DK116665B - Fremgangsmåde til fremstilling af picrater af β-amino-arylethylketoner. - Google Patents
Fremgangsmåde til fremstilling af picrater af β-amino-arylethylketoner.Info
- Publication number
- DK116665B DK116665B DK274163AA DK274163A DK116665B DK 116665 B DK116665 B DK 116665B DK 274163A A DK274163A A DK 274163AA DK 274163 A DK274163 A DK 274163A DK 116665 B DK116665 B DK 116665B
- Authority
- DK
- Denmark
- Prior art keywords
- picrates
- amino
- preparation
- ethyl ketones
- aryl ethyl
- Prior art date
Links
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical class OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/10—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms
- C07D295/104—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms with the ring nitrogen atoms and the doubly bound oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/108—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms with the ring nitrogen atoms and the doubly bound oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Color Printing (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT1167462 | 1962-06-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK116665B true DK116665B (da) | 1970-02-02 |
Family
ID=11136816
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK274163AA DK116665B (da) | 1962-06-11 | 1963-06-10 | Fremgangsmåde til fremstilling af picrater af β-amino-arylethylketoner. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3249606A (enExample) |
| AT (1) | AT241439B (enExample) |
| BE (1) | BE633437A (enExample) |
| BR (1) | BR6349776D0 (enExample) |
| CH (1) | CH446391A (enExample) |
| DE (1) | DE1203790B (enExample) |
| DK (1) | DK116665B (enExample) |
| ES (1) | ES288886A1 (enExample) |
| GB (1) | GB1039535A (enExample) |
| NL (2) | NL293782A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8604031B2 (en) * | 2006-05-18 | 2013-12-10 | Mannkind Corporation | Intracellular kinase inhibitors |
| EP2520561B1 (en) | 2007-06-08 | 2016-02-10 | MannKind Corporation | IRE-1A Inhibitors |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3058987A (en) * | 1959-09-21 | 1962-10-16 | Hoffmann La Roche | 3-amino-2-aminomethyl-1-phenyl-1-propanols |
-
0
- NL NL125054D patent/NL125054C/xx active
- BE BE633437D patent/BE633437A/xx unknown
- NL NL293782D patent/NL293782A/xx unknown
-
1963
- 1963-06-10 BR BR149776/63A patent/BR6349776D0/pt unknown
- 1963-06-10 DE DEM57136A patent/DE1203790B/de active Pending
- 1963-06-10 DK DK274163AA patent/DK116665B/da unknown
- 1963-06-10 US US286500A patent/US3249606A/en not_active Expired - Lifetime
- 1963-06-10 GB GB23061/63A patent/GB1039535A/en not_active Expired
- 1963-06-10 ES ES288886A patent/ES288886A1/es not_active Expired
- 1963-06-10 AT AT464563A patent/AT241439B/de active
- 1963-06-10 CH CH723063A patent/CH446391A/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AT241439B (de) | 1965-07-26 |
| CH446391A (de) | 1967-11-15 |
| US3249606A (en) | 1966-05-03 |
| NL125054C (enExample) | |
| DE1203790B (de) | 1965-10-28 |
| NL293782A (enExample) | |
| GB1039535A (en) | 1966-08-17 |
| BE633437A (enExample) | |
| ES288886A1 (es) | 1963-12-16 |
| BR6349776D0 (pt) | 1973-07-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK104168C (da) | Fremgangsmåde til fremstilling af mono-biguanider. | |
| DK104675C (da) | Fremgangsmåde til fremstilling af 3-hydroxy-N-nitro-picolinamid. | |
| DK118242B (da) | Fremgangsmåde til fremstilling af anhydropenicilliner. | |
| DK108976C (da) | Fremgangsmåde til fremstilling af hendecapeptider. | |
| DK107027C (da) | Fremgangsmåde til fremstilling af 3-hydroxy-benzisoxazoler. | |
| DK115325B (da) | Fremgangsmåde til fremstilling af fenylalkylsulfamider. | |
| DK116665B (da) | Fremgangsmåde til fremstilling af picrater af β-amino-arylethylketoner. | |
| DK106184C (da) | Fremgangsmåde til fremstilling af alkylaralkylftalater. | |
| DK118082B (da) | Fremgangsmåde til fremstilling af 4-cyanthiazol. | |
| DK103476C (da) | Fremgangsmåde til fremstilling af 2-oxa-3-oxo-steroider. | |
| DK103512C (da) | Fremgangsmåde til fremstilling af 3-nitroso-2-oxazolidon. | |
| DK108915C (da) | Fremgangsmåde til fremstilling af 21-acyloxy-acetyloxy-corticosteroider. | |
| DK104055C (da) | Fremgangsmåde til fremstilling af 6-methoxytetraloner. | |
| DK104347C (da) | Fremgangsmåde til fremstilling af 16α-hydroxysteroider. | |
| DK104136C (da) | Fremgangsmåde til fremstilling af benzensulfonylsemicarbazider. | |
| DK104063C (da) | Fremgangsmåde til fremstilling af 4-hydroxy-5-halogenpyrimidiner. | |
| DK113647B (da) | Fremgangsmåde til fremstilling af 2-sulfanilamido-5-metoxypyrimidin. | |
| DK102738C (da) | Fremgangsmåde til fremstilling af 1-dehydro-testosteron-17-acylater. | |
| DK99144C (da) | Fremgangsmåde til fremstilling af 2-β-metoksyætylpyridin. | |
| DK101523C (da) | Fremgangsmåde til fremstilling af N-kvaternære O-benzylaminoalkyl-N-phenylurethaner. | |
| DK101054C (da) | Fremgangsmåde til fremstilling af N-kvaternære O-benzylaminoalkyl-N-phenylurethaner. | |
| DK100051C (da) | Fremgangsmåde til fremstilling af 17α-acyloxy-21-hydroxysteroider. | |
| DK109693C (da) | Fremgangsmåde til fremstilling af ω-lactamer. | |
| DK105411C (da) | Fremgangsmåde til fremstilling af 5-alkoxy-2-sulfanilylaminopyrimidiner. | |
| DK103126C (da) | Fremgangsmåde til fremstilling af 2-β-metoksyætylpyridin. |