DE1768536C - - Google Patents
Info
- Publication number
- DE1768536C DE1768536C DE1768536C DE 1768536 C DE1768536 C DE 1768536C DE 1768536 C DE1768536 C DE 1768536C
- Authority
- DE
- Germany
- Prior art keywords
- acid
- column
- propionic acid
- chlorine
- halides
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 46
- 235000019260 propionic acid Nutrition 0.000 claims description 23
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 22
- 239000000460 chlorine Substances 0.000 claims description 13
- 229910052801 chlorine Inorganic materials 0.000 claims description 13
- 150000004820 halides Chemical class 0.000 claims description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- 239000007789 gas Substances 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- 239000011541 reaction mixture Substances 0.000 claims description 9
- 239000012159 carrier gas Substances 0.000 claims description 7
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 229910052698 phosphorus Inorganic materials 0.000 claims description 5
- 239000011574 phosphorus Substances 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 3
- 238000010924 continuous production Methods 0.000 claims description 2
- 238000005660 chlorination reaction Methods 0.000 description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 4
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- GAWAYYRQGQZKCR-REOHCLBHSA-N (S)-2-chloropropanoic acid Chemical compound C[C@H](Cl)C(O)=O GAWAYYRQGQZKCR-REOHCLBHSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- GAWAYYRQGQZKCR-UHFFFAOYSA-N 2-chloropropionic acid Chemical compound CC(Cl)C(O)=O GAWAYYRQGQZKCR-UHFFFAOYSA-N 0.000 description 1
- 102000007469 Actins Human genes 0.000 description 1
- 108010085238 Actins Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0019699B1 (de) | Verfahren zur Gewinnung von gasförmigem Chlorwasserstoff aus verdünnter wässriger Salzsäure | |
| DE1493815A1 (de) | Verfahren zur Herstellung von Bisphenol aus harzartigen Nebenprodukten | |
| DE1768536C (enrdf_load_stackoverflow) | ||
| DE1768536B1 (de) | Verfahren zur Herstellung von alpha-Chlorpropionsaeure | |
| DE3604968A1 (de) | Verfahren zur herstellung von dichlorethan | |
| DE69519026T2 (de) | Verfahren zur herstellung von difluoromethan | |
| EP0297238B1 (de) | Verfahren zur Herstellung von Methallylchlorid | |
| DE2635281C2 (enrdf_load_stackoverflow) | ||
| DE69628060T2 (de) | Verfahren zur Herstellung von Difluormethan und Difluorchlormethan | |
| DE2729911C2 (de) | Verfahren zur Herstellung von α-Chloralkanoylchloriden | |
| DE2554702A1 (de) | Verfahren zur entalkylierung von tert.-alkyl-substituierten phenolen | |
| EP0045425B1 (de) | Verfahren zur Halogenierung von gegebenenfalls substituierten 4-tert.-Butyltoluolen sowie die daraus erhaltenen Gemische aus gegebenenfalls substituierten 4-tert.-Butylbenzalhalogeniden, 4-tert.-Butylbenzylhalogeniden und 4-tert.-Butylbenzotrihalogeniden | |
| EP0006523B1 (de) | Verfahren zur Herstellung von Acetaldehyd | |
| DE2536261C3 (de) | Verfahren zur kontinuierlichen Herstellung von o- und p-Chlortoluol | |
| EP0028709B1 (de) | Verfahren zur Herstellung von gamma-Chloracetessigsäurechlorid | |
| EP0283833A2 (de) | Verfahren zur Entfernung von m-Chlortoluol aus Chlortoluolgemischen | |
| DE69332408T2 (de) | Verfahren zur herstellung von 1,1,1-trichlor-2,2,2-trifluor | |
| DE10207217C1 (de) | Verfahren zur Herstellung von 1,2-Dichlorethan mittels Direktchlorierung | |
| DE2001070C3 (de) | Verfahren zur Herstellung von Trioxan | |
| DE1618667C (de) | Verfahren zur Herstellung von aliphatischen Sulfonylchloriden und Alkylchloriden | |
| DE2510088C2 (de) | Verfahren zur fraktionierten Destillation von Diacetoxybutenisomeren | |
| DE3743981A1 (de) | Verfahren zur herstellung von acetylchlorid | |
| DE1668746C (de) | Verfahren zur Herstellung von Dimethylterephthalat | |
| DE1618433C (de) | Verfahren zum Aufarbeiten von gasförmigen Reaktionsgemischen aus der Chlorierung von Methylchlorid | |
| DE1568177C3 (de) | Verfahren zur kontinuierlichen Herstellung von alpha-Acetyl-alphachlor-gamma-butyrolacton |