DK116368B - Fremgangsmåde til fremstilling af 2,3-dihydro-2,2,4-trimethyl-7-benzofuranol. - Google Patents
Fremgangsmåde til fremstilling af 2,3-dihydro-2,2,4-trimethyl-7-benzofuranol.Info
- Publication number
- DK116368B DK116368B DK74667AA DK74667A DK116368B DK 116368 B DK116368 B DK 116368B DK 74667A A DK74667A A DK 74667AA DK 74667 A DK74667 A DK 74667A DK 116368 B DK116368 B DK 116368B
- Authority
- DK
- Denmark
- Prior art keywords
- benzofuranol
- dihydro
- trimethyl
- preparation
- Prior art date
Links
- VHVGYMZOFGBRGP-UHFFFAOYSA-N 2,2,4-trimethyl-3H-1-benzofuran-7-ol Chemical compound CC1(OC2=C(C1)C(=CC=C2O)C)C VHVGYMZOFGBRGP-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/51—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition
- C07C45/54—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition of compounds containing doubly bound oxygen atoms, e.g. esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/86—Benzo [b] furans; Hydrogenated benzo [b] furans with an oxygen atom directly attached in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US52924966A | 1966-02-23 | 1966-02-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK116368B true DK116368B (da) | 1970-01-05 |
Family
ID=24109136
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK74667AA DK116368B (da) | 1966-02-23 | 1967-02-10 | Fremgangsmåde til fremstilling af 2,3-dihydro-2,2,4-trimethyl-7-benzofuranol. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3455961A (Direct) |
| BE (1) | BE694174A (Direct) |
| CH (1) | CH500964A (Direct) |
| DK (1) | DK116368B (Direct) |
| FR (1) | FR1511331A (Direct) |
| GB (1) | GB1163179A (Direct) |
| NL (1) | NL6702644A (Direct) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL58661A (en) * | 1978-11-30 | 1983-11-30 | Philagro Sa | Process for the preparation of 2,3-dihydro-2,2-dimethyl-7-hydroxybenzofuran |
| DE4027572A1 (de) * | 1990-08-31 | 1992-03-05 | Basf Ag | 2,3-dihydrobenzofurylmethylester, ihre herstellung und sie enthaltende mittel zur bekaempfung von schaedlingen |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3356690A (en) * | 1965-02-04 | 1967-12-05 | Fmc Corp | Synthesis of 2, 3-dihydro-2, 2-dimethyl-7-benzofuranyl nu-methylcarbamate |
-
1966
- 1966-02-23 US US529249A patent/US3455961A/en not_active Expired - Lifetime
-
1967
- 1967-02-10 DK DK74667AA patent/DK116368B/da unknown
- 1967-02-14 FR FR94931A patent/FR1511331A/fr not_active Expired
- 1967-02-16 GB GB7458/67A patent/GB1163179A/en not_active Expired
- 1967-02-16 BE BE694174D patent/BE694174A/xx unknown
- 1967-02-21 NL NL6702644A patent/NL6702644A/xx unknown
- 1967-02-22 CH CH257567A patent/CH500964A/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR1511331A (fr) | 1968-01-26 |
| BE694174A (Direct) | 1967-08-16 |
| CH500964A (de) | 1970-12-31 |
| US3455961A (en) | 1969-07-15 |
| NL6702644A (Direct) | 1967-08-24 |
| GB1163179A (en) | 1969-09-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK106552C (da) | Fremgangsmåde til fremstilling af substituerede 6,7-benzomorphaner. | |
| DK120546B (da) | Fremgangsmåde til fremstilling af 2,4-diamino-5-benzylpyrimidiner. | |
| DK117957B (da) | Fremgangsmåde til fremstilling af 13β-alkyl-3-oxogona-4,9,11-triener. | |
| DK118877B (da) | Analogifremgangsmåde til fremstilling af 3,1-benzoxazin-2-oner. | |
| DK119005B (da) | Fremgangsmåde til fremstilling af 3-alkoxy-13-alkylgona-1,3,5(10),8,14-penten-17-oner. | |
| DK112523B (da) | Fremgangsmåde til fremstilling af 2,3-pyridindiol. | |
| DK118885B (da) | Fremgangsmåde til fremstilling af 2,3-dihydro-2,2-dimethyl-7-benzofuranol. | |
| DK112726B (da) | Fremgangsmåde til fremstilling af 1,6-dibrom-1,6-didesoxydulcitol. | |
| DK116656B (da) | Analogifremgangsmåde til fremstilling af 11-oxygenerede 3-(2'-chlorethylthio)-6-formyl-9α-fluor-3,5-pregnadien-20-oner. | |
| DK115632B (da) | Fremgangsmåde til fremstilling af 2,3-dihydro-2,2-dimethyl-7-benzofuranol. | |
| DK114556B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepin-2-on-4-oxider. | |
| DK116357B (da) | Fremgangsmåde til fremstilling af 1,1,1,2,2-pentafluor-3-chlorpropan. | |
| DK115184B (da) | Fremgangsmåde til fremstilling af 6,7-benzomorphaner. | |
| DK120131B (da) | Fremgangsmåde til fremstilling af 3-oxo-13β-alkylgona-4,9,11-triener. | |
| DK115622B (da) | Fremgangsmåde til fremstilling af 3-oxogona-4,9,11-triener. | |
| DK118406B (da) | Fremgangsmåde til fremstilling af 3-alkynyloxy- og 3-alkenyloxy-4-sulfanilamido-1,2,5-thiadiazoler. | |
| DK116368B (da) | Fremgangsmåde til fremstilling af 2,3-dihydro-2,2,4-trimethyl-7-benzofuranol. | |
| DK116594B (da) | Fremgangsmåde til fremstilling af 4,1,5-benzoxadiazociner. | |
| DK114962B (da) | Fremgangsmåde til fremstilling af α, α, α', α'-tetramethyl-xylylen-dicarbinoler. | |
| DK106329C (da) | Fremgangsmåde til fremstilling af 3,20-dioxo-19-nor-4,9,11-pregnatrien. | |
| DK126936B (da) | Fremgangsmåde til fremstilling af 3-oxo-13β-alkylgona-4,9,11-triener. | |
| DK120949B (da) | Analogifremgangsmåde til fremstilling af ethere af 3-oxygenerede-13β-alkyl-17β-hydroxygona-4,9,11-triener. | |
| DK127418B (da) | Fremgangsmåde til fremstilling af 13-alkyl-gona-1,3,5(10),6,8,14-hexaener. | |
| DK117955B (da) | Analogifremgangsmåde til fremstilling af N<4>-acrylerede 1-halogenbenzen-2,4-disulfonamider. | |
| DK109895C (da) | Fremgangsmåde til fremstilling af 1,3-dioxo-2-alkyl-cyclopentaner. |