DK117956B - Fremgangsmåde til fremstilling af 3-oxogona-4,9-diener. - Google Patents
Fremgangsmåde til fremstilling af 3-oxogona-4,9-diener.Info
- Publication number
- DK117956B DK117956B DK536866AA DK536866A DK117956B DK 117956 B DK117956 B DK 117956B DK 536866A A DK536866A A DK 536866AA DK 536866 A DK536866 A DK 536866A DK 117956 B DK117956 B DK 117956B
- Authority
- DK
- Denmark
- Prior art keywords
- oxogona
- dienes
- preparation
- Prior art date
Links
- CJRNSAVENUDGNX-PEYYIBSZSA-N (8s,13s,14r)-1,2,6,7,8,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one Chemical class C1C[C@@H]2CCC[C@H]2[C@@H]2CCC3=CC(=O)CCC3=C21 CJRNSAVENUDGNX-PEYYIBSZSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07J—STEROIDS
- C07J41/00—Normal steroids containing one or more nitrogen atoms not belonging to a hetero ring
- C07J41/0005—Normal steroids containing one or more nitrogen atoms not belonging to a hetero ring the nitrogen atom being directly linked to the cyclopenta(a)hydro phenanthrene skeleton
- C07J41/0027—Azides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Steroid Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR35958A FR1519520A (fr) | 1965-10-22 | 1965-10-22 | Procédé de préparation de dérivés stéroïdes nouveaux et produits ainsi obtenus |
| FR51506A FR5248M (enExample) | 1965-10-22 | 1966-03-01 | |
| FR58177 | 1966-04-19 | ||
| FR58340 | 1966-04-20 | ||
| FR63697A FR1504500A (fr) | 1965-10-22 | 1966-06-01 | Nouveaux dérivés stéroïdes substitués en position 11 et procédé de préparation |
| FR69128 | 1966-07-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK117956B true DK117956B (da) | 1970-06-22 |
Family
ID=27546026
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK536866AA DK117956B (da) | 1965-10-22 | 1966-10-18 | Fremgangsmåde til fremstilling af 3-oxogona-4,9-diener. |
Country Status (12)
| Country | Link |
|---|---|
| US (2) | US3472884A (enExample) |
| BE (1) | BE688085A (enExample) |
| BR (1) | BR6683910D0 (enExample) |
| CH (2) | CH473107A (enExample) |
| DK (1) | DK117956B (enExample) |
| ES (3) | ES336670A2 (enExample) |
| FR (6) | FR1519520A (enExample) |
| GB (3) | GB1128789A (enExample) |
| IL (3) | IL36947A (enExample) |
| NL (3) | NL139964B (enExample) |
| SE (1) | SE315890B (enExample) |
| YU (1) | YU33801B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3919267A (en) * | 1970-03-03 | 1975-11-11 | Roussel Uclaf | 13{62 -ethyl-17{60 -methyl-18,19-dinor-{66 {hu 4,9{b -pregnadiene-3,20-dione |
| GB8513723D0 (en) * | 1985-05-31 | 1985-07-03 | Erba Farmitalia | 11-beta substituted steroids |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3062846A (en) * | 1961-04-28 | 1962-11-06 | Olin Mathieson | (lower alkoxy) methyl ether derivatives of steroids and process therefor |
| US3444297A (en) * | 1961-07-06 | 1969-05-13 | Roussel Uclaf | 13beta-n-propyl-17alpha-ethynyl-delta**4,9-gonadien-17beta-ol-3- one,its preparation and use |
| BE649223A (enExample) * | 1963-07-10 | |||
| US3211764A (en) * | 1963-09-25 | 1965-10-12 | American Cyanamid Co | 19-norandrostadienes and method of preparing the same |
| NL127071C (enExample) * | 1964-12-31 | |||
| CH488682A (de) * | 1965-07-30 | 1970-04-15 | Ciba Geigy | Verfahren zur Herstellung von 4,9,11-Trienen der 19-Nor-androstanreihe |
-
0
- FR FR192D patent/FR192F/fr active Active
- FR FR205D patent/FR205F/fr active Active
- FR FR190D patent/FR190F/fr active Active
-
1965
- 1965-10-22 FR FR35958A patent/FR1519520A/fr not_active Expired
-
1966
- 1966-03-01 FR FR51506A patent/FR5248M/fr not_active Expired
- 1966-06-01 FR FR63697A patent/FR1504500A/fr not_active Expired
- 1966-10-11 BE BE688085D patent/BE688085A/xx unknown
- 1966-10-11 CH CH1462766A patent/CH473107A/fr not_active IP Right Cessation
- 1966-10-11 CH CH333969A patent/CH475969A/fr not_active IP Right Cessation
- 1966-10-17 US US587001A patent/US3472884A/en not_active Expired - Lifetime
- 1966-10-18 DK DK536866AA patent/DK117956B/da unknown
- 1966-10-20 SE SE14359/66A patent/SE315890B/xx unknown
- 1966-10-21 IL IL36947A patent/IL36947A/en unknown
- 1966-10-21 GB GB13138/68A patent/GB1128789A/en not_active Expired
- 1966-10-21 NL NL666614883A patent/NL139964B/xx unknown
- 1966-10-21 GB GB47255/66A patent/GB1128786A/en not_active Expired
- 1966-10-21 IL IL26731A patent/IL26731A/en unknown
- 1966-10-21 GB GB13139/68A patent/GB1128790A/en not_active Expired
- 1966-10-21 IL IL36946A patent/IL36946A/xx unknown
- 1966-10-21 BR BR183910/66A patent/BR6683910D0/pt unknown
-
1967
- 1967-02-10 ES ES336670A patent/ES336670A2/es not_active Expired
- 1967-04-19 ES ES339491A patent/ES339491A2/es not_active Expired
- 1967-05-11 YU YU1095/67A patent/YU33801B/xx unknown
- 1967-05-31 ES ES341196A patent/ES341196A2/es not_active Expired
-
1969
- 1969-05-13 US US824321A patent/US3519654A/en not_active Expired - Lifetime
-
1970
- 1970-06-19 NL NL7009052A patent/NL7009052A/xx unknown
- 1970-06-19 NL NL7009051A patent/NL7009051A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR1504500A (fr) | 1967-12-08 |
| GB1128790A (en) | 1968-10-02 |
| FR192F (enExample) | |
| FR5248M (enExample) | 1967-07-24 |
| ES339491A2 (es) | 1968-06-01 |
| ES336670A2 (es) | 1968-01-01 |
| FR1519520A (fr) | 1968-04-05 |
| NL7009052A (enExample) | 1970-10-26 |
| US3472884A (en) | 1969-10-14 |
| YU33801B (en) | 1978-05-15 |
| CH475969A (fr) | 1969-07-31 |
| BR6683910D0 (pt) | 1973-12-04 |
| NL6614883A (enExample) | 1967-04-24 |
| NL139964B (nl) | 1973-10-15 |
| US3519654A (en) | 1970-07-07 |
| GB1128789A (en) | 1968-10-02 |
| SE315890B (enExample) | 1969-10-13 |
| YU109567A (en) | 1977-10-31 |
| IL26731A (en) | 1972-04-27 |
| GB1128786A (en) | 1968-10-02 |
| FR205F (enExample) | |
| BE688085A (enExample) | 1967-04-11 |
| IL36947A (en) | 1972-04-27 |
| NL7009051A (enExample) | 1970-10-26 |
| FR190F (enExample) | |
| ES341196A2 (es) | 1968-11-16 |
| IL36946A (en) | 1972-04-27 |
| CH473107A (fr) | 1969-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK118769B (da) | Fremgangsmåde til fremstilling af O-methyl-S-methyl-phosphoroamidothioat. | |
| DK115474B (da) | Analogifremgangsmåde til fremstilling af N-p-chlorbenzoyl-5-fluorcytosin. | |
| DK114688B (da) | Fremgangsmåde til fremstilling af 2β, 16β-diamino-3,17-oksygenerede-5α-androstaner. | |
| DK127415B (da) | Fremgangsmåde til fremstilling af α-benzyl-β,β-dialkoxypropionitriler. | |
| DK118505B (da) | Fremgangsmåde til fremstilling af isoindolin-2-sulfonylurinstoffer. | |
| DK111568B (da) | Fremgangsmåde til fremstilling af N-alkyl-3,1-benzoxazin-2-oner. | |
| DK118239B (da) | Fremgangsmåde til fremstilling af substituerede 4-hydroxykinoliner. | |
| DK112523B (da) | Fremgangsmåde til fremstilling af 2,3-pyridindiol. | |
| DK106185C (da) | Fremgangsmåde til fremstilling af 17α-acyloxy-4,6-pregnadien-20-oner. | |
| DK120752B (da) | Fremgangsmåde til fremstilling af 5-aryl-3H-1,4-benzodiazepin-4-oxider. | |
| DK123236B (da) | Fremgangsmåde til fremstilling af 2-alkyl-3-hydoxy-4,5-dihydrofuran-4-oner. | |
| DK121052B (da) | Fremgangsmåde til fremstilling af steroid-17α,21-orthocarbonater. | |
| DK121759B (da) | Analogifremgangsmåde til fremstilling af 3-oxo-7α-methylgona-4,9-diener. | |
| DK128279B (da) | Fremgangsmåde til fremstilling af α,ω-alkylendiaminer. | |
| DK115184B (da) | Fremgangsmåde til fremstilling af 6,7-benzomorphaner. | |
| DK116594B (da) | Fremgangsmåde til fremstilling af 4,1,5-benzoxadiazociner. | |
| DK118670B (da) | Fremgangsmåde til fremstilling af cyanphenoler. | |
| DK118458B (da) | Fremgangsmåde til fremstilling af 5-halogen-2-amino-benzophenoniminer. | |
| DK130307B (da) | Fremgangsmåde til fremstilling af 3-oxo-13β-alkyl-17β-hydroxy-17α-ethynylgona-4,9-diener. | |
| DK114204B (da) | Fremgangsmåde til fremstilling af carboxamidoalkyl-1,3-benzoxaziner. | |
| DK117956B (da) | Fremgangsmåde til fremstilling af 3-oxogona-4,9-diener. | |
| DK122527B (da) | Fremgangsmåde til fremstilling af 3-nitro-2-oxo-tetrahydro-imidazoler. | |
| DK129842B (da) | Fremgangsmåde til fremstilling af 3-imino-1,2-benzisothiazoliner. | |
| DK118602B (da) | Analogifremgangsmåde til fremstilling af 3-chlorethoxy-6-cyan-3,5-pregnadiener. | |
| DK118947B (da) | Fremgangsmåde til fremstilling af 1,2-dihydro-4-hydroxyquinazolin-3-oxider. |