DK117567B - Fremgangsmåde til fremstilling af 2,4-diaminopyrido-[2,3-d]-pyrimidiner eller syreadditionssalte heraf. - Google Patents
Fremgangsmåde til fremstilling af 2,4-diaminopyrido-[2,3-d]-pyrimidiner eller syreadditionssalte heraf.Info
- Publication number
- DK117567B DK117567B DK5165AA DK5165A DK117567B DK 117567 B DK117567 B DK 117567B DK 5165A A DK5165A A DK 5165AA DK 5165 A DK5165 A DK 5165A DK 117567 B DK117567 B DK 117567B
- Authority
- DK
- Denmark
- Prior art keywords
- diaminopyrido
- pyrimidines
- preparation
- acid addition
- addition salts
- Prior art date
Links
- 239000002253 acid Substances 0.000 title 1
- LYXZTYXDCZQKSS-UHFFFAOYSA-N pyrido[2,3-d]pyrimidine-2,4-diamine Chemical class C1=CC=NC2=NC(N)=NC(N)=C21 LYXZTYXDCZQKSS-UHFFFAOYSA-N 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US31998463A | 1963-10-30 | 1963-10-30 | |
| GB80864 | 1964-01-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK117567B true DK117567B (da) | 1970-05-11 |
Family
ID=26236195
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK5165AA DK117567B (da) | 1963-10-30 | 1965-01-07 | Fremgangsmåde til fremstilling af 2,4-diaminopyrido-[2,3-d]-pyrimidiner eller syreadditionssalte heraf. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3322765A (enExample) |
| BE (2) | BE655138A (enExample) |
| DK (1) | DK117567B (enExample) |
| FR (4) | FR1431695A (enExample) |
| GB (1) | GB1084103A (enExample) |
| IL (1) | IL22365A (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3673184A (en) * | 1970-09-02 | 1972-06-27 | Dainippon Pharmaceutical Co | Certain 2-substituted-5,8-dihydro-5-oxopyrido{8 2,3-d{9 pyrimidine-6-carboxylic acid derivatives |
| ZA803539B (en) * | 1979-06-14 | 1982-01-27 | Wellcome Found | Alkoxybenzylrimidines method for their preparation formulation thereof and their use in medicine |
| HU184787B (en) * | 1979-06-14 | 1984-10-29 | Wellcome Found | Process for preparing alkoxy-benzyl-pyrido-pyrimidine derivatives |
| US4959474A (en) * | 1979-06-14 | 1990-09-25 | Burroughs Wellcome Co. | Dialkoxy pyridopyrimidine compounds |
| US4512992A (en) * | 1980-06-13 | 1985-04-23 | Burroughs Wellcome Co. | Treatment with dialkoxy pyridopyrimidine compounds |
| GB8702758D0 (en) * | 1987-02-06 | 1987-03-11 | Wellcome Found | Treatment of disease |
| AU598093B2 (en) * | 1987-02-07 | 1990-06-14 | Wellcome Foundation Limited, The | Pyridopyrimidines, methods for their preparation and pharmaceutical formulations thereof |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB774093A (en) * | 1952-11-28 | 1957-05-08 | British Thomson Houston Co Ltd | Improvements in electroluminescent devices |
| NL281111A (enExample) * | 1961-07-19 |
-
1964
- 1964-10-28 US US407230A patent/US3322765A/en not_active Expired - Lifetime
- 1964-10-29 GB GB4415364A patent/GB1084103A/en not_active Expired
- 1964-10-30 IL IL22365A patent/IL22365A/en unknown
- 1964-10-30 FR FR993298A patent/FR1431695A/fr not_active Expired
- 1964-10-30 BE BE655138A patent/BE655138A/xx unknown
-
1965
- 1965-01-05 BE BE657922A patent/BE657922A/xx unknown
- 1965-01-07 DK DK5165AA patent/DK117567B/da unknown
- 1965-01-07 FR FR1187A patent/FR1434978A/fr not_active Expired
- 1965-01-28 FR FR3528A patent/FR4018M/fr not_active Expired
- 1965-04-06 FR FR12055A patent/FR4802M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE657922A (enExample) | 1965-07-05 |
| FR4018M (enExample) | 1966-03-21 |
| US3322765A (en) | 1967-05-30 |
| BE655138A (enExample) | 1965-04-30 |
| GB1084103A (enExample) | 1967-09-20 |
| IL22365A (en) | 1968-06-20 |
| FR4802M (enExample) | 1967-02-06 |
| FR1431695A (fr) | 1966-03-18 |
| FR1434978A (fr) | 1966-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK108972C (da) | Fremgangsmåde til fremstilling af lipoylpyridoxamin eller syreadditionssalte deraf. | |
| DK108495C (da) | Fremgangsmåde til fremstilling af substituerede 6,7-benzomorphaner eller syreadditionssalte deraf. | |
| DK130070B (da) | Analogifremgangsmåde til fremstilling af 3,4-dihydroxyphenylalkanolaminer eller syreadditionssalte deraf. | |
| DK106796C (da) | Fremgangsmåde til fremstilling af 3-hydroxy-5-aminomethyl-isoxazol eller syreadditionssalte deraf. | |
| DK124404B (da) | Fremgangsmåde til fremstilling af 2-arylamino-1,3-diazacycloalkener-(2) eller syreadditionssalte deraf. | |
| DK116000B (da) | Fremgangsmåde til fremstilling af amino-halogen-benzylaminer eller syreadditionssalte heraf. | |
| DK117567B (da) | Fremgangsmåde til fremstilling af 2,4-diaminopyrido-[2,3-d]-pyrimidiner eller syreadditionssalte heraf. | |
| DK117000B (da) | Fremgangsmåde til fremstilling af substituerede phenylamino-1,3-diazacyclopentener-(2) eller syreadditionssalte heraf. | |
| DK112451B (da) | Fremgangsmåde til fremstilling af [1,2-α]-imidazopyridiner eller syreadditionssalte deraf. | |
| DK103831C (da) | Fremgangsmåde til fremstilling af 4-azathioxanthenderivater eller syreadditionssalte deraf. | |
| DK108394C (da) | Fremgangsmåde til fremstilling af substituerede imidazo- eller pyrimido-quinazoliner eller syreadditionssalte deraf. | |
| DK125552B (da) | Fremgangsmåde til fremstilling af 1,2,3,4-tetrahydroisoquinolin-2-carboxamidiner eller syreadditionssalte deraf. | |
| DK112449B (da) | Fremgangsmåde til fremstilling af 2,3-dihydro-5-pyridyl-1H-1,4-benzodiazepiner eller syreadditionssalte deraf. | |
| DK120953B (da) | Fremgangsmåde til fremstilling af geminataminocarbinoler eller de entantiomere eller syradditionssalte deraf. | |
| DK106381C (da) | Fremgangsmåde til fremstilling af 2-dimethylamino-3,5,6-trimethylpyrazin eller syreadditionssalte heraf. | |
| DK105649C (da) | Fremgangsmåde til fremstilling af 2-dimethylaminopyrazin eller syreadditionssalte deraf. | |
| DK111893B (da) | Fremgangsmåde til fremstilling af substituerede methylhydraziner eller syreadditionssalte deraf. | |
| DK107098C (da) | Fremgangsmåde til fremstilling af 5-hydrazino-pyrazol-derivater eller syreadditionssalte deraf. | |
| DK114198B (da) | Fremgangsmåde til fremstilling af 1-amino-bicyclo[2,2,2]octaner eller syreadditionssalte deraf. | |
| DK106144C (da) | Fremgangsmåde til fremstilling af aryl-N-(1,2,5,6-tetrahydro-1,3-dialkyl-4-pyridyl)-alkanoylamider eller syreadditionssalte deraf. | |
| DK107169C (da) | Fremgangsmåde til fremstilling af 10-monoalkylaminoalkyl-10,11-dihydro-11-oxo-5H-dibenzo(b,e)(1,4)diazepiner eller syreadditionssalte deraf. | |
| DK118345B (da) | Fremgangsmåde til fremstilling af 2,5-diacylamino-3,6-diamino-1,4-dihydroxybenzener eller syreadditionssalte deraf. | |
| DK106911C (da) | Fremgangsmåde til fremstilling af 2,3-dihydro-5-aryl-1H-1,4-benzodiazepinderivater eller syreadditionssalte deraf. | |
| DK107617C (da) | Fremgangsmåde til fremstilling af basisk substituerede 11-alkyl-5,6-dihydro-6-oxo-morphanthridiner eller syreadditionssalte deraf. | |
| DK118667B (da) | Fremgangsmåde til fremstilling af 1,3,4,5-tetrahydro-5-phenyl-2H-1,4-benzodiazepin-2-oner eller syreadditionssalte deraf. |