CS189638B2 - Method of producing basic substituted derivatives of theophyline - Google Patents
Method of producing basic substituted derivatives of theophylineInfo
- Publication number
- CS189638B2 CS189638B2 CS771447A CS144777A CS189638B2 CS 189638 B2 CS189638 B2 CS 189638B2 CS 771447 A CS771447 A CS 771447A CS 144777 A CS144777 A CS 144777A CS 189638 B2 CS189638 B2 CS 189638B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- theophyline
- substituted derivatives
- producing basic
- basic substituted
- producing
- Prior art date
Links
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical class O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 title 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS771447A CS189638B2 (en) | 1972-08-08 | 1977-03-03 | Method of producing basic substituted derivatives of theophyline |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2239012A DE2239012A1 (en) | 1972-08-08 | 1972-08-08 | BASIC SUBSTITUTED THEOPHYLLINE COMPOUNDS |
| CS735619A CS189616B2 (en) | 1972-08-08 | 1973-08-08 | Method of producing basic substituted derivatives of theophyline |
| CS771447A CS189638B2 (en) | 1972-08-08 | 1977-03-03 | Method of producing basic substituted derivatives of theophyline |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS189638B2 true CS189638B2 (en) | 1979-04-30 |
Family
ID=25746216
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS771447A CS189638B2 (en) | 1972-08-08 | 1977-03-03 | Method of producing basic substituted derivatives of theophyline |
| CS771448A CS189639B2 (en) | 1972-08-08 | 1977-03-03 | Method of preparing basically substituted theophylline derivatives |
| CS771449A CS189640B2 (en) | 1972-08-08 | 1977-03-03 | Method of producing basic substituted derivatives of theophyline |
| CS771446A CS189637B2 (en) | 1972-08-08 | 1977-03-03 | Method of preparing basically substituted theophylline derivatives |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS771448A CS189639B2 (en) | 1972-08-08 | 1977-03-03 | Method of preparing basically substituted theophylline derivatives |
| CS771449A CS189640B2 (en) | 1972-08-08 | 1977-03-03 | Method of producing basic substituted derivatives of theophyline |
| CS771446A CS189637B2 (en) | 1972-08-08 | 1977-03-03 | Method of preparing basically substituted theophylline derivatives |
Country Status (1)
| Country | Link |
|---|---|
| CS (4) | CS189638B2 (en) |
-
1977
- 1977-03-03 CS CS771447A patent/CS189638B2/en unknown
- 1977-03-03 CS CS771448A patent/CS189639B2/en unknown
- 1977-03-03 CS CS771449A patent/CS189640B2/en unknown
- 1977-03-03 CS CS771446A patent/CS189637B2/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CS189637B2 (en) | 1979-04-30 |
| CS189640B2 (en) | 1979-04-30 |
| CS189639B2 (en) | 1979-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS187389B2 (en) | Method of producing alkanolamine derivatives | |
| CS187390B2 (en) | Method of producing novel derivatives of benzimidazol-2-carbamic acid | |
| CS181701B2 (en) | Method of producing derivatives of 6-amino-9-arabinofur nosylpurine | |
| CS182793B2 (en) | Method for production of substituted ce-pentanorprostaglandins | |
| CS185620B2 (en) | Method of producing derivatives of chromone | |
| CS183686B2 (en) | Method of producing 1-hydroxy-2-pyridones | |
| CS188869B2 (en) | Method of producing derivatives of furane-3-carboxamide | |
| CS183721B2 (en) | Method of production of alfa-aminoacylcephalosporines | |
| CS182248B2 (en) | Method of producing n-benzhydryl-n-p-hydroxy-benzylpiperazine | |
| CS192504B2 (en) | Method of producing cyano-methyl-thioacetyl-cephalosporins | |
| CS191212B2 (en) | Method of producing lysergamides | |
| CS192502B2 (en) | Method of preparing derivatives of 3-carbamoyl-oxymethyl-cephalosporin | |
| CS190393B2 (en) | Method of producing antibiotic a-2315 | |
| CS181234B2 (en) | Method of producing benzodioxol derivatives | |
| BG24661A3 (en) | Method of preparing d-1-11-deoxoprostaglandine-e | |
| CS189616B2 (en) | Method of producing basic substituted derivatives of theophyline | |
| CS181238B2 (en) | Method of preparing 2-benzoyl-3-aminopyridines | |
| CS188175B2 (en) | Method of producing 15-substituted omega-nor-prostaglandins | |
| CS183694B2 (en) | Method of producing novel alfa-/o-sulphobenzimido/lactams | |
| CS193022B2 (en) | Method of producing derivatives of phosphonourea or phosphonothiourea | |
| CS187377B2 (en) | Method of producing novel cyclohexone derivatives | |
| CS193019B2 (en) | Method of producing 15alpha-methylene-4-estrene-17beta-ols | |
| CS189638B2 (en) | Method of producing basic substituted derivatives of theophyline | |
| CS181750B2 (en) | Method of producing n/6/-disubstituted derivatives of adenosine | |
| GB1406182A (en) | Method of producing d-ribose |