DE7425440U - Zwischenbehaelter fuer stranggussanlagen - Google Patents
Zwischenbehaelter fuer stranggussanlagenInfo
- Publication number
- DE7425440U DE7425440U DE7425440U DE7425440U DE7425440U DE 7425440 U DE7425440 U DE 7425440U DE 7425440 U DE7425440 U DE 7425440U DE 7425440 U DE7425440 U DE 7425440U DE 7425440 U DE7425440 U DE 7425440U
- Authority
- DE
- Germany
- Prior art keywords
- intermediate container
- permanent
- lining
- container according
- refractory
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000009749 continuous casting Methods 0.000 title claims description 8
- 239000011819 refractory material Substances 0.000 claims description 23
- 229910052751 metal Inorganic materials 0.000 claims description 21
- 239000002184 metal Substances 0.000 claims description 21
- 239000000463 material Substances 0.000 claims description 20
- 239000011449 brick Substances 0.000 claims description 13
- 239000012774 insulation material Substances 0.000 claims description 10
- 239000000835 fiber Substances 0.000 claims description 5
- 239000000945 filler Substances 0.000 claims description 4
- 239000011810 insulating material Substances 0.000 claims description 4
- 239000011230 binding agent Substances 0.000 claims description 2
- 125000006850 spacer group Chemical group 0.000 claims description 2
- 238000000465 moulding Methods 0.000 claims 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 26
- 239000004576 sand Substances 0.000 description 10
- 229910000831 Steel Inorganic materials 0.000 description 8
- 239000010959 steel Substances 0.000 description 8
- 239000006004 Quartz sand Substances 0.000 description 5
- 238000005266 casting Methods 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 239000010450 olivine Substances 0.000 description 4
- 229910052609 olivine Inorganic materials 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 239000010425 asbestos Substances 0.000 description 3
- 239000001095 magnesium carbonate Substances 0.000 description 3
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 3
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 3
- 235000014380 magnesium carbonate Nutrition 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229910052895 riebeckite Inorganic materials 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 239000000378 calcium silicate Substances 0.000 description 2
- 229910052918 calcium silicate Inorganic materials 0.000 description 2
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 230000003628 erosive effect Effects 0.000 description 2
- 239000010419 fine particle Substances 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- 239000003566 sealing material Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 1
- 229910000655 Killed steel Inorganic materials 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- GZCGUPFRVQAUEE-SLPGGIOYSA-N aldehydo-D-glucose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O GZCGUPFRVQAUEE-SLPGGIOYSA-N 0.000 description 1
- 239000011822 basic refractory Substances 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- -1 broken chamotte Substances 0.000 description 1
- 239000004568 cement Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000005253 cladding Methods 0.000 description 1
- 239000000571 coke Substances 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000009970 fire resistant effect Effects 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910001338 liquidmetal Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000003110 molding sand Substances 0.000 description 1
- 239000011823 monolithic refractory Substances 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 1
- 229910010271 silicon carbide Inorganic materials 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 229910000500 β-quartz Inorganic materials 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B22—CASTING; POWDER METALLURGY
- B22D—CASTING OF METALS; CASTING OF OTHER SUBSTANCES BY THE SAME PROCESSES OR DEVICES
- B22D41/00—Casting melt-holding vessels, e.g. ladles, tundishes, cups or the like
- B22D41/02—Linings
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Casting Support Devices, Ladles, And Melt Control Thereby (AREA)
- Furnace Housings, Linings, Walls, And Ceilings (AREA)
- Ceramic Products (AREA)
- Compositions Of Oxide Ceramics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3618573A GB1469513A (en) | 1973-07-30 | 1973-07-30 | Tundishes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE7425440U true DE7425440U (de) | 1976-06-24 |
Family
ID=10385756
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2435895A Ceased DE2435895A1 (de) | 1973-07-30 | 1974-07-25 | Zwischenbehaelter fuer stranggussanlagen |
| DE7425440U Expired DE7425440U (de) | 1973-07-30 | 1974-07-25 | Zwischenbehaelter fuer stranggussanlagen |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2435895A Ceased DE2435895A1 (de) | 1973-07-30 | 1974-07-25 | Zwischenbehaelter fuer stranggussanlagen |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4012029A (enExample) |
| AR (1) | AR201052A1 (enExample) |
| AT (1) | AT335647B (enExample) |
| AU (1) | AU472279B2 (enExample) |
| BR (1) | BR7406221D0 (enExample) |
| CA (1) | CA977124A (enExample) |
| CH (1) | CH574784A5 (enExample) |
| DE (2) | DE2435895A1 (enExample) |
| ES (1) | ES428756A1 (enExample) |
| FI (1) | FI227274A7 (enExample) |
| FR (1) | FR2239309B1 (enExample) |
| GB (1) | GB1469513A (enExample) |
| IN (1) | IN139870B (enExample) |
| IT (1) | IT1016721B (enExample) |
| NL (1) | NL7410250A (enExample) |
| SE (1) | SE410152B (enExample) |
| ZA (1) | ZA744818B (enExample) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU72865A1 (enExample) * | 1975-06-30 | 1977-03-07 | ||
| GB1542962A (en) * | 1976-04-07 | 1979-03-28 | Foseco Trading Ag | Tundishes |
| GB1585180A (en) * | 1976-10-07 | 1981-02-25 | Foseco Trading Ag | Lining slabs for containers for molten metal |
| JPS5346310A (en) * | 1976-10-08 | 1978-04-25 | Fuoseko Japan Rimitetsudo Yuug | Refractory heattinsulating lining material for tandish |
| SE434352B (sv) * | 1976-11-04 | 1984-07-23 | Foseco Int | Forfarande och anordning for forvermning av samverkande delar av ett munstycke och en stopparstang i ett for smelt metall avsett kerl |
| GB1537739A (en) * | 1976-12-07 | 1979-01-04 | Foseco Trading Ag | Molten metal handling vessels |
| US4194730A (en) * | 1977-12-27 | 1980-03-25 | Foseco Trading Ag | Molten metal handling vessels |
| FR2451789A1 (fr) * | 1979-03-22 | 1980-10-17 | Daussan & Co | Revetement thermiquement isolant pour recipients metallurgiques et procede s'y rapportant |
| FR2459094A2 (fr) * | 1979-06-21 | 1981-01-09 | Foseco Trading Ag | Repartiteur a double garnissage de matiere refractaire pour la coulee de metaux |
| US4325538A (en) * | 1979-12-27 | 1982-04-20 | Biuro Projektow Przemyslu Metali Niezelaznych "Bipromet" | Smelting furnace for direct obtaining of copper from ore concentrates/and copper ores |
| US4330107A (en) * | 1980-07-08 | 1982-05-18 | Foseco Trading A.G. | Teapot ladle and method of use |
| AT375850B (de) * | 1980-07-16 | 1984-09-10 | Voest Alpine Ag | Verfahren zur heissreparatur der schutzschicht auf dem dauerfutter eines zwischengefaesses einer stranggiessanlage |
| DE3167851D1 (en) * | 1980-10-01 | 1985-01-31 | Ants Nomtak | Vessel for molten metal and method of making it |
| JPS5781945A (en) * | 1980-11-10 | 1982-05-22 | Aikoo Kk | Container for molten metal |
| US4367866A (en) * | 1981-04-10 | 1983-01-11 | Sunbeam Equipment Corporation | Furnace adapted to contain molten metal |
| US4441700A (en) * | 1981-05-07 | 1984-04-10 | Labate M D | Blast furnace trough and liner combination |
| US4372544A (en) * | 1981-05-07 | 1983-02-08 | Labate Michael D | Blast furnace trough and liner combination |
| JPS57184884A (en) * | 1981-05-08 | 1982-11-13 | Fuaizaa Kuiguree Kk | Protective layer for metallurgical vessel |
| DE3271012D1 (en) * | 1981-09-19 | 1986-06-12 | Foseco Trading Ag | Molten metal transfer channels |
| DE3151533C2 (de) * | 1981-12-24 | 1983-11-24 | Günter Dr.-Ing. 5750 Menden Altland | Verlängerte Ausgußdüse für Zwischenbehälter |
| GB2121150B (en) * | 1982-05-27 | 1985-11-13 | Morganite Thermal Designs Limi | Linings for molten metal holders |
| GB2134234B (en) * | 1983-01-21 | 1987-07-15 | Labate Michael D | Blast furnace trough and liner combination |
| FR2585273B1 (fr) * | 1985-07-24 | 1988-05-13 | Daussan & Co | Revetement pour proteger l'interieur d'un recipient metallurgique et procede pour realiser ce revetement |
| GB8526669D0 (en) * | 1985-10-30 | 1985-12-04 | Micropore International Ltd | Vessel |
| US5110096A (en) * | 1991-02-15 | 1992-05-05 | Foseco International Limited | One-piece tundish lining |
| GB9216079D0 (en) * | 1992-07-28 | 1992-09-09 | Foseco Int | Lining of molten metal handling vessel |
| US5316071A (en) * | 1993-05-13 | 1994-05-31 | Wagstaff Inc. | Molten metal distribution launder |
| US5484138A (en) * | 1993-11-22 | 1996-01-16 | Magneco/Metrel, Inc. | Consumable form with adjustable walls |
| US5512316A (en) * | 1994-04-11 | 1996-04-30 | Minerals Technologies, Inc. | Method of protecting ladle linings |
| US5941237A (en) * | 1996-01-19 | 1999-08-24 | Heat-N-Glo Fireplace Products, Inc. | Universal non-porous fiber reinforced combustion chamber fireplace |
| US6083453A (en) * | 1997-12-12 | 2000-07-04 | Uss/Kobe Steel Company | Tundish having fume collection provisions |
| CN106862547B (zh) * | 2017-02-28 | 2019-04-23 | 山东钢铁股份有限公司 | 一种吸附钢水中夹杂物的中间包工作层内衬结构 |
| TWI837098B (zh) * | 2017-08-29 | 2024-04-01 | 美商維蘇威美國公司 | 耐火襯裡結構及冶金容器 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1681943A (en) * | 1925-12-18 | 1928-08-28 | New Castle Refractories Compan | Ladle lining |
| US1871159A (en) * | 1929-05-15 | 1932-08-09 | Westinghouse Electric & Mfg Co | Induction-furnace lining |
| US1917849A (en) * | 1930-07-26 | 1933-07-11 | Ajax Electrothermic Corp | Refractory lining |
| GB932073A (en) * | 1961-05-15 | 1963-07-24 | Campbell Gifford & Morton Ltd | Improvements in refractory-lined tundishes |
| AT275174B (de) * | 1967-01-02 | 1969-10-10 | Dolomite Franchi S P A | Feuerfeste Auskleidung für elektrische Lichtbogenöfen |
| GB1364665A (en) * | 1971-12-07 | 1974-08-29 | Foseco Trading Ag | Tundishes |
-
1973
- 1973-07-30 GB GB3618573A patent/GB1469513A/en not_active Expired
-
1974
- 1974-07-24 SE SE7409622A patent/SE410152B/xx not_active IP Right Cessation
- 1974-07-25 DE DE2435895A patent/DE2435895A1/de not_active Ceased
- 1974-07-25 DE DE7425440U patent/DE7425440U/de not_active Expired
- 1974-07-27 IN IN1683/CAL/74A patent/IN139870B/en unknown
- 1974-07-29 FI FI2272/74A patent/FI227274A7/fi unknown
- 1974-07-29 IT IT69406/74A patent/IT1016721B/it active
- 1974-07-29 ZA ZA00744818A patent/ZA744818B/xx unknown
- 1974-07-29 AU AU71767/74A patent/AU472279B2/en not_active Expired
- 1974-07-29 BR BR6221/74A patent/BR7406221D0/pt unknown
- 1974-07-29 AR AR254934A patent/AR201052A1/es active
- 1974-07-29 CA CA205,833A patent/CA977124A/en not_active Expired
- 1974-07-30 ES ES428756A patent/ES428756A1/es not_active Expired
- 1974-07-30 FR FR7426420A patent/FR2239309B1/fr not_active Expired
- 1974-07-30 AT AT625274A patent/AT335647B/de not_active IP Right Cessation
- 1974-07-30 NL NL7410250A patent/NL7410250A/xx not_active Application Discontinuation
- 1974-07-30 CH CH1051074A patent/CH574784A5/xx not_active IP Right Cessation
- 1974-07-30 US US05/493,893 patent/US4012029A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ES428756A1 (es) | 1976-09-01 |
| CH574784A5 (enExample) | 1976-04-30 |
| ZA744818B (en) | 1975-08-27 |
| FR2239309B1 (enExample) | 1976-10-22 |
| AT335647B (de) | 1977-03-25 |
| NL7410250A (nl) | 1975-02-03 |
| ATA625274A (de) | 1976-07-15 |
| FR2239309A1 (enExample) | 1975-02-28 |
| BR7406221D0 (pt) | 1975-04-22 |
| DE2435895A1 (de) | 1975-02-13 |
| US4012029A (en) | 1977-03-15 |
| FI227274A7 (enExample) | 1975-01-31 |
| AU472279B2 (en) | 1976-05-20 |
| AU7176774A (en) | 1976-02-19 |
| IT1016721B (it) | 1977-06-20 |
| IN139870B (enExample) | 1976-08-14 |
| SE7409622L (enExample) | 1975-01-31 |
| AR201052A1 (es) | 1975-02-06 |
| GB1469513A (en) | 1977-04-06 |
| CA977124A (en) | 1975-11-04 |
| SE410152B (sv) | 1979-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE7425440U (de) | Zwischenbehaelter fuer stranggussanlagen | |
| DE2259553B2 (de) | Zwischenbehälter für Stranggießanlagen | |
| DE3010868C2 (enExample) | ||
| DE2651295C3 (de) | Feuerfester ebener Auskleidungsteil für Gießereizwecke | |
| DE7619744U1 (de) | Umfuellbehaelter fuer fluessiges metall | |
| DE2653213C2 (de) | Vorrichtung zur Erzeugung eines Wärmestaus in der Nähe der Gießöffnung eines Zwischenbehälters | |
| DE3119548C1 (de) | Verschleissschicht eines mit Dauerfutter ausgekleideten metallurgischen Gefaesses mit einer zum Dauerfutter hin nicht gesinterten Schicht | |
| DE1807731B2 (de) | Verfahren zur herstellung von floatglas | |
| DE2715707A1 (de) | Zwischengefaess | |
| DE2754520C3 (de) | Gefäß zur Aufnahme von Metallschmelze | |
| DE2949998A1 (de) | Verfahren zum herstellen einer bausteineinheit fuer die wand eines metallurgischen ofens | |
| DE3910136C2 (enExample) | ||
| US3391726A (en) | Hot top lining | |
| DE7624644U1 (de) | Zusammengesetzte giessformen fuer metallguss | |
| DE1758269C3 (de) | Feuerfeste Isolierplatte für die Auskleidung von Metallgehäusen, und daraus hergestellte Auskleidung | |
| DE2713461B1 (de) | Horizontaler Verkokungsofen | |
| DE2630500C2 (de) | Schutzrohr für die Schmelzzuführung zu einem Zwischenbehälter | |
| DE856796C (de) | Eingusskopf fuer Blockgiessformen | |
| DE1458173A1 (de) | Plattenanordnung zur Verwendung beim Halten einer in eine Kokille zu giessenden Masse aus geschmolzenem Metall | |
| US3265347A (en) | Hot top | |
| DE2456241C2 (de) | Wärmehaube für Blockgießkokillen und Gießpfannen die zum Vergießen von beruhigtem Stahl dienen | |
| US1829114A (en) | Mold for casting refractories | |
| DE2636688A1 (de) | Industrieofen mit dessen innenwandung abdeckenden und isolierenden vorgefertigten flaechenelementen | |
| AT230921B (de) | Aus übereinandergeschichteten Blechmantelsteinen aufgebauter, großformatiger, feuerfester Block | |
| DE2103028A1 (de) | Wandmatenal fur Blockformauf satze zum Giessen von Stahl oder ande rem Metall |