DE3362129D1 - 2,2,2-trihalo-1-(trihalomethyl)ethylidene-bisbenzenethiols - Google Patents
2,2,2-trihalo-1-(trihalomethyl)ethylidene-bisbenzenethiolsInfo
- Publication number
- DE3362129D1 DE3362129D1 DE8383903873T DE3362129T DE3362129D1 DE 3362129 D1 DE3362129 D1 DE 3362129D1 DE 8383903873 T DE8383903873 T DE 8383903873T DE 3362129 T DE3362129 T DE 3362129T DE 3362129 D1 DE3362129 D1 DE 3362129D1
- Authority
- DE
- Germany
- Prior art keywords
- ethiols
- bisbenzene
- trihalo
- trihalomethyl
- ethylidene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- BSZXAFXFTLXUFV-UHFFFAOYSA-N 1-phenylethylbenzene Chemical compound C=1C=CC=CC=1C(C)C1=CC=CC=C1 BSZXAFXFTLXUFV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/07—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms
- C07C205/11—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C39/00—Compounds having at least one hydroxy or O-metal group bound to a carbon atom of a six-membered aromatic ring
- C07C39/24—Halogenated derivatives
- C07C39/367—Halogenated derivatives polycyclic non-condensed, containing only six-membered aromatic rings as cyclic parts, e.g. halogenated poly-hydroxyphenylalkanes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/453,431 US4720590A (en) | 1982-12-27 | 1982-12-27 | [2,2,2-trihalo-1-(trihalomethyl)]ethylidene-bisbenzenethiols |
| PCT/US1983/001751 WO1984002524A1 (en) | 1982-12-27 | 1983-11-07 | 2,2,2-trihalo-1-(trihalomethyl)ethylidene-bisbenzenethiols |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3362129D1 true DE3362129D1 (de) | 1986-03-27 |
Family
ID=23800557
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8383903873T Expired DE3362129D1 (de) | 1982-12-27 | 1983-11-07 | 2,2,2-trihalo-1-(trihalomethyl)ethylidene-bisbenzenethiols |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4720590A (enExample) |
| EP (1) | EP0129561B1 (enExample) |
| JP (1) | JPS60500175A (enExample) |
| CA (1) | CA1181097A (enExample) |
| DE (1) | DE3362129D1 (enExample) |
| IT (1) | IT1172389B (enExample) |
| WO (1) | WO1984002524A1 (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4695655A (en) * | 1984-09-04 | 1987-09-22 | Hughes Aircraft Company | Ethynylthiophenoxy derivatives of diphenylhexafluoropropane |
| US4866156A (en) * | 1985-12-12 | 1989-09-12 | Hughes Aircraft Copmany | Poly(arylether) or poly(arylthioether) from 2,2-bis(fluorophenyl)-hexafluoropropane |
| DE3624913A1 (de) * | 1986-07-23 | 1988-01-28 | Hoechst Ag | Verfahren zur herstellung von 2.2-bis(3-nitrophenyl)-hexafluorpropan sowie das dabei als zwischenprodukt auftretende 2.2-bis(4-carboxy-3-nitrophenyl)hexafluorpropan |
| DE19655356B4 (de) * | 1995-07-07 | 2007-12-27 | Nippon Mektron, Ltd. | Verfahren zur Herstellung einer Bisthiophenylperfluoralkyliden-Verbindung |
| JP3823343B2 (ja) * | 1995-07-07 | 2006-09-20 | ユニマテック株式会社 | 新規ビス(クロロスルホニルフェニル)パーフルオロアルキリデン化合物 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3291777A (en) * | 1963-02-27 | 1966-12-13 | Du Pont | Polymers from polyfluoroketones |
| US3274267A (en) * | 1963-09-23 | 1966-09-20 | Union Carbide Corp | Cyclic alpha-perfluoro-di-p-xylylenes |
| GB1135773A (en) * | 1965-04-28 | 1968-12-04 | Imp Semlting Corp N S C Ltd | Thiols |
| US3332909A (en) * | 1965-07-15 | 1967-07-25 | Union Carbide Corp | Polyarylene polyethers |
| CH464538A (de) * | 1966-03-28 | 1968-10-31 | Inventa Ag | Verfahren zur Herstellung von hitzebeständigen, linearen, thermoplastischen Polythioäthern |
| US3873593A (en) * | 1971-01-20 | 1975-03-25 | Gen Electric | Process for making aryloxy compositions |
| US3855313A (en) * | 1971-05-26 | 1974-12-17 | Univ Illinois | Insecticidal biodegradable methylthio analogs of ddt |
| US3736293A (en) * | 1971-08-23 | 1973-05-29 | Du Pont | Polyethers containing repeating perchloroaromatic units |
| US3929852A (en) * | 1974-05-01 | 1975-12-30 | Pennwalt Corp | Process for preparing {60 ,{62 -unsaturated thiolesters |
| US4238601A (en) * | 1979-06-25 | 1980-12-09 | The United States Of America As Represented By The Secretary Of The Navy | Perfluorinated aliphatic phenoxy bisorthodinitriles and polyphthalocyanines therefrom |
-
1982
- 1982-12-27 US US06/453,431 patent/US4720590A/en not_active Expired - Lifetime
-
1983
- 1983-11-07 DE DE8383903873T patent/DE3362129D1/de not_active Expired
- 1983-11-07 JP JP84500045A patent/JPS60500175A/ja active Granted
- 1983-11-07 EP EP83903873A patent/EP0129561B1/en not_active Expired
- 1983-11-07 WO PCT/US1983/001751 patent/WO1984002524A1/en not_active Ceased
- 1983-11-10 CA CA000440873A patent/CA1181097A/en not_active Expired
- 1983-12-22 IT IT49567/83A patent/IT1172389B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| JPS60500175A (ja) | 1985-02-07 |
| CA1181097A (en) | 1985-01-15 |
| IT1172389B (it) | 1987-06-18 |
| JPS6124386B2 (enExample) | 1986-06-10 |
| WO1984002524A1 (en) | 1984-07-05 |
| EP0129561A1 (en) | 1985-01-02 |
| US4720590A (en) | 1988-01-19 |
| EP0129561B1 (en) | 1986-02-12 |
| IT8349567A0 (it) | 1983-12-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU1179924A3 (ru) | "cпocoб пoлучehия пpoизboдhыx иmидaзoлa или иx taуtomepob,или kиcлotho-aддиtиbhыx coлeй" | |
| FI831664L (fi) | 1,3-dioxan-5-ylalkenoylsyror | |
| MA19680A1 (fr) | N- arylsulfonyl - n' - pyrimidinylurees. | |
| DK587183A (da) | 1,4-benzodiazepin-derivater | |
| FI830203A0 (fi) | Syrahydrolys, alkaliextraktion, materialbehandling | |
| FI824057L (fi) | Laosbar, snabbt loestagbar vridhake foer baerrem | |
| FI831952A0 (fi) | Hydrolyskaensliga, aktivaemne innehaollande, lagringsstabila tabletter | |
| FI832692L (fi) | Slangformigt livsmedelshoelje, isynnerhet korvhoelje | |
| FI831343A0 (fi) | Koerbar spaorstampnings, planings- och riktmaskin | |
| FI831101A0 (fi) | Deformerbart, roerformigt kopplingsdon | |
| MX9203211A (es) | 6'-alquilespectinomicinas. | |
| DE3365097D1 (de) | 6,7-dihydro-7,7-disubstituted-khellins | |
| DE3362129D1 (de) | 2,2,2-trihalo-1-(trihalomethyl)ethylidene-bisbenzenethiols | |
| DE3372615D1 (de) | 6-anilino-5,8-quinoxalinediones | |
| DE3360666D1 (de) | 2,6-dicyanoanilines | |
| FI832243A0 (fi) | Foerpackning, speciellt foer cigaretthylsor | |
| FI832976A0 (fi) | Tvaospaksreglage, isynnerhet foer baotmotorer | |
| ES264864Y (es) | "pesacartas". | |
| ES267636Y (es) | "lustrador". | |
| FI834384L (fi) | Framstaellningsfoerfarande foer 4(5)- acetyl-2-metylimidazol. | |
| FI820402L (fi) | Skida, speciellt terraengskida | |
| FI831983L (fi) | Vattendistributionssystem, saerskilt foer foeraongare foer vaermepumpar | |
| ES265530Y (es) | "perfil-esquinero perfeccionado". | |
| ES265226Y (es) | "tapapezunas". | |
| ES265809Y (es) | "contenedor-expositor". |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |