DK113712B - Fremgangsmåde til fremstilling af ethan-1-hydroxy-1,1-diphosphonsyre og salte heraf. - Google Patents
Fremgangsmåde til fremstilling af ethan-1-hydroxy-1,1-diphosphonsyre og salte heraf.Info
- Publication number
- DK113712B DK113712B DK166866AA DK166866A DK113712B DK 113712 B DK113712 B DK 113712B DK 166866A A DK166866A A DK 166866AA DK 166866 A DK166866 A DK 166866A DK 113712 B DK113712 B DK 113712B
- Authority
- DK
- Denmark
- Prior art keywords
- ethane
- hydroxy
- salts
- preparation
- diphosphonic acid
- Prior art date
Links
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/3804—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)] not used, see subgroups
- C07F9/3839—Polyphosphonic acids
- C07F9/386—Polyphosphonic acids containing hydroxy substituents in the hydrocarbon radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US44403365A | 1965-03-30 | 1965-03-30 | |
| US553648A US3400149A (en) | 1965-03-30 | 1966-05-31 | Process for preparing organo-phosphorous compounds using phosphorous acid anhydridese |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK113712B true DK113712B (da) | 1969-04-21 |
Family
ID=27033751
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK166866AA DK113712B (da) | 1965-03-30 | 1966-03-30 | Fremgangsmåde til fremstilling af ethan-1-hydroxy-1,1-diphosphonsyre og salte heraf. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3400149A (cg-RX-API-DMAC7.html) |
| BE (2) | BE678618A (cg-RX-API-DMAC7.html) |
| CH (2) | CH478847A (cg-RX-API-DMAC7.html) |
| DE (2) | DE1261850B (cg-RX-API-DMAC7.html) |
| DK (1) | DK113712B (cg-RX-API-DMAC7.html) |
| GB (2) | GB1131916A (cg-RX-API-DMAC7.html) |
| NL (2) | NL6604219A (cg-RX-API-DMAC7.html) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3532461A (en) * | 1966-07-20 | 1970-10-06 | Procter & Gamble | Process for preparing chemical compounds containing trivalent phosphorus |
| US3504018A (en) * | 1966-12-19 | 1970-03-31 | Monsanto Co | Process for preparing phosphonic acids |
| US3528772A (en) * | 1967-10-26 | 1970-09-15 | Procter & Gamble | Process for preparation of orthophosphorous acid |
| US4129588A (en) * | 1973-09-07 | 1978-12-12 | The United States Of America As Represented By The Secretary Of Agriculture | Selective manufacture of anhydrous modifications of methyl phosphonic acid and use thereof in making pure methyl phosphonic acid and salts thereof |
| FR2359243A1 (fr) * | 1976-07-23 | 1978-02-17 | Protex Manuf Prod Chimiq | Procede de teinture en presence d'agents sequestrants |
| DE3047107A1 (de) * | 1980-12-13 | 1982-07-29 | Hoechst Ag, 6000 Frankfurt | Verfahren zur hertellung von 1-amino-alkan-1,1-diphosphonsaeuren |
| US4559181A (en) * | 1982-08-25 | 1985-12-17 | Minemet Rechreche | Hydroxy-diphosphonic acid derivatives of higher carboxylic acids |
| DE10049735A1 (de) * | 2000-09-28 | 2002-04-18 | Jenapharm Gmbh | Verfahren zur Isolierung von pharmazeutisch verwertbarem Etidronat-Dinatrium |
| CN102276646A (zh) * | 2011-07-01 | 2011-12-14 | 常州市科威精细化工有限公司 | 一种羟基乙叉二膦酸固体的生产方法 |
| EP3060567B1 (en) * | 2013-10-25 | 2018-12-05 | Straitmark Holding AG | Method for the synthesis of alkane-1-hydroxy-1,1-diphosphonic acid |
| US9777027B2 (en) | 2013-10-25 | 2017-10-03 | Straitmark Holding Ag | Method for the synthesis of ethane-1-hydroxy-1,1-diphosphonic acid |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL130828C (cg-RX-API-DMAC7.html) * | 1959-06-03 | |||
| BE611467A (cg-RX-API-DMAC7.html) * | 1960-12-15 | |||
| NL124638C (cg-RX-API-DMAC7.html) * | 1961-07-03 |
-
1966
- 1966-03-23 DE DEP39043A patent/DE1261850B/de active Pending
- 1966-03-29 BE BE678618D patent/BE678618A/xx unknown
- 1966-03-29 CH CH453866A patent/CH478847A/de not_active IP Right Cessation
- 1966-03-30 GB GB14088/66A patent/GB1131916A/en not_active Expired
- 1966-03-30 DK DK166866AA patent/DK113712B/da unknown
- 1966-03-30 NL NL6604219A patent/NL6604219A/xx unknown
- 1966-05-31 US US553648A patent/US3400149A/en not_active Expired - Lifetime
-
1967
- 1967-05-29 DE DE19671618788 patent/DE1618788A1/de active Pending
- 1967-05-30 BE BE699203D patent/BE699203A/xx unknown
- 1967-05-30 CH CH753767D patent/CH496739A/de not_active IP Right Cessation
- 1967-05-31 GB GB25128/67A patent/GB1145608A/en not_active Expired
- 1967-05-31 NL NL6707590A patent/NL6707590A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1131916A (en) | 1968-10-30 |
| GB1145608A (en) | 1969-03-19 |
| BE678618A (cg-RX-API-DMAC7.html) | 1966-09-29 |
| NL6604219A (cg-RX-API-DMAC7.html) | 1966-10-03 |
| US3400149A (en) | 1968-09-03 |
| BE699203A (cg-RX-API-DMAC7.html) | 1967-11-30 |
| NL6707590A (cg-RX-API-DMAC7.html) | 1967-12-01 |
| CH496739A (de) | 1970-09-30 |
| CH478847A (de) | 1969-09-30 |
| DE1618788A1 (de) | 1971-02-25 |
| DE1261850B (de) | 1968-02-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK128245B (da) | Analogifremgangsmåde til fremstilling af salte af bis-chromon-2-carboxylsyrer. | |
| DK121365B (da) | Analogifremgangsmåde til fremstilling af 4-chlor-5-sulfamylsalicylsyrederivater eller salte deraf. | |
| DK113712B (da) | Fremgangsmåde til fremstilling af ethan-1-hydroxy-1,1-diphosphonsyre og salte heraf. | |
| DK136059B (da) | Analogifremgangsmåde til fremstilling af 5-aroyl-pyrrol-derivater og salte deraf. | |
| DK118457B (da) | Analogifremgangsmåde til fremstilling af bis-guanylhydrazoner af diphenylurinstoffer eller salte deraf. | |
| DK118666B (da) | Fremgangsmåde til fremstilling af 3-amino-4-carboxamidopyrazol eller salte deraf. | |
| DK119974B (da) | Analogifremgangsmåde til fremstilling af benzensulfonylsemicarbazider elle salte heraf. | |
| DK113442B (da) | Fremgangsmåde til fremstilling af 1-isopropylamino-2-hydroxy-3-(o-alkoxymethyl-phenoxy)-propaner eller salte deraf. | |
| DK107095C (da) | Fremgangsmåde til fremstilling af azcycloalkanderivater eller salte deraf. | |
| DK124827B (da) | Analogifremgangsmåde til fremstilling af carboxyacylaminopenicilliner eller salte deraf. | |
| DK140457B (da) | Fremgangsmåde til fremstilling af substituerede malonsyrehydrazider eller salte deraf. | |
| DK116874B (da) | Fremgangsmåde til fremstilling af α-aminopenicilliner eller salte deraf. | |
| DK112528B (da) | Fremgangsmåde til fremstilling af tropanyl-2-phenylacrylatderivater eller salte deraf. | |
| DK124035B (da) | Fremgangsmåde til fremstilling af α-carboxybenzylpencillin eller salte deraf. | |
| DK118509B (da) | Fremgangsmåde til fremstilling af 1,1-diphenyl-1-metoxy-3-benzylaminopropan eller salte heraf. | |
| DK109600C (da) | Fremgangsmåde til fremstilling af 4-p-aminobenzensulfonylamidopyrimidiner eller salte deraf. | |
| DK123021B (da) | Analogifremgangsmåde til fremstilling af syreadditionssalte af 2-aminoadamantan. | |
| DK112030B (da) | Fremgangsmåde til fremstilling af 3-amino-1-adamantancarboxylsyre eller salte deraf. | |
| DK121864B (da) | Analogifremgangsmåde til fremstilling af salte af substituerede s-triaziner. | |
| DK105591C (da) | Fremgangsmåde til fremstilling af 4-karboxyalkylmerkapto-5-aryl-pyrimidiner eller salte deraf. | |
| DK123982B (da) | Analogifremgangsmåde til fremstilling af thienyloxymethylpenicilliner eller salte deraf. | |
| DK113652B (da) | Fremgangsmåde til fremstilling af naphthoxypropanolderivater eller salte deraf. | |
| DK115262B (da) | Fremgangsmåde til fremstilling af 2-guanidinoalkyl-1-aza-cycloakyliminforbindelser eller salte deraf. | |
| DK110037C (da) | Fremgangsmåde til fremstilling af {-amino-3-hydroxy-5-isoxazoleddikesyre eller salte deraf. | |
| DK131852B (da) | Analogifremgangsmåde til fremstilling af 2-amino-halogen-benzylaminer eller salte heraf. |