CY750A - Substituted benzodipyrones - Google Patents
Substituted benzodipyronesInfo
- Publication number
- CY750A CY750A CY75074A CY75074A CY750A CY 750 A CY750 A CY 750A CY 75074 A CY75074 A CY 75074A CY 75074 A CY75074 A CY 75074A CY 750 A CY750 A CY 750A
- Authority
- CY
- Cyprus
- Prior art keywords
- benzodipyrones
- substituted
- substituted benzodipyrones
- Prior art date
Links
- ZXLJWZULPBXHSY-UHFFFAOYSA-N pyrano[2,3-g]chromene-2,7-dione Chemical class O1C(=O)C=CC2=C1C=C1C=CC(=O)OC1=C2 ZXLJWZULPBXHSY-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
- C07C59/70—Ethers of hydroxy-acetic acid, e.g. substitutes on the ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/90—Unsaturated compounds containing keto groups containing singly bound oxygen-containing groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
- C07D311/24—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D493/00—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system
- C07D493/02—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system in which the condensed system contains two hetero rings
- C07D493/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Plural Heterocyclic Compounds (AREA)
- Dairy Products (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3791267A GB1230087A (enExample) | 1967-08-17 | 1967-08-17 | |
| US00062170A US3718668A (en) | 1967-08-17 | 1970-08-07 | Benzodipyrones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CY750A true CY750A (en) | 1974-07-12 |
Family
ID=37698343
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CY75074A CY750A (en) | 1967-08-17 | 1974-07-12 | Substituted benzodipyrones |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3718668A (enExample) |
| JP (4) | JPS503000B1 (enExample) |
| BE (1) | BE719385A (enExample) |
| CA (1) | CA939344A (enExample) |
| CH (5) | CH530948A (enExample) |
| CY (1) | CY750A (enExample) |
| DE (1) | DE1793206C2 (enExample) |
| DK (1) | DK127853B (enExample) |
| FR (2) | FR8143M (enExample) |
| GB (1) | GB1230087A (enExample) |
| IE (1) | IE32345B1 (enExample) |
| IT (1) | IT1044555B (enExample) |
| MY (1) | MY7400193A (enExample) |
| NL (1) | NL162652C (enExample) |
| NO (1) | NO127397B (enExample) |
| SE (1) | SE372529B (enExample) |
| YU (1) | YU240274A (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1354477A (en) * | 1970-04-02 | 1974-06-05 | Fisons Ltd | Benzo di and tri-pyrones |
| US3975536A (en) * | 1971-05-12 | 1976-08-17 | Fisons Limited | Composition |
| GB1389227A (en) * | 1971-09-16 | 1975-04-03 | Fisons Ltd | Chromone-2-carboxylic acid derivatives methods for their preparation and compositions containing them |
| US4239748A (en) * | 1977-11-30 | 1980-12-16 | Fisons Limited | Inorganic salts of 2,8-dicarboxy-4,6-dioxo-10-propyl-4H,6H-benzo(1,2-b:5,4-b')dipyran useful for the treatment of asthma and hay fever |
| NL7811486A (nl) * | 1977-11-30 | 1979-06-01 | Fisons Ltd | Nieuwe dipyranderivaten. |
| CA1112651A (en) * | 1977-11-30 | 1981-11-17 | Hugh Cairns | Salt of 2,8-dicarboxy-4,6-dioxy-10-propyl-4h,6h- benzo(1,2-b:5,4-b')dipyran |
| DE2963903D1 (en) * | 1978-12-05 | 1982-11-25 | Fisons Plc | A process for the production of 2-alkyl- or 2-alkenyl-4,6-diacetyl resorcinols; 2-allyl-4,6-diacetyl resorcinol |
| JPS58189318A (ja) * | 1982-04-28 | 1983-11-05 | Mazda Motor Corp | 還元性雰囲気熱処理炉 |
| GB8402577D0 (en) * | 1984-02-01 | 1984-03-07 | Fisons Plc | Nitrogen heterocyclic compounds |
| JPS62149863A (ja) * | 1985-12-23 | 1987-07-03 | Mazda Motor Corp | 熱処理用トレイ |
| GB9322014D0 (en) | 1993-10-26 | 1993-12-15 | Co Ordinated Drug Dev | Improvements in and relating to carrier particles for use in dry powder inhalers |
| GB9501841D0 (en) * | 1995-01-31 | 1995-03-22 | Co Ordinated Drug Dev | Improvements in and relating to carrier particles for use in dry powder inhalers |
| GB9515182D0 (en) | 1995-07-24 | 1995-09-20 | Co Ordinated Drug Dev | Improvements in and relating to powders for use in dry powder inhalers |
| TW200524577A (en) | 2003-11-04 | 2005-08-01 | Glaxo Group Ltd | Muscarinic acetylcholine receptor antagonists |
| MY144753A (en) | 2004-04-27 | 2011-10-31 | Glaxo Group Ltd | Muscarinic acetylcholine receptor antagonists |
| JP6266940B2 (ja) * | 2013-10-07 | 2018-01-24 | マナック株式会社 | アリーレンジオキシ−ビス(無水コハク酸)及びその製造方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL140730B (nl) * | 1963-09-27 | 1974-01-15 | Fisons Pharmaceuticals Ltd | Werkwijze voor de bereiding van gesubstitueerde chromoncabonzuur-2-derivaten met remmende werking op anafylactische reacties. |
| GB1147976A (en) * | 1965-12-21 | 1969-04-10 | Fisons Pharmaceuticals Ltd | Chromone derivatives |
-
1967
- 1967-08-17 GB GB3791267A patent/GB1230087A/en not_active Expired
-
1968
- 1968-08-01 DK DK372868AA patent/DK127853B/da unknown
- 1968-08-07 CH CH1686570A patent/CH530948A/fr not_active IP Right Cessation
- 1968-08-07 IE IE961/68A patent/IE32345B1/xx unknown
- 1968-08-07 CH CH1686770A patent/CH533099A/fr not_active IP Right Cessation
- 1968-08-07 CH CH1686670A patent/CH533098A/fr not_active IP Right Cessation
- 1968-08-07 CH CH1184468A patent/CH511829A/fr not_active IP Right Cessation
- 1968-08-07 CH CH382472A patent/CH532570A/fr not_active IP Right Cessation
- 1968-08-08 FR FR162270A patent/FR8143M/fr not_active Expired
- 1968-08-12 IT IT2011968A patent/IT1044555B/it active
- 1968-08-12 BE BE719385D patent/BE719385A/xx unknown
- 1968-08-14 CA CA027,333A patent/CA939344A/en not_active Expired
- 1968-08-16 NL NL6811740.A patent/NL162652C/xx not_active IP Right Cessation
- 1968-08-16 DE DE1793206A patent/DE1793206C2/de not_active Expired
- 1968-08-16 SE SE6811090A patent/SE372529B/xx unknown
- 1968-08-16 NO NO683226A patent/NO127397B/no unknown
- 1968-08-21 FR FR163602A patent/FR1605539A/fr not_active Expired
-
1970
- 1970-08-07 US US00062170A patent/US3718668A/en not_active Expired - Lifetime
- 1970-09-04 JP JP45077243A patent/JPS503000B1/ja active Pending
- 1970-09-04 JP JP45077241A patent/JPS4925959B1/ja active Pending
- 1970-09-04 JP JP45077242A patent/JPS4925960B1/ja active Pending
-
1974
- 1974-04-05 JP JP3804174A patent/JPS5324013A/ja active Pending
- 1974-07-12 CY CY75074A patent/CY750A/xx unknown
- 1974-09-05 YU YU02402/74A patent/YU240274A/xx unknown
- 1974-12-30 MY MY193/74A patent/MY7400193A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO127397B (enExample) | 1973-06-18 |
| NL6811740A (enExample) | 1969-02-19 |
| CH532570A (fr) | 1973-01-15 |
| NL162652B (nl) | 1980-01-15 |
| CA939344A (en) | 1974-01-01 |
| IE32345L (en) | 1969-02-17 |
| DE1793206A1 (de) | 1972-02-10 |
| YU240274A (en) | 1982-05-31 |
| JPS4925960B1 (enExample) | 1974-07-04 |
| SE372529B (enExample) | 1974-12-23 |
| MY7400193A (en) | 1974-12-31 |
| IE32345B1 (en) | 1973-06-27 |
| NL162652C (nl) | 1980-06-16 |
| CH533099A (fr) | 1973-01-31 |
| GB1230087A (enExample) | 1971-04-28 |
| IT1044555B (it) | 1980-03-31 |
| CH533098A (fr) | 1973-01-31 |
| CH530948A (fr) | 1972-11-30 |
| CH511829A (fr) | 1971-08-31 |
| DE1793206C2 (de) | 1982-04-01 |
| US3718668A (en) | 1973-02-27 |
| DK127853B (da) | 1974-01-21 |
| FR8143M (enExample) | 1970-08-17 |
| JPS4925959B1 (enExample) | 1974-07-04 |
| BE719385A (enExample) | 1969-02-12 |
| JPS503000B1 (enExample) | 1975-01-30 |
| JPS5324013A (en) | 1978-03-06 |
| FR1605539A (enExample) | 1979-02-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CY750A (en) | Substituted benzodipyrones | |
| IL31026A (en) | Anilinomethylenemalononitriles | |
| GB1165990A (en) | Track-Set | |
| IE32269L (en) | 11 - halogenosteroids | |
| IL29822A0 (en) | 3-oh-or 3-or-pyrazinamido-guanidines | |
| MY7200116A (en) | Substituted benzodioxoles | |
| IL31168A0 (en) | Evaporimeters | |
| IL29828A0 (en) | 4-aryl-4-aminoalkoxy-piperidines | |
| USB450708I5 (en) | Tetrahydropyran-2-Ols | |
| IL30059A (en) | Harmonograph | |
| IE30940L (en) | Substituted 2-aminobenzimidazoles | |
| IE30941L (en) | Substituted 2-aminobenzimidazoles | |
| IE31800L (en) | Benzenesulphonyl-ureas | |
| IE31499L (en) | 11ß-CHLORO-19-NOR-STEROIDS | |
| IE32040L (en) | Cyanophenoxyaminopropanols | |
| IE31953L (en) | Kallikrein-inactivator | |
| IE31929B1 (en) | Rho-alkoxy-piperidine-amides | |
| IE32477L (en) | 4-phenyl-quinazolinones | |
| IE31701L (en) | Arylsulphonyl-ureas | |
| IE32895L (en) | Aminoacetylaminobenzophenones | |
| IE31673L (en) | Carbamoyloxy-phenylureas | |
| IE31634L (en) | Tritylamines | |
| IE31633L (en) | Dispenser-closure | |
| IE31570L (en) | Cyanonitrofuramidine | |
| IL28360A (en) | De-palletizers |