CA2850473A1 - Neck support pillow - Google Patents
Neck support pillow Download PDFInfo
- Publication number
- CA2850473A1 CA2850473A1 CA2850473A CA2850473A CA2850473A1 CA 2850473 A1 CA2850473 A1 CA 2850473A1 CA 2850473 A CA2850473 A CA 2850473A CA 2850473 A CA2850473 A CA 2850473A CA 2850473 A1 CA2850473 A1 CA 2850473A1
- Authority
- CA
- Canada
- Prior art keywords
- pillow
- insert
- support
- user
- visco elastic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000011800 void material Substances 0.000 claims abstract description 57
- 239000000463 material Substances 0.000 claims abstract description 29
- 229920000079 Memory foam Polymers 0.000 claims description 28
- 239000008210 memory foam Substances 0.000 claims description 28
- 239000006260 foam Substances 0.000 claims description 21
- 239000011324 bead Substances 0.000 claims description 11
- 239000004744 fabric Substances 0.000 claims description 10
- 239000006261 foam material Substances 0.000 claims description 5
- 239000006104 solid solution Substances 0.000 claims description 5
- 239000012858 resilient material Substances 0.000 claims 10
- 210000003739 neck Anatomy 0.000 description 43
- 238000010276 construction Methods 0.000 description 6
- 210000003746 feather Anatomy 0.000 description 5
- 239000000945 filler Substances 0.000 description 5
- 230000003466 anti-cipated effect Effects 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- 238000003780 insertion Methods 0.000 description 3
- 230000037431 insertion Effects 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 208000027418 Wounds and injury Diseases 0.000 description 2
- 230000006835 compression Effects 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- 208000014674 injury Diseases 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 238000009958 sewing Methods 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 1
- 229920004934 Dacron® Polymers 0.000 description 1
- 241001669679 Eleotris Species 0.000 description 1
- 240000008620 Fagopyrum esculentum Species 0.000 description 1
- 235000009419 Fagopyrum esculentum Nutrition 0.000 description 1
- 206010019194 Head discomfort Diseases 0.000 description 1
- 206010048865 Hypoacusis Diseases 0.000 description 1
- 206010053156 Musculoskeletal discomfort Diseases 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 229920005830 Polyurethane Foam Polymers 0.000 description 1
- 208000013738 Sleep Initiation and Maintenance disease Diseases 0.000 description 1
- 210000003484 anatomy Anatomy 0.000 description 1
- 230000037237 body shape Effects 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 210000005069 ears Anatomy 0.000 description 1
- 239000013013 elastic material Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 206010022437 insomnia Diseases 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000011325 microbead Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- RGCLLPNLLBQHPF-HJWRWDBZSA-N phosphamidon Chemical compound CCN(CC)C(=O)C(\Cl)=C(/C)OP(=O)(OC)OC RGCLLPNLLBQHPF-HJWRWDBZSA-N 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 239000011496 polyurethane foam Substances 0.000 description 1
- 230000003319 supportive effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47G—HOUSEHOLD OR TABLE EQUIPMENT
- A47G9/00—Bed-covers; Counterpanes; Travelling rugs; Sleeping rugs; Sleeping bags; Pillows
- A47G9/10—Pillows
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47G—HOUSEHOLD OR TABLE EQUIPMENT
- A47G9/00—Bed-covers; Counterpanes; Travelling rugs; Sleeping rugs; Sleeping bags; Pillows
- A47G9/10—Pillows
- A47G2009/1018—Foam pillows
Landscapes
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Otolaryngology (AREA)
- Pulmonology (AREA)
- Bedding Items (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| USN/A | 2002-03-26 | ||
| US38850210P | 2010-09-30 | 2010-09-30 | |
| US61/388,502 | 2010-09-30 | ||
| PCT/US2011/054405 WO2012045032A2 (en) | 2010-09-30 | 2011-09-30 | Neck support pillow |
| US13/250,915 US20120079659A1 (en) | 2010-09-30 | 2011-09-30 | Neck support pillow |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2850473A1 true CA2850473A1 (en) | 2012-05-04 |
Family
ID=45888559
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA2850473A Pending CA2850473A1 (en) | 2010-09-30 | 2011-09-30 | Neck support pillow |
Country Status (6)
| Country | Link |
|---|---|
| US (2) | US20120079659A1 (zh) |
| EP (1) | EP2621312A4 (zh) |
| CN (1) | CN103379842A (zh) |
| AU (1) | AU2011308529A1 (zh) |
| CA (1) | CA2850473A1 (zh) |
| WO (1) | WO2012045032A2 (zh) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8997279B1 (en) * | 2004-05-20 | 2015-04-07 | King Koil Licensing Company, Inc. | Multi-layer mattress with an air filtration foundation |
| US8931128B2 (en) * | 2006-06-12 | 2015-01-13 | Mtj American Llc | Encapsulated and filtered mattress |
| US20140109318A1 (en) * | 2012-10-24 | 2014-04-24 | Rick Loos | Neck support pillow |
| US8572779B2 (en) * | 2011-05-13 | 2013-11-05 | Pacific Coast Feather Company | Expandable pillow |
| US20130174344A1 (en) * | 2012-01-09 | 2013-07-11 | Steve Klancnik | Component with multiple layers |
| US9167924B2 (en) * | 2012-08-03 | 2015-10-27 | Forsound Corp. | Ergonomical pillow for head rest |
| US9538855B2 (en) | 2013-01-25 | 2017-01-10 | Serta, Inc. | Component with multiple layers |
| US20150082545A1 (en) * | 2013-09-20 | 2015-03-26 | Standard Fiber Llc | Bedding article having a cooling insert |
| US10548790B2 (en) * | 2015-04-28 | 2020-02-04 | Andrew Miller | Post-surgical support member for surgical site |
| US9795232B2 (en) | 2015-10-08 | 2017-10-24 | Standard Fiber, Llc | Hourglass pillow with internal baffle |
| US20180352979A1 (en) * | 2016-02-15 | 2018-12-13 | Alexandre Leu | Multifunctional body pillow |
| US9943179B1 (en) * | 2016-12-14 | 2018-04-17 | SnoozeWell, LLC | Upright sleep system |
| US10722058B1 (en) | 2017-03-29 | 2020-07-28 | Zelzeos LLC | Therapeutic pillow |
| USD899141S1 (en) * | 2019-03-21 | 2020-10-20 | Shanghai Sintang Industrial Co., Ltd. | Face pillow |
| USD961960S1 (en) | 2020-09-26 | 2022-08-30 | Yiwu Locyop Household Product co., Ltd | Palm-shaped pillow |
| USD925948S1 (en) * | 2020-11-16 | 2021-07-27 | Amazonkey | Pillow |
| USD941610S1 (en) * | 2021-01-12 | 2022-01-25 | Shiliang Zhang | Cervical pillow |
| USD985311S1 (en) | 2021-02-12 | 2023-05-09 | Teresa C. Marshall | Supportive pillow |
| USD942183S1 (en) | 2021-02-12 | 2022-02-01 | Teresa MARSHALL | Supportive pillow |
| USD1002235S1 (en) * | 2021-02-12 | 2023-10-24 | Banyan Licensing L.L.C. | Pillow |
| USD998384S1 (en) | 2021-04-08 | 2023-09-12 | Anna Grigoryevna Polupanova | Multi layer pillow |
| USD939248S1 (en) * | 2021-04-14 | 2021-12-28 | Shenzhen Qiji Technology Co., Ltd. | Pillow |
| USD966010S1 (en) * | 2021-05-20 | 2022-10-11 | Oleksandr Volodymyrovych Nevalidov | Orthopedic pillow for sleeping |
| USD959875S1 (en) * | 2021-06-11 | 2022-08-09 | Shiliang Zhang | Cervical pillow |
| USD959876S1 (en) * | 2021-07-06 | 2022-08-09 | Shiliang Zhang | Cervical pillow |
| USD1015018S1 (en) * | 2021-08-23 | 2024-02-20 | Suk Hwa Hong | Infant support pillow |
| USD965346S1 (en) * | 2021-10-08 | 2022-10-04 | Fujian Generous Sleeping Technology Co. Inc. | Pillow |
| WO2024110900A1 (en) * | 2022-11-22 | 2024-05-30 | Bioconix Pty Ltd | Stress offloading pillow |
| USD997603S1 (en) | 2023-06-06 | 2023-09-05 | Shenzhen Keyulongyu E-Commerce Co., Ltd. | Neck pillow |
| USD1025659S1 (en) | 2023-09-01 | 2024-05-07 | Chengdu Yishouweisheng Technology Inc. | Pillow |
Family Cites Families (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3848281A (en) * | 1974-01-23 | 1974-11-19 | D Mathews | Apertured article and protective cover therefor |
| USD261681S (en) * | 1979-06-07 | 1981-11-03 | Chandler John W | Orthopedic pillow |
| US4375112A (en) * | 1980-02-04 | 1983-03-01 | Leonhart Virginia R | Pillow to protect hairdo |
| US4777855A (en) * | 1986-11-07 | 1988-10-18 | Convo Corporation | Method of fabricating pillow presenting portions of different firmness |
| USD339949S (en) * | 1991-05-15 | 1993-10-05 | Christine Wei | Foot warming pillow |
| USD336809S (en) * | 1991-10-11 | 1993-06-29 | Emery Paula L | Pillow for use with dental headgear |
| USD342409S (en) * | 1992-12-01 | 1993-12-21 | Suzanne Gambin | Maternity bean bag mattress |
| US5781947A (en) * | 1996-11-12 | 1998-07-21 | Sramek; Roger | Adjustable cervical pillow with depressions for a user's ears |
| US5916088A (en) * | 1998-10-26 | 1999-06-29 | Gueli; Martin | Cooling beach pillow |
| US6408468B1 (en) * | 2001-07-19 | 2002-06-25 | Kristen Comfort | Pillow to facilitate hearing |
| JP2003102608A (ja) * | 2001-09-28 | 2003-04-08 | Inoac Corp | 枕 |
| US6918146B2 (en) * | 2003-06-19 | 2005-07-19 | England, Inc. | Adjustable seat cushion for furniture |
| US6739008B1 (en) * | 2003-08-15 | 2004-05-25 | Sharon Elaine Kindrick | Variable density therapeutic cushion |
| JP2006051295A (ja) * | 2003-09-04 | 2006-02-23 | Sumitomo Rubber Ind Ltd | 枕 |
| CA2538277C (fr) * | 2003-09-16 | 2013-07-02 | Gerard Guez | Oreiller osteopathique |
| US7788750B2 (en) * | 2004-08-09 | 2010-09-07 | Core Products International Inc. | Multi-function cervical pillow |
| JP2006075488A (ja) * | 2004-09-13 | 2006-03-23 | Hisayoshi Kumashiro | 枕 |
| US20060265808A1 (en) * | 2005-05-27 | 2006-11-30 | Phillips Carmen L | Face cradle pillow |
| US8656537B2 (en) * | 2006-04-20 | 2014-02-25 | Dan Foam Aps | Multi-component pillow and method of manufacturing and assembling same |
| US8931128B2 (en) * | 2006-06-12 | 2015-01-13 | Mtj American Llc | Encapsulated and filtered mattress |
| KR200440193Y1 (ko) * | 2007-03-02 | 2008-05-29 | 이일수 | 통풍 구멍을 구비한 쿠션 |
| US20090106904A1 (en) * | 2007-10-24 | 2009-04-30 | Pacific Coast Feather Company | Convex pillow configuration |
| US20090188043A1 (en) * | 2008-01-25 | 2009-07-30 | Kirch Perry J | Graduated Set of Pillows |
| US20090250069A1 (en) * | 2008-04-07 | 2009-10-08 | Frey Steven J | Migraine headache relief pillow |
| US8448273B2 (en) * | 2008-10-29 | 2013-05-28 | Smartsilk Corporation Inc. | Pillow and cover for a pillow |
| US7578015B1 (en) * | 2008-12-10 | 2009-08-25 | Karen L. Wilson | Inflatable neck support |
| DE202009015848U1 (de) * | 2009-11-16 | 2010-02-25 | Berker, Wolfgang | Kissen |
| US10939772B2 (en) * | 2017-03-15 | 2021-03-09 | Chiropractic Family Line, LLC | Pillow system |
| USD876127S1 (en) * | 2018-07-24 | 2020-02-25 | Se Il Park | Baby pillow |
-
2011
- 2011-09-30 EP EP11830031.8A patent/EP2621312A4/en not_active Ceased
- 2011-09-30 WO PCT/US2011/054405 patent/WO2012045032A2/en active Application Filing
- 2011-09-30 CA CA2850473A patent/CA2850473A1/en active Pending
- 2011-09-30 US US13/250,915 patent/US20120079659A1/en not_active Abandoned
- 2011-09-30 AU AU2011308529A patent/AU2011308529A1/en not_active Abandoned
- 2011-09-30 CN CN2011800575179A patent/CN103379842A/zh active Pending
-
2019
- 2019-02-25 US US29/681,404 patent/USD887175S1/en active Active
Also Published As
| Publication number | Publication date |
|---|---|
| AU2011308529A1 (en) | 2013-05-23 |
| US20120079659A1 (en) | 2012-04-05 |
| EP2621312A4 (en) | 2014-02-26 |
| EP2621312A2 (en) | 2013-08-07 |
| CN103379842A (zh) | 2013-10-30 |
| WO2012045032A2 (en) | 2012-04-05 |
| WO2012045032A3 (en) | 2012-07-05 |
| USD887175S1 (en) | 2020-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US20120079659A1 (en) | Neck support pillow | |
| US20180310732A1 (en) | Neck Support Pillow | |
| US5642543A (en) | Adjustable ergonomic pillow | |
| US20190269263A1 (en) | Universal pillow | |
| US5781947A (en) | Adjustable cervical pillow with depressions for a user's ears | |
| US20140317851A1 (en) | Adjustable Pillow | |
| US20130318722A1 (en) | Functional Pillow | |
| CN105283100A (zh) | 功能性枕头 | |
| US9937092B2 (en) | Device and methods for positioning the head of a reclining person | |
| US20120023676A1 (en) | Orthopedic pillow having oblong central aperture | |
| US6701555B1 (en) | Dual-filled, adjustable postural health pillow | |
| US20190269264A1 (en) | Therapeutic Pillow | |
| CN103844744B (zh) | 枕头 | |
| US20160100701A1 (en) | Pillow | |
| US20140082845A1 (en) | Therapeutic pillow | |
| KR101520403B1 (ko) | 경추교정 및 코골이 개선에 효과적인 자가 높이 조절식 기능성 숙면 베개 | |
| US20110131729A1 (en) | Configurable Support Locations Pillow | |
| JP3074823U (ja) | 枕 | |
| US20110314610A1 (en) | Platform extension | |
| KR101626219B1 (ko) | 여러 방향으로 사용이 가능한 기능성 베개 | |
| CN210643520U (zh) | 组合式枕头 | |
| KR102102538B1 (ko) | 기능성 베개 | |
| JP3059614U (ja) | 枕 | |
| JP4345949B2 (ja) | 枕 | |
| KR20240001674U (ko) | 거북목 바른 자세 교정기 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request |
Effective date: 20160914 |