DK116448B - Fremgangsmåde til fremstilling af 1-(3,5-dimetoksy-4-hydroksyfenyl)-2-monometylaminoætanol. - Google Patents
Fremgangsmåde til fremstilling af 1-(3,5-dimetoksy-4-hydroksyfenyl)-2-monometylaminoætanol.Info
- Publication number
- DK116448B DK116448B DK469067AA DK469067A DK116448B DK 116448 B DK116448 B DK 116448B DK 469067A A DK469067A A DK 469067AA DK 469067 A DK469067 A DK 469067A DK 116448 B DK116448 B DK 116448B
- Authority
- DK
- Denmark
- Prior art keywords
- monomethylaminoethanol
- dimethoxy
- hydroxyphenyl
- preparation
- Prior art date
Links
- ZKGDBJAHIIXDDW-UHFFFAOYSA-N dimetofrine Chemical compound CNCC(O)C1=CC(OC)=C(O)C(OC)=C1 ZKGDBJAHIIXDDW-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C245/00—Compounds containing chains of at least two nitrogen atoms with at least one nitrogen-to-nitrogen multiple bond
- C07C245/12—Diazo compounds, i.e. compounds having the free valencies of >N2 groups attached to the same carbon atom
- C07C245/14—Diazo compounds, i.e. compounds having the free valencies of >N2 groups attached to the same carbon atom having diazo groups bound to acyclic carbon atoms of a carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT15981/67A IT1051652B (it) | 1967-05-11 | 1967-05-11 | Farmaco ad azione ipertensiva a base di i(3,5 dimetossi 4 idrossifenil)2 monometilaminoetanolo |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK116448B true DK116448B (da) | 1970-01-12 |
Family
ID=11148418
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK469067AA DK116448B (da) | 1967-05-11 | 1967-09-20 | Fremgangsmåde til fremstilling af 1-(3,5-dimetoksy-4-hydroksyfenyl)-2-monometylaminoætanol. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3646144A (cs) |
| BE (1) | BE705169A (cs) |
| CH (1) | CH481060A (cs) |
| DE (1) | DE1643570C3 (cs) |
| DK (1) | DK116448B (cs) |
| ES (1) | ES343446A1 (cs) |
| FR (1) | FR1579539A (cs) |
| GB (1) | GB1145637A (cs) |
| GR (1) | GR34165B (cs) |
| IT (1) | IT1051652B (cs) |
| SE (1) | SE330179B (cs) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1148741B (it) * | 1980-11-28 | 1986-12-03 | Zambeletti Spa L | Procedimento per la preparazione dell'1-(3,5-dimetossi-4-idrossifenil)-2-(n-metilammino)etanolo cloridrato |
-
1967
- 1967-05-11 IT IT15981/67A patent/IT1051652B/it active
- 1967-07-07 CH CH979867A patent/CH481060A/de not_active IP Right Cessation
- 1967-07-26 ES ES343446A patent/ES343446A1/es not_active Expired
- 1967-08-09 DE DE1643570A patent/DE1643570C3/de not_active Expired
- 1967-08-11 GR GR670134165A patent/GR34165B/el unknown
- 1967-08-25 SE SE11882/67A patent/SE330179B/xx unknown
- 1967-09-20 DK DK469067AA patent/DK116448B/da not_active IP Right Cessation
- 1967-10-06 GB GB45880/67A patent/GB1145637A/en not_active Expired
- 1967-10-16 BE BE705169D patent/BE705169A/xx not_active IP Right Cessation
- 1967-10-25 US US680611A patent/US3646144A/en not_active Expired - Lifetime
-
1968
- 1968-03-27 FR FR1579539D patent/FR1579539A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE705169A (cs) | 1968-03-01 |
| ES343446A1 (es) | 1968-12-16 |
| GB1145637A (en) | 1969-03-19 |
| US3646144A (en) | 1972-02-29 |
| SE330179B (cs) | 1970-11-09 |
| DE1643570C3 (de) | 1974-02-21 |
| FR1579539A (cs) | 1969-08-29 |
| CH481060A (de) | 1969-11-15 |
| IT1051652B (it) | 1981-05-20 |
| GR34165B (el) | 1968-03-30 |
| DE1643570A1 (de) | 1972-05-04 |
| DE1643570B2 (de) | 1973-07-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK120546B (da) | Fremgangsmåde til fremstilling af 2,4-diamino-5-benzylpyrimidiner. | |
| DK118877B (da) | Analogifremgangsmåde til fremstilling af 3,1-benzoxazin-2-oner. | |
| DK112523B (da) | Fremgangsmåde til fremstilling af 2,3-pyridindiol. | |
| DK129234B (da) | Fremgangsmåde til fremstilling af levo-1-n-butyl-2',6'-pipecoloxylidid. | |
| DK118246B (da) | Analogifremgangsmåde til fremstilling af 2-isothiuroniummethyl-3-carboxylsyreamido-quinozalin-di-N-oxid-(1,4)-halogenider. | |
| DK119166B (da) | Fremgangsmåde til fremstilling af 1,4-bezodiazepinderivater. | |
| DK121757B (da) | Fremgangsmåde til fremstilling af 10,11-dihydro-10,11-dihydroxy-5-(3-substituerede aminopropyliden)-5H-dibenzo-[a,d]-cycloheptenforbindelser. | |
| DK116219B (da) | Fremgangsmåde til fremstilling af 1,2,4-triazoler. | |
| DK114556B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepin-2-on-4-oxider. | |
| DK116357B (da) | Fremgangsmåde til fremstilling af 1,1,1,2,2-pentafluor-3-chlorpropan. | |
| DK115184B (da) | Fremgangsmåde til fremstilling af 6,7-benzomorphaner. | |
| DK126936B (da) | Fremgangsmåde til fremstilling af 3-oxo-13β-alkylgona-4,9,11-triener. | |
| DK116448B (da) | Fremgangsmåde til fremstilling af 1-(3,5-dimetoksy-4-hydroksyfenyl)-2-monometylaminoætanol. | |
| DK115622B (da) | Fremgangsmåde til fremstilling af 3-oxogona-4,9,11-triener. | |
| DK120131B (da) | Fremgangsmåde til fremstilling af 3-oxo-13β-alkylgona-4,9,11-triener. | |
| DK116594B (da) | Fremgangsmåde til fremstilling af 4,1,5-benzoxadiazociner. | |
| DK135310B (da) | Analogifremgangsmåde til fremstilling af 1-(2-ethinylphenoxy)-2-hydroxy-3-butylaminopropaner. | |
| DK137494B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. | |
| DK125083B (da) | Fremgangsmåde til fremstilling af 2,3-diklor-4-butyryl-fenoxyeddikesyre. | |
| DK120395B (da) | Fremgangsmåde til fremstilling af 1-[5-nitrothiazolyl-(2)]-2-oxo-tetrahydro-imidazoler. | |
| DK129842B (da) | Fremgangsmåde til fremstilling af 3-imino-1,2-benzisothiazoliner. | |
| DK123476B (da) | Fremgangsmåde til fremstilling af 3-oxo-A-nor-B-homo-estra-5(10)-ener. | |
| DK112319B (da) | Fremgangsmåde til fremstilling af 7-nitrosubstituerede 1,4-benzodiazepinoner. | |
| DK122175B (da) | Analogifremgangsmåde til fremstilling af 3-oxo-13β-alkyl-17α-allyl-17β-hydroxygona-4,9,11-triener. | |
| DK121235B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |