CS189637B2 - Method of preparing basically substituted theophylline derivatives - Google Patents
Method of preparing basically substituted theophylline derivativesInfo
- Publication number
- CS189637B2 CS189637B2 CS771446A CS144677A CS189637B2 CS 189637 B2 CS189637 B2 CS 189637B2 CS 771446 A CS771446 A CS 771446A CS 144677 A CS144677 A CS 144677A CS 189637 B2 CS189637 B2 CS 189637B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- theophylline derivatives
- basically substituted
- preparing
- substituted theophylline
- preparing basically
- Prior art date
Links
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical class O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 title 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS771446A CS189637B2 (en) | 1972-08-08 | 1977-03-03 | Method of preparing basically substituted theophylline derivatives |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2239012A DE2239012A1 (en) | 1972-08-08 | 1972-08-08 | BASIC SUBSTITUTED THEOPHYLLINE COMPOUNDS |
| CS735619A CS189616B2 (en) | 1972-08-08 | 1973-08-08 | Method of producing basic substituted derivatives of theophyline |
| CS771446A CS189637B2 (en) | 1972-08-08 | 1977-03-03 | Method of preparing basically substituted theophylline derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS189637B2 true CS189637B2 (en) | 1979-04-30 |
Family
ID=25746216
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS771448A CS189639B2 (en) | 1972-08-08 | 1977-03-03 | Method of preparing basically substituted theophylline derivatives |
| CS771446A CS189637B2 (en) | 1972-08-08 | 1977-03-03 | Method of preparing basically substituted theophylline derivatives |
| CS771449A CS189640B2 (en) | 1972-08-08 | 1977-03-03 | Method of producing basic substituted derivatives of theophyline |
| CS771447A CS189638B2 (en) | 1972-08-08 | 1977-03-03 | Method of producing basic substituted derivatives of theophyline |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS771448A CS189639B2 (en) | 1972-08-08 | 1977-03-03 | Method of preparing basically substituted theophylline derivatives |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS771449A CS189640B2 (en) | 1972-08-08 | 1977-03-03 | Method of producing basic substituted derivatives of theophyline |
| CS771447A CS189638B2 (en) | 1972-08-08 | 1977-03-03 | Method of producing basic substituted derivatives of theophyline |
Country Status (1)
| Country | Link |
|---|---|
| CS (4) | CS189639B2 (en) |
-
1977
- 1977-03-03 CS CS771448A patent/CS189639B2/en unknown
- 1977-03-03 CS CS771446A patent/CS189637B2/en unknown
- 1977-03-03 CS CS771449A patent/CS189640B2/en unknown
- 1977-03-03 CS CS771447A patent/CS189638B2/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CS189638B2 (en) | 1979-04-30 |
| CS189640B2 (en) | 1979-04-30 |
| CS189639B2 (en) | 1979-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR780000008B1 (en) | Process for the preparation of chromane derivatives | |
| YU35582B (en) | Process for obtaining substituted derivatives of piperidino-alkanone-oximes | |
| PH9508A (en) | Process for preparing derivatives of 1-phenoxy-3-amino propane-2-01 | |
| SU725559A3 (en) | Method of preparing benzofuran derivatives | |
| JPS52122349A (en) | Process for preparing tntermediate of 155substituteddomegaa pentanoprostagladines | |
| CS192502B2 (en) | Method of preparing derivatives of 3-carbamoyl-oxymethyl-cephalosporin | |
| BG24661A3 (en) | Method of preparing d-1-11-deoxoprostaglandine-e | |
| CS192507B2 (en) | Method of preparing derivatives of indole | |
| ZA737182B (en) | New aryl-piperazine derivatives of adenine | |
| KR780000273B1 (en) | Method for preparation of theophylline derivatives | |
| CS181238B2 (en) | Method of preparing 2-benzoyl-3-aminopyridines | |
| YU299579A (en) | Process for obtaining novel derivatives of aminoimidazoloisoquinoline | |
| CS183726B2 (en) | Method for producing derivatives of triazole | |
| CS183747B2 (en) | Method of preparing novel 1-p-/2-substituted aminovinyl/phenoxy-2-hydroxy-3-aminopropanes | |
| IL42679A0 (en) | Process for preparing polyhalohemiacetal derivatives of polysaccharides | |
| CS193022B2 (en) | Method of producing derivatives of phosphonourea or phosphonothiourea | |
| BG24663A3 (en) | Method of preparing succinylsuccinic acid dieste s | |
| CS181727B2 (en) | Process for preparing n/6/-disubstituted derivatives of adenosine | |
| CS189639B2 (en) | Method of preparing basically substituted theophylline derivatives | |
| CS188905B2 (en) | Method of preparing derivatives of 7-acylamido-7-alkoxy cephalosporin | |
| CS179444B2 (en) | Method for preparing derivatives of urea | |
| JPS53121752A (en) | Method for preparation of derivative of 22aminoindane | |
| CS179977B2 (en) | Method for producing novel derivatives of benzocycloheptathiophenone | |
| ZA731720B (en) | Process of preparation of penicillin derivatives | |
| BG24953A3 (en) | A method of obtaining phthalasines derivatives |