAM) |
| AT (1) | AT255401B (OSRAM) |
| BE (1) | BE678405A (OSRAM) |
| BR (1) | BR6678141D0 (OSRAM) |
| CH (1) | CH471073A (OSRAM) |
| DE (1) | DE1543730A1 (OSRAM) |
| DK (1) | DK118509B (OSRAM) |
| ES (1) | ES324194A1 (OSRAM) |
| FI (1) | FI44802C (OSRAM) |
| FR (1) | FR5424M (OSRAM) |
| GB (1) | GB1064929A (OSRAM) |
| NL (1) | NL138919B (OSRAM) |
| SE (1) | SE329175B (OSRAM) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3504031A (en) * | 1966-05-24 | 1970-03-31 | Mead Johnson & Co | 1-aminoalkyl-1-phenylindene process and intermediate therefor |
| US3960960A (en) * | 1972-09-11 | 1976-06-01 | Chemie Linz Aktiengesellschaft | 1,1-Diphenyl-1-lower alkoxy-amino-alkanes and the salts thereof |
| US4110441A (en) * | 1974-04-29 | 1978-08-29 | Chinoin Gyogyszer Es Vegyeszeti Termekek Gyara Rt. | Gamma-l-glutamyl cholamine phosphate |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3157656A (en) * | 1960-07-20 | 1964-11-17 | Olin Mathieson | Heterocyclic compounds |
-
1965
- 1965-03-25 AT AT270365A patent/AT255401B/de active
-
1966
- 1966-02-24 CH CH269766A patent/CH471073A/de not_active IP Right Cessation
- 1966-02-28 DE DE19661543730 patent/DE1543730A1/de not_active Withdrawn
- 1966-03-08 DK DK119966AA patent/DK118509B/da unknown
- 1966-03-08 FI FI660573A patent/FI44802C/fi active
- 1966-03-15 ES ES0324194A patent/ES324194A1/es not_active Expired
- 1966-03-17 GB GB11867/66A patent/GB1064929A/en not_active Expired
- 1966-03-22 US US536313A patent/US3384662A/en not_active Expired - Lifetime
- 1966-03-24 NL NL666603882A patent/NL138919B/xx unknown
- 1966-03-24 BR BR178141/66A patent/BR6678141D0/pt unknown
- 1966-03-24 SE SE03908/66A patent/SE329175B/xx unknown
- 1966-03-24 BE BE678405D patent/BE678405A/xx unknown
- 1966-03-24 FR FR54742A patent/FR5424M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE329175B (OSRAM) | 1970-10-05 |
| CH471073A (de) | 1969-04-15 |
| NL6603882A (OSRAM) | 1966-09-26 |
| GB1064929A (en) | 1967-04-12 |
| FI44802B (OSRAM) | 1971-09-30 |
| BR6678141D0 (pt) | 1973-05-17 |
| US3384662A (en) | 1968-05-21 |
| ES324194A1 (es) | 1967-02-01 |
| BE678405A (OSRAM) | 1966-09-26 |
| FR5424M (OSRAM) | 1967-10-02 |
| FI44802C (fi) | 1972-01-10 |
| DE1543730A1 (de) | 1970-05-21 |
| AT255401B (de) | 1967-07-10 |
| NL138919B (nl) | 1973-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK134113B (da) | Analogifremgangsmåde til fremstilling af 1,2,3,4-tetrahydro-7-halogen-eller 7-trifluormethyl-6-sulfamyl-4-quinazolinoner eller salte heraf. | |
| DK136608B (da) | Fremgangsmåde til fremstilling af 1,2,4-oxadiazolderivater eller salte deraf. | |
| DK109265C (da) | Fremgangsmåde til fremstilling af substituerede chlorbenzen-2,4-disulfonamider eller salte deraf. | |
| DK108574C (da) | Fremgangsmåde til fremstilling af derivater af 7-oxy-2-oxo-1,2-dihydrogenquinolin eller salte deraf. | |
| DK112951B (da) | Fremgangsmåde til fremstilling af i 10-stillingen basisk substituerede 10,11-dihydrobidenzo-(b,f)-thiepiner eller salte deraf. | |
| DK118457B (da) | Analogifremgangsmåde til fremstilling af bis-guanylhydrazoner af diphenylurinstoffer eller salte deraf. | |
| DK123032B (da) | Analogifremgangsmåde til fremstilling af 1-phenoxymethyl-3,4-dihydro- og -1,2,3,4-tetrahydro-isoquinolin-forbindelser eller salte deraf. | |
| DK113441B (da) | Fremgangsmåde til fremstilling af 1-isopropylamino-2-hydroxy-3-(o-alkoxymethyl-phenoxy)-propaner eller salte deraf. | |
| DK124827B (da) | Analogifremgangsmåde til fremstilling af carboxyacylaminopenicilliner eller salte deraf. | |
| DK107095C (da) | Fremgangsmåde til fremstilling af azcycloalkanderivater eller salte deraf. | |
| DK118559B (da) | Fremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. | |
| DK118509B (da) | Fremgangsmåde til fremstilling af 1,1-diphenyl-1-metoxy-3-benzylaminopropan eller salte heraf. | |
| DK115256B (da) | Fremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. | |
| DK112528B (da) | Fremgangsmåde til fremstilling af tropanyl-2-phenylacrylatderivater eller salte deraf. | |
| DK124035B (da) | Fremgangsmåde til fremstilling af α-carboxybenzylpencillin eller salte deraf. | |
| DK108919C (da) | Fremgangsmåde til fremstilling af 1,2-diaryl-4-alkyl-3,5-dioxo-pyrazolidiner eller salte deraf. | |
| DK117419B (da) | Analogifremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. | |
| DK117146B (da) | Fremgangsmåde til fremstilling af 5- eller 3-sulfanilamido-4-methoxy-isoxazoler eller salte deraf. | |
| DK109600C (da) | Fremgangsmåde til fremstilling af 4-p-aminobenzensulfonylamidopyrimidiner eller salte deraf. | |
| DK118554B (da) | Analogifremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. | |
| DK117633B (da) | Analogifremgangsmåde til fremstilling af antidepressivt virksomme 4-pyridylbicyklo-[2,2,2]-oktan-1-aminer eller salte deraf. | |
| DK123982B (da) | Analogifremgangsmåde til fremstilling af thienyloxymethylpenicilliner eller salte deraf. | |
| DK126591B (da) | Analogifremgangsmåde til fremstilling af 1-aralkyl-3-aryl-3-propylpyrrolidinforbindelser eller salte heraf. | |
| DK113652B (da) | Fremgangsmåde til fremstilling af naphthoxypropanolderivater eller salte deraf. | |
| DK115707B (da) | Fremgangsmåde til fremstilling af 1,1-diphenyl-1-methoxy-3-benzylaminopropan eller salte heraf. |