CH439287A - Verfahren zur Herstellung von 4,4'-Bipyridyl-quaternärsalzen - Google Patents
Verfahren zur Herstellung von 4,4'-Bipyridyl-quaternärsalzenInfo
- Publication number
- CH439287A CH439287A CH1486662A CH1486662A CH439287A CH 439287 A CH439287 A CH 439287A CH 1486662 A CH1486662 A CH 1486662A CH 1486662 A CH1486662 A CH 1486662A CH 439287 A CH439287 A CH 439287A
- Authority
- CH
- Switzerland
- Prior art keywords
- preparation
- quaternary salts
- bipyridyl quaternary
- bipyridyl
- salts
- Prior art date
Links
- MWVTWFVJZLCBMC-UHFFFAOYSA-N 4,4'-bipyridine Chemical group C1=NC=CC(C=2C=CN=CC=2)=C1 MWVTWFVJZLCBMC-UHFFFAOYSA-N 0.000 title 1
- 150000003839 salts Chemical group 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/22—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom containing two or more pyridine rings directly linked together, e.g. bipyridyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB45646/61A GB1037641A (en) | 1961-12-20 | 1961-12-20 | 4,4'-bipyridylium quaternary salts |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH439287A true CH439287A (de) | 1967-07-15 |
Family
ID=10438023
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1486662A CH439287A (de) | 1961-12-20 | 1962-12-19 | Verfahren zur Herstellung von 4,4'-Bipyridyl-quaternärsalzen |
| CH659567A CH439864A (de) | 1961-12-20 | 1962-12-19 | Unkrautvertilgungsmittel |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH659567A CH439864A (de) | 1961-12-20 | 1962-12-19 | Unkrautvertilgungsmittel |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3332959A (Direct) |
| BR (1) | BR6245597D0 (Direct) |
| CH (2) | CH439287A (Direct) |
| GB (2) | GB1037641A (Direct) |
| MY (1) | MY6700041A (Direct) |
| NL (1) | NL287014A (Direct) |
| SE (1) | SE303399B (Direct) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1073824A (en) * | 1965-04-06 | 1967-06-28 | Ici Ltd | Separation of a 4:4-bipyridylium salt from a mixture containing it |
| US3458305A (en) * | 1966-08-24 | 1969-07-29 | Gulf Research Development Co | Bispyridinium compounds as herbicides |
| US3530141A (en) * | 1966-11-07 | 1970-09-22 | Ici Ltd | Process for preparing 1,1'-dialkyl-4,4'-bipyridylium compounds |
| GB1170643A (en) * | 1967-09-27 | 1969-11-12 | Ici Ltd | Improved Herbicidal Compositions |
| US4052405A (en) * | 1972-09-04 | 1977-10-04 | Imperial Chemical Industries Limited | Manufacture of 1,1'-dialkyl-4,4'-bipyridylium salts |
| NZ180649A (en) * | 1975-04-28 | 1978-06-20 | Ici Ltd | Selectively killing oats growing in cereal crops other than oats |
| CA1075029A (en) * | 1975-12-02 | 1980-04-08 | Richard Comber | Treatment of tobacco |
| GB1583959A (en) * | 1976-11-16 | 1981-02-04 | Ici Ltd | Arboricides |
| WO1979000838A1 (en) | 1978-03-28 | 1979-10-18 | Michael James Sampson | New plant technique |
| EP0027344B1 (en) * | 1979-10-13 | 1984-02-22 | Neville Hutchings | Process for obtaining improved yields from plants |
| ATE80520T1 (de) * | 1984-07-27 | 1992-10-15 | Univ Illinois | Photodynamische unkrautvertilger. |
| IL77817A (en) * | 1986-02-06 | 1995-06-29 | Yeda Res & Dev | Process for controlling plant growth and herbicidal compositions therefor |
| US5009451A (en) * | 1988-07-19 | 1991-04-23 | Kabushiki Kaisha Showa Seisakusho | Shock absorber for use in a vehicle |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3040052A (en) * | 1962-06-19 | Preparation of z | ||
| US3054798A (en) * | 1962-09-18 | Bis quaternary oximes | ||
| NL216005A (Direct) * | 1956-04-04 | |||
| US3020143A (en) * | 1957-01-23 | 1962-02-06 | Diamond Alkali Co | Method of regulating plant growth |
| BE600423A (Direct) * | 1960-02-23 | |||
| US3049547A (en) * | 1961-05-31 | 1962-08-14 | Reilly Tar & Chem Corp | Dipyridyl quaternary salts |
-
0
- NL NL287014D patent/NL287014A/xx unknown
-
1961
- 1961-12-20 GB GB45646/61A patent/GB1037641A/en not_active Expired
- 1961-12-20 GB GB313/66A patent/GB1040170A/en not_active Expired
-
1962
- 1962-12-13 US US244290A patent/US3332959A/en not_active Expired - Lifetime
- 1962-12-19 CH CH1486662A patent/CH439287A/de unknown
- 1962-12-19 CH CH659567A patent/CH439864A/de unknown
- 1962-12-19 SE SE13716/62A patent/SE303399B/xx unknown
- 1962-12-20 BR BR145597/62A patent/BR6245597D0/pt unknown
-
1967
- 1967-12-31 MY MY196741A patent/MY6700041A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL287014A (Direct) | |
| BR6245597D0 (pt) | 1973-05-15 |
| SE303399B (Direct) | 1968-08-26 |
| MY6700041A (en) | 1967-12-31 |
| CH439864A (de) | 1967-07-31 |
| GB1037641A (en) | 1966-08-03 |
| GB1040170A (en) | 1966-08-24 |
| US3332959A (en) | 1967-07-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH412918A (de) | Verfahren zur Herstellung von 1,8-Naphthyridinen | |
| CH453340A (de) | Verfahren zur Herstellung von trans-Dimethylolcyclohexan-1,4 | |
| CH457473A (de) | Verfahren zur Herstellung von 9,10-Dihydroergovalin | |
| CH439287A (de) | Verfahren zur Herstellung von 4,4'-Bipyridyl-quaternärsalzen | |
| CH414655A (de) | Verfahren zur Herstellung von 1,4-Benzodiazepinen | |
| CH420147A (de) | Verfahren zur Herstellung von 4,4'-Bipyridyl-Quaternärsalzen | |
| CH433236A (de) | Verfahren zur Herstellung von 2,6-Dichlorbenzonitril | |
| CH415664A (de) | Verfahren zur Herstellung von substituierten 1-Halogenphenyl-2-amino-alkanonen-(1) | |
| CH430704A (de) | Verfahren zur Herstellung von 4,7-Dihalogen-1-methylindan-3-onen | |
| CH387656A (de) | Verfahren zur Herstellung von 2,5-Furandicarbonsäure | |
| CH426758A (de) | Verfahren zur Herstellung von 4-(2',6',6'-Trimethyl-cyclohexen-(1')-yl)-2-methylbuten-(3)-al-(1) | |
| CH442352A (de) | Verfahren zur Herstellung von 2-Alkoxy-3,4-dihydroxy-5-hydroxymethyl-tetrahydrofuranderivaten | |
| CH397715A (de) | Verfahren zur Herstellung von 2,5-Diarylaminoterephthalsäuren | |
| CH442323A (de) | Verfahren zur Herstellung von O,S-Dialkoxycarbonylthiaminen | |
| CH445488A (de) | Verfahren zur Herstellung von Bis-bipyridylquaternäsalzen | |
| CH442306A (de) | Verfahren zur Herstellung von 3,4-Dihydro-benzoxazinonen-(1,3,2) | |
| CH415649A (de) | Verfahren zur Herstellung von 2-(5',6',7',8'-Tetrahydronaphthyl-1')-amino-imidazolin | |
| CH432487A (de) | Verfahren zur Herstellung von Mononitro-1,3,5-trialkylbenzol | |
| CH408934A (de) | Verfahren zur Herstellung von 1,4,5-trisubstituierten Pyridazonen-(6) | |
| AT231451B (de) | Verfahren zur Herstellung von 2, 6-Diketo-8-thiapurinen | |
| CH428769A (de) | Verfahren zur Herstellung von 1,8-Dihydroxyanthrachinonyl-5-thioäthern | |
| CH431507A (de) | Verfahren zur Herstellung von 1,2,3,4-Tetrachlor-9-anthron | |
| CH433355A (de) | Verfahren zur Herstellung von 2,4-Diamino-6-hydroxymethyl-7,8-dihydro-pteridin | |
| CH421122A (de) | Verfahren zur Herstellung von 1,3,4-Oxdiazolen | |
| CH407086A (de) | Verfahren zur Herstellung von 1,2,3,4-Tetraalkyl-anthrachinon-8-carbonsäuren |