CS180032B2 - Method for preparation of diphenoxyacetic acid derivatives - Google Patents
Method for preparation of diphenoxyacetic acid derivativesInfo
- Publication number
- CS180032B2 CS180032B2 CS7400008568A CS856874A CS180032B2 CS 180032 B2 CS180032 B2 CS 180032B2 CS 7400008568 A CS7400008568 A CS 7400008568A CS 856874 A CS856874 A CS 856874A CS 180032 B2 CS180032 B2 CS 180032B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- preparation
- acid derivatives
- diphenoxyacetic acid
- diphenoxyacetic
- derivatives
- Prior art date
Links
- BWRPEDIXOHZKFD-UHFFFAOYSA-N 2,2-diphenoxyacetic acid Chemical class C=1C=CC=CC=1OC(C(=O)O)OC1=CC=CC=C1 BWRPEDIXOHZKFD-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/233—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/08—Preparation of carboxylic acids or their salts, halides or anhydrides from nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
- C07C59/70—Ethers of hydroxy-acetic acid, e.g. substitutes on the ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/04—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms
- C07D215/06—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms having only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D215/14—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/096—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/58—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D335/00—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom
- C07D335/04—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D335/06—Benzothiopyrans; Hydrogenated benzothiopyrans
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Quinoline Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2362416A DE2362416A1 (de) | 1973-12-15 | 1973-12-15 | Diphenoxyessigsaeure-derivate und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS180032B2 true CS180032B2 (en) | 1977-12-30 |
Family
ID=5900858
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS7400008568A CS180032B2 (en) | 1973-12-15 | 1974-12-13 | Method for preparation of diphenoxyacetic acid derivatives |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4051170A (cs) |
| JP (1) | JPS5089336A (cs) |
| AT (1) | AT344685B (cs) |
| BE (1) | BE823212A (cs) |
| CA (1) | CA1049529A (cs) |
| CH (1) | CH612904A5 (cs) |
| CS (1) | CS180032B2 (cs) |
| DD (1) | DD115483A5 (cs) |
| DE (1) | DE2362416A1 (cs) |
| DK (1) | DK139714C (cs) |
| ES (1) | ES432894A1 (cs) |
| FR (1) | FR2254319B1 (cs) |
| GB (1) | GB1437300A (cs) |
| HK (1) | HK62978A (cs) |
| HU (1) | HU170600B (cs) |
| IL (1) | IL46161A (cs) |
| IT (1) | IT7948174A0 (cs) |
| KE (1) | KE2891A (cs) |
| MY (1) | MY7800441A (cs) |
| NL (1) | NL7416271A (cs) |
| SE (1) | SE7415456L (cs) |
| ZA (1) | ZA747980B (cs) |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3517051A (en) * | 1964-03-20 | 1970-06-23 | Merck & Co Inc | Phenoxy substituted phenylacetic acids |
| US3474128A (en) * | 1966-01-10 | 1969-10-21 | Sandoz Ag | Derivatives of malonic acid |
| US3454581A (en) * | 1967-02-21 | 1969-07-08 | Sandoz Ag | Derivatives of bis-(p-chlorophenoxy) acetic acid |
| US3546229A (en) * | 1967-07-14 | 1970-12-08 | Sandoz Ag | Derivatives of acetic acid |
| US3707549A (en) * | 1967-12-05 | 1972-12-26 | Lilly Co Eli | Alpha-substituted hydrocinnamic acids and derivatives thereof |
| US3681365A (en) * | 1968-10-18 | 1972-08-01 | Sandoz Ag | Derivatives of acetic acid |
| US3526632A (en) * | 1968-10-22 | 1970-09-01 | Sandoz Ag | Derivatives of bis-(4-biphenylyloxy)acetic acid |
-
1973
- 1973-12-15 DE DE2362416A patent/DE2362416A1/de not_active Withdrawn
-
1974
- 1974-11-29 IL IL46161A patent/IL46161A/xx unknown
- 1974-12-06 HU HUME1808A patent/HU170600B/hu unknown
- 1974-12-09 CA CA215,506A patent/CA1049529A/en not_active Expired
- 1974-12-10 SE SE7415456A patent/SE7415456L/xx unknown
- 1974-12-11 GB GB5364274A patent/GB1437300A/en not_active Expired
- 1974-12-11 BE BE151382A patent/BE823212A/xx unknown
- 1974-12-11 US US05/531,475 patent/US4051170A/en not_active Expired - Lifetime
- 1974-12-13 CS CS7400008568A patent/CS180032B2/cs unknown
- 1974-12-13 JP JP49144013A patent/JPS5089336A/ja active Pending
- 1974-12-13 NL NL7416271A patent/NL7416271A/xx not_active Application Discontinuation
- 1974-12-13 FR FR7441198A patent/FR2254319B1/fr not_active Expired
- 1974-12-13 CH CH1662674A patent/CH612904A5/xx not_active IP Right Cessation
- 1974-12-13 ZA ZA00747980A patent/ZA747980B/xx unknown
- 1974-12-13 DD DD183003A patent/DD115483A5/xx unknown
- 1974-12-13 DK DK649674A patent/DK139714C/da active
- 1974-12-13 AT AT995774A patent/AT344685B/de not_active IP Right Cessation
- 1974-12-13 ES ES432894A patent/ES432894A1/es not_active Expired
-
1978
- 1978-10-11 KE KE2891A patent/KE2891A/xx unknown
- 1978-10-26 HK HK629/78A patent/HK62978A/xx unknown
- 1978-12-30 MY MY441/78A patent/MY7800441A/xx unknown
-
1979
- 1979-03-01 IT IT7948174A patent/IT7948174A0/it unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL7416271A (nl) | 1975-06-17 |
| HU170600B (cs) | 1977-07-28 |
| FR2254319A1 (cs) | 1975-07-11 |
| AT344685B (de) | 1978-08-10 |
| DK139714C (da) | 1979-09-17 |
| KE2891A (en) | 1978-10-27 |
| ATA995774A (de) | 1977-12-15 |
| US4051170A (en) | 1977-09-27 |
| ZA747980B (en) | 1976-01-28 |
| HK62978A (en) | 1978-11-03 |
| DK649674A (cs) | 1975-08-25 |
| SE7415456L (cs) | 1975-06-16 |
| GB1437300A (en) | 1976-05-26 |
| FR2254319B1 (cs) | 1979-05-11 |
| IT7948174A0 (it) | 1979-03-01 |
| IL46161A0 (en) | 1975-02-10 |
| IL46161A (en) | 1978-09-29 |
| DD115483A5 (cs) | 1975-10-05 |
| CH612904A5 (cs) | 1979-08-31 |
| CA1049529A (en) | 1979-02-27 |
| BE823212A (fr) | 1975-06-11 |
| DE2362416A1 (de) | 1975-06-19 |
| DK139714B (da) | 1979-04-02 |
| MY7800441A (en) | 1978-12-31 |
| AU7570174A (en) | 1976-05-27 |
| JPS5089336A (cs) | 1975-07-17 |
| ES432894A1 (es) | 1977-02-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EG11489A (en) | Process for preparing of prostanoic acid derivatives | |
| GR60708B (en) | Preparation process of 2-acyl-4-oxo pyrazino-isoquinoline derivatives | |
| CS187435B2 (en) | Process for preparing derivatives of mycophenolic acid | |
| HU172234B (hu) | Sposob poluchenija novykh proizvodnykh 7-beta-acilamido-cef-3-em-4-karbonovojj kisloty | |
| CH610902A5 (en) | Process for the preparation of cephalosporanic acid derivatives | |
| IL45294A (en) | 7-acylamido-3-cephem-4-carboxylic acid derivatives and process for their preparation | |
| EG11731A (en) | Process for the preparation of new pregnan-21 acid derivatives | |
| EG11281A (en) | Process for preparation of oxamic acid derivatives | |
| EG11155A (en) | Process for the preparation of 7-acylaminodesaceto xycephalosporanic acid derivatives | |
| CH612926A5 (en) | Process for the preparation of substituted alpha-aminooxy-carbohydrazide derivatives and their acid addition salts | |
| IL52704A0 (en) | Novel derivatives of 7-amino-cephem-4-carboxylic acid | |
| CS184849B2 (en) | Method of preparing 5-fluor-2-methyl-1-/p-methyl-sulphinyl-benzylidene/-3-indenyl acetic acid | |
| CS184347B2 (en) | Method for producing derivatives of 1-phenoxy-2-hydroxy-3-aminopropane | |
| CS178923B2 (en) | Method for preparation of 3-ketoglutaric acid | |
| IL45603A0 (en) | 7-trichloroacetamido-3-desacetoxy-cephalosporanic acid derivatives and processes for their preparation | |
| CS178910B2 (en) | Method for preparing derivatives of 3-alkyl-7-acylaminoceph-3-em-4-carboxylic acid | |
| BG24404A3 (en) | Method of preparing citric acid | |
| CS181278B2 (en) | Method of producing cephalosporane acid derivatives | |
| CS180032B2 (en) | Method for preparation of diphenoxyacetic acid derivatives | |
| EG11957A (en) | Process for the preparation of otaconic acid and derivatives thereof | |
| YU222474A (en) | Process for preparing new pyrrazole-4-acetic acid derivatives | |
| IL45602A0 (en) | 6-trichloroacetamido-penicillanic acid derivatives and processes for their preparation | |
| IL45605A0 (en) | 7-monochloroacetamido-3-desacetoxy-cephalosporanic acid derivatives and processes for their preparation | |
| CS189699B2 (en) | Method of producing novel derivatives of 3-cephem-4-carboxilic acid | |
| MY7700210A (en) | Derivatives of 3-thivallophanic acid |