DE3315681A1 - Verfahren zur herstellung von oxiranen - Google Patents
Verfahren zur herstellung von oxiranenInfo
- Publication number
- DE3315681A1 DE3315681A1 DE19833315681 DE3315681A DE3315681A1 DE 3315681 A1 DE3315681 A1 DE 3315681A1 DE 19833315681 DE19833315681 DE 19833315681 DE 3315681 A DE3315681 A DE 3315681A DE 3315681 A1 DE3315681 A1 DE 3315681A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- tert
- dimethyl
- process according
- sodium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000002924 oxiranes Chemical class 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 25
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 claims description 14
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 claims description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 9
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 150000002576 ketones Chemical class 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- ANXKZXRDXAZQJT-UHFFFAOYSA-M methyl sulfate;trimethylsulfanium Chemical compound C[S+](C)C.COS([O-])(=O)=O ANXKZXRDXAZQJT-UHFFFAOYSA-M 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 238000002955 isolation Methods 0.000 claims description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 claims description 3
- ILQGIJDYSLHIOX-UHFFFAOYSA-N 1-(4-chlorophenyl)-4,4-dimethylpentan-3-one Chemical compound CC(C)(C)C(=O)CCC1=CC=C(Cl)C=C1 ILQGIJDYSLHIOX-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 claims description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 claims description 2
- 239000012312 sodium hydride Substances 0.000 claims description 2
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 2
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 8
- QLCGXXYDHCTVKP-UHFFFAOYSA-N 2-tert-butyl-2-[2-(4-chlorophenyl)ethyl]oxirane Chemical compound C=1C=C(Cl)C=CC=1CCC1(C(C)(C)C)CO1 QLCGXXYDHCTVKP-UHFFFAOYSA-N 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 230000000855 fungicidal effect Effects 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- GNBNHUUABUEZGZ-UHFFFAOYSA-N 1-(1h-pyrrol-2-yl)ethanol Chemical class CC(O)C1=CC=CN1 GNBNHUUABUEZGZ-UHFFFAOYSA-N 0.000 description 2
- PXMNMQRDXWABCY-UHFFFAOYSA-N 1-(4-chlorophenyl)-4,4-dimethyl-3-(1H-1,2,4-triazol-1-ylmethyl)pentan-3-ol Chemical compound C1=NC=NN1CC(O)(C(C)(C)C)CCC1=CC=C(Cl)C=C1 PXMNMQRDXWABCY-UHFFFAOYSA-N 0.000 description 2
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 230000000630 rising effect Effects 0.000 description 2
- RXGHMNIJLHIADK-UHFFFAOYSA-N 1-chloro-4-(4,4-dimethylpentyl)benzene Chemical compound CC(C)(C)CCCC1=CC=C(Cl)C=C1 RXGHMNIJLHIADK-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- -1 dimethyl sulfate 1- (4-chloro-phenyl) -4,4-dimethyl-pentan-3-one Chemical compound 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- SATVIFGJTRRDQU-UHFFFAOYSA-N potassium hypochlorite Chemical compound [K+].Cl[O-] SATVIFGJTRRDQU-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/22—Ethers with hydroxy compounds containing no oxirane rings with monohydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/04—Compounds containing oxirane rings containing only hydrogen and carbon atoms in addition to the ring oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/08—Compounds containing oxirane rings with hydrocarbon radicals, substituted by halogen atoms, nitro radicals or nitroso radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Epoxy Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833315681 DE3315681A1 (de) | 1983-04-29 | 1983-04-29 | Verfahren zur herstellung von oxiranen |
| DE8484104328T DE3474960D1 (en) | 1983-04-29 | 1984-04-17 | Process for the preparation of oxiranes |
| EP84104328A EP0124009B1 (de) | 1983-04-29 | 1984-04-17 | Verfahren zur Herstellung von Oxiranen |
| JP59082140A JPS59206377A (ja) | 1983-04-29 | 1984-04-25 | オキシラン類の製造法 |
| US06/772,066 US4898954A (en) | 1983-04-29 | 1985-09-03 | Process for the preparation of oxiranes |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833315681 DE3315681A1 (de) | 1983-04-29 | 1983-04-29 | Verfahren zur herstellung von oxiranen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3315681A1 true DE3315681A1 (de) | 1984-10-31 |
Family
ID=6197748
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19833315681 Withdrawn DE3315681A1 (de) | 1983-04-29 | 1983-04-29 | Verfahren zur herstellung von oxiranen |
| DE8484104328T Expired DE3474960D1 (en) | 1983-04-29 | 1984-04-17 | Process for the preparation of oxiranes |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8484104328T Expired DE3474960D1 (en) | 1983-04-29 | 1984-04-17 | Process for the preparation of oxiranes |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4898954A (enExample) |
| EP (1) | EP0124009B1 (enExample) |
| JP (1) | JPS59206377A (enExample) |
| DE (2) | DE3315681A1 (enExample) |
Cited By (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4929735A (en) * | 1985-10-24 | 1990-05-29 | Bayer Aktiengesellschaft | Process for the preparation of oxiranes |
| WO2011113820A1 (en) | 2010-03-16 | 2011-09-22 | Basf Se | A process using grignard reagents |
| WO2012041858A1 (en) | 2010-09-30 | 2012-04-05 | Basf Se | A process for the synthesis of thio-triazolo-group containing compounds |
| WO2012130823A1 (en) | 2011-03-30 | 2012-10-04 | Basf Se | Suspension concentrates |
| WO2012146535A1 (en) | 2011-04-28 | 2012-11-01 | Basf Se | Process for the preparation of 2-substituted 2,4-dihydro-[1,2,4]triazole-3-thiones |
| WO2012146598A1 (en) | 2011-04-28 | 2012-11-01 | Basf Se | Process for the preparation of 2-substituted 4-amino-2,4-dihydro-[1,2,4]triazole-3-thiones |
| EP2746258A1 (en) | 2012-12-21 | 2014-06-25 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| EP2746257A1 (en) | 2012-12-21 | 2014-06-25 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| WO2014167009A1 (en) | 2013-04-12 | 2014-10-16 | Bayer Cropscience Ag | Novel triazole derivatives |
| WO2014167008A1 (en) | 2013-04-12 | 2014-10-16 | Bayer Cropscience Ag | Novel triazolinthione derivatives |
| WO2016156294A1 (en) | 2015-04-02 | 2016-10-06 | Bayer Cropscience Aktiengesellschaft | Triazol derivatives as fungicides |
| WO2016156282A1 (en) | 2015-04-02 | 2016-10-06 | Bayer Cropscience Aktiengesellschaft | Novel triazole compounds for controlling phytopathogenic harmful fungi |
| WO2016156290A1 (en) | 2015-04-02 | 2016-10-06 | Bayer Cropscience Aktiengesellschaft | Novel 5-substituted imidazole derivatives |
| US9668481B2 (en) | 2013-04-12 | 2017-06-06 | Bayer Cropscience Aktiengesellschaft | Triazole derivatives |
| WO2018050535A1 (en) | 2016-09-13 | 2018-03-22 | Bayer Cropscience Aktiengesellschaft | Active compound combinations |
| WO2018050456A1 (en) | 2016-09-13 | 2018-03-22 | Bayer Cropscience Aktiengesellschaft | Active compound combinations comprising a 5-substituted imidazole derivative |
| WO2018060073A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | Novel 5-substituted imidazole derivatives |
| WO2018060076A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | Novel triazole derivatives |
| WO2018060075A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | 1 -[2-(1 -chlorocyclopropyl)-2-hydroxy-3-(3-phenyl-1,2-oxazol-5-yl)propyl]-1h-imidazole-5-carbonitrile derivatives and related compounds as fungicides for crop protection |
| WO2018060071A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | Novel triazole derivatives |
| WO2018060093A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | 1,5-substituted imidazole derivatives as fungicides for crop protection. |
| WO2018060074A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | Novel 5-substituted imidazolylmethyl derivatives |
| WO2018060070A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | Novel triazole derivatives |
| WO2018145933A1 (en) | 2017-02-08 | 2018-08-16 | Bayer Aktiengesellschaft | Triazolethione derivatives |
| WO2018145932A1 (en) | 2017-02-08 | 2018-08-16 | Bayer Cropscience Aktiengesellschaft | Triazole derivatives and their use as fungicides |
| WO2018145921A1 (en) | 2017-02-10 | 2018-08-16 | Bayer Aktiengesellschaft | Composition for controlling harmful microorganisms comprising 1 -(phenoxy-pyridinyl)-2-(1,2,4-triazol-1 -yl)-ethanol derivatives |
| WO2018145934A1 (en) | 2017-02-08 | 2018-08-16 | Bayer Cropscience Aktiengesellschaft | Novel triazole derivatives |
| US10053436B2 (en) | 2014-07-08 | 2018-08-21 | BASF Agro B.V. | Process for the preparation of substituted oxiranes and triazoles |
| WO2019092086A1 (en) | 2017-11-13 | 2019-05-16 | Bayer Aktiengesellschaft | Tetrazolylpropyl derivatives and their use as fungicides |
| US10344008B2 (en) | 2015-05-08 | 2019-07-09 | BASF Agro B.V. | Process for the preparation of terpinolene epoxide |
| US10538470B2 (en) | 2015-05-08 | 2020-01-21 | BASF Agro B.V. | Process for the preparation of limonene-4-ol |
| WO2020020816A1 (en) | 2018-07-26 | 2020-01-30 | Bayer Aktiengesellschaft | Novel triazole derivatives |
| US10640477B2 (en) | 2016-06-15 | 2020-05-05 | BASF Agro B.V. | Process for the epoxidation of a tetrasubstituted alkene |
| US11072593B2 (en) | 2016-06-15 | 2021-07-27 | BASF Agro B.V. | Process for the epoxidation of a tetrasubstituted alkene |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3823174A1 (de) * | 1988-07-08 | 1990-01-11 | Bayer Ag | Optisch aktive (1,3-oxathian-2-yl)-oxirane, ihre herstellung und verwendung als zwischenprodukte, sowie verfahren zur herstellung von optisch aktiven 2-hydroxyethyl-1,2,4-triazol-derivaten |
| US5194636A (en) * | 1990-06-13 | 1993-03-16 | Bayer Aktiengesellschaft | Preparation of benzyl ketones and an oxirane |
| DE4027608A1 (de) * | 1990-08-31 | 1992-03-05 | Bayer Ag | Verfahren zur herstellung von 1-chlor-2-(1-chlor-cyclopropyl)-3-(2-chlor-phenyl)-propan-2-ol und/oder 2-(1-chlor-cyclopropyl)-2-(2-chlor-benzyl)-oxiran |
| GB9103260D0 (en) * | 1991-02-15 | 1991-04-03 | Ici Plc | Chemical process |
| EP1071676A4 (en) * | 1998-04-16 | 2004-09-29 | Univ Colorado State Res Found | Kinetic resolution of olefins |
| CN102276558A (zh) * | 2010-06-11 | 2011-12-14 | 南通派斯第农药化工有限公司 | 一种2-(4-氯苯乙基)-2-叔丁基环氧乙烷的制备方法 |
| CN102382068B (zh) * | 2011-08-09 | 2013-11-27 | 湖南大学 | 一种制备1-(1,2,4-三唑-1-基)-2-芳基-2-烷基醇的方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4162258A (en) * | 1977-04-06 | 1979-07-24 | The Lion Dentifrice Co., Ltd. | Novel compounds spiro[5-isopropylbicyclo[3.1.0]hexane-2,2'-oxiranes], process for the production of the novel compounds, and process for the production of sabinene hydrates therefrom |
| US4230719A (en) * | 1977-11-21 | 1980-10-28 | Toyama Chemical Co., Ltd. | Novel 2-[4-(3-methyl-2-thienyl)phenyl]propionic acid and pharmaceutically acceptable salt thereof and method for treating symptoms of inflammation and pain |
| AU542623B2 (en) * | 1980-05-16 | 1985-02-28 | Bayer Aktiengesellschaft | 1-hydroxyethyl-azole derivatives |
| DE3315619A1 (de) * | 1983-04-29 | 1984-10-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von oxiranen |
-
1983
- 1983-04-29 DE DE19833315681 patent/DE3315681A1/de not_active Withdrawn
-
1984
- 1984-04-17 DE DE8484104328T patent/DE3474960D1/de not_active Expired
- 1984-04-17 EP EP84104328A patent/EP0124009B1/de not_active Expired
- 1984-04-25 JP JP59082140A patent/JPS59206377A/ja active Granted
-
1985
- 1985-09-03 US US06/772,066 patent/US4898954A/en not_active Expired - Lifetime
Cited By (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4929735A (en) * | 1985-10-24 | 1990-05-29 | Bayer Aktiengesellschaft | Process for the preparation of oxiranes |
| US9167817B2 (en) | 2010-03-16 | 2015-10-27 | Basf Se | Process using Grignard reagents |
| WO2011113820A1 (en) | 2010-03-16 | 2011-09-22 | Basf Se | A process using grignard reagents |
| US8729272B2 (en) | 2010-03-16 | 2014-05-20 | Basf Se | Process using grignard reagents |
| WO2012041858A1 (en) | 2010-09-30 | 2012-04-05 | Basf Se | A process for the synthesis of thio-triazolo-group containing compounds |
| WO2012130823A1 (en) | 2011-03-30 | 2012-10-04 | Basf Se | Suspension concentrates |
| WO2012146535A1 (en) | 2011-04-28 | 2012-11-01 | Basf Se | Process for the preparation of 2-substituted 2,4-dihydro-[1,2,4]triazole-3-thiones |
| WO2012146598A1 (en) | 2011-04-28 | 2012-11-01 | Basf Se | Process for the preparation of 2-substituted 4-amino-2,4-dihydro-[1,2,4]triazole-3-thiones |
| EP2746258A1 (en) | 2012-12-21 | 2014-06-25 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| EP2746257A1 (en) | 2012-12-21 | 2014-06-25 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| WO2014167008A1 (en) | 2013-04-12 | 2014-10-16 | Bayer Cropscience Ag | Novel triazolinthione derivatives |
| US9550752B2 (en) | 2013-04-12 | 2017-01-24 | Bayer Cropscience Aktiengesellschaft | Triazolinthione derivatives |
| US9668481B2 (en) | 2013-04-12 | 2017-06-06 | Bayer Cropscience Aktiengesellschaft | Triazole derivatives |
| US9822099B2 (en) | 2013-04-12 | 2017-11-21 | Bayer Cropscience Aktiengesellschaft | Triazole derivatives |
| WO2014167009A1 (en) | 2013-04-12 | 2014-10-16 | Bayer Cropscience Ag | Novel triazole derivatives |
| US10053436B2 (en) | 2014-07-08 | 2018-08-21 | BASF Agro B.V. | Process for the preparation of substituted oxiranes and triazoles |
| WO2016156294A1 (en) | 2015-04-02 | 2016-10-06 | Bayer Cropscience Aktiengesellschaft | Triazol derivatives as fungicides |
| WO2016156282A1 (en) | 2015-04-02 | 2016-10-06 | Bayer Cropscience Aktiengesellschaft | Novel triazole compounds for controlling phytopathogenic harmful fungi |
| WO2016156290A1 (en) | 2015-04-02 | 2016-10-06 | Bayer Cropscience Aktiengesellschaft | Novel 5-substituted imidazole derivatives |
| US10538470B2 (en) | 2015-05-08 | 2020-01-21 | BASF Agro B.V. | Process for the preparation of limonene-4-ol |
| US10344008B2 (en) | 2015-05-08 | 2019-07-09 | BASF Agro B.V. | Process for the preparation of terpinolene epoxide |
| US11072593B2 (en) | 2016-06-15 | 2021-07-27 | BASF Agro B.V. | Process for the epoxidation of a tetrasubstituted alkene |
| US10640477B2 (en) | 2016-06-15 | 2020-05-05 | BASF Agro B.V. | Process for the epoxidation of a tetrasubstituted alkene |
| WO2018050535A1 (en) | 2016-09-13 | 2018-03-22 | Bayer Cropscience Aktiengesellschaft | Active compound combinations |
| WO2018050456A1 (en) | 2016-09-13 | 2018-03-22 | Bayer Cropscience Aktiengesellschaft | Active compound combinations comprising a 5-substituted imidazole derivative |
| WO2018060075A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | 1 -[2-(1 -chlorocyclopropyl)-2-hydroxy-3-(3-phenyl-1,2-oxazol-5-yl)propyl]-1h-imidazole-5-carbonitrile derivatives and related compounds as fungicides for crop protection |
| WO2018060074A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | Novel 5-substituted imidazolylmethyl derivatives |
| WO2018060070A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | Novel triazole derivatives |
| WO2018060093A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | 1,5-substituted imidazole derivatives as fungicides for crop protection. |
| WO2018060073A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | Novel 5-substituted imidazole derivatives |
| WO2018060076A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | Novel triazole derivatives |
| WO2018060071A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | Novel triazole derivatives |
| WO2018145933A1 (en) | 2017-02-08 | 2018-08-16 | Bayer Aktiengesellschaft | Triazolethione derivatives |
| WO2018145934A1 (en) | 2017-02-08 | 2018-08-16 | Bayer Cropscience Aktiengesellschaft | Novel triazole derivatives |
| WO2018145932A1 (en) | 2017-02-08 | 2018-08-16 | Bayer Cropscience Aktiengesellschaft | Triazole derivatives and their use as fungicides |
| WO2018145921A1 (en) | 2017-02-10 | 2018-08-16 | Bayer Aktiengesellschaft | Composition for controlling harmful microorganisms comprising 1 -(phenoxy-pyridinyl)-2-(1,2,4-triazol-1 -yl)-ethanol derivatives |
| WO2019092086A1 (en) | 2017-11-13 | 2019-05-16 | Bayer Aktiengesellschaft | Tetrazolylpropyl derivatives and their use as fungicides |
| WO2020020816A1 (en) | 2018-07-26 | 2020-01-30 | Bayer Aktiengesellschaft | Novel triazole derivatives |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS59206377A (ja) | 1984-11-22 |
| EP0124009A2 (de) | 1984-11-07 |
| JPH0458474B2 (enExample) | 1992-09-17 |
| EP0124009A3 (en) | 1985-07-03 |
| DE3474960D1 (en) | 1988-12-08 |
| EP0124009B1 (de) | 1988-11-02 |
| US4898954A (en) | 1990-02-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3315681A1 (de) | Verfahren zur herstellung von oxiranen | |
| EP0061051B1 (de) | Substituierte Triazolylmethyl-oxirane, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Zwischenprodukte | |
| DE3140276A1 (de) | Phenoxyphenyl-azolylmethyl-ketone und -carbinole, verfahren zu ihrer herstellung und ihre verwendung als fungizide und als zwischenprodukte | |
| WO1999018087A1 (de) | Verfahren zur herstellung von triazolinthion-derivaten | |
| DE3733755C2 (enExample) | ||
| EP0124011B1 (de) | Verfahren zur Herstellung von Oxiranen | |
| DE3048266A1 (de) | Substituierte 1-azolyl-butan-2one, verfahren zu ihrer herstellung und ihre verwendung als fungizide sowie als zwischenprodukte | |
| EP0219799B1 (de) | Verfahren zur Herstellung von Oxiranen | |
| DE2912288C2 (enExample) | ||
| DE3311702A1 (de) | Fungizide mittel, verfahren zu ihrer herstellung und deren verwendung | |
| EP0124013B1 (de) | Verfahren zur Herstellung von Oxiranen | |
| EP0124014B1 (de) | Verfahren zur Herstellung von Oxiranen | |
| DE3824457C2 (de) | Verfahren zur Herstellung von 2- (4-Chlorphenyl-ethyl) -2- tert.-butyl-oxiran | |
| EP0143379B1 (de) | Verfahren zur Herstellung von beta-Hydroxyethyl-(1,2,4-triazol)-Derivaten | |
| EP0169439B1 (de) | Verfahren und Zwischenprodukte zur Synthese von diastereomeren Triazolyl-O,N-acetalen | |
| DE3008477A1 (de) | 3,3-dimethyl-1-phenoxy-butan-2-ole, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte | |
| DE3021516C2 (enExample) | ||
| EP0290907B1 (de) | Verfahren zur Herstellung von Acetylenepoxiden und deren Verwendung | |
| EP0277572A2 (de) | Verfahren zur Herstellung optisch aktiver 2-Hydroxyethyl-azol-Derivate | |
| EP0431450B1 (de) | 1-Brom-3-chlor-1,2-diaryl-2-propanole, Verfahren zur stereoselektiven Herstellung der erythro-1-Brom-3-chlor-1,2-diaryl-2-propanole und deren Umsetzung zu Azolylmethyloxiranen | |
| DE3021516C1 (enExample) | ||
| EP1399437B1 (de) | Vefahren zur herstellung vin triazolylmethyl-oxiranen | |
| DE2954650C2 (en) | 2-Aryl-2-hydroxyethyl-imidazole and -triazole derivs. prepn. | |
| DD202613A5 (de) | Fungizide mittel | |
| DE3119390A1 (de) | 3-substituierte 1-azolyl-3-methyl-1-phenoxy-butan-2-one und -ole, verfahren zu iher herstellung und ihre verwendung als fungizide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |