DEG0014134MA - - Google Patents
Info
- Publication number
- DEG0014134MA DEG0014134MA DEG0014134MA DE G0014134M A DEG0014134M A DE G0014134MA DE G0014134M A DEG0014134M A DE G0014134MA
- Authority
- DE
- Germany
- Prior art keywords
- layer
- conductive
- glass
- electroluminescent
- electroluminescent panel
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000011521 glass Substances 0.000 claims description 21
- 239000004744 fabric Substances 0.000 claims description 19
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 10
- 229910052751 metal Inorganic materials 0.000 claims description 10
- 239000002184 metal Substances 0.000 claims description 10
- 239000003365 glass fiber Substances 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 6
- 239000003989 dielectric material Substances 0.000 claims description 3
- 239000012266 salt solution Substances 0.000 claims description 3
- 230000005684 electric field Effects 0.000 claims description 2
- VRDNAHLDDUCBMP-UHFFFAOYSA-K indium(3+);2,2,2-trifluoroacetate Chemical compound [In+3].[O-]C(=O)C(F)(F)F.[O-]C(=O)C(F)(F)F.[O-]C(=O)C(F)(F)F VRDNAHLDDUCBMP-UHFFFAOYSA-K 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 claims description 2
- 238000000354 decomposition reaction Methods 0.000 claims 1
- 239000012799 electrically-conductive coating Substances 0.000 claims 1
- 239000000123 paper Substances 0.000 description 9
- 239000000835 fiber Substances 0.000 description 7
- 229920003023 plastic Polymers 0.000 description 6
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 3
- 229910052793 cadmium Inorganic materials 0.000 description 3
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 229910052738 indium Inorganic materials 0.000 description 3
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 3
- 238000000465 moulding Methods 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229910052718 tin Inorganic materials 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 239000011152 fibreglass Substances 0.000 description 2
- PSCMQHVBLHHWTO-UHFFFAOYSA-K indium(iii) chloride Chemical compound Cl[In](Cl)Cl PSCMQHVBLHHWTO-UHFFFAOYSA-K 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000002985 plastic film Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- SVONRAPFKPVNKG-UHFFFAOYSA-N 2-ethoxyethyl acetate Chemical compound CCOCCOC(C)=O SVONRAPFKPVNKG-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- LMJCYTXYVJJFFN-UHFFFAOYSA-N [O-2].P.[S-2].[Zn+2].[Zn+2] Chemical compound [O-2].P.[S-2].[Zn+2].[Zn+2] LMJCYTXYVJJFFN-UHFFFAOYSA-N 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- XIEPJMXMMWZAAV-UHFFFAOYSA-N cadmium nitrate Inorganic materials [Cd+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XIEPJMXMMWZAAV-UHFFFAOYSA-N 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 239000004568 cement Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000005401 electroluminescence Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 1
- 239000011120 plywood Substances 0.000 description 1
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 1
- 239000005401 pressed glass Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000011090 solid board Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000007738 vacuum evaporation Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69019318T2 (de) | Elektrolumineszentes Lampenpaneel. | |
| DE964973C (de) | Biegsame, elektrolumineszierende, geschichtete Tafel | |
| DE2923770C2 (show.php) | ||
| DE69926112T2 (de) | Flexibles substrat | |
| DE69314721T2 (de) | Durchsichtiges Flächenheizelement und Verfahren für seine Herstellung | |
| US2774004A (en) | Flexible electroluminescent laminated panel | |
| DE102011077687B4 (de) | Organische leuchtdiode, verfahren zur herstellung einer organischen leuchtdiode und modul mit mindestens zwei organischen leuchtdioden | |
| EP2308117B1 (de) | Strahlungsemittierende vorrichtung und verfahren zur herstellung einer strahlungsemittierenden vorrichtung | |
| DE3426515A1 (de) | Durch klebstoff verbundenes elektrolumineszenz-system | |
| DE3740559A1 (de) | Elektrolumineszierendes lichtelement | |
| DE102008004942A1 (de) | Mehrschichtelement mit einer ersten transparenten Flächenelektrode | |
| DE102009017787A1 (de) | Optoelektronische Folienanordnung | |
| DE68906431T2 (de) | Verlängerte elektrolumineszierende Zelle sowie Verfahren zur Herstellung. | |
| DE10328140B4 (de) | Organische lichtemittierende Einrichtung und Verfahren zu deren Herstellung | |
| EP1033762A2 (de) | Aus Fasern aufgebauter Sonnenkollektor | |
| DE3313579C2 (show.php) | ||
| DEG0014134MA (show.php) | ||
| DE2016211C3 (de) | Verfahren zur Herstellung einer Halbleitervorrichtung | |
| DE2942328A1 (de) | Photovolt-vorrichtung | |
| DE4225576A1 (de) | Photoelektrochemische Zelle | |
| DE102006005025A1 (de) | Thermische Nachbehandlung hochleitfähiger, transparenter Metalloxid-Schichten mittels Blitzlampen-Temperung | |
| DE3328899C2 (de) | Photovoltaische Zelle | |
| DE2035454C3 (de) | Elektrolumineszenz-Leuchtzelle | |
| DE2941245A1 (de) | Elektrolumineszente zelle und verfahren zu ihrer herstellung | |
| EP3520154A1 (de) | Kontaktierung von optoelektronischen bauelementen |