CA918158A - 3-amino-5-benzyl-1,2,4-oxadiazoles - Google Patents
3-amino-5-benzyl-1,2,4-oxadiazolesInfo
- Publication number
- CA918158A CA918158A CA112454A CA112454A CA918158A CA 918158 A CA918158 A CA 918158A CA 112454 A CA112454 A CA 112454A CA 112454 A CA112454 A CA 112454A CA 918158 A CA918158 A CA 918158A
- Authority
- CA
- Canada
- Prior art keywords
- oxadiazoles
- benzyl
- amino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- IYGOAQQRJOCCBB-UHFFFAOYSA-N 5-benzyl-1,2,4-oxadiazol-3-amine Chemical class NC1=NOC(CC=2C=CC=CC=2)=N1 IYGOAQQRJOCCBB-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
- C07D271/07—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US5525370A | 1970-07-15 | 1970-07-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA918158A true CA918158A (en) | 1973-01-02 |
Family
ID=21996688
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA112454A Expired CA918158A (en) | 1970-07-15 | 1971-05-07 | 3-amino-5-benzyl-1,2,4-oxadiazoles |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3720685A (enExample) |
| CA (1) | CA918158A (enExample) |
| CH (1) | CH522670A (enExample) |
| DE (1) | DE2124907A1 (enExample) |
| FR (1) | FR2100914B1 (enExample) |
| GB (1) | GB1322451A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3917615A (en) * | 1974-04-01 | 1975-11-04 | Searle & Co | 1,1-Diaryl-1-oxadiazol-alkylamines |
| US4003904A (en) * | 1974-04-01 | 1977-01-18 | G. D. Searle & Co. | Anti-diarrheal oxadiazoles |
| DE2860691D1 (en) * | 1977-07-12 | 1981-08-13 | Synthelabo | 1,2,4-oxadiazol derivatives, their preparation and application in pharmaceutical compositions |
| US5180731A (en) * | 1986-06-03 | 1993-01-19 | Sumitomo Pharmaceuticals Company, Limited | Aminoazole derivatives and their production and use |
| US4914112A (en) * | 1986-06-03 | 1990-04-03 | Sumitomo Pharmaceuticals Company, Limited | Aminoazole derivatives and their production and use |
| WO1998047880A1 (en) * | 1997-04-21 | 1998-10-29 | Sumitomo Pharmaceuticals Company, Limited | Isoxazole derivatives |
| US6100260A (en) * | 1997-04-21 | 2000-08-08 | Sumitomo Pharmaceutical Company, Limited | Isoxazole derivatives |
| WO2010073011A2 (en) | 2008-12-23 | 2010-07-01 | Betagenon Ab | Compounds useful as medicaments |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1279280A (fr) * | 1959-09-29 | 1961-12-22 | Francesco Angelini | Perfectionnements apportés aux procédés pour préparer des 1, 2, 4-oxadiazoles |
| US3564607A (en) * | 1965-07-30 | 1971-02-16 | Olin Corp | Halogenated aryloxyacetyl cyanamides |
-
1970
- 1970-07-15 US US00055253A patent/US3720685A/en not_active Expired - Lifetime
-
1971
- 1971-04-30 GB GB1255371A patent/GB1322451A/en not_active Expired
- 1971-05-07 CA CA112454A patent/CA918158A/en not_active Expired
- 1971-05-14 CH CH712171A patent/CH522670A/de not_active IP Right Cessation
- 1971-05-19 DE DE19712124907 patent/DE2124907A1/de active Pending
- 1971-07-15 FR FR7125927A patent/FR2100914B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH522670A (de) | 1972-06-30 |
| DE2124907A1 (de) | 1972-01-20 |
| GB1322451A (en) | 1973-07-04 |
| US3720685A (en) | 1973-03-13 |
| FR2100914B1 (enExample) | 1975-02-07 |
| FR2100914A1 (enExample) | 1972-03-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1002049A (en) | 3,5-dioxopiperazinyl derivatives | |
| CA965104A (en) | 3,4,5-trialkylcyclohexanols | |
| CA918158A (en) | 3-amino-5-benzyl-1,2,4-oxadiazoles | |
| CA954866A (en) | Partly new 1,2,4 - oxadiazoles | |
| AU465145B2 (en) | 2, 4-diamino-5-benzylpyrimidines | |
| CA947277A (en) | 6.alpha.-FLUORO-16.alpha.,18-DIMETHYL-.DELTA.1,4-PREGNADIENE-3-20-DIONES | |
| CA924308A (en) | 1,2,4-oxadiazole derivatives | |
| CA994346A (en) | 3-arylsulfonyl-1,2,4-oxadiazoles | |
| CA943126A (en) | 4,14-estradiene compounds | |
| CA837636A (en) | 1,3-diazacyclo-2,4-butanediones | |
| CA931962A (en) | 3-amino-5-n undecyl-1,2,4-oxadiazole | |
| AU2707271A (en) | 1, 2, 4-oxadiazoline derivative | |
| AU3151271A (en) | Substituted 1, 3-indandiols | |
| CA941831A (en) | Phosphorylated 1,2,4-oxadiazoles | |
| CA858562A (en) | 2-halo-3,11,20-triketo-17-hydroxy-21-acyloxy-pregnanes | |
| CA854718A (en) | 1,2-dihydro-1-hydroxypyrimidines | |
| CA854194A (en) | 2,3,1-diazaborines | |
| CA851181A (en) | 2,2-ethylenetestosterones | |
| CA831547A (en) | 2,6-diarylphenols | |
| CA838693A (en) | 1,2-dihydro-1-hydroxypyrimidines | |
| AU440569B2 (en) | 1,2,6b,7b-DIMETHYLENE-STEROIDS | |
| CA850661A (en) | 1,2,4 thiadiazoles | |
| CA839720A (en) | 2-aryl-1-oxa-3-azaspiro (5,5) undec-2-enes | |
| CA833598A (en) | 1-bromo-1-chloro-2,3,3-trifluoropropene | |
| CA856240A (en) | .delta.4,20,22-bufatrienolides |