DE3047343A1 - "faseroptisches messgeraet" - Google Patents
"faseroptisches messgeraet"Info
- Publication number
- DE3047343A1 DE3047343A1 DE19803047343 DE3047343A DE3047343A1 DE 3047343 A1 DE3047343 A1 DE 3047343A1 DE 19803047343 DE19803047343 DE 19803047343 DE 3047343 A DE3047343 A DE 3047343A DE 3047343 A1 DE3047343 A1 DE 3047343A1
- Authority
- DE
- Germany
- Prior art keywords
- fiber
- measuring device
- organ
- light
- spectrum
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000835 fiber Substances 0.000 title claims description 84
- 230000003287 optical effect Effects 0.000 title claims description 10
- 239000000463 material Substances 0.000 claims description 39
- 238000001228 spectrum Methods 0.000 claims description 16
- 230000005284 excitation Effects 0.000 claims description 11
- 229910001218 Gallium arsenide Inorganic materials 0.000 claims description 5
- 238000004020 luminiscence type Methods 0.000 claims description 5
- 239000004065 semiconductor Substances 0.000 claims description 5
- 230000003595 spectral effect Effects 0.000 claims description 5
- 229910000673 Indium arsenide Inorganic materials 0.000 claims description 4
- 230000001419 dependent effect Effects 0.000 claims description 4
- RPQDHPTXJYYUPQ-UHFFFAOYSA-N indium arsenide Chemical compound [In]#[As] RPQDHPTXJYYUPQ-UHFFFAOYSA-N 0.000 claims description 4
- 239000013307 optical fiber Substances 0.000 claims description 4
- 229910052733 gallium Inorganic materials 0.000 claims description 3
- SBIBMFFZSBJNJF-UHFFFAOYSA-N selenium;zinc Chemical compound [Se]=[Zn] SBIBMFFZSBJNJF-UHFFFAOYSA-N 0.000 claims description 3
- 229910004613 CdTe Inorganic materials 0.000 claims description 2
- 229910007709 ZnTe Inorganic materials 0.000 claims description 2
- 230000001133 acceleration Effects 0.000 claims description 2
- 229910052785 arsenic Inorganic materials 0.000 claims description 2
- UHYPYGJEEGLRJD-UHFFFAOYSA-N cadmium(2+);selenium(2-) Chemical compound [Se-2].[Cd+2] UHYPYGJEEGLRJD-UHFFFAOYSA-N 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 238000001748 luminescence spectrum Methods 0.000 claims description 2
- 229910052748 manganese Inorganic materials 0.000 claims description 2
- 210000000056 organ Anatomy 0.000 claims 16
- 238000000295 emission spectrum Methods 0.000 claims 2
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 claims 1
- 230000032683 aging Effects 0.000 claims 1
- 230000002452 interceptive effect Effects 0.000 claims 1
- 230000007704 transition Effects 0.000 claims 1
- 238000002834 transmittance Methods 0.000 claims 1
- 238000005424 photoluminescence Methods 0.000 description 10
- 238000010586 diagram Methods 0.000 description 5
- 230000000694 effects Effects 0.000 description 3
- 238000000695 excitation spectrum Methods 0.000 description 3
- 230000005540 biological transmission Effects 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- QQQIECGTIMUVDS-UHFFFAOYSA-N N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3,4-dimethoxybenzamide Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)NCC1=CC=C(OCCN(C)C)C=C1 QQQIECGTIMUVDS-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 230000005670 electromagnetic radiation Effects 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 229910052950 sphalerite Inorganic materials 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- XLOMVQKBTHCTTD-UHFFFAOYSA-N zinc oxide Inorganic materials [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 1
- 229910052984 zinc sulfide Inorganic materials 0.000 description 1
Classifications
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01J—MEASUREMENT OF INTENSITY, VELOCITY, SPECTRAL CONTENT, POLARISATION, PHASE OR PULSE CHARACTERISTICS OF INFRARED, VISIBLE OR ULTRAVIOLET LIGHT; COLORIMETRY; RADIATION PYROMETRY
- G01J1/00—Photometry, e.g. photographic exposure meter
- G01J1/58—Photometry, e.g. photographic exposure meter using luminescence generated by light
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01D—MEASURING NOT SPECIALLY ADAPTED FOR A SPECIFIC VARIABLE; ARRANGEMENTS FOR MEASURING TWO OR MORE VARIABLES NOT COVERED IN A SINGLE OTHER SUBCLASS; TARIFF METERING APPARATUS; MEASURING OR TESTING NOT OTHERWISE PROVIDED FOR
- G01D5/00—Mechanical means for transferring the output of a sensing member; Means for converting the output of a sensing member to another variable where the form or nature of the sensing member does not constrain the means for converting; Transducers not specially adapted for a specific variable
- G01D5/26—Mechanical means for transferring the output of a sensing member; Means for converting the output of a sensing member to another variable where the form or nature of the sensing member does not constrain the means for converting; Transducers not specially adapted for a specific variable characterised by optical transfer means, i.e. using infrared, visible, or ultraviolet light
- G01D5/268—Mechanical means for transferring the output of a sensing member; Means for converting the output of a sensing member to another variable where the form or nature of the sensing member does not constrain the means for converting; Transducers not specially adapted for a specific variable characterised by optical transfer means, i.e. using infrared, visible, or ultraviolet light using optical fibres
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Optical Transform (AREA)
- Investigating, Analyzing Materials By Fluorescence Or Luminescence (AREA)
- Length Measuring Devices By Optical Means (AREA)
- Arrangements For Transmission Of Measured Signals (AREA)
- Measuring Fluid Pressure (AREA)
- Investigating Or Analysing Materials By Optical Means (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE7910715A SE7910715L (sv) | 1979-12-28 | 1979-12-28 | Fiberoptiskt metdon for metning av lege, kraft, tryck, temperatur etc |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3047343A1 true DE3047343A1 (de) | 1981-09-17 |
| DE3047343C2 DE3047343C2 (enExample) | 1987-12-10 |
Family
ID=20339658
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803047343 Granted DE3047343A1 (de) | 1979-12-28 | 1980-12-16 | "faseroptisches messgeraet" |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4880972A (enExample) |
| JP (1) | JPS56101516A (enExample) |
| DE (1) | DE3047343A1 (enExample) |
| SE (1) | SE7910715L (enExample) |
Cited By (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3137387A1 (de) * | 1980-09-30 | 1982-08-19 | ASEA AB, 72183 Västerås | Faseroptisches messgeraet zum messen physikalischer und chemischer groessen |
| DE3304440A1 (de) * | 1982-02-09 | 1983-09-08 | Mitsubishi Denki K.K., Tokyo | Steuersystem fuer ein automobil unter verwendung optischer sensoren |
| EP0092505A1 (de) * | 1982-04-21 | 1983-10-26 | Asea Ab | Faseroptischer Geber |
| DE3219877A1 (de) * | 1982-05-27 | 1983-12-01 | kabelmetal electro GmbH, 3000 Hannover | Schaltungsanordnung zur ueberwachung und anzeige der position eines geraets |
| EP0096262A1 (de) * | 1982-05-27 | 1983-12-21 | Takaoka Electric Co., Ltd. | Faseroptischer Sensor zur Messung von dynamischen Grössen |
| DE3319526A1 (de) * | 1983-05-28 | 1984-11-29 | Max-Planck-Gesellschaft zur Förderung der Wissenschaften e.V., 3400 Göttingen | Sensor zur messung von physikalischen parametern oder teilchenkonzentrationen |
| EP0115025A3 (en) * | 1982-12-23 | 1984-12-12 | Wolfgang Dr. Ruhrmann | Optical sensor |
| EP0135350A1 (en) * | 1983-08-25 | 1985-03-27 | The Babcock & Wilcox Company | Systems for transmitting light |
| DE3441498A1 (de) * | 1984-11-09 | 1986-05-15 | Licentia Patent-Verwaltungs-Gmbh, 6000 Frankfurt | Verfahren und anordnung zur erfassung der position von lichtstrahlen |
| EP0085875A3 (de) * | 1982-02-02 | 1986-09-17 | Asea Ab | Faseroptische Messanordnung zur Messung physikalischer Grössen |
| DE3640519A1 (de) * | 1985-12-18 | 1987-06-19 | Smiths Industries Plc | Optischer lagemesswandler |
| EP0116131A3 (de) * | 1982-11-22 | 1988-02-10 | Asea Ab | Faseroptischer Geber |
| EP0266118A1 (en) * | 1986-10-24 | 1988-05-04 | The University Of Liverpool | Displacement detection |
| US4850491A (en) * | 1986-05-30 | 1989-07-25 | Stormax International A/S | Apparatus for control of a wooden article |
| EP0256310A3 (en) * | 1986-08-18 | 1990-03-28 | International Business Machines Corporation | Fluorescent sensors for infrared free-space links in data communication systems |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5004913A (en) * | 1982-08-06 | 1991-04-02 | Marcos Kleinerman | Remote measurement of physical variables with fiber optic systems - methods, materials and devices |
| US5222810A (en) * | 1982-08-06 | 1993-06-29 | Kleinerman Marcos Y | Fiber optic systems for sensing temperature and other physical variables |
| US5090818A (en) * | 1982-08-06 | 1992-02-25 | Kleinerman Marcos Y | Fiber optic systems for sensing temperature and other physical variables |
| JPS59229698A (ja) * | 1983-06-10 | 1984-12-24 | 株式会社チノー | 光学的測定装置 |
| DE3820912A1 (de) * | 1988-06-21 | 1989-12-28 | Bayerische Motoren Werke Ag | Fiberoptisches sensorsystem |
| US4947038A (en) * | 1988-08-24 | 1990-08-07 | Daimler-Benz Ag | Process and arrangement for optically measuring a physical quantity |
| DE3920155C2 (de) * | 1989-06-20 | 1995-03-09 | Siemens Ag | Streckenneutrale optische Meßanordnung |
| US5102625A (en) * | 1990-02-16 | 1992-04-07 | Boc Health Care, Inc. | Apparatus for monitoring a chemical concentration |
| US5183338A (en) * | 1991-04-10 | 1993-02-02 | Luxtron Corporation | Temperature measurement with combined photo-luminescent and black body sensing techniques |
| US5241184A (en) * | 1991-09-26 | 1993-08-31 | Electric Power Research Institute | Apparatus and method for quantizing remaining lifetime of transmission cable insulation |
| FR2713770B1 (fr) * | 1993-12-10 | 1996-02-09 | Sextant Avionique | Procédé et appareil de mesure optique de la pression d'un mélange gazeux. |
| FR2713768B1 (fr) * | 1993-12-10 | 1996-02-09 | Sextant Avionique | Procédé et appareil de mesure optique de la température d'un mélange gazeux. |
| FR2718237B1 (fr) * | 1994-03-30 | 1996-06-21 | Europ Propulsion | Dispositif de mesure optique de température cryogénique. |
| US5683179A (en) * | 1995-12-15 | 1997-11-04 | Northrop Grumman Corporation | Apparatus and method for thermoluminescent quench detection for superconducting devices |
| US6123455A (en) * | 1997-05-02 | 2000-09-26 | American Iron And Steel Institute | Phosphor thermometry system |
| RU2193497C1 (ru) * | 2001-09-20 | 2002-11-27 | ГАВРИЛОВ Андрей Юрьевич | Указатель |
| CA2372637A1 (en) * | 2002-02-20 | 2003-08-20 | Institut National D'optique | Packaged optical sensors on the side of optical fibres |
| US6607300B1 (en) * | 2002-09-20 | 2003-08-19 | Marcos Y. Kleinerman | Methods and devices for sensing temperature and oxygen pressure with a single optical probe |
| GB0323372D0 (en) * | 2003-10-07 | 2003-11-05 | Rolls Royce Plc | An apparatus for measuring temperature using luminescence thermometry |
| GB2438872A (en) * | 2006-06-09 | 2007-12-12 | Univ Southampton | Movement detector apparatus and detecting method |
| EP2439619B1 (en) * | 2010-09-17 | 2019-07-17 | BlackBerry Limited | Touch-sensitive display with optical sensor and method |
| US9513737B2 (en) | 2010-09-17 | 2016-12-06 | Blackberry Limited | Touch-sensitive display with optical sensor and method |
| EP2437144B1 (en) * | 2010-09-17 | 2018-08-29 | BlackBerry Limited | Touch-sensitive display with optical sensor and method |
| US9223431B2 (en) | 2010-09-17 | 2015-12-29 | Blackberry Limited | Touch-sensitive display with depression detection and method |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB993063A (en) * | 1962-04-30 | 1965-05-26 | Gunsons Sortex Ltd | Photoelectric sorting machine |
| DE2905630A1 (de) * | 1978-02-15 | 1979-08-16 | Hitachi Ltd | Optische messeinrichtung |
| DE2920489A1 (de) * | 1978-06-02 | 1979-12-06 | Asea Ab | Faseroptisches messgeraet |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2353586A (en) * | 1942-06-04 | 1944-07-11 | Gustave M Reininger | Inclinometer |
| US2501560A (en) * | 1947-04-26 | 1950-03-21 | Canadian Radium & Uranium Corp | Apparatus for indicating and measuring small movements |
| US4075493A (en) * | 1976-12-16 | 1978-02-21 | Ronald Alves | Optical temperature measurement technique utilizing phosphors |
| JPS53129672A (en) * | 1977-04-18 | 1978-11-11 | Okamura Shiro | Optical responsing apparatus for displacement |
| US4176551A (en) * | 1978-10-10 | 1979-12-04 | Rca Corporation | Fiber-optic thermometer |
| US4213138A (en) * | 1978-12-14 | 1980-07-15 | Bell Telephone Laboratories, Incorporated | Demultiplexing photodetector |
| US4245507A (en) * | 1979-09-10 | 1981-01-20 | Samulski Thaddeus V | Temperature probe |
| US4356396A (en) * | 1980-12-17 | 1982-10-26 | Siemens Corporation | Fiber optical measuring device with compensating properties |
| SE435967B (sv) * | 1982-04-01 | 1984-10-29 | Asea Ab | Fiberoptiskt luminiscensmetdon |
-
1979
- 1979-12-28 SE SE7910715A patent/SE7910715L/ not_active IP Right Cessation
-
1980
- 1980-12-16 DE DE19803047343 patent/DE3047343A1/de active Granted
- 1980-12-24 JP JP18368180A patent/JPS56101516A/ja active Granted
-
1985
- 1985-03-04 US US06/708,095 patent/US4880972A/en not_active Expired - Fee Related
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB993063A (en) * | 1962-04-30 | 1965-05-26 | Gunsons Sortex Ltd | Photoelectric sorting machine |
| DE2905630A1 (de) * | 1978-02-15 | 1979-08-16 | Hitachi Ltd | Optische messeinrichtung |
| DE2920489A1 (de) * | 1978-06-02 | 1979-12-06 | Asea Ab | Faseroptisches messgeraet |
Cited By (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3137387A1 (de) * | 1980-09-30 | 1982-08-19 | ASEA AB, 72183 Västerås | Faseroptisches messgeraet zum messen physikalischer und chemischer groessen |
| EP0085875A3 (de) * | 1982-02-02 | 1986-09-17 | Asea Ab | Faseroptische Messanordnung zur Messung physikalischer Grössen |
| DE3304440A1 (de) * | 1982-02-09 | 1983-09-08 | Mitsubishi Denki K.K., Tokyo | Steuersystem fuer ein automobil unter verwendung optischer sensoren |
| EP0092505A1 (de) * | 1982-04-21 | 1983-10-26 | Asea Ab | Faseroptischer Geber |
| DE3219877A1 (de) * | 1982-05-27 | 1983-12-01 | kabelmetal electro GmbH, 3000 Hannover | Schaltungsanordnung zur ueberwachung und anzeige der position eines geraets |
| EP0096262A1 (de) * | 1982-05-27 | 1983-12-21 | Takaoka Electric Co., Ltd. | Faseroptischer Sensor zur Messung von dynamischen Grössen |
| EP0116131A3 (de) * | 1982-11-22 | 1988-02-10 | Asea Ab | Faseroptischer Geber |
| EP0115025A3 (en) * | 1982-12-23 | 1984-12-12 | Wolfgang Dr. Ruhrmann | Optical sensor |
| DE3319526A1 (de) * | 1983-05-28 | 1984-11-29 | Max-Planck-Gesellschaft zur Förderung der Wissenschaften e.V., 3400 Göttingen | Sensor zur messung von physikalischen parametern oder teilchenkonzentrationen |
| EP0135350A1 (en) * | 1983-08-25 | 1985-03-27 | The Babcock & Wilcox Company | Systems for transmitting light |
| DE3441498A1 (de) * | 1984-11-09 | 1986-05-15 | Licentia Patent-Verwaltungs-Gmbh, 6000 Frankfurt | Verfahren und anordnung zur erfassung der position von lichtstrahlen |
| DE3640519A1 (de) * | 1985-12-18 | 1987-06-19 | Smiths Industries Plc | Optischer lagemesswandler |
| US4850491A (en) * | 1986-05-30 | 1989-07-25 | Stormax International A/S | Apparatus for control of a wooden article |
| EP0256310A3 (en) * | 1986-08-18 | 1990-03-28 | International Business Machines Corporation | Fluorescent sensors for infrared free-space links in data communication systems |
| EP0266118A1 (en) * | 1986-10-24 | 1988-05-04 | The University Of Liverpool | Displacement detection |
Also Published As
| Publication number | Publication date |
|---|---|
| SE418904B (sv) | 1981-06-29 |
| DE3047343C2 (enExample) | 1987-12-10 |
| JPH0122882B2 (enExample) | 1989-04-28 |
| US4880972A (en) | 1989-11-14 |
| JPS56101516A (en) | 1981-08-14 |
| SE7910715L (sv) | 1981-06-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3047343A1 (de) | "faseroptisches messgeraet" | |
| EP1405037B1 (de) | Vorrichtung zur optischen distanzmessung über einen grossen messbereich | |
| DE3036682C2 (enExample) | ||
| DE3242219C1 (de) | Optisches Markenerkennungsgeraet | |
| EP0057464B1 (de) | Faseroptische Sensorvorrichtung | |
| DE3409618A1 (de) | Faseroptische messanordnung zur messung physikalischer groessen | |
| DE19859670A1 (de) | Abtastkopf und Verfahren zu dessen Herstellung | |
| DE102008029467A1 (de) | Halbleiterbauelement, Verwendung eines Halbleiterbauelements als Näherungssensor sowie Verfahren zum Detektieren von Objekten | |
| EP2210124B1 (de) | Vorrichtung zur optischen distanzmessung | |
| EP0083689B1 (de) | Lichtelektrische inkrementale Längen- oder Winkelmesseinrichtung | |
| DE2614377A1 (de) | Optoelektrischer detektor mit einem objektiv und einer modulationsvorrichtung | |
| EP0085875A2 (de) | Faseroptische Messanordnung zur Messung physikalischer Grössen | |
| DE3137387A1 (de) | Faseroptisches messgeraet zum messen physikalischer und chemischer groessen | |
| EP3339811B1 (de) | Optische positionsmesseinrichtung | |
| DE10000030A1 (de) | Kamerasystem für die Bearbeitung von Dokumenten | |
| EP0096262B1 (de) | Faseroptischer Sensor zur Messung von dynamischen Grössen | |
| EP0231538B1 (de) | Optischer Weg-Sensor mit einem Filter | |
| DE2713396A1 (de) | Verfahren und vorrichtung zur kennzeichnung oder identifizierung eines leuchtmaterial enthaltenden oder tragenden koerpers | |
| DE3625703C2 (enExample) | ||
| DE68902877T2 (de) | Verfahren und vorrichtung zur messung der sichtweite durch ein medium veraenderlicher dichte. | |
| DE19816359A1 (de) | Fasersensor zum Erkennen von Oberflächenstrukturen | |
| DE19518714A1 (de) | Geber mit diffraktiven optischen Abbildungselementen | |
| DE2624365A1 (de) | Verfahren und vorrichtung zur ausgleichung chromatischer impulsdispersion | |
| DE102015204124A1 (de) | Auskoppelelement für einen Lichtleiter zur Lichtführung an einem Lichtlaufzeitsensor | |
| EP3315902B1 (de) | Messvorrichtung und verfahren zur triangulationsmessung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |