CS207489B2 - Method of making new ergoline derivates - Google Patents
Method of making new ergoline derivates Download PDFInfo
- Publication number
- CS207489B2 CS207489B2 CS778087A CS808777A CS207489B2 CS 207489 B2 CS207489 B2 CS 207489B2 CS 778087 A CS778087 A CS 778087A CS 808777 A CS808777 A CS 808777A CS 207489 B2 CS207489 B2 CS 207489B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- alkyl
- methyl
- carbon atoms
- title compound
- yield
- Prior art date
Links
- AWFDCTXCTHGORH-HGHGUNKESA-N 6-[4-[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl]piperazin-1-yl]-1-methylpyridin-2-one Chemical compound O=C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N(CC1)CCN1C1=CC=CC(=O)N1C AWFDCTXCTHGORH-HGHGUNKESA-N 0.000 title claims abstract description 11
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 38
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 10
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 7
- 239000001257 hydrogen Substances 0.000 claims abstract description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 5
- 239000000460 chlorine Substances 0.000 claims abstract description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 3
- 238000000034 method Methods 0.000 claims description 25
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 8
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 5
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 claims description 3
- XXTZHYXQVWRADW-UHFFFAOYSA-N diazomethanone Chemical compound [N]N=C=O XXTZHYXQVWRADW-UHFFFAOYSA-N 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- MOIPGXQKZSZOQX-UHFFFAOYSA-N carbonyl bromide Chemical compound BrC(Br)=O MOIPGXQKZSZOQX-UHFFFAOYSA-N 0.000 claims description 2
- 239000003153 chemical reaction reagent Substances 0.000 claims description 2
- 239000012434 nucleophilic reagent Substances 0.000 claims description 2
- 125000004193 piperazinyl group Chemical group 0.000 claims description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 1
- 150000008064 anhydrides Chemical class 0.000 claims 1
- 239000000203 mixture Substances 0.000 claims 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims 1
- -1 substituted-phenyl Chemical group 0.000 abstract description 9
- 125000000217 alkyl group Chemical group 0.000 abstract description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract description 2
- 125000003545 alkoxy group Chemical group 0.000 abstract description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract description 2
- 229910052736 halogen Inorganic materials 0.000 abstract description 2
- 150000002367 halogens Chemical group 0.000 abstract description 2
- 125000005842 heteroatom Chemical group 0.000 abstract description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 abstract description 2
- 229910052760 oxygen Inorganic materials 0.000 abstract description 2
- 239000001301 oxygen Substances 0.000 abstract description 2
- 229920006395 saturated elastomer Polymers 0.000 abstract description 2
- 239000005864 Sulphur Substances 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- 241000700159 Rattus Species 0.000 description 8
- OULXAFABNHTZLI-SKNXHYNKSA-N 1-[(6ar,10ar)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-yl]ethanone Chemical compound C1=CC([C@@H]2[C@H](NCC(C2)C(=O)C)C2)=C3C2=CNC3=C1 OULXAFABNHTZLI-SKNXHYNKSA-N 0.000 description 6
- WDLVDQMIHSOUPY-IIWDCPNDSA-N 1-[(6ar,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]-2-bromoethanone Chemical compound C1=CC([C@H]2CC(CN([C@@H]2C2)C)C(=O)CBr)=C3C2=CNC3=C1 WDLVDQMIHSOUPY-IIWDCPNDSA-N 0.000 description 5
- OZVBMTJYIDMWIL-AYFBDAFISA-N bromocriptine Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N[C@]2(C(=O)N3[C@H](C(N4CCC[C@H]4[C@]3(O)O2)=O)CC(C)C)C(C)C)C2)=C3C2=C(Br)NC3=C1 OZVBMTJYIDMWIL-AYFBDAFISA-N 0.000 description 5
- 229960002802 bromocriptine Drugs 0.000 description 5
- 241000282472 Canis lupus familiaris Species 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000001263 anti-prolactin effect Effects 0.000 description 3
- 239000002895 emetic Substances 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- HTKHLVIOITZWSN-PXFYRTPJSA-N 1-[(6ar,10ar)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-yl]-2-bromoethanone Chemical compound C1=CC([C@H]2CC(CN([C@@H]2C2)C)C(=O)CBr)=C3C2=CN(C)C3=C1 HTKHLVIOITZWSN-PXFYRTPJSA-N 0.000 description 2
- CQVKMVQRSNNAGO-UHFFFAOYSA-N 2-[4-formyl-3-methyl-n-(2-methylsulfonyloxyethyl)anilino]ethyl methanesulfonate Chemical compound CC1=CC(N(CCOS(C)(=O)=O)CCOS(C)(=O)=O)=CC=C1C=O CQVKMVQRSNNAGO-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 102000003946 Prolactin Human genes 0.000 description 2
- 108010057464 Prolactin Proteins 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 238000002513 implantation Methods 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- XULSCZPZVQIMFM-IPZQJPLYSA-N odevixibat Chemical compound C12=CC(SC)=C(OCC(=O)N[C@@H](C(=O)N[C@@H](CC)C(O)=O)C=3C=CC(O)=CC=3)C=C2S(=O)(=O)NC(CCCC)(CCCC)CN1C1=CC=CC=C1 XULSCZPZVQIMFM-IPZQJPLYSA-N 0.000 description 2
- 230000035935 pregnancy Effects 0.000 description 2
- 229940097325 prolactin Drugs 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 230000001629 suppression Effects 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- MCCXTHKWNDYNKL-HUFXEGEASA-N (6ar,9r)-4,7-dimethyl-5,5a,6,6a,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C([C@H](CN(C)[C@@H]1C2)C(O)=O)=C1C1=CC=CC3=C1C2CN3C MCCXTHKWNDYNKL-HUFXEGEASA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- RRVBCOGQWXLOIF-RMNMTYGKSA-N 1-[(6ar,10ar)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-yl]-2-morpholin-4-ylethanone Chemical compound CN([C@H]1[C@@H](C=2C=CC=C3N(C)C=C(C=23)C1)C1)CC1C(=O)CN1CCOCC1 RRVBCOGQWXLOIF-RMNMTYGKSA-N 0.000 description 1
- ZWTDLHNMTMBVEV-GERZZCHPSA-N 1-[(6ar,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]-2-(diethylamino)ethanone Chemical compound C1=CC([C@H]2CC(CN(C)[C@@H]2C2)C(=O)CN(CC)CC)=C3C2=CNC3=C1 ZWTDLHNMTMBVEV-GERZZCHPSA-N 0.000 description 1
- WICFOCORUNSCHI-IIWDCPNDSA-N 1-[(6ar,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]-2-hydroxyethanone Chemical compound C1=CC([C@H]2CC(CN([C@@H]2C2)C)C(=O)CO)=C3C2=CNC3=C1 WICFOCORUNSCHI-IIWDCPNDSA-N 0.000 description 1
- FUSRBCOOWOTXCG-GERZZCHPSA-N 1-[(6ar,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]-2-morpholin-4-ylethanone Chemical compound CN([C@H]1[C@@H](C=2C=CC=C3NC=C(C=23)C1)C1)CC1C(=O)CN1CCOCC1 FUSRBCOOWOTXCG-GERZZCHPSA-N 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- 208000001287 Galactorrhea Diseases 0.000 description 1
- 206010017600 Galactorrhoea Diseases 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ZRKWMRDKSOPRRS-UHFFFAOYSA-N N-Methyl-N-nitrosourea Chemical compound O=NN(C)C(N)=O ZRKWMRDKSOPRRS-UHFFFAOYSA-N 0.000 description 1
- 208000018737 Parkinson disease Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- FHKPLLOSJHHKNU-INIZCTEOSA-N [(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]-(oxan-4-yl)methanone Chemical compound C(C)N1N=CC(=C1C)C=1N(C2=NC=NC(=C2N=1)O[C@@H]1CN(CC1)C(=O)C1CCOCC1)C FHKPLLOSJHHKNU-INIZCTEOSA-N 0.000 description 1
- VSHCYSYLUCDUAQ-KXBOQVSUSA-N [2-[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-2-oxoethyl] 2,6-dimethylbenzoate Chemical compound CC1=C(C(=O)OCC(=O)C2CN([C@@H]3CC4=CNC5=CC=CC([C@H]3C2)=C45)C)C(=CC=C1)C VSHCYSYLUCDUAQ-KXBOQVSUSA-N 0.000 description 1
- 229940008309 acetone / ethanol Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 208000007502 anemia Diseases 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 210000003756 cervix mucus Anatomy 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 230000004720 fertilization Effects 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 239000000960 hypophysis hormone Substances 0.000 description 1
- 230000036512 infertility Effects 0.000 description 1
- 208000000509 infertility Diseases 0.000 description 1
- 231100000535 infertility Toxicity 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 230000006651 lactation Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- UNEIHNMKASENIG-UHFFFAOYSA-N para-chlorophenylpiperazine Chemical compound C1=CC(Cl)=CC=C1N1CCNCC1 UNEIHNMKASENIG-UHFFFAOYSA-N 0.000 description 1
- MRDGZSKYFPGAKP-UHFFFAOYSA-N para-methoxyphenylpiperazine Chemical compound C1=CC(OC)=CC=C1N1CCNCC1 MRDGZSKYFPGAKP-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 229940103091 potassium benzoate Drugs 0.000 description 1
- 235000010235 potassium benzoate Nutrition 0.000 description 1
- 239000004300 potassium benzoate Substances 0.000 description 1
- YQFJGGDKUUOQFA-UHFFFAOYSA-M potassium;1h-pyrrole-2-carboxylate Chemical compound [K+].[O-]C(=O)C1=CC=CN1 YQFJGGDKUUOQFA-UHFFFAOYSA-M 0.000 description 1
- WFMNHCSATCWAAQ-UHFFFAOYSA-M potassium;2,2-dimethylpropanoate Chemical compound [K+].CC(C)(C)C([O-])=O WFMNHCSATCWAAQ-UHFFFAOYSA-M 0.000 description 1
- MRFNZGPGVYIEFP-UHFFFAOYSA-M potassium;2,6-dimethoxybenzoate Chemical compound [K+].COC1=CC=CC(OC)=C1C([O-])=O MRFNZGPGVYIEFP-UHFFFAOYSA-M 0.000 description 1
- MISVOFAYXMKGCO-UHFFFAOYSA-M potassium;2,6-dimethylbenzoate Chemical compound [K+].CC1=CC=CC(C)=C1C([O-])=O MISVOFAYXMKGCO-UHFFFAOYSA-M 0.000 description 1
- VWQYYVHMLGMRSQ-UHFFFAOYSA-M potassium;5-bromopyridine-3-carboxylate Chemical compound [K+].[O-]C(=O)C1=CN=CC(Br)=C1 VWQYYVHMLGMRSQ-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000002250 progressing effect Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 1
- 235000019254 sodium formate Nutrition 0.000 description 1
- UDWXLZLRRVQONG-UHFFFAOYSA-M sodium hexanoate Chemical compound [Na+].CCCCCC([O-])=O UDWXLZLRRVQONG-UHFFFAOYSA-M 0.000 description 1
- QNRDAHPABVDRHI-UHFFFAOYSA-M sodium;5-methylpyrimidine-2-thiolate Chemical compound [Na+].CC1=CN=C([S-])N=C1 QNRDAHPABVDRHI-UHFFFAOYSA-M 0.000 description 1
- KFLRWGSAMLBHBV-UHFFFAOYSA-M sodium;pyridine-3-carboxylate Chemical compound [Na+].[O-]C(=O)C1=CC=CN=C1 KFLRWGSAMLBHBV-UHFFFAOYSA-M 0.000 description 1
- PVXCGWNPDFFPOV-UHFFFAOYSA-M sodium;pyridine-4-carboxylate Chemical compound [Na+].[O-]C(=O)C1=CC=NC=C1 PVXCGWNPDFFPOV-UHFFFAOYSA-M 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 229910052717 sulfur Chemical group 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Substances SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB50746/76A GB1580448A (en) | 1976-12-06 | 1976-12-06 | 8 -acetyl-6-methyl-ergoline i derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS207489B2 true CS207489B2 (en) | 1981-07-31 |
Family
ID=10457193
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS778087A CS207489B2 (en) | 1976-12-06 | 1977-12-05 | Method of making new ergoline derivates |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4196288A (de) |
| JP (1) | JPS5371099A (de) |
| AT (1) | AT361138B (de) |
| AU (1) | AU3111277A (de) |
| BE (1) | BE861480A (de) |
| CA (1) | CA1101848A (de) |
| CS (1) | CS207489B2 (de) |
| DE (1) | DE2754028A1 (de) |
| DK (1) | DK535777A (de) |
| FR (1) | FR2372834A1 (de) |
| GB (1) | GB1580448A (de) |
| HU (1) | HU177143B (de) |
| NL (1) | NL7713226A (de) |
| NO (1) | NO774133L (de) |
| NZ (1) | NZ185837A (de) |
| SE (1) | SE7713720L (de) |
| SU (1) | SU736872A3 (de) |
| YU (1) | YU283177A (de) |
| ZA (1) | ZA777174B (de) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE879822A (fr) * | 1979-02-20 | 1980-03-03 | Erba Farmitalia | Derives de l'ergoline |
| GB9711043D0 (en) * | 1997-05-29 | 1997-07-23 | Ciba Geigy Ag | Organic compounds |
| BR0210915A (pt) * | 2001-06-08 | 2004-06-08 | Sod Conseils Rech Applic | Análogos quiméricos de somatostatina-dopamina |
-
1976
- 1976-12-06 GB GB50746/76A patent/GB1580448A/en not_active Expired
-
1977
- 1977-11-30 NL NL7713226A patent/NL7713226A/xx not_active Application Discontinuation
- 1977-12-01 AU AU31112/77A patent/AU3111277A/en active Pending
- 1977-12-01 YU YU02831/77A patent/YU283177A/xx unknown
- 1977-12-01 US US05/856,536 patent/US4196288A/en not_active Expired - Lifetime
- 1977-12-01 AT AT860477A patent/AT361138B/de not_active IP Right Cessation
- 1977-12-02 DK DK535777A patent/DK535777A/da unknown
- 1977-12-02 ZA ZA00777174A patent/ZA777174B/xx unknown
- 1977-12-02 HU HU77SO1204A patent/HU177143B/hu unknown
- 1977-12-02 NO NO774133A patent/NO774133L/no unknown
- 1977-12-02 CA CA292,311A patent/CA1101848A/en not_active Expired
- 1977-12-02 NZ NZ185837A patent/NZ185837A/xx unknown
- 1977-12-02 SE SE7713720A patent/SE7713720L/xx unknown
- 1977-12-05 BE BE183147A patent/BE861480A/xx unknown
- 1977-12-05 DE DE19772754028 patent/DE2754028A1/de not_active Withdrawn
- 1977-12-05 JP JP14599077A patent/JPS5371099A/ja active Pending
- 1977-12-05 FR FR7736504A patent/FR2372834A1/fr active Granted
- 1977-12-05 SU SU772548999A patent/SU736872A3/ru active
- 1977-12-05 CS CS778087A patent/CS207489B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU3111277A (en) | 1979-06-07 |
| US4196288A (en) | 1980-04-01 |
| SU736872A3 (ru) | 1980-05-25 |
| CA1101848A (en) | 1981-05-26 |
| BE861480A (fr) | 1978-03-31 |
| SE7713720L (sv) | 1978-06-07 |
| HU177143B (en) | 1981-07-28 |
| AT361138B (de) | 1981-02-25 |
| FR2372834B1 (de) | 1981-11-27 |
| ZA777174B (en) | 1978-08-30 |
| NL7713226A (nl) | 1978-06-08 |
| GB1580448A (en) | 1980-12-03 |
| FR2372834A1 (fr) | 1978-06-30 |
| NO774133L (no) | 1978-06-07 |
| NZ185837A (en) | 1979-11-01 |
| DE2754028A1 (de) | 1978-06-08 |
| YU283177A (en) | 1983-12-31 |
| DK535777A (da) | 1978-06-07 |
| JPS5371099A (en) | 1978-06-24 |
| ATA860477A (de) | 1980-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3388129A (en) | 1-methyl ergot alkaloids | |
| US3920664A (en) | D-2-halo-6-alkyl-8-substituted ergolines and related compounds | |
| US4348391A (en) | Sulfonamido and sulfamoylamino-ergoline-I derivatives | |
| US4649200A (en) | Substituted pyrroles with opioid receptor activity | |
| US3922347A (en) | Method of inhibiting prolactin secretion with 8-acylaminoergolenes | |
| US4054660A (en) | Method of inhibiting prolactin | |
| EP0070562B1 (de) | Ergolin-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zusammenstellungen | |
| EP0125607A2 (de) | Pharmakologisch aktive Derivate von Pyrido(1,5)benzodiazepinon | |
| US4180581A (en) | N-9,10-dihydrolysergyl-m-aminobenzoic acid amide derivative | |
| Johnson et al. | Emetic activity of reduced lysergamides | |
| HU192052B (en) | Process for preparing new beta-carboline derivatives and pharmaceutical compositions containing them | |
| CA1064918A (en) | 8,8-disubstituted-6-methylergolines and related compounds | |
| US3238211A (en) | Derhvatives of g-methyl and i,g-dimethyl ergolhne | |
| CS207489B2 (en) | Method of making new ergoline derivates | |
| US3814765A (en) | 8,9-didehydro-10-alkoxy-ergolenes and process of preparation thereof | |
| US3646046A (en) | 1 6-dimethyl-10alpha-ergoline derivatives | |
| CA1062253A (en) | Process for preparing 6-methyl-8-(substituted) methylergolines | |
| IL42730A (en) | D-6-methyl-2,8-disubstituted ergolines,their preparation and pharmaceutical compositions containing them | |
| CA1142176B (en) | 2-azaergolines and 2-aza-8 (or 9)-ergolenes | |
| US4176182A (en) | Sulfamoyl derivatives of 8-β-aminomethylergoline | |
| CZ129693A3 (en) | Novel thienothiazine derivatives, process of their preparation and pharmaceutical preparations in which they are comprised | |
| AU631228B2 (en) | Pyrido (2,3-g) quinolines | |
| US3968112A (en) | Synthesis of penniclavine and elymoclavine | |
| US4001242A (en) | D-6-methyl-8-formyl-10α-alkoxy-8-ergolene | |
| US3684805A (en) | 2,3,4,4a-TETRAHYDRO-10H-1,2-OXAZINO {8 3,2-b{9 (1,3)BENZOXAZIN-10-ONES |