DE2901098C2 - - Google Patents
Info
- Publication number
- DE2901098C2 DE2901098C2 DE2901098A DE2901098A DE2901098C2 DE 2901098 C2 DE2901098 C2 DE 2901098C2 DE 2901098 A DE2901098 A DE 2901098A DE 2901098 A DE2901098 A DE 2901098A DE 2901098 C2 DE2901098 C2 DE 2901098C2
- Authority
- DE
- Germany
- Prior art keywords
- fuel
- air
- primary
- combustion chamber
- combustion
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000446 fuel Substances 0.000 claims description 89
- 238000002485 combustion reaction Methods 0.000 claims description 67
- 239000000203 mixture Substances 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 15
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 3
- 239000003546 flue gas Substances 0.000 claims description 3
- MWUXSHHQAYIFBG-UHFFFAOYSA-N nitrogen oxide Inorganic materials O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 27
- 239000007789 gas Substances 0.000 description 20
- 238000010586 diagram Methods 0.000 description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 7
- 239000001301 oxygen Substances 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 238000010790 dilution Methods 0.000 description 5
- 239000012895 dilution Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 238000003915 air pollution Methods 0.000 description 3
- 239000002283 diesel fuel Substances 0.000 description 3
- 239000003344 environmental pollutant Substances 0.000 description 3
- 231100000719 pollutant Toxicity 0.000 description 3
- 238000011144 upstream manufacturing Methods 0.000 description 3
- WYTGDNHDOZPMIW-RCBQFDQVSA-N alstonine Natural products C1=CC2=C3C=CC=CC3=NC2=C2N1C[C@H]1[C@H](C)OC=C(C(=O)OC)[C@H]1C2 WYTGDNHDOZPMIW-RCBQFDQVSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000011017 operating method Methods 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F23—COMBUSTION APPARATUS; COMBUSTION PROCESSES
- F23R—GENERATING COMBUSTION PRODUCTS OF HIGH PRESSURE OR HIGH VELOCITY, e.g. GAS-TURBINE COMBUSTION CHAMBERS
- F23R3/00—Continuous combustion chambers using liquid or gaseous fuel
- F23R3/28—Continuous combustion chambers using liquid or gaseous fuel characterised by the fuel supply
- F23R3/286—Continuous combustion chambers using liquid or gaseous fuel characterised by the fuel supply having fuel-air premixing devices
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F23—COMBUSTION APPARATUS; COMBUSTION PROCESSES
- F23R—GENERATING COMBUSTION PRODUCTS OF HIGH PRESSURE OR HIGH VELOCITY, e.g. GAS-TURBINE COMBUSTION CHAMBERS
- F23R3/00—Continuous combustion chambers using liquid or gaseous fuel
- F23R3/02—Continuous combustion chambers using liquid or gaseous fuel characterised by the air-flow or gas-flow configuration
- F23R3/04—Air inlet arrangements
- F23R3/10—Air inlet arrangements for primary air
- F23R3/12—Air inlet arrangements for primary air inducing a vortex
Landscapes
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Combustion & Propulsion (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/870,787 US4222232A (en) | 1978-01-19 | 1978-01-19 | Method and apparatus for reducing nitrous oxide emissions from combustors |
| US05/870,789 US4226083A (en) | 1978-01-19 | 1978-01-19 | Method and apparatus for reducing nitrous oxide emissions from combustors |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2901098A1 DE2901098A1 (de) | 1979-07-26 |
| DE2901098C2 true DE2901098C2 (enExample) | 1989-09-07 |
Family
ID=27128175
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792901098 Granted DE2901098A1 (de) | 1978-01-19 | 1979-01-12 | Brennkammer und verfahren zum betreiben derselben |
Country Status (11)
| Country | Link |
|---|---|
| US (2) | US4226083A (enExample) |
| JP (1) | JPS54112412A (enExample) |
| AT (1) | AT364961B (enExample) |
| AU (1) | AU519298B2 (enExample) |
| BE (1) | BE873565A (enExample) |
| CA (1) | CA1126519A (enExample) |
| DE (1) | DE2901098A1 (enExample) |
| FR (1) | FR2415264B1 (enExample) |
| GB (1) | GB2012883B (enExample) |
| NL (1) | NL186652C (enExample) |
| SE (1) | SE436794B (enExample) |
Families Citing this family (60)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2950535A1 (de) * | 1979-11-23 | 1981-06-11 | BBC AG Brown, Boveri & Cie., Baden, Aargau | Brennkammer einer gasturbine mit vormisch/vorverdampf-elementen |
| US4356698A (en) * | 1980-10-02 | 1982-11-02 | United Technologies Corporation | Staged combustor having aerodynamically separated combustion zones |
| US4500052A (en) * | 1981-03-05 | 1985-02-19 | Kyusik Kim | Liquid fuel prevaporization and back burning induction jet oval thrust transition tail pipe |
| DE3241162A1 (de) * | 1982-11-08 | 1984-05-10 | Kraftwerk Union AG, 4330 Mülheim | Vormischbrenner mit integriertem diffusionsbrenner |
| US5207064A (en) * | 1990-11-21 | 1993-05-04 | General Electric Company | Staged, mixed combustor assembly having low emissions |
| WO1993009384A1 (en) * | 1991-10-28 | 1993-05-13 | Irvin Glassman | Asymmetric whirl combustion |
| US5239818A (en) * | 1992-03-30 | 1993-08-31 | General Electric Company | Dilution pole combustor and method |
| FR2695460B1 (fr) * | 1992-09-09 | 1994-10-21 | Snecma | Chambre de combustion de turbomachine à plusieurs injecteurs. |
| US5596873A (en) * | 1994-09-14 | 1997-01-28 | General Electric Company | Gas turbine combustor with a plurality of circumferentially spaced pre-mixers |
| EP0747635B1 (en) * | 1995-06-05 | 2003-01-15 | Rolls-Royce Corporation | Dry low oxides of nitrogen lean premix module for industrial gas turbine engines |
| US5813232A (en) * | 1995-06-05 | 1998-09-29 | Allison Engine Company, Inc. | Dry low emission combustor for gas turbine engines |
| US5592811A (en) * | 1995-10-03 | 1997-01-14 | Alliedsignal Inc. | Method and apparatus for the destruction of volatile organic compounds |
| US5673553A (en) * | 1995-10-03 | 1997-10-07 | Alliedsignal Inc. | Apparatus for the destruction of volatile organic compounds |
| US5791137A (en) * | 1995-11-13 | 1998-08-11 | United Technologies Corporation | Radial inflow dual fuel injector |
| US5996352A (en) * | 1997-12-22 | 1999-12-07 | United Technologies Corporation | Thermally decoupled swirler for a gas turbine combustor |
| FR2774152B1 (fr) * | 1998-01-28 | 2000-03-24 | Inst Francais Du Petrole | Chambre de combustion de turbine a gaz fonctionnant au carburant liquide |
| RU2158877C1 (ru) * | 1999-03-18 | 2000-11-10 | Новокузнецкое государственное научно-производственное предприятие "Экотехника" | Вихревая камерная топка |
| RU2154234C1 (ru) * | 1999-04-23 | 2000-08-10 | Малое государственное внедренческое предприятие МГВП "Политехэнерго" | Топка |
| DE19934612A1 (de) | 1999-07-23 | 2001-01-25 | Abb Alstom Power Ch Ag | Verfahren zur aktiven Unterdrückung von strömungsmechanischen Instabilitäten in einem Verbrennungssystem sowie Verbrennungssystem zur Durchführung des Verfahrens |
| RU2185570C1 (ru) * | 2001-04-27 | 2002-07-20 | Вагнер Андрей Александрович | Топка |
| RU2185571C1 (ru) * | 2001-04-27 | 2002-07-20 | Вагнер Андрей Александрович | Вихревая топка |
| RU2199056C2 (ru) * | 2001-05-14 | 2003-02-20 | Автономная некоммерческая научно-образовательная организация ДВГТУ "Научно-технический и внедренческий центр "Модернизация котельной техники" | Вихревая топка |
| RU2217657C1 (ru) * | 2002-09-05 | 2003-11-27 | Ульянов Валерий Васильевич | Газомазутная топка |
| RU2294484C1 (ru) * | 2005-07-06 | 2007-02-27 | Государственное образовательное учреждение высшего профессионального образования Красноярский государственный технический университет (КГТУ) | Топка |
| RU2298132C1 (ru) * | 2005-12-30 | 2007-04-27 | Общество с ограниченной ответственностью "Политехэнерго" | Вихревая топка |
| RU2309328C1 (ru) * | 2006-08-01 | 2007-10-27 | Общество с ограниченной ответственностью "Политехэнерго" | Способ работы вихревой топки и вихревая топка |
| RU2310125C1 (ru) * | 2006-01-10 | 2007-11-10 | Государственное образовательное учреждение высшего профессионального образования Красноярский государственный технический университет (КГТУ) | Топка |
| RU2303194C1 (ru) * | 2006-04-10 | 2007-07-20 | Государственное образовательное учреждение высшего профессионального образования "Южно-Уральский государственный университет" | Топка |
| RU2310126C1 (ru) * | 2006-04-10 | 2007-11-10 | Государственное образовательное учреждение высшего профессионального образования Красноярский государственный технический университет (КГТУ) | Топка |
| RU2310127C1 (ru) * | 2006-04-24 | 2007-11-10 | Государственное образовательное учреждение высшего профессионального образования Красноярский государственный технический университет (КГТУ) | Топка |
| RU2313034C1 (ru) * | 2006-06-29 | 2007-12-20 | Государственное образовательное учреждение высшего профессионального образования Красноярский государственный технический университет (КГТУ) | Топка |
| RU2317485C1 (ru) * | 2006-09-20 | 2008-02-20 | Государственное образовательное учреждение высшего профессионального образования Красноярский государственный технический университет (КГТУ) | Топка |
| RU2324108C1 (ru) * | 2006-12-21 | 2008-05-10 | Государственное образовательное учреждение высшего профессионального образования "Государственный университет цветных металлов и золота" | Способ работы вертикальной призматической топки |
| RU2349835C2 (ru) * | 2007-03-05 | 2009-03-20 | Закрытое акционерное общество "НЕВЭНЕРГОПРОМ" (ЗАО "НЕВЭНЕРГОПРОМ") | Способ сжигания твердого топлива в вихревой топке и вихревая топка для его реализации |
| RU2343347C1 (ru) * | 2007-05-08 | 2009-01-10 | Федеральное государственное образовательное учреждение высшего профессионального образования "Сибирский федеральный университет" (СФУ) | Топка |
| RU2331017C1 (ru) * | 2007-07-23 | 2008-08-10 | Общество с ограниченной ответственностью "Политехэнерго" | Вихревая топка |
| RU2350838C1 (ru) * | 2007-11-09 | 2009-03-27 | Государственное образовательное учреждение высшего профессионального образования "Кузбасский государственный технический университет" (ГУ КузГТУ) | Высокотемпературный циклонный реактор |
| RU2348861C1 (ru) * | 2008-01-09 | 2009-03-10 | Закрытое акционерное общество "НЕВЭНЕРГОПРОМ" (ЗАО "НЕВЭНЕРГОПРОМ") | Вихревая топка для сжигания твердого топлива |
| RU2349834C1 (ru) * | 2008-01-16 | 2009-03-20 | Федеральное государственное образовательное учреждение высшего профессионального образования "Сибирский федеральный университет" | Способ работы шахтно-мельничной топки |
| RU2379585C1 (ru) * | 2008-12-10 | 2010-01-20 | Федеральное государственное образовательное учреждение высшего профессионального образования "Сибирский федеральный университет" (СФУ) | Топка котла |
| RU2377465C1 (ru) * | 2008-12-16 | 2009-12-27 | Закрытое акционерное общество "КОТЭС-Сибирь" | Топка парогенератора |
| RU2382941C1 (ru) * | 2009-03-23 | 2010-02-27 | Федеральное государственное образовательное учреждение высшего профессионального образования "Сибирский федеральный университет" | Способ сжигания шлакующих углей в фронтальной топке |
| RU2388963C1 (ru) * | 2009-05-15 | 2010-05-10 | Закрытое акционерное общество "ЗиО-КОТЭС" | Топка парогенератора |
| RU2406023C1 (ru) * | 2009-09-15 | 2010-12-10 | Учреждение Российской академии наук Кемеровский научный центр Сибирского отделения РАН (КемНЦ СО РАН) | Вихревая топка |
| RU2415337C1 (ru) * | 2009-12-17 | 2011-03-27 | Государственное образовательное учреждение высшего профессионального образования "Оренбургский государственный университет" | Способ работы котла в режиме твердого шлакоудаления |
| RU2446350C1 (ru) * | 2010-11-02 | 2012-03-27 | Федеральное государственное бюджетное образовательное учреждение высшего профессионального образования "Кузбасский государственный технический университет имени Т.Ф. Горбачева"(КузГТУ) | Низкоэмиссионный циклонный реактор |
| US8863526B2 (en) * | 2011-01-14 | 2014-10-21 | General Electric Company | Fuel injector |
| US9388985B2 (en) | 2011-07-29 | 2016-07-12 | General Electric Company | Premixing apparatus for gas turbine system |
| US9134023B2 (en) * | 2012-01-06 | 2015-09-15 | General Electric Company | Combustor and method for distributing fuel in the combustor |
| US20130213046A1 (en) * | 2012-02-16 | 2013-08-22 | General Electric Company | Late lean injection system |
| US10890329B2 (en) | 2018-03-01 | 2021-01-12 | General Electric Company | Fuel injector assembly for gas turbine engine |
| US10935245B2 (en) | 2018-11-20 | 2021-03-02 | General Electric Company | Annular concentric fuel nozzle assembly with annular depression and radial inlet ports |
| US11286884B2 (en) | 2018-12-12 | 2022-03-29 | General Electric Company | Combustion section and fuel injector assembly for a heat engine |
| US11073114B2 (en) | 2018-12-12 | 2021-07-27 | General Electric Company | Fuel injector assembly for a heat engine |
| US11156360B2 (en) | 2019-02-18 | 2021-10-26 | General Electric Company | Fuel nozzle assembly |
| GB2601563B (en) * | 2020-12-07 | 2024-11-06 | Rolls Royce Plc | Lean burn combustor |
| DE102021123513A1 (de) * | 2021-09-10 | 2023-03-16 | Man Energy Solutions Se | Brenner und Verfahren zu dessen Herstellung |
| US12454909B2 (en) | 2021-12-03 | 2025-10-28 | General Electric Company | Combustor size rating for a gas turbine engine using hydrogen fuel |
| US12331932B2 (en) | 2022-01-31 | 2025-06-17 | General Electric Company | Turbine engine fuel mixer |
| US12215866B2 (en) | 2022-02-18 | 2025-02-04 | General Electric Company | Combustor for a turbine engine having a fuel-air mixer including a set of mixing passages |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2931174A (en) * | 1952-12-20 | 1960-04-05 | Armstrong Siddeley Motors Ltd | Vaporizer for liquid fuel |
| US3675419A (en) * | 1970-10-26 | 1972-07-11 | United Aircraft Corp | Combustion chamber having swirling flow |
| US3788065A (en) * | 1970-10-26 | 1974-01-29 | United Aircraft Corp | Annular combustion chamber for dissimilar fluids in swirling flow relationship |
| US3722216A (en) * | 1971-01-04 | 1973-03-27 | Gen Electric | Annular slot combustor |
| JPS5228251B2 (enExample) * | 1974-03-05 | 1977-07-26 | ||
| US4058977A (en) * | 1974-12-18 | 1977-11-22 | United Technologies Corporation | Low emission combustion chamber |
| US3973390A (en) * | 1974-12-18 | 1976-08-10 | United Technologies Corporation | Combustor employing serially staged pilot combustion, fuel vaporization, and primary combustion zones |
| US3973395A (en) * | 1974-12-18 | 1976-08-10 | United Technologies Corporation | Low emission combustion chamber |
| US4052844A (en) * | 1975-06-02 | 1977-10-11 | Societe Nationale D'etude Et De Construction De Moteurs D'aviation | Gas turbine combustion chambers |
| GB1575410A (en) * | 1976-09-04 | 1980-09-24 | Rolls Royce | Combustion apparatus for use in gas turbine engines |
-
1978
- 1978-01-19 US US05/870,789 patent/US4226083A/en not_active Expired - Lifetime
- 1978-01-19 US US05/870,787 patent/US4222232A/en not_active Expired - Lifetime
-
1979
- 1979-01-10 AU AU43257/79A patent/AU519298B2/en not_active Expired
- 1979-01-12 AT AT0022979A patent/AT364961B/de not_active IP Right Cessation
- 1979-01-12 DE DE19792901098 patent/DE2901098A1/de active Granted
- 1979-01-15 SE SE7900323A patent/SE436794B/sv not_active IP Right Cessation
- 1979-01-15 CA CA319,674A patent/CA1126519A/en not_active Expired
- 1979-01-16 GB GB791551A patent/GB2012883B/en not_active Expired
- 1979-01-18 NL NLAANVRAGE7900397,A patent/NL186652C/xx not_active IP Right Cessation
- 1979-01-18 BE BE192967A patent/BE873565A/xx not_active IP Right Cessation
- 1979-01-18 FR FR7901203A patent/FR2415264B1/fr not_active Expired
- 1979-01-19 JP JP549879A patent/JPS54112412A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| CA1126519A (en) | 1982-06-29 |
| US4226083A (en) | 1980-10-07 |
| BE873565A (fr) | 1979-05-16 |
| FR2415264B1 (fr) | 1987-06-19 |
| AT364961B (de) | 1981-11-25 |
| NL186652C (nl) | 1991-01-16 |
| GB2012883A (en) | 1979-08-01 |
| ATA22979A (de) | 1981-04-15 |
| SE7900323L (sv) | 1979-07-20 |
| US4222232A (en) | 1980-09-16 |
| JPS54112412A (en) | 1979-09-03 |
| FR2415264A1 (fr) | 1979-08-17 |
| GB2012883B (en) | 1982-04-07 |
| SE436794B (sv) | 1985-01-21 |
| JPS6135448B2 (enExample) | 1986-08-13 |
| NL7900397A (nl) | 1979-07-23 |
| NL186652B (nl) | 1990-08-16 |
| DE2901098A1 (de) | 1979-07-26 |
| AU4325779A (en) | 1979-07-26 |
| AU519298B2 (en) | 1981-11-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2901098C2 (enExample) | ||
| DE2901099A1 (de) | Kraftstoffverdampfungsvorrichtung, damit ausgeruestete brennkammer und verfahren zum betreiben derselben | |
| DE2845619C2 (de) | Brennkammer für ein Gasturbinentriebwerk | |
| DE69024081T2 (de) | Verfahren zur Verbrennung mit Gasvormischung und eine Verbrennungsvorrichtung zur Durchführung des Verfahrens | |
| DE69009202T2 (de) | Gasturbinenbrennkammer und Betriebsverfahren dafür. | |
| DE2539993C2 (de) | Brenner für flüssigen oder gasförmigen Brennstoff | |
| DE2415036C2 (de) | Brennkammer für Gasturbinentriebwerke mit Regenerativ-Wärmetauschern | |
| DE69523082T2 (de) | Brennstoffdüse einer Turbine mit doppelter Möglichkeit zur Diffusions- und Vormischverbrennung und Verfahren zum Betrieb | |
| DE69828916T2 (de) | Emissionsarmes Verbrennungssystem für Gasturbinentriebwerke | |
| DE69405281T2 (de) | Vormischbrennkammer mit konzentrischen Ringkanälen | |
| DE60028690T2 (de) | Brennkammerwand mit versetzter Verdünnung | |
| DE69428549T2 (de) | Gasturbinenkammer mit niedriger schadstoffemission | |
| EP0274630A1 (de) | Brenneranordnung | |
| CH618780A5 (enExample) | ||
| DE2555085A1 (de) | Brennkammer und verfahren zum erzeugen einer emissionsarmen verbrennung | |
| DE60120313T2 (de) | Brennkammer mit mehreren Einspritzdüsen | |
| DE4200073A1 (de) | Dualer kraftstoff-brenner mit verringertem no(pfeil abwaerts)x(pfeil abwaerts)ausstoss | |
| DE2912103C2 (de) | Brenner für ein Gasturbinentriebwerk | |
| DE4416650A1 (de) | Verbrennungsverfahren für atmosphärische Feuerungsanlagen | |
| DE2460709A1 (de) | Brennkammer fuer gasturbinen | |
| DE69633163T2 (de) | Kraftstoff-Luft Mischrohr | |
| DE2629761A1 (de) | Brennkammer fuer gasturbinen | |
| DE102009003453A1 (de) | Brennrohr-Vormischer und Verfahren zur Gas/Luft-Gemischbildung in einer Gasturbine | |
| DE19859210A1 (de) | Brennstoff-Luft-Mischanordnung für Verbrennungsvorrichtungen | |
| DE2926278C2 (de) | Verfahren zum Betreiben eines Brenners und Brenner zur Durchführung des Verfahrens |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: MENGES, R., DIPL.-ING., PAT.-ANW., 8000 MUENCHEN |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |