DK117149B - Fremgangsmåde til fremstilling af 14-hydroxy-dihydro-6β-thebainol-4-methylether. - Google Patents
Fremgangsmåde til fremstilling af 14-hydroxy-dihydro-6β-thebainol-4-methylether.Info
- Publication number
- DK117149B DK117149B DK260268A DK260268A DK117149B DK 117149 B DK117149 B DK 117149B DK 260268 A DK260268 A DK 260268A DK 260268 A DK260268 A DK 260268A DK 117149 B DK117149 B DK 117149B
- Authority
- DK
- Denmark
- Prior art keywords
- thebainol
- dihydro
- hydroxy
- preparation
- methyl ether
- Prior art date
Links
- LCAHPIFLPICNRW-SVYNMNNPSA-N Oxymetebanol Chemical compound C1[C@H](O)CC[C@@]2(O)[C@H]3CC4=CC=C(OC)C(OC)=C4[C@]21CCN3C LCAHPIFLPICNRW-SVYNMNNPSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/22—Bridged ring systems
- C07D221/28—Morphinans
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3610567 | 1967-06-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK117149B true DK117149B (da) | 1970-03-23 |
Family
ID=12460476
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK260268A DK117149B (da) | 1967-06-06 | 1968-06-04 | Fremgangsmåde til fremstilling af 14-hydroxy-dihydro-6β-thebainol-4-methylether. |
Country Status (10)
| Country | Link |
|---|---|
| BE (1) | BE715928A (th) |
| CH (1) | CH492716A (th) |
| CS (1) | CS151471B2 (th) |
| DE (1) | DE1770563C3 (th) |
| DK (1) | DK117149B (th) |
| ES (1) | ES354706A1 (th) |
| FR (1) | FR1568523A (th) |
| GB (1) | GB1195144A (th) |
| NL (1) | NL160253C (th) |
| SE (1) | SE330541B (th) |
-
1968
- 1968-05-29 NL NL6807553A patent/NL160253C/xx active
- 1968-05-31 BE BE715928D patent/BE715928A/xx unknown
- 1968-05-31 CH CH814068A patent/CH492716A/de not_active IP Right Cessation
- 1968-06-04 DK DK260268A patent/DK117149B/da unknown
- 1968-06-04 GB GB2651068A patent/GB1195144A/en not_active Expired
- 1968-06-05 FR FR1568523D patent/FR1568523A/fr not_active Expired
- 1968-06-05 DE DE19681770563 patent/DE1770563C3/de not_active Expired
- 1968-06-05 ES ES354706A patent/ES354706A1/es not_active Expired
- 1968-06-06 CS CS420268A patent/CS151471B2/cs unknown
- 1968-06-06 SE SE758568A patent/SE330541B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH492716A (de) | 1970-06-30 |
| ES354706A1 (es) | 1970-02-16 |
| NL160253C (nl) | 1979-10-15 |
| NL160253B (nl) | 1979-05-15 |
| FR1568523A (th) | 1969-05-23 |
| DE1770563C3 (de) | 1979-07-12 |
| GB1195144A (en) | 1970-06-17 |
| CS151471B2 (th) | 1973-10-19 |
| SE330541B (th) | 1970-11-23 |
| DE1770563B2 (de) | 1978-10-05 |
| BE715928A (th) | 1968-10-16 |
| NL6807553A (th) | 1968-12-09 |
| DE1770563A1 (de) | 1971-11-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK137232B (da) | Analogifremgangsmåde til fremstilling af phenylethanolaminer. | |
| DK122222B (da) | Fremgangsmåde til fremstilling af alk-3-en-1-oler. | |
| DK133783B (da) | Fremgangsmåde til fremstilling af 7-halogen-7-desoxy-1-thio-alfa-D-galacto-octopyranosider. | |
| DK120698B (da) | Analogifremgangsmåde til fremstilling af acetylguanidiner. | |
| DK124080B (da) | Fremgangsmåde til fremstilling af D-6-metyl-8-cyanmetylergolin. | |
| DK118820B (da) | Analogifremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoliner. | |
| DK123482B (da) | Analogifremgangsmåde til fremstilling af alkaloider. | |
| DK119307B (da) | Fremgangsmåde til fremstilling af ketonitriler. | |
| DK118883B (da) | Fremgangsmåde til fremstilling af alkylarylethere. | |
| DK123868B (da) | Analogifremgangsmåde til fremstilling af 3-hydroxycumarin-derivater. | |
| DK122758B (da) | Fremgangsmåde til fremstilling af α-methyl-multicyclo-methylaminer. | |
| DK123100B (da) | Fremgangsmåde til fremstilling af N-tritylimidazoler. | |
| DK122522B (da) | Fremgangsmåde til fremstilling af dichlorquinoliner. | |
| DK119663B (da) | Analogifremgangsmåde til fremstilling af 2-benzolsulfonamidopyrimidinforbindelser. | |
| DK118507B (da) | Fremgangsmåde til fremstilling af 3-dimethylsulfamoylphenthiazinderivater. | |
| DK118558B (da) | Analogifremgangsmåde til fremstilling af N-Pyridylformiminoætere. | |
| DK120598B (da) | Analogifremgangsmåde til fremstilling af furazanderivater. | |
| DK125285B (da) | Analogifremgangsmåde til fremstilling af furazanderivater. | |
| DK119976B (da) | Analogifremgangsmåde til fremstilling af 18-methyl-19-nor-17α-hydroxyprogesteroner og -17-estere deraf. | |
| DK130307B (da) | Fremgangsmåde til fremstilling af 3-oxo-13β-alkyl-17β-hydroxy-17α-ethynylgona-4,9-diener. | |
| DK120948B (da) | Fremgangsmåde til fremstilling af (androst-17β-yl)-α-pyroner. | |
| DK122666B (da) | Analogifremgangsmåde til fremstilling af hydrocortison-17-cyclopentancorboxylat. | |
| DK117568B (da) | Analogifremgangsmåde til fremstilling af ftalazino-ftalazindioner. | |
| DK129842B (da) | Fremgangsmåde til fremstilling af 3-imino-1,2-benzisothiazoliner. | |
| DK118087B (da) | Analogifremgangsmåde til fremstilling af 3-acetamidomorphiner. |