DE2839710C2 - Selbstverlöschende, polymere Massen - Google Patents
Selbstverlöschende, polymere MassenInfo
- Publication number
- DE2839710C2 DE2839710C2 DE2839710A DE2839710A DE2839710C2 DE 2839710 C2 DE2839710 C2 DE 2839710C2 DE 2839710 A DE2839710 A DE 2839710A DE 2839710 A DE2839710 A DE 2839710A DE 2839710 C2 DE2839710 C2 DE 2839710C2
- Authority
- DE
- Germany
- Prior art keywords
- udf54
- udf53
- compositions according
- isocyanurate
- melamine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 29
- 229920000877 Melamine resin Polymers 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 15
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 claims description 14
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 claims description 12
- BPXVHIRIPLPOPT-UHFFFAOYSA-N 1,3,5-tris(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione Chemical compound OCCN1C(=O)N(CCO)C(=O)N(CCO)C1=O BPXVHIRIPLPOPT-UHFFFAOYSA-N 0.000 claims description 11
- 239000000654 additive Substances 0.000 claims description 10
- -1 amine phosphate Chemical class 0.000 claims description 10
- 239000000047 product Substances 0.000 claims description 10
- 230000000996 additive effect Effects 0.000 claims description 7
- 239000007859 condensation product Substances 0.000 claims description 7
- OUPZKGBUJRBPGC-UHFFFAOYSA-N 1,3,5-tris(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione Chemical compound O=C1N(CC2OC2)C(=O)N(CC2OC2)C(=O)N1CC1CO1 OUPZKGBUJRBPGC-UHFFFAOYSA-N 0.000 claims description 6
- 239000003063 flame retardant Substances 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 238000005979 thermal decomposition reaction Methods 0.000 claims description 6
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 5
- GZVHEAJQGPRDLQ-UHFFFAOYSA-N 6-phenyl-1,3,5-triazine-2,4-diamine Chemical compound NC1=NC(N)=NC(C=2C=CC=CC=2)=N1 GZVHEAJQGPRDLQ-UHFFFAOYSA-N 0.000 claims description 5
- 235000019289 ammonium phosphates Nutrition 0.000 claims description 5
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 claims description 5
- 229920001169 thermoplastic Polymers 0.000 claims description 5
- 239000004254 Ammonium phosphate Substances 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 229920001228 polyisocyanate Polymers 0.000 claims description 4
- 239000005056 polyisocyanate Substances 0.000 claims description 4
- 229910019142 PO4 Inorganic materials 0.000 claims description 3
- 239000004743 Polypropylene Substances 0.000 claims description 3
- 239000004793 Polystyrene Substances 0.000 claims description 3
- 229910000148 ammonium phosphate Inorganic materials 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 claims description 3
- 229920001155 polypropylene Polymers 0.000 claims description 3
- 229920002223 polystyrene Polymers 0.000 claims description 3
- 150000005846 sugar alcohols Polymers 0.000 claims description 3
- MFEFTTYGMZOIKO-UHFFFAOYSA-N 5-azacytosine Chemical compound NC1=NC=NC(=O)N1 MFEFTTYGMZOIKO-UHFFFAOYSA-N 0.000 claims description 2
- USDJGQLNFPZEON-UHFFFAOYSA-N [[4,6-bis(hydroxymethylamino)-1,3,5-triazin-2-yl]amino]methanol Chemical compound OCNC1=NC(NCO)=NC(NCO)=N1 USDJGQLNFPZEON-UHFFFAOYSA-N 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000002894 organic compounds Chemical class 0.000 claims description 2
- 239000010452 phosphate Substances 0.000 claims description 2
- 229920000768 polyamine Polymers 0.000 claims description 2
- 150000007974 melamines Chemical class 0.000 claims 1
- 229920000642 polymer Polymers 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 11
- 229910001868 water Inorganic materials 0.000 description 11
- 235000019256 formaldehyde Nutrition 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- 238000000034 method Methods 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 229920005989 resin Polymers 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000008098 formaldehyde solution Substances 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 235000011149 sulphuric acid Nutrition 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 229920000388 Polyphosphate Polymers 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 238000004132 cross linking Methods 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000001205 polyphosphate Substances 0.000 description 3
- 235000011176 polyphosphates Nutrition 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- PTJWCLYPVFJWMP-UHFFFAOYSA-N 2-[[3-hydroxy-2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(CO)(CO)COCC(CO)(CO)COCC(CO)(CO)CO PTJWCLYPVFJWMP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 235000019826 ammonium polyphosphate Nutrition 0.000 description 2
- 229920001276 ammonium polyphosphate Polymers 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 239000003822 epoxy resin Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229920000647 polyepoxide Polymers 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- JMHCCAYJTTWMCX-QWPJCUCISA-M sodium;(2s)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoate;pentahydrate Chemical compound O.O.O.O.O.[Na+].IC1=CC(C[C@H](N)C([O-])=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 JMHCCAYJTTWMCX-QWPJCUCISA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- ZWVMLYRJXORSEP-UHFFFAOYSA-N 1,2,6-Hexanetriol Chemical compound OCCCCC(O)CO ZWVMLYRJXORSEP-UHFFFAOYSA-N 0.000 description 1
- TXBCBTDQIULDIA-UHFFFAOYSA-N 2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(CO)(CO)COCC(CO)(CO)CO TXBCBTDQIULDIA-UHFFFAOYSA-N 0.000 description 1
- 239000004114 Ammonium polyphosphate Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- ZRIUUUJAJJNDSS-UHFFFAOYSA-N ammonium phosphates Chemical class [NH4+].[NH4+].[NH4+].[O-]P([O-])([O-])=O ZRIUUUJAJJNDSS-UHFFFAOYSA-N 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- ASLNLSYDVOWAFS-UHFFFAOYSA-N diethylazanium;dihydrogen phosphate Chemical compound CCNCC.OP(O)(O)=O ASLNLSYDVOWAFS-UHFFFAOYSA-N 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- ZSFDBVJMDCMTBM-UHFFFAOYSA-N ethane-1,2-diamine;phosphoric acid Chemical compound NCCN.OP(O)(O)=O ZSFDBVJMDCMTBM-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- GUSFEBGYPWJUSS-UHFFFAOYSA-N pentaazanium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [NH4+].[NH4+].[NH4+].[NH4+].[NH4+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O GUSFEBGYPWJUSS-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 239000004848 polyfunctional curative Substances 0.000 description 1
- 239000002861 polymer material Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000002341 toxic gas Substances 0.000 description 1
- QXJQHYBHAIHNGG-UHFFFAOYSA-N trimethylolethane Chemical compound OCC(C)(CO)CO QXJQHYBHAIHNGG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3467—Heterocyclic compounds having nitrogen in the ring having more than two nitrogen atoms in the ring
- C08K5/3477—Six-membered rings
- C08K5/3492—Triazines
- C08K5/34928—Salts
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K13/00—Use of mixtures of ingredients not covered by one single of the preceding main groups, each of these compounds being essential
- C08K13/02—Organic and inorganic ingredients
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3467—Heterocyclic compounds having nitrogen in the ring having more than two nitrogen atoms in the ring
- C08K5/3477—Six-membered rings
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S260/00—Chemistry of carbon compounds
- Y10S260/24—Flameproof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Fireproofing Substances (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
IT27520/77A IT1087517B (it) | 1977-09-14 | 1977-09-14 | Composizioni polimeriche |
Publications (2)
Publication Number | Publication Date |
---|---|
DE2839710A1 DE2839710A1 (de) | 1979-03-22 |
DE2839710C2 true DE2839710C2 (de) | 1987-02-19 |
Family
ID=11221816
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE2839710A Expired DE2839710C2 (de) | 1977-09-14 | 1978-09-13 | Selbstverlöschende, polymere Massen |
Country Status (10)
Cited By (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE10321286A1 (de) * | 2003-05-13 | 2004-12-09 | Clariant Gmbh | Flammschutzadditive für Polymere Massen mit verbesserter Hydrothermaler Stabilitat |
Families Citing this family (48)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
IT1123491B (it) * | 1979-07-27 | 1986-04-30 | Montedison Spa | Composizioni polimeriche autoestinguenti |
IT1123206B (it) * | 1979-09-18 | 1986-04-30 | Montedison Spa | Composizini polimeriche autoestinguenti |
US4331780A (en) * | 1980-03-20 | 1982-05-25 | Phillips Petroleum Company | Flame retardant transparent resinous copolymer |
US4461862A (en) * | 1980-06-02 | 1984-07-24 | Ludwig Eigenmann | Self extinguishing polymeric compositions, which upon contacting a flame provide a nondropping char-forming incandescent crust, and which do not produce flame neither toxic fumes |
DE3149454A1 (de) * | 1981-12-14 | 1983-06-23 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur herstellung von polyacrylnitrilpolyphosphonsaeure und ihre verwendung als flammschutzmittel |
US4404303A (en) * | 1982-03-24 | 1983-09-13 | The Dow Chemical Company | Carbonate polymers containing a barbituate as an ignition depressant |
IT1160191B (it) * | 1983-02-07 | 1987-03-04 | Montedison Spa | Composizioni polimeriche autoestinguenti |
DE3347523A1 (de) * | 1983-12-30 | 1985-07-11 | EC Erdölchemie GmbH, 5000 Köln | Flammfest eingestellte polymere |
FR2564475B1 (fr) * | 1984-05-21 | 1986-11-28 | Atochem | Compositions a base de polyamides a combustibilite retardee |
GB8413929D0 (en) * | 1984-05-31 | 1984-07-04 | Plascoat Uk Ltd | Flame retardant compositions |
JPS61106643A (ja) * | 1984-10-30 | 1986-05-24 | Marubishi Yuka Kogyo Kk | ポリオレフイン用難燃剤 |
DE3507562A1 (de) * | 1985-03-04 | 1986-09-04 | Hoechst Ag, 6230 Frankfurt | Selbstverloeschende polymere massen |
IT1183524B (it) * | 1985-03-29 | 1987-10-22 | Enichem Sintesi | Composizioni di polimeri termoplastici autoestinguenti |
IT1183626B (it) * | 1985-05-14 | 1987-10-22 | Vamp Srl | Prodotti polimerici autoestinguenti a base di poliolefine |
GB2196010C (en) * | 1986-08-16 | 1994-11-25 | Dollken & Co Gmbh W | Production of fireproofing materal mouldings |
US5312853A (en) * | 1986-08-25 | 1994-05-17 | Hoechst Celanese Corporation | Flame retardant polymeric compositions |
DE3720094A1 (de) * | 1986-08-25 | 1988-03-03 | Hoechst Ag | Flammwidrige polymere massen |
JPS63305169A (ja) * | 1987-06-05 | 1988-12-13 | Marubishi Yuka Kogyo Kk | 難燃性合成樹脂組成物 |
IT1228923B (it) * | 1987-08-04 | 1991-07-10 | Vamp Srl | Composizione ritardante di fiamma per polimeri e prodotti polimerici autoestinguenti cosi' ottenuti. |
DE3727352A1 (de) * | 1987-08-17 | 1989-03-02 | Am Produkte Ag | Selbstverloeschend ausgeruestete thermoplaste |
DE3732377A1 (de) * | 1987-09-25 | 1989-04-06 | Hoechst Ag | Flammwidrige polymere massen |
US5104917A (en) * | 1988-08-05 | 1992-04-14 | Ad-Va-Cote Tri-State Inc. | Heat ablative compositions |
CA2007510A1 (en) * | 1989-02-07 | 1990-08-07 | Horst Staendeke | Intumescent flame retardant systems |
CA2013922A1 (en) * | 1989-08-07 | 1991-02-07 | Linda Harmon Nelson | Flame retardant thermoplastic containing (iso) cyanurate |
FR2656322B1 (fr) * | 1989-12-21 | 1992-12-31 | Norsolor Sa | Compositions thermoplastiques a tenue au feu amelioree comprenant des polymere salcenylaromatiques. |
DE4003231A1 (de) * | 1990-02-03 | 1991-08-08 | Hoechst Ag | Flammwidrige polymere massen |
DE4003230A1 (de) * | 1990-02-03 | 1991-08-08 | Hoechst Ag | Selbstverloeschende polyurethane |
US5162418A (en) * | 1990-10-29 | 1992-11-10 | Ppg Industries, Inc. | Nonionic surfactant surface-modified ammonium polyphosphate |
US5164437A (en) * | 1990-10-30 | 1992-11-17 | Ppg Industries, Inc. | Anionic surfactant surface-modified ammonium polyphosphate |
US5204392A (en) * | 1991-09-05 | 1993-04-20 | Hoechst Celanese Corporation | Two-component intumescent flame retardant |
US5204393A (en) * | 1991-09-05 | 1993-04-20 | Hoechst Celanese Corporation | Three-component intumescent flame retardant |
US5185103A (en) * | 1991-12-23 | 1993-02-09 | Ppg Industries, Inc. | Intumescent flame retardant composition |
US5227416A (en) * | 1991-12-23 | 1993-07-13 | Ppg Industries, Inc. | Intumescent flame retardant composition |
GB2267498B (en) * | 1992-04-24 | 1996-05-29 | Minnesota Mining & Mfg | Flame retardants for polymers |
CA2102001C (en) * | 1992-12-01 | 2001-04-17 | George K. Castle | Reinforcement system for mastic intumescent fire protection coatings |
AU5072593A (en) * | 1992-12-01 | 1994-06-16 | Avco Corporation | Reinforcement system for mastic intumescent fire protection coatings |
US5356983A (en) * | 1993-03-01 | 1994-10-18 | Ppg Industries, Inc. | Particulate ammonium phosphate of small size |
DE4314852C2 (de) * | 1993-05-05 | 1995-06-14 | Gerhard Dr Pohl | Verfahren zur Herstellung flammwidriger thermoplastischer Kunststoffe mit verbesserten mechanischen Eigenschaften |
JP3007512B2 (ja) * | 1993-06-01 | 2000-02-07 | チッソ株式会社 | 難燃性熱可塑性樹脂組成物 |
US5414031A (en) * | 1993-11-19 | 1995-05-09 | Polymer Product Company, Inc. | Intumescent nonhalogenated flame retardant polystyrene composition |
TW314535B (US08124630-20120228-C00152.png) * | 1993-12-27 | 1997-09-01 | Chisso Corp | |
KR0158978B1 (ko) * | 1993-12-28 | 1999-01-15 | 고토 순기치 | 난연성 열가소성 중합체 조성물, 이의 성분으로서의 수불용성 폴리인산암모늄 분말 및 이의 제조방법 |
TW318861B (US08124630-20120228-C00152.png) * | 1994-08-16 | 1997-11-01 | Mitsui Toatsu Chemicals | |
US6239219B1 (en) * | 1995-07-21 | 2001-05-29 | Atofina | Thermoplastic compositions with improved fire resistance |
US5834535A (en) * | 1995-08-21 | 1998-11-10 | General Motors Corporation | Moldable intumescent polyethylene and chlorinated polyethylene compositions |
DE19546834A1 (de) * | 1995-12-15 | 1997-06-19 | Hoechst Ag | Flammwidrige polymere Massen |
US6479574B1 (en) * | 1999-10-21 | 2002-11-12 | Ppg Industries Ohio, Inc. | Fire retardant composition for composites |
US20110257284A1 (en) * | 2010-04-15 | 2011-10-20 | Basf Se | Process for producing flame-retardant pu foams |
Family Cites Families (16)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE1225386B (de) | 1961-12-29 | 1966-09-22 | Fmc Corp | Verfahren zur Herstellung von stickstoffhaltigen Polykondensaten |
US3293224A (en) * | 1963-08-05 | 1966-12-20 | Allied Chem | Tris (2-hydroxyethyl) isocyanurate homopolymer |
US3378530A (en) * | 1965-03-15 | 1968-04-16 | Allied Chem | Process of preparing copolymers of tris(2-hydroxyethyl)isocyanurate and formaldehyde |
US3392082A (en) * | 1965-04-16 | 1968-07-09 | Allied Chem | Modified melamine-formaldehyde resins modified with tris (2-hydroxyalkyl)isocyanurates and laminates made therewith |
US3629365A (en) * | 1970-09-14 | 1971-12-21 | Akzona Inc | Flame retardant polyesters containing polyamides and phosphine oxides |
US3663502A (en) * | 1970-10-29 | 1972-05-16 | American Cyanamid Co | Tertiary phosphine oxide-ammonium polyphosphate combinations as flame-retardants for propylene polymers |
US3810862A (en) * | 1972-02-14 | 1974-05-14 | Phillips Petroleum Co | Char-forming,flame retardant polyolefin composition |
US3783146A (en) * | 1972-04-03 | 1974-01-01 | American Cyanamid Co | Ammonium polyphosphate-phosphonium bromide-alkoxyalkanolamine as flame-retardants for polyolefins |
IN139125B (US08124630-20120228-C00152.png) * | 1973-04-25 | 1976-05-08 | Ishikawa T | |
US3936416A (en) * | 1973-07-24 | 1976-02-03 | Phillips Petroleum Company | Nonburning, nondripping, char-forming, polypropylene composition |
JPS5625955B2 (US08124630-20120228-C00152.png) * | 1973-12-27 | 1981-06-16 | ||
US4137199A (en) * | 1974-07-16 | 1979-01-30 | Imperial Chemical Industries Limited | Fire-retardant composition |
NL7512126A (nl) * | 1974-10-18 | 1976-04-21 | Mitsubishi Petrochemical Co | Werkwijze voor het bereiden van een zelfdovende harssamenstelling en daaruit vervaardigde pro- dukten. |
JPS5329181B2 (US08124630-20120228-C00152.png) * | 1974-11-07 | 1978-08-18 | ||
DE2459492A1 (de) | 1974-12-17 | 1976-06-24 | Bayer Ag | Gegenueber isocyanaten reaktive phosphorhaltige flammschutzmittel |
IT1060705B (it) * | 1976-05-28 | 1982-08-20 | Montedison Spa | Composizioni polimeriche autoestinguenti |
-
1977
- 1977-09-14 IT IT27520/77A patent/IT1087517B/it active
-
1978
- 1978-09-08 NL NLAANVRAGE7809204,A patent/NL189816C/xx not_active IP Right Cessation
- 1978-09-11 US US05/941,396 patent/US4198493A/en not_active Expired - Lifetime
- 1978-09-11 GB GB7836334A patent/GB2006223B/en not_active Expired
- 1978-09-12 FR FR7826136A patent/FR2403357A1/fr active Granted
- 1978-09-12 CA CA311,174A patent/CA1129133A/en not_active Expired
- 1978-09-13 DE DE2839710A patent/DE2839710C2/de not_active Expired
- 1978-09-13 BE BE190435A patent/BE870425A/xx not_active IP Right Cessation
- 1978-09-13 ES ES473301A patent/ES473301A1/es not_active Expired
- 1978-09-14 JP JP11247578A patent/JPS5453156A/ja active Granted
Cited By (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE10321286A1 (de) * | 2003-05-13 | 2004-12-09 | Clariant Gmbh | Flammschutzadditive für Polymere Massen mit verbesserter Hydrothermaler Stabilitat |
DE10321286B4 (de) * | 2003-05-13 | 2005-04-14 | Clariant Gmbh | Flammschutzadditiv für polymere Massen mit verbesserter hydrothermaler Stabilität |
Also Published As
Publication number | Publication date |
---|---|
CA1129133A (en) | 1982-08-03 |
FR2403357A1 (fr) | 1979-04-13 |
FR2403357B1 (US08124630-20120228-C00152.png) | 1980-07-18 |
US4198493A (en) | 1980-04-15 |
BE870425A (fr) | 1979-03-13 |
DE2839710A1 (de) | 1979-03-22 |
GB2006223B (en) | 1982-03-17 |
JPS5453156A (en) | 1979-04-26 |
GB2006223A (en) | 1979-05-02 |
NL7809204A (nl) | 1979-03-16 |
NL189816B (nl) | 1993-03-01 |
NL189816C (nl) | 1993-08-02 |
ES473301A1 (es) | 1979-10-16 |
IT1087517B (it) | 1985-06-04 |
JPS6147875B2 (US08124630-20120228-C00152.png) | 1986-10-21 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE2839710C2 (de) | Selbstverlöschende, polymere Massen | |
DE69014443T2 (de) | Selbst-löschende polymerische Zusammensetzungen. | |
DE2723877C2 (US08124630-20120228-C00152.png) | ||
DE69033310T2 (de) | Flammenhemmende Polypropenharzzusammensetzung | |
DE102009055434A1 (de) | Flammenschutzmittelzusammensetzung für thermoplastische Formmassen | |
EP2956491B1 (de) | Duromer, herstellungsverfahren, verwendung und zusammensetzungen | |
DE69412357T2 (de) | Flammhemmende, thermoplastische Harzzusammensetzung | |
DE69128179T2 (de) | Selbstverlöschende polymere Zusammensetzungen | |
DE2800891C2 (de) | Selbstverlöschende, polymere Massen | |
EP0025082B1 (de) | Herstellung eines festen intumeszierenden, phosphorhaltigen Flammschutzmittels und dessen Verwendung in Kunststoffen | |
DE69230453T2 (de) | Neue Pentaerythrityl-Phosphonate und ihre Verwendung in selbstlöschenden thermoplastischen Polymerzusammensetzungen | |
DE102004019716A1 (de) | Flammenschutzmittelzusammensetzung, flammgeschützte Formmasse, Verfahren zu deren Herstellung und deren Verwendung | |
DE102018100984A1 (de) | Phosphorhaltige thermoplastische Polymere | |
DE4003231A1 (de) | Flammwidrige polymere massen | |
DE2719738B2 (de) | Phosphonsäureesterderivate und diese enthaltende Polyurethanzubereitungen | |
DE3689892T2 (de) | Selbstauslöschende Zusammensetzungen aus thermoplastischen Polymeren. | |
DE69225382T2 (de) | Selbstverlöschende Polymerzusammensetzungen | |
EP1397418B1 (de) | Phosphor-stickstoff-kondensat, verfahren zu dessen herstellung und dessen verwendung als flammschutzmittel | |
DE3149454A1 (de) | Verfahren zur herstellung von polyacrylnitrilpolyphosphonsaeure und ihre verwendung als flammschutzmittel | |
DE69123400T2 (de) | Flammfeste Polyolefinfasern und Folien | |
EP0005497A1 (de) | Spirocyclische Borverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als flammhemmender Zusatz | |
WO2001090234A2 (de) | Neue phosphor-stickstoff-verbindungen als flammschutzmittel in thermoplastischen formmassen und ihre herstellung | |
DE10321286A1 (de) | Flammschutzadditive für Polymere Massen mit verbesserter Hydrothermaler Stabilitat | |
DE102019001656A1 (de) | Makromolekulare Verbindungen mit hohen Gehalten an Phosphor und Stickstoff, Verfahren zur Herstellung und Verwendung | |
WO2015039737A1 (de) | Flammschutzmittelzusammensetzung |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
8110 | Request for examination paragraph 44 | ||
D2 | Grant after examination | ||
8364 | No opposition during term of opposition |