CA2583716A1

CA2583716A1 - Formes posologiques orales de polypeptides resistant aux proteases

Formes posologiques orales de polypeptides resistant aux proteases Download PDF

Info

Publication number: CA2583716A1
Authority: CA; Canada
Prior art keywords: polypeptide; protease; resistant; seq; ifn
Prior art date: 2007-04-18
Legal status : Abandoned

Application number

CA 2583716

Other languages

English (en)

Inventor

Gilles Borrelly

Caroline Chauchard

Lila Drittanti

Manuel Vega

Current Assignee

Nautilus Biotech SA

Original Assignee

Nautilus Biotech SA

Priority date

2007-04-18

Filing date

2007-04-18

Publication date

2008-10-18

2007-04-18 Application filed by Nautilus Biotech SA filed Critical Nautilus Biotech SA

2007-04-18 Priority to CA 2583716 priority Critical patent/CA2583716A1/fr

2008-10-18 Publication of CA2583716A1 publication Critical patent/CA2583716A1/fr

Status Abandoned legal-status Critical Current

Links

108090000765 processed proteins & peptides Proteins 0.000 title claims abstract description 504
102000004196 processed proteins & peptides Human genes 0.000 title claims abstract description 498
229920001184 polypeptide Polymers 0.000 title claims abstract description 497
108091005804 Peptidases Proteins 0.000 title claims abstract description 310
239000004365 Protease Substances 0.000 title claims abstract description 307
239000000203 mixture Substances 0.000 title claims abstract description 239
238000009472 formulation Methods 0.000 title claims abstract description 215
102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 title claims abstract 20
230000001225 therapeutic effect Effects 0.000 claims abstract description 176
239000002775 capsule Substances 0.000 claims abstract description 65
238000011282 treatment Methods 0.000 claims abstract description 36
238000007920 subcutaneous administration Methods 0.000 claims abstract description 15
102000035195 Peptidases Human genes 0.000 claims description 290
108090000623 proteins and genes Proteins 0.000 claims description 143
150000001413 amino acids Chemical class 0.000 claims description 140
102000004169 proteins and genes Human genes 0.000 claims description 139
230000004048 modification Effects 0.000 claims description 102
238000012986 modification Methods 0.000 claims description 102
102000018997 Growth Hormone Human genes 0.000 claims description 43
108010051696 Growth Hormone Proteins 0.000 claims description 43
102000004127 Cytokines Human genes 0.000 claims description 36
108090000695 Cytokines Proteins 0.000 claims description 36
208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 32
102000004877 Insulin Human genes 0.000 claims description 31
108090001061 Insulin Proteins 0.000 claims description 31
NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 claims description 31
239000000122 growth hormone Substances 0.000 claims description 28
102000003743 Relaxin Human genes 0.000 claims description 26
108090000103 Relaxin Proteins 0.000 claims description 26
201000010099 disease Diseases 0.000 claims description 26
102000002265 Human Growth Hormone Human genes 0.000 claims description 24
108010000521 Human Growth Hormone Proteins 0.000 claims description 24
239000000854 Human Growth Hormone Substances 0.000 claims description 24
239000003795 chemical substances by application Substances 0.000 claims description 20
230000001965 increasing effect Effects 0.000 claims description 18
239000003814 drug Substances 0.000 claims description 16
102000003814 Interleukin-10 Human genes 0.000 claims description 15
108090000174 Interleukin-10 Proteins 0.000 claims description 15
239000003102 growth factor Substances 0.000 claims description 14
OXCMYAYHXIHQOA-UHFFFAOYSA-N potassium;[2-butyl-5-chloro-3-[[4-[2-(1,2,4-triaza-3-azanidacyclopenta-1,4-dien-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol Chemical compound [K+].CCCCC1=NC(Cl)=C(CO)N1CC1=CC=C(C=2C(=CC=CC=2)C2=N[N-]N=N2)C=C1 OXCMYAYHXIHQOA-UHFFFAOYSA-N 0.000 claims description 14
108090000394 Erythropoietin Proteins 0.000 claims description 13
102000003951 Erythropoietin Human genes 0.000 claims description 13
108090000176 Interleukin-13 Proteins 0.000 claims description 13
102000003816 Interleukin-13 Human genes 0.000 claims description 13
108010002386 Interleukin-3 Proteins 0.000 claims description 13
102000000646 Interleukin-3 Human genes 0.000 claims description 13
108010002616 Interleukin-5 Proteins 0.000 claims description 13
102100039897 Interleukin-5 Human genes 0.000 claims description 13
108090001005 Interleukin-6 Proteins 0.000 claims description 13
102000004889 Interleukin-6 Human genes 0.000 claims description 13
229940105423 erythropoietin Drugs 0.000 claims description 13
229940125396 insulin Drugs 0.000 claims description 13
102100031614 Ciliary neurotrophic factor Human genes 0.000 claims description 12
108010017213 Granulocyte-Macrophage Colony-Stimulating Factor Proteins 0.000 claims description 12
102100039620 Granulocyte-macrophage colony-stimulating factor Human genes 0.000 claims description 12
102000013462 Interleukin-12 Human genes 0.000 claims description 12
108010065805 Interleukin-12 Proteins 0.000 claims description 12
108010002350 Interleukin-2 Proteins 0.000 claims description 12
102000000588 Interleukin-2 Human genes 0.000 claims description 12
102000004388 Interleukin-4 Human genes 0.000 claims description 12
108090000978 Interleukin-4 Proteins 0.000 claims description 12
229940076264 interleukin-3 Drugs 0.000 claims description 12
229940100602 interleukin-5 Drugs 0.000 claims description 12
229940100601 interleukin-6 Drugs 0.000 claims description 12
238000006467 substitution reaction Methods 0.000 claims description 12
108010005939 Ciliary Neurotrophic Factor Proteins 0.000 claims description 11
102000004269 Granulocyte Colony-Stimulating Factor Human genes 0.000 claims description 10
108010017080 Granulocyte Colony-Stimulating Factor Proteins 0.000 claims description 10
102000014150 Interferons Human genes 0.000 claims description 10
108010050904 Interferons Proteins 0.000 claims description 10
239000012634 fragment Substances 0.000 claims description 10
230000013595 glycosylation Effects 0.000 claims description 10
238000006206 glycosylation reaction Methods 0.000 claims description 10
108090000581 Leukemia inhibitory factor Proteins 0.000 claims description 9
108060008682 Tumor Necrosis Factor Proteins 0.000 claims description 9
239000003112 inhibitor Substances 0.000 claims description 9
229940076144 interleukin-10 Drugs 0.000 claims description 9
229940124597 therapeutic agent Drugs 0.000 claims description 9
102000004058 Leukemia inhibitory factor Human genes 0.000 claims description 8
102000004140 Oncostatin M Human genes 0.000 claims description 8
229940079322 interferon Drugs 0.000 claims description 8
210000000130 stem cell Anatomy 0.000 claims description 8
102000016267 Leptin Human genes 0.000 claims description 7
108090000630 Oncostatin M Proteins 0.000 claims description 7
NRYBAZVQPHGZNS-ZSOCWYAHSA-N leptin Chemical compound O=C([C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CC(C)C)CCSC)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CS)C(O)=O NRYBAZVQPHGZNS-ZSOCWYAHSA-N 0.000 claims description 7
229940039781 leptin Drugs 0.000 claims description 7
102000003390 tumor necrosis factor Human genes 0.000 claims description 7
108010074328 Interferon-gamma Proteins 0.000 claims description 6
102000008070 Interferon-gamma Human genes 0.000 claims description 6
108010092277 Leptin Proteins 0.000 claims description 6
229960003130 interferon gamma Drugs 0.000 claims description 6
229940117681 interleukin-12 Drugs 0.000 claims description 6
229940028885 interleukin-4 Drugs 0.000 claims description 6
102100020715 Fms-related tyrosine kinase 3 ligand protein Human genes 0.000 claims description 5
101710162577 Fms-related tyrosine kinase 3 ligand protein Proteins 0.000 claims description 5
102000004157 Hydrolases Human genes 0.000 claims description 5
108090000604 Hydrolases Proteins 0.000 claims description 5
XLXSAKCOAKORKW-AQJXLSMYSA-N gonadorelin Chemical compound C([C@@H](C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1[C@@H](CCC1)C(=O)NCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H]1NC(=O)CC1)C1=CC=C(O)C=C1 XLXSAKCOAKORKW-AQJXLSMYSA-N 0.000 claims description 5
229940088597 hormone Drugs 0.000 claims description 5
239000005556 hormone Substances 0.000 claims description 5
239000002777 nucleoside Substances 0.000 claims description 5
102000015081 Blood Coagulation Factors Human genes 0.000 claims description 4
108010039209 Blood Coagulation Factors Proteins 0.000 claims description 4
102000003996 Interferon-beta Human genes 0.000 claims description 4
108090000467 Interferon-beta Proteins 0.000 claims description 4
101710144111 Non-structural protein 3 Proteins 0.000 claims description 4
239000003114 blood coagulation factor Substances 0.000 claims description 4
229960001388 interferon-beta Drugs 0.000 claims description 4
102100033367 Appetite-regulating hormone Human genes 0.000 claims description 3
239000000579 Gonadotropin-Releasing Hormone Substances 0.000 claims description 3
108060003951 Immunoglobulin Proteins 0.000 claims description 3
102100040018 Interferon alpha-2 Human genes 0.000 claims description 3
108010047761 Interferon-alpha Proteins 0.000 claims description 3
102000006992 Interferon-alpha Human genes 0.000 claims description 3
108010079944 Interferon-alpha2b Proteins 0.000 claims description 3
101000857870 Squalus acanthias Gonadoliberin Proteins 0.000 claims description 3
239000005557 antagonist Substances 0.000 claims description 3
229940035638 gonadotropin-releasing hormone Drugs 0.000 claims description 3
102000018358 immunoglobulin Human genes 0.000 claims description 3
229940072221 immunoglobulins Drugs 0.000 claims description 3
150000003833 nucleoside derivatives Chemical class 0.000 claims description 3
229940077274 Alpha glucosidase inhibitor Drugs 0.000 claims description 2
101000599951 Homo sapiens Insulin-like growth factor I Proteins 0.000 claims description 2
101000950669 Homo sapiens Mitogen-activated protein kinase 9 Proteins 0.000 claims description 2
102100037852 Insulin-like growth factor I Human genes 0.000 claims description 2
229940123187 Interferon receptor antagonist Drugs 0.000 claims description 2
102100037809 Mitogen-activated protein kinase 9 Human genes 0.000 claims description 2
101800001554 RNA-directed RNA polymerase Proteins 0.000 claims description 2
IWUCXVSUMQZMFG-AFCXAGJDSA-N Ribavirin Chemical compound N1=C(C(=O)N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 IWUCXVSUMQZMFG-AFCXAGJDSA-N 0.000 claims description 2
239000003888 alpha glucosidase inhibitor Substances 0.000 claims description 2
DKNWSYNQZKUICI-UHFFFAOYSA-N amantadine Chemical compound C1C(C2)CC3CC2CC1(N)C3 DKNWSYNQZKUICI-UHFFFAOYSA-N 0.000 claims description 2
229960003805 amantadine Drugs 0.000 claims description 2
239000003263 anabolic agent Substances 0.000 claims description 2
230000033228 biological regulation Effects 0.000 claims description 2
230000002281 colonystimulating effect Effects 0.000 claims description 2
235000021588 free fatty acids Nutrition 0.000 claims description 2
210000003714 granulocyte Anatomy 0.000 claims description 2
239000003488 releasing hormone Substances 0.000 claims description 2
229960000329 ribavirin Drugs 0.000 claims description 2
HZCAHMRRMINHDJ-DBRKOABJSA-N ribavirin Natural products O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1N=CN=C1 HZCAHMRRMINHDJ-DBRKOABJSA-N 0.000 claims description 2
108010077753 type II interferon receptor Proteins 0.000 claims description 2
108010077689 gamma-aminobutyryl-2-methyltryptophyl-2-methyltryptophyl-2-methyltryptophyl-lysinamide Proteins 0.000 claims 2
102220104186 rs561111097 Human genes 0.000 claims 2
102100031939 Erythropoietin Human genes 0.000 claims 1
102100032352 Leukemia inhibitory factor Human genes 0.000 claims 1
229940019700 blood coagulation factors Drugs 0.000 claims 1
238000000034 method Methods 0.000 abstract description 76
230000006806 disease prevention Effects 0.000 abstract description 2
235000019419 proteases Nutrition 0.000 description 244
235000001014 amino acid Nutrition 0.000 description 149
229940024606 amino acid Drugs 0.000 description 132
235000018102 proteins Nutrition 0.000 description 129
230000000694 effects Effects 0.000 description 69
238000000576 coating method Methods 0.000 description 47
239000003826 tablet Substances 0.000 description 46
239000011248 coating agent Substances 0.000 description 38
210000001035 gastrointestinal tract Anatomy 0.000 description 37
125000003275 alpha amino acid group Chemical group 0.000 description 35
PBGKTOXHQIOBKM-FHFVDXKLSA-N insulin (human) Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H]1CSSC[C@H]2C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@H](C(N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=3C=CC(O)=CC=3)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=3C=CC(O)=CC=3)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=3C=CC(O)=CC=3)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=3NC=NC=3)NC(=O)[C@H](CO)NC(=O)CNC1=O)C(=O)NCC(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(O)=O)C(=O)N[C@@H](CC(N)=O)C(O)=O)=O)CSSC[C@@H](C(N2)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@@H](NC(=O)CN)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CC=1C=CC=CC=1)C(C)C)C1=CN=CN1 PBGKTOXHQIOBKM-FHFVDXKLSA-N 0.000 description 29
239000000546 pharmaceutical excipient Substances 0.000 description 29
239000002702 enteric coating Substances 0.000 description 28
238000009505 enteric coating Methods 0.000 description 28
210000004369 blood Anatomy 0.000 description 27
239000008280 blood Substances 0.000 description 27
230000017854 proteolysis Effects 0.000 description 26
239000002245 particle Substances 0.000 description 24
241000894007 species Species 0.000 description 23
230000000875 corresponding effect Effects 0.000 description 22
150000007523 nucleic acids Chemical class 0.000 description 21
102000005962 receptors Human genes 0.000 description 21
108020003175 receptors Proteins 0.000 description 21
102000039446 nucleic acids Human genes 0.000 description 20
108020004707 nucleic acids Proteins 0.000 description 20
230000009102 absorption Effects 0.000 description 19
238000010521 absorption reaction Methods 0.000 description 19
239000008187 granular material Substances 0.000 description 19
210000000813 small intestine Anatomy 0.000 description 19
101000976075 Homo sapiens Insulin Proteins 0.000 description 17
125000000539 amino acid group Chemical group 0.000 description 16
239000011324 bead Substances 0.000 description 13
239000007891 compressed tablet Substances 0.000 description 12
239000008176 lyophilized powder Substances 0.000 description 12
210000002784 stomach Anatomy 0.000 description 12
210000003238 esophagus Anatomy 0.000 description 11
230000002496 gastric effect Effects 0.000 description 11
239000000463 material Substances 0.000 description 11
-1 monoclonal antibody Proteins 0.000 description 11
229920000642 polymer Polymers 0.000 description 11
238000002360 preparation method Methods 0.000 description 11
210000000214 mouth Anatomy 0.000 description 10
210000003800 pharynx Anatomy 0.000 description 10
102000019034 Chemokines Human genes 0.000 description 9
108010012236 Chemokines Proteins 0.000 description 9
230000002491 angiogenic effect Effects 0.000 description 9
DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 8
150000001875 compounds Chemical class 0.000 description 8
230000003111 delayed effect Effects 0.000 description 8
239000002552 dosage form Substances 0.000 description 8
239000012530 fluid Substances 0.000 description 8
239000003446 ligand Substances 0.000 description 8
210000003750 lower gastrointestinal tract Anatomy 0.000 description 8
102220484652 Deoxyribonuclease-2-alpha_N86Q_mutation Human genes 0.000 description 7
KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 7
KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 7
108090000631 Trypsin Proteins 0.000 description 7
102000004142 Trypsin Human genes 0.000 description 7
239000004480 active ingredient Substances 0.000 description 7
229960000182 blood factors Drugs 0.000 description 7
125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 7
239000000539 dimer Substances 0.000 description 7
239000007903 gelatin capsule Substances 0.000 description 7
210000000936 intestine Anatomy 0.000 description 7
210000002429 large intestine Anatomy 0.000 description 7
239000000178 monomer Substances 0.000 description 7
239000006187 pill Substances 0.000 description 7
239000004014 plasticizer Substances 0.000 description 7
239000012588 trypsin Substances 0.000 description 7
MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 6
229920000623 Cellulose acetate phthalate Polymers 0.000 description 6
229920003139 Eudragit® L 100 Polymers 0.000 description 6
108010065920 Insulin Lispro Proteins 0.000 description 6
241001465754 Metazoa Species 0.000 description 6
108010076504 Protein Sorting Signals Proteins 0.000 description 6
102000012479 Serine Proteases Human genes 0.000 description 6
108010022999 Serine Proteases Proteins 0.000 description 6
108010073929 Vascular Endothelial Growth Factor A Proteins 0.000 description 6
238000003556 assay Methods 0.000 description 6
LEMUFSYUPGXXCM-JNEQYSBXSA-N caninsulin Chemical compound [Zn].C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H]1CSSC[C@H]2C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@H](C(N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=3C=CC(O)=CC=3)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=3C=CC(O)=CC=3)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=3C=CC(O)=CC=3)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC3N=CN=C3)NC(=O)[C@H](CO)NC(=O)CNC1=O)C(=O)NCC(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C(C)O)C(O)=O)C(=O)N[C@@H](CC(N)=O)C(O)=O)=O)CSSC[C@@H](C(N2)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@@H](NC(=O)CN)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CC=1C=CC=CC=1)C(C)C)C1C=NC=N1 LEMUFSYUPGXXCM-JNEQYSBXSA-N 0.000 description 6
230000015556 catabolic process Effects 0.000 description 6
210000004027 cell Anatomy 0.000 description 6
238000003776 cleavage reaction Methods 0.000 description 6
229920001577 copolymer Polymers 0.000 description 6
238000006731 degradation reaction Methods 0.000 description 6
208000035475 disorder Diseases 0.000 description 6
230000014509 gene expression Effects 0.000 description 6
WNRQPCUGRUFHED-DETKDSODSA-N humalog Chemical compound C([C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CS)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CS)NC(=O)[C@H](CS)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@@H](NC(=O)CN)[C@@H](C)CC)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(N)=O)C(O)=O)C1=CC=C(O)C=C1.C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CS)C(=O)NCC(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCCN)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H]([C@@H](C)O)C(O)=O)C(C)C)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CS)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CC=1C=CC=CC=1)C(C)C)C1=CN=CN1 WNRQPCUGRUFHED-DETKDSODSA-N 0.000 description 6
229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 6
229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 6
238000001727 in vivo Methods 0.000 description 6
108010046018 leukocyte inhibitory factor Proteins 0.000 description 6
230000000670 limiting effect Effects 0.000 description 6
238000004519 manufacturing process Methods 0.000 description 6
230000035772 mutation Effects 0.000 description 6
230000007017 scission Effects 0.000 description 6
238000013268 sustained release Methods 0.000 description 6
239000012730 sustained-release form Substances 0.000 description 6
238000012360 testing method Methods 0.000 description 6
URAYPUMNDPQOKB-UHFFFAOYSA-N triacetin Chemical compound CC(=O)OCC(OC(C)=O)COC(C)=O URAYPUMNDPQOKB-UHFFFAOYSA-N 0.000 description 6
102000053602 DNA Human genes 0.000 description 5
108020004414 DNA Proteins 0.000 description 5
229920003136 Eudragit® L polymer Polymers 0.000 description 5
229920003141 Eudragit® S 100 Polymers 0.000 description 5
PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 5
241000282412 Homo Species 0.000 description 5
108010090613 Human Regular Insulin Proteins 0.000 description 5
102000013266 Human Regular Insulin Human genes 0.000 description 5
CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 5
241000124008 Mammalia Species 0.000 description 5
108010067372 Pancreatic elastase Proteins 0.000 description 5
102000016387 Pancreatic elastase Human genes 0.000 description 5
241000700159 Rattus Species 0.000 description 5
108010019530 Vascular Endothelial Growth Factors Proteins 0.000 description 5
239000000654 additive Substances 0.000 description 5
229940081734 cellulose acetate phthalate Drugs 0.000 description 5
230000008859 change Effects 0.000 description 5
230000029087 digestion Effects 0.000 description 5
210000001198 duodenum Anatomy 0.000 description 5
230000006870 function Effects 0.000 description 5
229940103471 humulin Drugs 0.000 description 5
238000000338 in vitro Methods 0.000 description 5
230000000968 intestinal effect Effects 0.000 description 5
231100000350 mutagenesis Toxicity 0.000 description 5
238000002703 mutagenesis Methods 0.000 description 5
239000002773 nucleotide Substances 0.000 description 5
125000003729 nucleotide group Chemical group 0.000 description 5
230000006320 pegylation Effects 0.000 description 5
239000008194 pharmaceutical composition Substances 0.000 description 5
229940023488 pill Drugs 0.000 description 5
235000015277 pork Nutrition 0.000 description 5
239000002243 precursor Substances 0.000 description 5
230000002265 prevention Effects 0.000 description 5
210000002966 serum Anatomy 0.000 description 5
239000002904 solvent Substances 0.000 description 5
230000009385 viral infection Effects 0.000 description 5
LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 4
239000001856 Ethyl cellulose Substances 0.000 description 4
ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 4
102000005561 Human Isophane Insulin Human genes 0.000 description 4
108010084048 Human Isophane Insulin Proteins 0.000 description 4
206010028980 Neoplasm Diseases 0.000 description 4
108090000284 Pepsin A Proteins 0.000 description 4
102000057297 Pepsin A Human genes 0.000 description 4
239000002202 Polyethylene glycol Substances 0.000 description 4
102100025037 Protein Mis18-alpha Human genes 0.000 description 4
MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 4
108090000373 Tissue Plasminogen Activator Proteins 0.000 description 4
102000003978 Tissue Plasminogen Activator Human genes 0.000 description 4
102100039037 Vascular endothelial growth factor A Human genes 0.000 description 4
208000036142 Viral infection Diseases 0.000 description 4
102220532161 WW domain-binding protein 11_E60Q_mutation Human genes 0.000 description 4
239000013543 active substance Substances 0.000 description 4
235000010443 alginic acid Nutrition 0.000 description 4
229920000615 alginic acid Polymers 0.000 description 4
230000000840 anti-viral effect Effects 0.000 description 4
230000021235 carbamoylation Effects 0.000 description 4
230000021523 carboxylation Effects 0.000 description 4
238000006473 carboxylation reaction Methods 0.000 description 4
239000000969 carrier Substances 0.000 description 4
230000001419 dependent effect Effects 0.000 description 4
DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 4
238000004090 dissolution Methods 0.000 description 4
235000019325 ethyl cellulose Nutrition 0.000 description 4
229920001249 ethyl cellulose Polymers 0.000 description 4
GDCRSXZBSIRSFR-UHFFFAOYSA-N ethyl prop-2-enoate;2-methylprop-2-enoic acid Chemical compound CC(=C)C(O)=O.CCOC(=O)C=C GDCRSXZBSIRSFR-UHFFFAOYSA-N 0.000 description 4
108020001507 fusion proteins Proteins 0.000 description 4
102000037865 fusion proteins Human genes 0.000 description 4
230000033444 hydroxylation Effects 0.000 description 4
238000005805 hydroxylation reaction Methods 0.000 description 4
235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 4
229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 4
239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 4
UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 4
229920000639 hydroxypropylmethylcellulose acetate succinate Polymers 0.000 description 4
HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
229920000609 methyl cellulose Polymers 0.000 description 4
235000010981 methylcellulose Nutrition 0.000 description 4
239000001923 methylcellulose Substances 0.000 description 4
238000002156 mixing Methods 0.000 description 4
229940103453 novolin Drugs 0.000 description 4
229940111202 pepsin Drugs 0.000 description 4
229940124531 pharmaceutical excipient Drugs 0.000 description 4
230000026731 phosphorylation Effects 0.000 description 4
238000006366 phosphorylation reaction Methods 0.000 description 4
229920001223 polyethylene glycol Polymers 0.000 description 4
102000040430 polynucleotide Human genes 0.000 description 4
108091033319 polynucleotide Proteins 0.000 description 4
239000002157 polynucleotide Substances 0.000 description 4
238000009498 subcoating Methods 0.000 description 4
239000000126 substance Substances 0.000 description 4
230000019635 sulfation Effects 0.000 description 4
238000005670 sulfation reaction Methods 0.000 description 4
239000004094 surface-active agent Substances 0.000 description 4
239000000454 talc Substances 0.000 description 4
235000012222 talc Nutrition 0.000 description 4
229910052623 talc Inorganic materials 0.000 description 4
210000001519 tissue Anatomy 0.000 description 4
229960000187 tissue plasminogen activator Drugs 0.000 description 4
229960001322 trypsin Drugs 0.000 description 4
210000002438 upper gastrointestinal tract Anatomy 0.000 description 4
102220631991 AH receptor-interacting protein_E42Q_mutation Human genes 0.000 description 3
208000030507 AIDS Diseases 0.000 description 3
241000283690 Bos taurus Species 0.000 description 3
102220598977 Calcyphosin_E74H_mutation Human genes 0.000 description 3
108010006303 Carboxypeptidases Proteins 0.000 description 3
102000005367 Carboxypeptidases Human genes 0.000 description 3
102000000844 Cell Surface Receptors Human genes 0.000 description 3
108010001857 Cell Surface Receptors Proteins 0.000 description 3
108090000317 Chymotrypsin Proteins 0.000 description 3
229920003138 Eudragit® L 30 D-55 Polymers 0.000 description 3
229920003137 Eudragit® S polymer Polymers 0.000 description 3
229920003134 Eudragit® polymer Polymers 0.000 description 3
WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 3
239000004471 Glycine Substances 0.000 description 3
239000004354 Hydroxyethyl cellulose Substances 0.000 description 3
229920000663 Hydroxyethyl cellulose Polymers 0.000 description 3
229920002153 Hydroxypropyl cellulose Polymers 0.000 description 3
108090000723 Insulin-Like Growth Factor I Proteins 0.000 description 3
150000008575 L-amino acids Chemical class 0.000 description 3
DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 description 3
AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 3
CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 3
VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 3
102220495079 Nucleolar and spindle-associated protein 1_E89Q_mutation Human genes 0.000 description 3
108010029485 Protein Isoforms Proteins 0.000 description 3
102000001708 Protein Isoforms Human genes 0.000 description 3
VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
102000013275 Somatomedins Human genes 0.000 description 3
229920002472 Starch Polymers 0.000 description 3
102220548254 Tafazzin_E96Q_mutation Human genes 0.000 description 3
108010009583 Transforming Growth Factors Proteins 0.000 description 3
102000009618 Transforming Growth Factors Human genes 0.000 description 3
DOOTYTYQINUNNV-UHFFFAOYSA-N Triethyl citrate Chemical compound CCOC(=O)CC(O)(C(=O)OCC)CC(=O)OCC DOOTYTYQINUNNV-UHFFFAOYSA-N 0.000 description 3
KZSNJWFQEVHDMF-UHFFFAOYSA-N Valine Natural products CC(C)C(N)C(O)=O KZSNJWFQEVHDMF-UHFFFAOYSA-N 0.000 description 3
239000002253 acid Substances 0.000 description 3
239000000783 alginic acid Substances 0.000 description 3
229960001126 alginic acid Drugs 0.000 description 3
150000004781 alginic acids Chemical class 0.000 description 3
238000004458 analytical method Methods 0.000 description 3
238000010171 animal model Methods 0.000 description 3
125000000129 anionic group Chemical group 0.000 description 3
239000011230 binding agent Substances 0.000 description 3
239000000872 buffer Substances 0.000 description 3
229910052799 carbon Inorganic materials 0.000 description 3
229960002376 chymotrypsin Drugs 0.000 description 3
230000007423 decrease Effects 0.000 description 3
230000003247 decreasing effect Effects 0.000 description 3
239000003937 drug carrier Substances 0.000 description 3
238000005516 engineering process Methods 0.000 description 3
125000004185 ester group Chemical group 0.000 description 3
230000005714 functional activity Effects 0.000 description 3
210000004051 gastric juice Anatomy 0.000 description 3
239000000499 gel Substances 0.000 description 3
239000001087 glyceryl triacetate Substances 0.000 description 3
235000013773 glyceryl triacetate Nutrition 0.000 description 3
230000012010 growth Effects 0.000 description 3
229940038661 humalog Drugs 0.000 description 3
230000007062 hydrolysis Effects 0.000 description 3
238000006460 hydrolysis reaction Methods 0.000 description 3
235000019447 hydroxyethyl cellulose Nutrition 0.000 description 3
235000010977 hydroxypropyl cellulose Nutrition 0.000 description 3
239000001863 hydroxypropyl cellulose Substances 0.000 description 3
210000003405 ileum Anatomy 0.000 description 3
238000002347 injection Methods 0.000 description 3
239000007924 injection Substances 0.000 description 3
229960002068 insulin lispro Drugs 0.000 description 3
230000003993 interaction Effects 0.000 description 3
239000000314 lubricant Substances 0.000 description 3
239000011159 matrix material Substances 0.000 description 3
230000007246 mechanism Effects 0.000 description 3
210000004400 mucous membrane Anatomy 0.000 description 3
230000003387 muscular Effects 0.000 description 3
WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 3
QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 3
229920000036 polyvinylpyrrolidone Polymers 0.000 description 3
235000013855 polyvinylpyrrolidone Nutrition 0.000 description 3
239000001267 polyvinylpyrrolidone Substances 0.000 description 3
230000008569 process Effects 0.000 description 3
235000019833 protease Nutrition 0.000 description 3
230000002797 proteolythic effect Effects 0.000 description 3
239000002151 riboflavin Substances 0.000 description 3
102220217497 rs1046890336 Human genes 0.000 description 3
102220248585 rs1555631393 Human genes 0.000 description 3
102200117947 rs33953406 Human genes 0.000 description 3
102220242077 rs374438347 Human genes 0.000 description 3
102220018931 rs80358540 Human genes 0.000 description 3
239000007787 solid Substances 0.000 description 3
239000000243 solution Substances 0.000 description 3
235000019698 starch Nutrition 0.000 description 3
229940032147 starch Drugs 0.000 description 3
239000008107 starch Substances 0.000 description 3
230000002459 sustained effect Effects 0.000 description 3
229960002622 triacetin Drugs 0.000 description 3
239000001069 triethyl citrate Substances 0.000 description 3
235000013769 triethyl citrate Nutrition 0.000 description 3
VMYFZRTXGLUXMZ-UHFFFAOYSA-N triethyl citrate Natural products CCOC(=O)C(O)(C(=O)OCC)C(=O)OCC VMYFZRTXGLUXMZ-UHFFFAOYSA-N 0.000 description 3
CFYIUBWVKZQDOG-UHFFFAOYSA-N 4-[[2-[[2-[[1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-4-oxobutanoic acid Chemical compound C=1C=C([N+]([O-])=O)C=CC=1NC(=O)C(NC(=O)CNC(=O)CNC(=O)CCC(=O)O)CC1=CC=CC=C1 CFYIUBWVKZQDOG-UHFFFAOYSA-N 0.000 description 2
BJRCFZKVYNDCJE-WBSNEMHCSA-N 99489-95-9 Chemical compound C([C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@@H]2CSSC[C@@H](C(=O)N[C@H](C(N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)NCC(=O)N2)[C@@H](C)CC)=O)CSSC[C@@H](C(NCC(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H](CSSC[C@H](NC1=O)C(O)=O)C(=O)NCC(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(O)=O)[C@@H](C)CC)[C@@H](C)CC)C(C)C)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@@H](N)CCCCN)C(C)C)[C@@H](C)CC)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](N)CCCNC(N)=N)C(C)C)C1=CC=C(O)C=C1 BJRCFZKVYNDCJE-WBSNEMHCSA-N 0.000 description 2
102220645054 ADP-ribosylhydrolase ARH3_E41Q_mutation Human genes 0.000 description 2
QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
102000004400 Aminopeptidases Human genes 0.000 description 2
108090000915 Aminopeptidases Proteins 0.000 description 2
241000271566 Aves Species 0.000 description 2
102220631970 Bestrophin-1_L67V_mutation Human genes 0.000 description 2
102220618447 Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe_P89A_mutation Human genes 0.000 description 2
102100032367 C-C motif chemokine 5 Human genes 0.000 description 2
206010006895 Cachexia Diseases 0.000 description 2
241000282472 Canis lupus familiaris Species 0.000 description 2
102220584203 Cellular tumor antigen p53_P89S_mutation Human genes 0.000 description 2
241000282693 Cercopithecidae Species 0.000 description 2
108010055166 Chemokine CCL5 Proteins 0.000 description 2
108020004705 Codon Proteins 0.000 description 2
241000699800 Cricetinae Species 0.000 description 2
102220627697 Cytochrome b-c1 complex subunit 7_F63V_mutation Human genes 0.000 description 2
102220585547 D site-binding protein_K52Q_mutation Human genes 0.000 description 2
108090000194 Dipeptidyl-peptidases and tripeptidyl-peptidases Proteins 0.000 description 2
102000003779 Dipeptidyl-peptidases and tripeptidyl-peptidases Human genes 0.000 description 2
102220521062 Discoidin, CUB and LCCL domain-containing protein 1_K37Q_mutation Human genes 0.000 description 2
102220510434 E3 ubiquitin-protein ligase NHLRC1_E67Q_mutation Human genes 0.000 description 2
102000001301 EGF receptor Human genes 0.000 description 2
108060006698 EGF receptor Proteins 0.000 description 2
102000005593 Endopeptidases Human genes 0.000 description 2
108010059378 Endopeptidases Proteins 0.000 description 2
102100029727 Enteropeptidase Human genes 0.000 description 2
108010013369 Enteropeptidase Proteins 0.000 description 2
102000004190 Enzymes Human genes 0.000 description 2
108090000790 Enzymes Proteins 0.000 description 2
241000283086 Equidae Species 0.000 description 2
108010074860 Factor Xa Proteins 0.000 description 2
241000282326 Felis catus Species 0.000 description 2
108010088842 Fibrinolysin Proteins 0.000 description 2
102000003974 Fibroblast growth factor 2 Human genes 0.000 description 2
108090000379 Fibroblast growth factor 2 Proteins 0.000 description 2
102220640780 GEM-interacting protein_E65Q_mutation Human genes 0.000 description 2
108010010803 Gelatin Proteins 0.000 description 2
206010018338 Glioma Diseases 0.000 description 2
108010051815 Glutamyl endopeptidase Proteins 0.000 description 2
241000282575 Gorilla Species 0.000 description 2
102000001398 Granzyme Human genes 0.000 description 2
108060005986 Granzyme Proteins 0.000 description 2
206010056438 Growth hormone deficiency Diseases 0.000 description 2
102220576609 HLA class I histocompatibility antigen, A alpha chain_D130Y_mutation Human genes 0.000 description 2
102220606815 Hemoglobin subunit beta_K133N_mutation Human genes 0.000 description 2
102220606491 Hemoglobin subunit beta_L82V_mutation Human genes 0.000 description 2
108010021625 Immunoglobulin Fragments Proteins 0.000 description 2
102000008394 Immunoglobulin Fragments Human genes 0.000 description 2
108010057186 Insulin Glargine Proteins 0.000 description 2
COCFEDIXXNGUNL-RFKWWTKHSA-N Insulin glargine Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H]1CSSC[C@H]2C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@H](C(N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=3C=CC(O)=CC=3)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=3C=CC(O)=CC=3)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=3C=CC(O)=CC=3)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=3NC=NC=3)NC(=O)[C@H](CO)NC(=O)CNC1=O)C(=O)NCC(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)C(=O)NCC(O)=O)=O)CSSC[C@@H](C(N2)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@@H](NC(=O)CN)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CC=1C=CC=CC=1)C(C)C)C1=CN=CN1 COCFEDIXXNGUNL-RFKWWTKHSA-N 0.000 description 2
102000019223 Interleukin-1 receptor Human genes 0.000 description 2
108050006617 Interleukin-1 receptor Proteins 0.000 description 2
UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
108010081368 Isophane Insulin Proteins 0.000 description 2
102000005237 Isophane Insulin Human genes 0.000 description 2
QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 2
ZDXPYRJPNDTMRX-VKHMYHEASA-N L-glutamine Chemical compound OC(=O)[C@@H](N)CCC(N)=O ZDXPYRJPNDTMRX-VKHMYHEASA-N 0.000 description 2
HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 2
UKAUYVFTDYCKQA-VKHMYHEASA-N L-homoserine Chemical compound OC(=O)[C@@H](N)CCO UKAUYVFTDYCKQA-VKHMYHEASA-N 0.000 description 2
LRQKBLKVPFOOQJ-YFKPBYRVSA-N L-norleucine Chemical compound CCCC[C@H]([NH3+])C([O-])=O LRQKBLKVPFOOQJ-YFKPBYRVSA-N 0.000 description 2
KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 description 2
STECJAGHUSJQJN-USLFZFAMSA-N LSM-4015 Chemical compound C1([C@@H](CO)C(=O)OC2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-USLFZFAMSA-N 0.000 description 2
102000009151 Luteinizing Hormone Human genes 0.000 description 2
108010073521 Luteinizing Hormone Proteins 0.000 description 2
241000282553 Macaca Species 0.000 description 2
102000000424 Matrix Metalloproteinase 2 Human genes 0.000 description 2
108010016165 Matrix Metalloproteinase 2 Proteins 0.000 description 2
102000001776 Matrix metalloproteinase-9 Human genes 0.000 description 2
108010015302 Matrix metalloproteinase-9 Proteins 0.000 description 2
102220512211 Max-interacting protein 1_E43Q_mutation Human genes 0.000 description 2
241001529936 Murinae Species 0.000 description 2
241000699670 Mus sp. Species 0.000 description 2
108010025020 Nerve Growth Factor Proteins 0.000 description 2
102000015336 Nerve Growth Factor Human genes 0.000 description 2
102000007999 Nuclear Proteins Human genes 0.000 description 2
108010089610 Nuclear Proteins Proteins 0.000 description 2
241000282579 Pan Species 0.000 description 2
108010030544 Peptidyl-Lys metalloendopeptidase Proteins 0.000 description 2
102100021768 Phosphoserine aminotransferase Human genes 0.000 description 2
239000004372 Polyvinyl alcohol Substances 0.000 description 2
102220613852 Presenilin-1_V82E_mutation Human genes 0.000 description 2
241000288906 Primates Species 0.000 description 2
108010072866 Prostate-Specific Antigen Proteins 0.000 description 2
102220529021 Receptor expression-enhancing protein 5_K49N_mutation Human genes 0.000 description 2
102220640822 Retinoid isomerohydrolase_F70V_mutation Human genes 0.000 description 2
102220509705 Serine/threonine-protein kinase greatwall_E92Q_mutation Human genes 0.000 description 2
102220520962 Serine/threonine-protein phosphatase 2A regulatory subunit B'' subunit alpha_K97Q_mutation Human genes 0.000 description 2
102220532368 Serpin B10_K99Q_mutation Human genes 0.000 description 2
229920001800 Shellac Polymers 0.000 description 2
DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
235000021355 Stearic acid Nutrition 0.000 description 2
241000282887 Suidae Species 0.000 description 2
AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 2
239000004473 Threonine Substances 0.000 description 2
108090000190 Thrombin Proteins 0.000 description 2
ZFOZVQLOBQUTQQ-UHFFFAOYSA-N Tributyl citrate Chemical compound CCCCOC(=O)CC(O)(C(=O)OCCCC)CC(=O)OCCCC ZFOZVQLOBQUTQQ-UHFFFAOYSA-N 0.000 description 2
102100040247 Tumor necrosis factor Human genes 0.000 description 2
102220555543 Ubiquitin carboxyl-terminal hydrolase isozyme L1_H97N_mutation Human genes 0.000 description 2
108090000435 Urokinase-type plasminogen activator Proteins 0.000 description 2
102000003990 Urokinase-type plasminogen activator Human genes 0.000 description 2
102220515124 Vacuolar protein sorting-associated protein 4A_E58Q_mutation Human genes 0.000 description 2
108010073923 Vascular Endothelial Growth Factor C Proteins 0.000 description 2
102100038232 Vascular endothelial growth factor C Human genes 0.000 description 2
108010003205 Vasoactive Intestinal Peptide Proteins 0.000 description 2
102400000015 Vasoactive intestinal peptide Human genes 0.000 description 2
XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
ZUAAPNNKRHMPKG-UHFFFAOYSA-N acetic acid;butanedioic acid;methanol;propane-1,2-diol Chemical compound OC.CC(O)=O.CC(O)CO.OC(=O)CCC(O)=O ZUAAPNNKRHMPKG-UHFFFAOYSA-N 0.000 description 2
150000007513 acids Chemical class 0.000 description 2
230000004913 activation Effects 0.000 description 2
YAJCHEVQCOHZDC-QMMNLEPNSA-N actrapid Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H]1CSSC[C@H]2C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@@H](C(N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=3C=CC(O)=CC=3)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=3C=CC(O)=CC=3)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=3C=CC(O)=CC=3)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=3N=CNC=3)NC(=O)[C@H](CO)NC(=O)CNC1=O)C(=O)NCC(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H]([C@H](C)O)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@H](C)O)C(O)=O)C(=O)N[C@@H](CC(N)=O)C(O)=O)=O)CSSC[C@@H](C(N2)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@@H](NC(=O)CN)[C@H](C)CC)[C@H](C)CC)[C@H](C)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](N)CC=1C=CC=CC=1)C(C)C)C(N)=O)C1=CNC=N1 YAJCHEVQCOHZDC-QMMNLEPNSA-N 0.000 description 2
239000000853 adhesive Substances 0.000 description 2
230000001070 adhesive effect Effects 0.000 description 2
235000004279 alanine Nutrition 0.000 description 2
230000004075 alteration Effects 0.000 description 2
125000003277 amino group Chemical group 0.000 description 2
230000001028 anti-proliverative effect Effects 0.000 description 2
239000000427 antigen Substances 0.000 description 2
108091007433 antigens Proteins 0.000 description 2
102000036639 antigens Human genes 0.000 description 2
230000008901 benefit Effects 0.000 description 2
230000004071 biological effect Effects 0.000 description 2
230000015572 biosynthetic process Effects 0.000 description 2
210000000988 bone and bone Anatomy 0.000 description 2
102220368360 c.157C>G Human genes 0.000 description 2
102220348218 c.188G>A Human genes 0.000 description 2
102220361662 c.208A>C Human genes 0.000 description 2
102220405946 c.262G>C Human genes 0.000 description 2
102220360487 c.268C>T Human genes 0.000 description 2
OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
238000004422 calculation algorithm Methods 0.000 description 2
201000011510 cancer Diseases 0.000 description 2
239000001768 carboxy methyl cellulose Substances 0.000 description 2
239000004359 castor oil Substances 0.000 description 2
235000019438 castor oil Nutrition 0.000 description 2
239000011247 coating layer Substances 0.000 description 2
239000003086 colorant Substances 0.000 description 2
230000002354 daily effect Effects 0.000 description 2
230000007812 deficiency Effects 0.000 description 2
238000012217 deletion Methods 0.000 description 2
230000037430 deletion Effects 0.000 description 2
238000001514 detection method Methods 0.000 description 2
238000011161 development Methods 0.000 description 2
230000018109 developmental process Effects 0.000 description 2
FLKPEMZONWLCSK-UHFFFAOYSA-N diethyl phthalate Chemical compound CCOC(=O)C1=CC=CC=C1C(=O)OCC FLKPEMZONWLCSK-UHFFFAOYSA-N 0.000 description 2
239000003085 diluting agent Substances 0.000 description 2
239000007884 disintegrant Substances 0.000 description 2
239000000975 dye Substances 0.000 description 2
108010003914 endoproteinase Asp-N Proteins 0.000 description 2
229940088598 enzyme Drugs 0.000 description 2
210000000981 epithelium Anatomy 0.000 description 2
AVEZUPSKZQQURH-UHFFFAOYSA-N ethyl 2-(3-hydroxycyclobutyl)acetate Chemical compound CCOC(=O)CC1CC(O)C1 AVEZUPSKZQQURH-UHFFFAOYSA-N 0.000 description 2
239000000945 filler Substances 0.000 description 2
239000000796 flavoring agent Substances 0.000 description 2
235000013355 food flavoring agent Nutrition 0.000 description 2
235000011389 fruit/vegetable juice Nutrition 0.000 description 2
239000008273 gelatin Substances 0.000 description 2
229920000159 gelatin Polymers 0.000 description 2
235000019322 gelatine Nutrition 0.000 description 2
235000011852 gelatine desserts Nutrition 0.000 description 2
235000011187 glycerol Nutrition 0.000 description 2
ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 2
239000008241 heterogeneous mixture Substances 0.000 description 2
HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 2
229940084776 humulin n Drugs 0.000 description 2
230000005847 immunogenicity Effects 0.000 description 2
108091006086 inhibitor proteins Proteins 0.000 description 2
238000003780 insertion Methods 0.000 description 2
230000037431 insertion Effects 0.000 description 2
239000004026 insulin derivative Substances 0.000 description 2
229940047124 interferons Drugs 0.000 description 2
230000031891 intestinal absorption Effects 0.000 description 2
238000001990 intravenous administration Methods 0.000 description 2
VBUWHHLIZKOSMS-RIWXPGAOSA-N invicorp Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(O)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC=1NC=NC=1)C(C)C)[C@@H](C)O)[C@@H](C)O)C(C)C)C1=CC=C(O)C=C1 VBUWHHLIZKOSMS-RIWXPGAOSA-N 0.000 description 2
210000001630 jejunum Anatomy 0.000 description 2
239000010410 layer Substances 0.000 description 2
229940040129 luteinizing hormone Drugs 0.000 description 2
235000019359 magnesium stearate Nutrition 0.000 description 2
210000004379 membrane Anatomy 0.000 description 2
239000012528 membrane Substances 0.000 description 2
208000030159 metabolic disease Diseases 0.000 description 2
229910052751 metal Inorganic materials 0.000 description 2
239000002184 metal Substances 0.000 description 2
229930182817 methionine Natural products 0.000 description 2
125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
102000035118 modified proteins Human genes 0.000 description 2
108091005573 modified proteins Proteins 0.000 description 2
210000003205 muscle Anatomy 0.000 description 2
AOHAPDDBNAPPIN-UHFFFAOYSA-N myristicinic acid Natural products COC1=CC(C(O)=O)=CC2=C1OCO2 AOHAPDDBNAPPIN-UHFFFAOYSA-N 0.000 description 2
KEMQGTRYUADPNZ-UHFFFAOYSA-N n-heptadecanoic acid Natural products CCCCCCCCCCCCCCCCC(O)=O KEMQGTRYUADPNZ-UHFFFAOYSA-N 0.000 description 2
IPCSVZSSVZVIGE-UHFFFAOYSA-N n-hexadecanoic acid Natural products CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
229940053128 nerve growth factor Drugs 0.000 description 2
229940098815 novolin n Drugs 0.000 description 2
OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
239000006186 oral dosage form Substances 0.000 description 2
210000000056 organ Anatomy 0.000 description 2
150000002894 organic compounds Chemical class 0.000 description 2
230000000144 pharmacologic effect Effects 0.000 description 2
239000000049 pigment Substances 0.000 description 2
229940012957 plasmin Drugs 0.000 description 2
229920000058 polyacrylate Polymers 0.000 description 2
229940100467 polyvinyl acetate phthalate Drugs 0.000 description 2
229920002451 polyvinyl alcohol Polymers 0.000 description 2
229920001592 potato starch Polymers 0.000 description 2
239000000843 powder Substances 0.000 description 2
239000003755 preservative agent Substances 0.000 description 2
125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
239000000047 product Substances 0.000 description 2
238000011321 prophylaxis Methods 0.000 description 2
108010087851 prorelaxin Proteins 0.000 description 2
108020001580 protein domains Proteins 0.000 description 2
238000002818 protein evolution Methods 0.000 description 2
238000011160 research Methods 0.000 description 2
239000011347 resin Substances 0.000 description 2
229920005989 resin Polymers 0.000 description 2
230000004044 response Effects 0.000 description 2
102220041766 rs104893826 Human genes 0.000 description 2
102220218614 rs1060502519 Human genes 0.000 description 2
102220230053 rs1064793357 Human genes 0.000 description 2
102220234844 rs1131690927 Human genes 0.000 description 2
102200107843 rs11540654 Human genes 0.000 description 2
102200027734 rs118092776 Human genes 0.000 description 2
102220030871 rs151103906 Human genes 0.000 description 2
102220317882 rs1553902342 Human genes 0.000 description 2
102220317878 rs1553902353 Human genes 0.000 description 2
102200006479 rs16969925 Human genes 0.000 description 2
102200108021 rs199473049 Human genes 0.000 description 2
102220067473 rs199906203 Human genes 0.000 description 2
102200043784 rs200314808 Human genes 0.000 description 2
102220268018 rs201210997 Human genes 0.000 description 2
102220100163 rs201567345 Human genes 0.000 description 2
102220005405 rs33915947 Human genes 0.000 description 2
102220005272 rs33940051 Human genes 0.000 description 2
102200118239 rs33966487 Human genes 0.000 description 2
102200116153 rs386833897 Human genes 0.000 description 2
102220013087 rs397516459 Human genes 0.000 description 2
102220005361 rs41393644 Human genes 0.000 description 2
102220005347 rs41466346 Human genes 0.000 description 2
102220089633 rs531254130 Human genes 0.000 description 2
102220040112 rs587778184 Human genes 0.000 description 2
102220036916 rs587780117 Human genes 0.000 description 2
102200087964 rs63751258 Human genes 0.000 description 2
102200101940 rs72554339 Human genes 0.000 description 2
102220209659 rs752415137 Human genes 0.000 description 2
102200067148 rs769650474 Human genes 0.000 description 2
102220229323 rs780777061 Human genes 0.000 description 2
102220059035 rs786201910 Human genes 0.000 description 2
102220062241 rs786201968 Human genes 0.000 description 2
102220257092 rs786202335 Human genes 0.000 description 2
102220059322 rs786203566 Human genes 0.000 description 2
102220009454 rs80356863 Human genes 0.000 description 2
102220020965 rs80356883 Human genes 0.000 description 2
102220021335 rs80357091 Human genes 0.000 description 2
102200109053 rs863224683 Human genes 0.000 description 2
102200108223 rs869312782 Human genes 0.000 description 2
102200046443 rs9014 Human genes 0.000 description 2
108091008601 sVEGFR Proteins 0.000 description 2
150000003839 salts Chemical class 0.000 description 2
238000007423 screening assay Methods 0.000 description 2
239000004208 shellac Substances 0.000 description 2
ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 2
229940113147 shellac Drugs 0.000 description 2
235000013874 shellac Nutrition 0.000 description 2
235000002639 sodium chloride Nutrition 0.000 description 2
235000019333 sodium laurylsulphate Nutrition 0.000 description 2
239000003381 stabilizer Substances 0.000 description 2
239000008117 stearic acid Substances 0.000 description 2
108010059339 submandibular proteinase A Proteins 0.000 description 2
239000000758 substrate Substances 0.000 description 2
208000024891 symptom Diseases 0.000 description 2
238000002560 therapeutic procedure Methods 0.000 description 2
229960004072 thrombin Drugs 0.000 description 2
230000000699 topical effect Effects 0.000 description 2
239000003053 toxin Substances 0.000 description 2
231100000765 toxin Toxicity 0.000 description 2
108700012359 toxins Proteins 0.000 description 2
125000001493 tyrosinyl group Chemical group [H]OC1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 2
229960005356 urokinase Drugs 0.000 description 2
239000004474 valine Substances 0.000 description 2
239000013598 vector Substances 0.000 description 2
229920002554 vinyl polymer Polymers 0.000 description 2
XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
230000003442 weekly effect Effects 0.000 description 2
229920001285 xanthan gum Polymers 0.000 description 2
OIXLLKLZKCBCPS-RZVRUWJTSA-N (2s)-2-azanyl-5-[bis(azanyl)methylideneamino]pentanoic acid Chemical compound OC(=O)[C@@H](N)CCCNC(N)=N.OC(=O)[C@@H](N)CCCNC(N)=N OIXLLKLZKCBCPS-RZVRUWJTSA-N 0.000 description 1
XOMRRQXKHMYMOC-NRFANRHFSA-N (3s)-3-hexadecanoyloxy-4-(trimethylazaniumyl)butanoate Chemical compound CCCCCCCCCCCCCCCC(=O)O[C@@H](CC([O-])=O)C[N+](C)(C)C XOMRRQXKHMYMOC-NRFANRHFSA-N 0.000 description 1
RYAUSSKQMZRMAI-YESZJQIVSA-N (S)-fenpropimorph Chemical compound C([C@@H](C)CC=1C=CC(=CC=1)C(C)(C)C)N1C[C@H](C)O[C@H](C)C1 RYAUSSKQMZRMAI-YESZJQIVSA-N 0.000 description 1
UKAUYVFTDYCKQA-UHFFFAOYSA-N -2-Amino-4-hydroxybutanoic acid Natural products OC(=O)C(N)CCO UKAUYVFTDYCKQA-UHFFFAOYSA-N 0.000 description 1
OKMWKBLSFKFYGZ-UHFFFAOYSA-N 1-behenoylglycerol Chemical compound CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(O)CO OKMWKBLSFKFYGZ-UHFFFAOYSA-N 0.000 description 1
YVOOPGWEIRIUOX-UHFFFAOYSA-N 2-azanyl-3-sulfanyl-propanoic acid Chemical compound SCC(N)C(O)=O.SCC(N)C(O)=O YVOOPGWEIRIUOX-UHFFFAOYSA-N 0.000 description 1
102220583987 28S ribosomal protein S10, mitochondrial_D58R_mutation Human genes 0.000 description 1
102220643871 39S ribosomal protein L9, mitochondrial_E99Q_mutation Human genes 0.000 description 1
102220615433 40S ribosomal protein S13_L57H_mutation Human genes 0.000 description 1
LVRVABPNVHYXRT-BQWXUCBYSA-N 52906-92-0 Chemical compound C([C@H](N)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)NCC(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(O)=O)C(C)C)C1=CC=CC=C1 LVRVABPNVHYXRT-BQWXUCBYSA-N 0.000 description 1
102220470040 60S acidic ribosomal protein P0-like_L47H_mutation Human genes 0.000 description 1
JMHFFDIMOUKDCZ-NTXHZHDSSA-N 61214-51-5 Chemical compound C([C@@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CCC(O)=O)C(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CCSC)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)CNC(=O)CNC(=O)[C@@H](N)CC=1C=CC(O)=CC=1)[C@@H](C)O)[C@@H](C)O)C(C)C)[C@@H](C)O)C1=CC=CC=C1 JMHFFDIMOUKDCZ-NTXHZHDSSA-N 0.000 description 1
GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 1
102220483288 ADP-sugar pyrophosphatase_L98A_mutation Human genes 0.000 description 1
102220468915 AP-4 complex subunit epsilon-1_F96V_mutation Human genes 0.000 description 1
102220510636 APC membrane recruitment protein 1_Q16D_mutation Human genes 0.000 description 1
102220510637 APC membrane recruitment protein 1_Q16R_mutation Human genes 0.000 description 1
102220510656 APC membrane recruitment protein 1_Q16T_mutation Human genes 0.000 description 1
244000215068 Acacia senegal Species 0.000 description 1
102220565734 Acid-sensing ion channel 4_T26K_mutation Human genes 0.000 description 1
102220588802 Acidic mammalian chitinase_N45D_mutation Human genes 0.000 description 1
102220621118 Actin, alpha skeletal muscle_D27N_mutation Human genes 0.000 description 1
102220582488 Actin, cytoplasmic 1_W79E_mutation Human genes 0.000 description 1
102220467406 Acyl-coenzyme A thioesterase MBLAC2_E45Q_mutation Human genes 0.000 description 1
102220511881 Acyl-coenzyme A thioesterase THEM4_L17R_mutation Human genes 0.000 description 1
229910002012 Aerosil® Inorganic materials 0.000 description 1
229920001817 Agar Polymers 0.000 description 1
102220468857 Albumin_R23H_mutation Human genes 0.000 description 1
102000009027 Albumins Human genes 0.000 description 1
108010088751 Albumins Proteins 0.000 description 1
108700028369 Alleles Proteins 0.000 description 1
102100022712 Alpha-1-antitrypsin Human genes 0.000 description 1
239000005995 Aluminium silicate Substances 0.000 description 1
102100022987 Angiogenin Human genes 0.000 description 1
102220465452 Angiogenin_K64Q_mutation Human genes 0.000 description 1
102220534042 Angiopoietin-related protein 3_K65N_mutation Human genes 0.000 description 1
102220594474 Annexin-2 receptor_L88T_mutation Human genes 0.000 description 1
102220609080 Apolipoprotein E_Q64H_mutation Human genes 0.000 description 1
102220467169 Apoptosis-resistant E3 ubiquitin protein ligase 1_T82D_mutation Human genes 0.000 description 1
108010039627 Aprotinin Proteins 0.000 description 1
208000002109 Argyria Diseases 0.000 description 1
DCXYFEDJOCDNAF-UHFFFAOYSA-N Asparagine Natural products OC(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-N 0.000 description 1
241000416162 Astragalus gummifer Species 0.000 description 1
102220582667 Astrocytic phosphoprotein PEA-15_E18R_mutation Human genes 0.000 description 1
102220582664 Astrocytic phosphoprotein PEA-15_N14R_mutation Human genes 0.000 description 1
102220582079 Astrocytic phosphoprotein PEA-15_Q10N_mutation Human genes 0.000 description 1
102000002723 Atrial Natriuretic Factor Human genes 0.000 description 1
101800001288 Atrial natriuretic factor Proteins 0.000 description 1
208000023275 Autoimmune disease Diseases 0.000 description 1
102220561183 Autophagy-related protein 2 homolog A_V82R_mutation Human genes 0.000 description 1
102220534209 B-cell lymphoma/leukemia 10_L28A_mutation Human genes 0.000 description 1
102220534198 B-cell lymphoma/leukemia 10_L47A_mutation Human genes 0.000 description 1
102100022005 B-lymphocyte antigen CD20 Human genes 0.000 description 1
102220617586 B1 bradykinin receptor_K16Q_mutation Human genes 0.000 description 1
102220567472 BICD family-like cargo adapter 2_L24A_mutation Human genes 0.000 description 1
241000894006 Bacteria Species 0.000 description 1
208000035143 Bacterial infection Diseases 0.000 description 1
102220590237 Barttin_K19Q_mutation Human genes 0.000 description 1
239000005711 Benzoic acid Substances 0.000 description 1
102400000748 Beta-endorphin Human genes 0.000 description 1
101800005049 Beta-endorphin Proteins 0.000 description 1
102220638116 Beta-enolase_D87N_mutation Human genes 0.000 description 1
102220638121 Beta-enolase_R32Q_mutation Human genes 0.000 description 1
208000019838 Blood disease Diseases 0.000 description 1
108010051479 Bombesin Proteins 0.000 description 1
102000013585 Bombesin Human genes 0.000 description 1
101800004538 Bradykinin Proteins 0.000 description 1
102400000967 Bradykinin Human genes 0.000 description 1
102100021943 C-C motif chemokine 2 Human genes 0.000 description 1
101710155857 C-C motif chemokine 2 Proteins 0.000 description 1
108010075254 C-Peptide Proteins 0.000 description 1
102220606581 C-reactive protein_S84K_mutation Human genes 0.000 description 1
102220617217 CPX chromosomal region candidate gene 1 protein_L87E_mutation Human genes 0.000 description 1
108060001064 Calcitonin Proteins 0.000 description 1
102000055006 Calcitonin Human genes 0.000 description 1
OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
241000282465 Canis Species 0.000 description 1
241000283707 Capra Species 0.000 description 1
229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
102220547739 Carcinoembryonic antigen-related cell adhesion molecule 3_K90Q_mutation Human genes 0.000 description 1
208000024172 Cardiovascular disease Diseases 0.000 description 1
102220518415 Casein kinase I isoform gamma-2_K15Q_mutation Human genes 0.000 description 1
102220495091 Caspase-5_K19N_mutation Human genes 0.000 description 1
102220495085 Caspase-5_L75R_mutation Human genes 0.000 description 1
102220588161 Cell growth regulator with EF hand domain protein 1_F48W_mutation Human genes 0.000 description 1
102220645934 Cell surface A33 antigen_N28Q_mutation Human genes 0.000 description 1
102220583786 Cellular tumor antigen p53_D61N_mutation Human genes 0.000 description 1
102220571941 Cellular tumor antigen p53_K164Q_mutation Human genes 0.000 description 1
102220571940 Cellular tumor antigen p53_K164T_mutation Human genes 0.000 description 1
102220575217 Cellular tumor antigen p53_L130H_mutation Human genes 0.000 description 1
102220575812 Cellular tumor antigen p53_P177A_mutation Human genes 0.000 description 1
102220575797 Cellular tumor antigen p53_P177S_mutation Human genes 0.000 description 1
102220584267 Cellular tumor antigen p53_P85S_mutation Human genes 0.000 description 1
102220587347 Cellular tumor antigen p53_P92A_mutation Human genes 0.000 description 1
102220587348 Cellular tumor antigen p53_P92S_mutation Human genes 0.000 description 1
102220575164 Cellular tumor antigen p53_Y126H_mutation Human genes 0.000 description 1
240000008886 Ceratonia siliqua Species 0.000 description 1
235000013912 Ceratonia siliqua Nutrition 0.000 description 1
102220604597 Ceroid-lipofuscinosis neuronal protein 6_N90K_mutation Human genes 0.000 description 1
101800001982 Cholecystokinin Proteins 0.000 description 1
102100025841 Cholecystokinin Human genes 0.000 description 1
208000000419 Chronic Hepatitis B Diseases 0.000 description 1
208000013725 Chronic Kidney Disease-Mineral and Bone disease Diseases 0.000 description 1
208000006154 Chronic hepatitis C Diseases 0.000 description 1
KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
102100022641 Coagulation factor IX Human genes 0.000 description 1
102220627589 Coagulation factor IX_L20S_mutation Human genes 0.000 description 1
102100023804 Coagulation factor VII Human genes 0.000 description 1
102220511023 Coagulation factor VIII_Y35H_mutation Human genes 0.000 description 1
102220519059 Conserved oligomeric Golgi complex subunit 3_K20Q_mutation Human genes 0.000 description 1
238000011537 Coomassie blue staining Methods 0.000 description 1
229920002261 Corn starch Polymers 0.000 description 1
102220645394 Cornifin-B_Q23H_mutation Human genes 0.000 description 1
102220554117 Cyclic GMP-AMP synthase_L17T_mutation Human genes 0.000 description 1
102220554118 Cyclic GMP-AMP synthase_L21H_mutation Human genes 0.000 description 1
201000003883 Cystic fibrosis Diseases 0.000 description 1
102220519208 Cytochrome P450 1A2_P42R_mutation Human genes 0.000 description 1
FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
102220589476 DNA repair protein XRCC4_E62R_mutation Human genes 0.000 description 1
PYGXAGIECVVIOZ-UHFFFAOYSA-N Dibutyl decanedioate Chemical compound CCCCOC(=O)CCCCCCCCC(=O)OCCCC PYGXAGIECVVIOZ-UHFFFAOYSA-N 0.000 description 1
102220546581 Distal membrane-arm assembly complex protein 1_L24R_mutation Human genes 0.000 description 1
108010065372 Dynorphins Proteins 0.000 description 1
KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
238000002965 ELISA Methods 0.000 description 1
102220475127 Ectodysplasin-A_L98D_mutation Human genes 0.000 description 1
102220482162 Endothelial differentiation-related factor 1_T40D_mutation Human genes 0.000 description 1
108010092674 Enkephalins Proteins 0.000 description 1
102400001368 Epidermal growth factor Human genes 0.000 description 1
101800003838 Epidermal growth factor Proteins 0.000 description 1
241000283073 Equus caballus Species 0.000 description 1
IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
241000206602 Eukaryota Species 0.000 description 1
102220480358 Eukaryotic translation initiation factor 3 subunit B_F84V_mutation Human genes 0.000 description 1
102220505068 Eukaryotic translation initiation factor 3 subunit B_F86V_mutation Human genes 0.000 description 1
102220557008 F-box/LRR-repeat protein 12_L63H_mutation Human genes 0.000 description 1
108010076282 Factor IX Proteins 0.000 description 1
108010023321 Factor VII Proteins 0.000 description 1
108010054218 Factor VIII Proteins 0.000 description 1
102000001690 Factor VIII Human genes 0.000 description 1
241000282324 Felis Species 0.000 description 1
102000009123 Fibrin Human genes 0.000 description 1
108010073385 Fibrin Proteins 0.000 description 1
BWGVNKXGVNDBDI-UHFFFAOYSA-N Fibrin monomer Chemical compound CNC(=O)CNC(=O)CN BWGVNKXGVNDBDI-UHFFFAOYSA-N 0.000 description 1
102000003971 Fibroblast Growth Factor 1 Human genes 0.000 description 1
108090000386 Fibroblast Growth Factor 1 Proteins 0.000 description 1
102000003972 Fibroblast growth factor 7 Human genes 0.000 description 1
108090000385 Fibroblast growth factor 7 Proteins 0.000 description 1
102000012673 Follicle Stimulating Hormone Human genes 0.000 description 1
108010079345 Follicle Stimulating Hormone Proteins 0.000 description 1
101800002068 Galanin Proteins 0.000 description 1
102400001370 Galanin Human genes 0.000 description 1
102220641639 Galectin-related protein_D39H_mutation Human genes 0.000 description 1
102220592877 Ganglioside-induced differentiation-associated protein 1_K39N_mutation Human genes 0.000 description 1
102220606760 Gap junction beta-1 protein_N14K_mutation Human genes 0.000 description 1
102220590587 Gap junction beta-1 protein_P87S_mutation Human genes 0.000 description 1
208000018522 Gastrointestinal disease Diseases 0.000 description 1
241000699694 Gerbillinae Species 0.000 description 1
102100039289 Glial fibrillary acidic protein Human genes 0.000 description 1
101710193519 Glial fibrillary acidic protein Proteins 0.000 description 1
208000032612 Glial tumor Diseases 0.000 description 1
WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
102220560591 Glucose-6-phosphate 1-dehydrogenase_H32R_mutation Human genes 0.000 description 1
102220537647 Glutathione S-transferase LANCL1_L20K_mutation Human genes 0.000 description 1
102220591688 Glycine amidinotransferase, mitochondrial_E46Q_mutation Human genes 0.000 description 1
239000000095 Growth Hormone-Releasing Hormone Substances 0.000 description 1
101710119601 Growth hormone-releasing peptides Proteins 0.000 description 1
102220487182 Growth/differentiation factor 9_E53Q_mutation Human genes 0.000 description 1
102220640750 Guanine nucleotide-binding protein G(i) subunit alpha-3_N90R_mutation Human genes 0.000 description 1
229920002907 Guar gum Polymers 0.000 description 1
229920000084 Gum arabic Polymers 0.000 description 1
QXZGBUJJYSLZLT-UHFFFAOYSA-N H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH Natural products NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1C(C(=O)NCC(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CO)C(=O)N2C(CCC2)C(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CCCN=C(N)N)C(O)=O)CCC1 QXZGBUJJYSLZLT-UHFFFAOYSA-N 0.000 description 1
102220576566 HLA class I histocompatibility antigen, A alpha chain_F56V_mutation Human genes 0.000 description 1
102220576604 HLA class I histocompatibility antigen, A alpha chain_K19S_mutation Human genes 0.000 description 1
102220576567 HLA class I histocompatibility antigen, A alpha chain_Q86R_mutation Human genes 0.000 description 1
102220576556 HLA class I histocompatibility antigen, A alpha chain_R59Q_mutation Human genes 0.000 description 1
102220576081 HLA class I histocompatibility antigen, B alpha chain_D54G_mutation Human genes 0.000 description 1
102220576056 HLA class I histocompatibility antigen, B alpha chain_Q94K_mutation Human genes 0.000 description 1
102220576035 HLA class I histocompatibility antigen, B alpha chain_Q94N_mutation Human genes 0.000 description 1
102220576032 HLA class I histocompatibility antigen, B alpha chain_Q94S_mutation Human genes 0.000 description 1
102220474593 HLA class II histocompatibility antigen, DP alpha 1 chain_M62Q_mutation Human genes 0.000 description 1
102220541599 HLA class II histocompatibility antigen, DQ beta 1 chain_P87R_mutation Human genes 0.000 description 1
102220498334 HLA class II histocompatibility antigen, DR beta 3 chain_E38Q_mutation Human genes 0.000 description 1
102220467563 HLA class II histocompatibility antigen, DR beta 5 chain_D66N_mutation Human genes 0.000 description 1
102220493630 HLA class II histocompatibility antigen, DRB1 beta chain_F60V_mutation Human genes 0.000 description 1
102220493708 HLA class II histocompatibility antigen, DRB1 beta chain_R33Q_mutation Human genes 0.000 description 1
102220493742 HLA class II histocompatibility antigen, DRB1 beta chain_Y59H_mutation Human genes 0.000 description 1
102220593535 HORMA domain-containing protein 1_L87A_mutation Human genes 0.000 description 1
102220593534 HORMA domain-containing protein 1_L87W_mutation Human genes 0.000 description 1
102220619665 Hemoglobin subunit alpha_K61N_mutation Human genes 0.000 description 1
102220609562 Hemoglobin subunit alpha_K61Q_mutation Human genes 0.000 description 1
102220591532 Hemoglobin subunit beta_L33V_mutation Human genes 0.000 description 1
102000001554 Hemoglobins Human genes 0.000 description 1
108010054147 Hemoglobins Proteins 0.000 description 1
208000005176 Hepatitis C Diseases 0.000 description 1
108090000100 Hepatocyte Growth Factor Proteins 0.000 description 1
102100021866 Hepatocyte growth factor Human genes 0.000 description 1
102000007625 Hirudins Human genes 0.000 description 1
108010007267 Hirudins Proteins 0.000 description 1
102220487043 Histone H4 transcription factor_D37N_mutation Human genes 0.000 description 1
102220487045 Histone H4 transcription factor_E39Q_mutation Human genes 0.000 description 1
102220568291 Histone PARylation factor 1_R12H_mutation Human genes 0.000 description 1
101000897405 Homo sapiens B-lymphocyte antigen CD20 Proteins 0.000 description 1
101000993364 Homo sapiens Ciliary neurotrophic factor Proteins 0.000 description 1
101001063991 Homo sapiens Leptin Proteins 0.000 description 1
101000992170 Homo sapiens Oncostatin-M Proteins 0.000 description 1
101000808011 Homo sapiens Vascular endothelial growth factor A Proteins 0.000 description 1
102220609195 Huntingtin-associated protein 1_D73N_mutation Human genes 0.000 description 1
102220570190 Hydroxymethylglutaryl-CoA lyase, mitochondrial_K48N_mutation Human genes 0.000 description 1
241000282596 Hylobatidae Species 0.000 description 1
201000009794 Idiopathic Pulmonary Fibrosis Diseases 0.000 description 1
102220548011 Inducible T-cell costimulator_Q10S_mutation Human genes 0.000 description 1
206010061218 Inflammation Diseases 0.000 description 1
102220546461 Insulin-like growth factor-binding protein complex acid labile subunit_E45N_mutation Human genes 0.000 description 1
102100025390 Integrin beta-2 Human genes 0.000 description 1
102000010787 Interleukin-4 Receptors Human genes 0.000 description 1
108010038486 Interleukin-4 Receptors Proteins 0.000 description 1
108090001007 Interleukin-8 Proteins 0.000 description 1
102000004890 Interleukin-8 Human genes 0.000 description 1
102220624060 Iron-sulfur cluster assembly enzyme ISCU, mitochondrial_D39G_mutation Human genes 0.000 description 1
102220619243 Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial_K33S_mutation Human genes 0.000 description 1
102220525252 Killer cell lectin-like receptor subfamily B member 1_E32Q_mutation Human genes 0.000 description 1
XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 description 1
ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 1
125000000998 L-alanino group Chemical group [H]N([*])[C@](C([H])([H])[H])([H])C(=O)O[H] 0.000 description 1
ODKSFYDXXFIFQN-BYPYZUCNSA-N L-arginine Chemical compound OC(=O)[C@@H](N)CCCN=C(N)N ODKSFYDXXFIFQN-BYPYZUCNSA-N 0.000 description 1
229930064664 L-arginine Natural products 0.000 description 1
235000014852 L-arginine Nutrition 0.000 description 1
AGPKZVBTJJNPAG-WHFBIAKZSA-N L-isoleucine Chemical compound CC[C@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-WHFBIAKZSA-N 0.000 description 1
ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 1
FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 1
XNSAINXGIQZQOO-UHFFFAOYSA-N L-pyroglutamyl-L-histidyl-L-proline amide Natural products NC(=O)C1CCCN1C(=O)C(NC(=O)C1NC(=O)CC1)CC1=CN=CN1 XNSAINXGIQZQOO-UHFFFAOYSA-N 0.000 description 1
OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
102220595357 Lanosterol 14-alpha demethylase_L98H_mutation Human genes 0.000 description 1
URLZCHNOLZSCCA-VABKMULXSA-N Leu-enkephalin Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)CNC(=O)CNC(=O)[C@@H](N)CC=1C=CC(O)=CC=1)C1=CC=CC=C1 URLZCHNOLZSCCA-VABKMULXSA-N 0.000 description 1
235000010643 Leucaena leucocephala Nutrition 0.000 description 1
240000007472 Leucaena leucocephala Species 0.000 description 1
ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 1
239000004117 Lignosulphonate Substances 0.000 description 1
101500021084 Locusta migratoria 5 kDa peptide Proteins 0.000 description 1
108010064548 Lymphocyte Function-Associated Antigen-1 Proteins 0.000 description 1
206010025323 Lymphomas Diseases 0.000 description 1
239000004472 Lysine Substances 0.000 description 1
102220639866 Lysine-specific demethylase RSBN1L_P64A_mutation Human genes 0.000 description 1
235000019759 Maize starch Nutrition 0.000 description 1
229930195725 Mannitol Natural products 0.000 description 1
102000002274 Matrix Metalloproteinases Human genes 0.000 description 1
108010000684 Matrix Metalloproteinases Proteins 0.000 description 1
102220608983 Mediator of RNA polymerase II transcription subunit 12_L24K_mutation Human genes 0.000 description 1
101710151321 Melanostatin Proteins 0.000 description 1
102220568015 Merlin_H97E_mutation Human genes 0.000 description 1
CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
102220556035 Methylthioribulose-1-phosphate dehydratase_S84D_mutation Human genes 0.000 description 1
229920000168 Microcrystalline cellulose Polymers 0.000 description 1
101710151805 Mitochondrial intermediate peptidase 1 Proteins 0.000 description 1
102220507409 Mitochondrial tRNA-specific 2-thiouridylase 1_H94K_mutation Human genes 0.000 description 1
102220608426 Mitogen-activated protein kinase kinase kinase kinase 1_D44N_mutation Human genes 0.000 description 1
101800002372 Motilin Proteins 0.000 description 1
102000002419 Motilin Human genes 0.000 description 1
102220633124 Mu-type opioid receptor_D55Q_mutation Human genes 0.000 description 1
241000699666 Mus <mouse, genus> Species 0.000 description 1
101001026869 Mus musculus F-box/LRR-repeat protein 3 Proteins 0.000 description 1
102220484420 Myb/SANT-like DNA-binding domain-containing protein 1_L32Q_mutation Human genes 0.000 description 1
102220467826 MyoD family inhibitor domain-containing protein 2_E26H_mutation Human genes 0.000 description 1
102220468721 MyoD family inhibitor domain-containing protein 2_E26N_mutation Human genes 0.000 description 1
102220514706 Myoglobin_D94S_mutation Human genes 0.000 description 1
WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
102220533461 N-acetylgalactosamine-6-sulfatase_F97V_mutation Human genes 0.000 description 1
102220483312 NADH-ubiquinone oxidoreductase chain 1_Y30H_mutation Human genes 0.000 description 1
102220574558 Neuronal acetylcholine receptor subunit alpha-2_E23R_mutation Human genes 0.000 description 1
102400000064 Neuropeptide Y Human genes 0.000 description 1
101800001814 Neurotensin Proteins 0.000 description 1
102400001103 Neurotensin Human genes 0.000 description 1
102220500398 Neutral and basic amino acid transport protein rBAT_K43Q_mutation Human genes 0.000 description 1
102220480985 Nicotinate phosphoribosyltransferase_Q51N_mutation Human genes 0.000 description 1
102220558656 Nuclear protein 1_E52Q_mutation Human genes 0.000 description 1
102220558654 Nuclear protein 1_E55Q_mutation Human genes 0.000 description 1
108091028043 Nucleic acid sequence Proteins 0.000 description 1
102220531281 Nucleolar GTP-binding protein 2_Q16E_mutation Human genes 0.000 description 1
102220495764 Nucleolar and spindle-associated protein 1_E93Q_mutation Human genes 0.000 description 1
208000008589 Obesity Diseases 0.000 description 1
241000283973 Oryctolagus cuniculus Species 0.000 description 1
102400000050 Oxytocin Human genes 0.000 description 1
101800000989 Oxytocin Proteins 0.000 description 1
XNOPRXBHLZRZKH-UHFFFAOYSA-N Oxytocin Natural products N1C(=O)C(N)CSSCC(C(=O)N2C(CCC2)C(=O)NC(CC(C)C)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C(C(C)CC)NC(=O)C1CC1=CC=C(O)C=C1 XNOPRXBHLZRZKH-UHFFFAOYSA-N 0.000 description 1
102220624881 PDZ and LIM domain protein 2_L80K_mutation Human genes 0.000 description 1
102220536901 PRKC apoptosis WT1 regulator protein_L69I_mutation Human genes 0.000 description 1
241000282577 Pan troglodytes Species 0.000 description 1
102220479386 Pantetheinase_P48A_mutation Human genes 0.000 description 1
241000282520 Papio Species 0.000 description 1
102220493314 Parkinson disease protein 7_E18N_mutation Human genes 0.000 description 1
102220537706 Partner and localizer of BRCA2_L21A_mutation Human genes 0.000 description 1
241000336676 Pelia Species 0.000 description 1
102220517148 Phosphate-regulating neutral endopeptidase PHEX_D84Q_mutation Human genes 0.000 description 1
102220539619 Piwi-like protein 1_E85Q_mutation Human genes 0.000 description 1
239000004698 Polyethylene Substances 0.000 description 1
241000282405 Pongo abelii Species 0.000 description 1
108010005991 Pork Regular Insulin Proteins 0.000 description 1
102220485938 Probable ATP-dependent RNA helicase DHX34_K94R_mutation Human genes 0.000 description 1
102100024622 Proenkephalin-B Human genes 0.000 description 1
108010076181 Proinsulin Proteins 0.000 description 1
108010057464 Prolactin Proteins 0.000 description 1
102000003946 Prolactin Human genes 0.000 description 1
ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 1
102220472460 Proline-rich basic protein 1_Q94R_mutation Human genes 0.000 description 1
GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
102000007327 Protamines Human genes 0.000 description 1
108010007568 Protamines Proteins 0.000 description 1
102220470512 Proteasome subunit beta type-3_V82G_mutation Human genes 0.000 description 1
102220472528 Protein ENL_T26E_mutation Human genes 0.000 description 1
102220537309 Protein NDRG2_S34K_mutation Human genes 0.000 description 1
102220595929 Protein RCC2_K19T_mutation Human genes 0.000 description 1
102220595858 Protein RCC2_K20T_mutation Human genes 0.000 description 1
102220573242 Protein adenylyltransferase SelO, mitochondrial_C17S_mutation Human genes 0.000 description 1
102220607245 Protein inscuteable homolog_E89R_mutation Human genes 0.000 description 1
102220619489 Protein mago nashi homolog_E72R_mutation Human genes 0.000 description 1
102220526140 Putative EP400-like protein_P63A_mutation Human genes 0.000 description 1
102220559553 Putative uncharacterized protein TSPEAR-AS2_K89Q_mutation Human genes 0.000 description 1
108010035587 R13Q Proteins 0.000 description 1
102220546262 Ras-related protein Rab-43_T82E_mutation Human genes 0.000 description 1
102220473688 Ras-related protein Rab-5A_S84E_mutation Human genes 0.000 description 1
102220529117 Receptor expression-enhancing protein 5_H97T_mutation Human genes 0.000 description 1
241000283984 Rodentia Species 0.000 description 1
102220629168 SH2 domain-containing protein 1B_P90K_mutation Human genes 0.000 description 1
102220608400 SMAD5 antisense gene protein 1_K85N_mutation Human genes 0.000 description 1
101000663557 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) 60S ribosomal protein L17-A Proteins 0.000 description 1
206010039491 Sarcoma Diseases 0.000 description 1
108010086019 Secretin Proteins 0.000 description 1
102100037505 Secretin Human genes 0.000 description 1
238000012300 Sequence Analysis Methods 0.000 description 1
102000003667 Serine Endopeptidases Human genes 0.000 description 1
108090000083 Serine Endopeptidases Proteins 0.000 description 1
102220522598 Serine/arginine-rich splicing factor 2_L75D_mutation Human genes 0.000 description 1
102220580859 Serine/threonine-protein kinase STK11_K48Q_mutation Human genes 0.000 description 1
102220509680 Serine/threonine-protein kinase greatwall_M36A_mutation Human genes 0.000 description 1
102220562714 Sex-determining region Y protein_F67V_mutation Human genes 0.000 description 1
102220471970 Single-stranded DNA cytosine deaminase_T27E_mutation Human genes 0.000 description 1
102220509305 Small integral membrane protein 10_D34Q_mutation Human genes 0.000 description 1
102220495230 Sodium channel subunit beta-2_K38Q_mutation Human genes 0.000 description 1
239000004141 Sodium laurylsulphate Substances 0.000 description 1
239000003568 Sodium, potassium and calcium salts of fatty acids Substances 0.000 description 1
102220493202 Sodium/calcium exchanger 3_M62V_mutation Human genes 0.000 description 1
102220493455 Sodium/calcium exchanger 3_R14Q_mutation Human genes 0.000 description 1
101710142969 Somatoliberin Proteins 0.000 description 1
102100022831 Somatoliberin Human genes 0.000 description 1
108010056088 Somatostatin Proteins 0.000 description 1
102000005157 Somatostatin Human genes 0.000 description 1
102220577394 Stromal cell-derived factor 1_K45S_mutation Human genes 0.000 description 1
102220577362 Stromal cell-derived factor 1_Y28H_mutation Human genes 0.000 description 1
102220494897 Stromal cell-derived factor 2-like protein 1_E55H_mutation Human genes 0.000 description 1
102220607244 Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial_E37N_mutation Human genes 0.000 description 1
229930006000 Sucrose Natural products 0.000 description 1
CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
102220608441 Suppressor of cytokine signaling 2_L75E_mutation Human genes 0.000 description 1
102220612268 T-cell surface glycoprotein CD4_N86D_mutation Human genes 0.000 description 1
102220521895 THAP domain-containing protein 1_L32A_mutation Human genes 0.000 description 1
102220521924 THAP domain-containing protein 1_L32H_mutation Human genes 0.000 description 1
102220536504 THAP domain-containing protein 1_P78A_mutation Human genes 0.000 description 1
102220468963 Thymosin beta-10_Y42H_mutation Human genes 0.000 description 1
102000011923 Thyrotropin Human genes 0.000 description 1
108010061174 Thyrotropin Proteins 0.000 description 1
239000000627 Thyrotropin-Releasing Hormone Substances 0.000 description 1
102400000336 Thyrotropin-releasing hormone Human genes 0.000 description 1
101800004623 Thyrotropin-releasing hormone Proteins 0.000 description 1
ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
102000005876 Tissue Inhibitor of Metalloproteinases Human genes 0.000 description 1
108010005246 Tissue Inhibitor of Metalloproteinases Proteins 0.000 description 1
229920001615 Tragacanth Polymers 0.000 description 1
102220608364 Transcription factor SOX-2_W79S_mutation Human genes 0.000 description 1
102220604981 Transcription factor Sp2_L47Q_mutation Human genes 0.000 description 1
102220600063 Transcriptional coactivator YAP1_P85A_mutation Human genes 0.000 description 1
102000004887 Transforming Growth Factor beta Human genes 0.000 description 1
108090001012 Transforming Growth Factor beta Proteins 0.000 description 1
102220548995 Translin-associated factor X-interacting protein 1_Q64T_mutation Human genes 0.000 description 1
102220559475 Transmembrane protein 207_L57V_mutation Human genes 0.000 description 1
102220472110 Transmembrane protein_M68V_mutation Human genes 0.000 description 1
102220472118 Transmembrane protein_Q48N_mutation Human genes 0.000 description 1
102220483597 Troponin I, cardiac muscle_K40Q_mutation Human genes 0.000 description 1
102220645855 Tubulin alpha-1A chain_L20A_mutation Human genes 0.000 description 1
102220527902 Tumor protein D54_K33Q_mutation Human genes 0.000 description 1
102220544505 Tyrosine-protein kinase TXK_Q23K_mutation Human genes 0.000 description 1
102220489711 Ubiquitin-like modifier-activating enzyme ATG7_F15D_mutation Human genes 0.000 description 1
102220531375 Uncharacterized protein KIAA2012_Q16K_mutation Human genes 0.000 description 1
102220478507 Vacuolar protein sorting-associated protein 35_T82R_mutation Human genes 0.000 description 1
108010073925 Vascular Endothelial Growth Factor B Proteins 0.000 description 1
108010073919 Vascular Endothelial Growth Factor D Proteins 0.000 description 1
102100038217 Vascular endothelial growth factor B Human genes 0.000 description 1
102100038234 Vascular endothelial growth factor D Human genes 0.000 description 1
102220609891 Vasoactive intestinal polypeptide receptor 1_L57A_mutation Human genes 0.000 description 1
102220609878 Vasoactive intestinal polypeptide receptor 1_L63A_mutation Human genes 0.000 description 1
GXBMIBRIOWHPDT-UHFFFAOYSA-N Vasopressin Natural products N1C(=O)C(CC=2C=C(O)C=CC=2)NC(=O)C(N)CSSCC(C(=O)N2C(CCC2)C(=O)NC(CCCN=C(N)N)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C1CC1=CC=CC=C1 GXBMIBRIOWHPDT-UHFFFAOYSA-N 0.000 description 1
102220513286 Vasopressin V1b receptor_N14Q_mutation Human genes 0.000 description 1
108010004977 Vasopressins Proteins 0.000 description 1
102000002852 Vasopressins Human genes 0.000 description 1
102220580962 Voltage-dependent T-type calcium channel subunit alpha-1H_M32V_mutation Human genes 0.000 description 1
102220506818 Werner syndrome ATP-dependent helicase_L88A_mutation Human genes 0.000 description 1
101000642591 Xenopus laevis Somatotropin-A Proteins 0.000 description 1
235000010489 acacia gum Nutrition 0.000 description 1
239000000205 acacia gum Substances 0.000 description 1
DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
BAPJBEWLBFYGME-UHFFFAOYSA-N acrylic acid methyl ester Natural products COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 1
230000003213 activating effect Effects 0.000 description 1
239000008186 active pharmaceutical agent Substances 0.000 description 1
238000005273 aeration Methods 0.000 description 1
238000001042 affinity chromatography Methods 0.000 description 1
239000008272 agar Substances 0.000 description 1
229940023476 agar Drugs 0.000 description 1
235000010419 agar Nutrition 0.000 description 1
108010050122 alpha 1-Antitrypsin Proteins 0.000 description 1
229940024142 alpha 1-antitrypsin Drugs 0.000 description 1
235000012211 aluminium silicate Nutrition 0.000 description 1
SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 1
BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
229910052921 ammonium sulfate Inorganic materials 0.000 description 1
235000011130 ammonium sulphate Nutrition 0.000 description 1
108010072788 angiogenin Proteins 0.000 description 1
229920006318 anionic polymer Polymers 0.000 description 1
230000003712 anti-aging effect Effects 0.000 description 1
230000000665 anti-chemotactic effect Effects 0.000 description 1
230000010100 anticoagulation Effects 0.000 description 1
239000003963 antioxidant agent Substances 0.000 description 1
210000000436 anus Anatomy 0.000 description 1
229960004405 aprotinin Drugs 0.000 description 1
239000013011 aqueous formulation Substances 0.000 description 1
KBZOIRJILGZLEJ-LGYYRGKSSA-N argipressin Chemical compound C([C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CSSC[C@@H](C(N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N1)=O)N)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(N)=O)C1=CC=CC=C1 KBZOIRJILGZLEJ-LGYYRGKSSA-N 0.000 description 1
210000001815 ascending colon Anatomy 0.000 description 1
235000009582 asparagine Nutrition 0.000 description 1
229960001230 asparagine Drugs 0.000 description 1
229940009098 aspartate Drugs 0.000 description 1
CKLJMWTZIZZHCS-REOHCLBHSA-L aspartate group Chemical group N[C@@H](CC(=O)[O-])C(=O)[O-] CKLJMWTZIZZHCS-REOHCLBHSA-L 0.000 description 1
235000003704 aspartic acid Nutrition 0.000 description 1
208000022362 bacterial infectious disease Diseases 0.000 description 1
OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
210000000941 bile Anatomy 0.000 description 1
239000003833 bile salt Substances 0.000 description 1
229940093761 bile salts Drugs 0.000 description 1
238000002306 biochemical method Methods 0.000 description 1
229920000249 biocompatible polymer Polymers 0.000 description 1
239000012620 biological material Substances 0.000 description 1
229920001400 block copolymer Polymers 0.000 description 1
210000000601 blood cell Anatomy 0.000 description 1
230000023555 blood coagulation Effects 0.000 description 1
230000036760 body temperature Effects 0.000 description 1
230000037396 body weight Effects 0.000 description 1
DNDCVAGJPBKION-DOPDSADYSA-N bombesin Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(N)=O)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CC=1NC2=CC=CC=C2C=1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1NC(=O)CC1)C(C)C)C1=CN=CN1 DNDCVAGJPBKION-DOPDSADYSA-N 0.000 description 1
QXZGBUJJYSLZLT-FDISYFBBSA-N bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 description 1
239000006172 buffering agent Substances 0.000 description 1
210000004899 c-terminal region Anatomy 0.000 description 1
102220344899 c.109G>A Human genes 0.000 description 1
102200122401 c.116G>C Human genes 0.000 description 1
102220360816 c.121A>C Human genes 0.000 description 1
102220359217 c.136A>G Human genes 0.000 description 1
102220371053 c.160G>C Human genes 0.000 description 1
102220353977 c.160T>G Human genes 0.000 description 1
102220417887 c.178T>G Human genes 0.000 description 1
102220411699 c.188T>A Human genes 0.000 description 1
102220354962 c.208C>G Human genes 0.000 description 1
102220408233 c.214G>A Human genes 0.000 description 1
102220370165 c.214T>C Human genes 0.000 description 1
102220417893 c.226C>G Human genes 0.000 description 1
102220423712 c.227G>A Human genes 0.000 description 1
102220351600 c.250A>C Human genes 0.000 description 1
102220351976 c.268A>G Human genes 0.000 description 1
102220414144 c.275A>G Human genes 0.000 description 1
102220362350 c.28C>G Human genes 0.000 description 1
102220354464 c.295C>T Human genes 0.000 description 1
102200005764 c.296G>A Human genes 0.000 description 1
102200095236 c.296G>A Human genes 0.000 description 1
102220357233 c.29C>T Human genes 0.000 description 1
102220364121 c.35G>A Human genes 0.000 description 1
102220363074 c.40C>G Human genes 0.000 description 1
102200108567 c.442G>A Human genes 0.000 description 1
229960004015 calcitonin Drugs 0.000 description 1
BBBFJLBPOGFECG-VJVYQDLKSA-N calcitonin Chemical compound N([C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(N)=O)C(C)C)C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1 BBBFJLBPOGFECG-VJVYQDLKSA-N 0.000 description 1
239000011575 calcium Substances 0.000 description 1
229910052791 calcium Inorganic materials 0.000 description 1
FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
235000011132 calcium sulphate Nutrition 0.000 description 1
229960000772 camostat Drugs 0.000 description 1
XASIMHXSUQUHLV-UHFFFAOYSA-N camostat Chemical compound C1=CC(CC(=O)OCC(=O)N(C)C)=CC=C1OC(=O)C1=CC=C(N=C(N)N)C=C1 XASIMHXSUQUHLV-UHFFFAOYSA-N 0.000 description 1
239000007963 capsule composition Substances 0.000 description 1
235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
125000002843 carboxylic acid group Chemical group 0.000 description 1
239000008112 carboxymethyl-cellulose Substances 0.000 description 1
NSQLIUXCMFBZME-MPVJKSABSA-N carperitide Chemical class C([C@H]1C(=O)NCC(=O)NCC(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H](C(NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CSSC[C@@H](C(=O)N1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(O)=O)=O)[C@@H](C)CC)C1=CC=CC=C1 NSQLIUXCMFBZME-MPVJKSABSA-N 0.000 description 1
230000003197 catalytic effect Effects 0.000 description 1
210000004534 cecum Anatomy 0.000 description 1
238000001516 cell proliferation assay Methods 0.000 description 1
235000010980 cellulose Nutrition 0.000 description 1
229920002678 cellulose Polymers 0.000 description 1
239000001913 cellulose Substances 0.000 description 1
229920002301 cellulose acetate Polymers 0.000 description 1
239000002738 chelating agent Substances 0.000 description 1
238000004182 chemical digestion Methods 0.000 description 1
230000001055 chewing effect Effects 0.000 description 1
229940107137 cholecystokinin Drugs 0.000 description 1
208000019425 cirrhosis of liver Diseases 0.000 description 1
238000005345 coagulation Methods 0.000 description 1
239000007931 coated granule Substances 0.000 description 1
210000001072 colon Anatomy 0.000 description 1
238000002648 combination therapy Methods 0.000 description 1
238000004590 computer program Methods 0.000 description 1
230000001268 conjugating effect Effects 0.000 description 1
239000000356 contaminant Substances 0.000 description 1
230000002596 correlated effect Effects 0.000 description 1
229960000913 crospovidone Drugs 0.000 description 1
239000000287 crude extract Substances 0.000 description 1
239000013078 crystal Substances 0.000 description 1
XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 1
235000018417 cysteine Nutrition 0.000 description 1
238000000432 density-gradient centrifugation Methods 0.000 description 1
210000001731 descending colon Anatomy 0.000 description 1
239000008121 dextrose Substances 0.000 description 1
229940099371 diacetylated monoglycerides Drugs 0.000 description 1
238000003745 diagnosis Methods 0.000 description 1
229960002380 dibutyl phthalate Drugs 0.000 description 1
235000019700 dicalcium phosphate Nutrition 0.000 description 1
235000014113 dietary fatty acids Nutrition 0.000 description 1
238000010790 dilution Methods 0.000 description 1
239000012895 dilution Substances 0.000 description 1
229940042399 direct acting antivirals protease inhibitors Drugs 0.000 description 1
229940079593 drug Drugs 0.000 description 1
238000012377 drug delivery Methods 0.000 description 1
238000001035 drying Methods 0.000 description 1
230000002183 duodenal effect Effects 0.000 description 1
229960001484 edetic acid Drugs 0.000 description 1
238000001962 electrophoresis Methods 0.000 description 1
230000008030 elimination Effects 0.000 description 1
238000003379 elimination reaction Methods 0.000 description 1
239000003623 enhancer Substances 0.000 description 1
230000002708 enhancing effect Effects 0.000 description 1
229940116977 epidermal growth factor Drugs 0.000 description 1
102000052116 epidermal growth factor receptor activity proteins Human genes 0.000 description 1
108700015053 epidermal growth factor receptor activity proteins Proteins 0.000 description 1
230000004049 epigenetic modification Effects 0.000 description 1
MVPICKVDHDWCJQ-UHFFFAOYSA-N ethyl 3-pyrrolidin-1-ylpropanoate Chemical compound CCOC(=O)CCN1CCCC1 MVPICKVDHDWCJQ-UHFFFAOYSA-N 0.000 description 1
230000003203 everyday effect Effects 0.000 description 1
230000029142 excretion Effects 0.000 description 1
230000001747 exhibiting effect Effects 0.000 description 1
239000000284 extract Substances 0.000 description 1
229960004222 factor ix Drugs 0.000 description 1
229940012413 factor vii Drugs 0.000 description 1
229960000301 factor viii Drugs 0.000 description 1
239000000194 fatty acid Substances 0.000 description 1
229930195729 fatty acid Natural products 0.000 description 1
150000004665 fatty acids Chemical class 0.000 description 1
229950003499 fibrin Drugs 0.000 description 1
239000003527 fibrinolytic agent Substances 0.000 description 1
230000003176 fibrotic effect Effects 0.000 description 1
238000011049 filling Methods 0.000 description 1
229940028334 follicle stimulating hormone Drugs 0.000 description 1
201000003444 follicular lymphoma Diseases 0.000 description 1
230000037406 food intake Effects 0.000 description 1
235000003599 food sweetener Nutrition 0.000 description 1
238000005194 fractionation Methods 0.000 description 1
238000004108 freeze drying Methods 0.000 description 1
238000002825 functional assay Methods 0.000 description 1
238000002523 gelfiltration Methods 0.000 description 1
210000005046 glial fibrillary acidic protein Anatomy 0.000 description 1
235000013922 glutamic acid Nutrition 0.000 description 1
239000004220 glutamic acid Substances 0.000 description 1
125000000291 glutamic acid group Chemical group N[C@@H](CCC(O)=O)C(=O)* 0.000 description 1
ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 description 1
125000000404 glutamine group Chemical group N[C@@H](CCC(N)=O)C(=O)* 0.000 description 1
229940049654 glyceryl behenate Drugs 0.000 description 1
235000010417 guar gum Nutrition 0.000 description 1
239000000665 guar gum Substances 0.000 description 1
229960002154 guar gum Drugs 0.000 description 1
229920000591 gum Polymers 0.000 description 1
201000009277 hairy cell leukemia Diseases 0.000 description 1
208000014951 hematologic disease Diseases 0.000 description 1
208000018706 hematopoietic system disease Diseases 0.000 description 1
208000006454 hepatitis Diseases 0.000 description 1
231100000283 hepatitis Toxicity 0.000 description 1
208000002672 hepatitis B Diseases 0.000 description 1
208000010710 hepatitis C virus infection Diseases 0.000 description 1
229940006607 hirudin Drugs 0.000 description 1
WQPDUTSPKFMPDP-OUMQNGNKSA-N hirudin Chemical compound C([C@@H](C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC(OS(O)(=O)=O)=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(O)=O)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]1NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@@H]2CSSC[C@@H](C(=O)N[C@@H](CCC(O)=O)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(=O)N[C@H](C(NCC(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)N2)=O)CSSC1)C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]1NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=2C=CC(O)=CC=2)NC(=O)[C@@H](NC(=O)[C@@H](N)C(C)C)C(C)C)[C@@H](C)O)CSSC1)C(C)C)[C@@H](C)O)[C@@H](C)O)C1=CC=CC=C1 WQPDUTSPKFMPDP-OUMQNGNKSA-N 0.000 description 1
125000000487 histidyl group Chemical group [H]N([H])C(C(=O)O*)C([H])([H])C1=C([H])N([H])C([H])=N1 0.000 description 1
102000058223 human VEGFA Human genes 0.000 description 1
229940084769 humulin r Drugs 0.000 description 1
239000000017 hydrogel Substances 0.000 description 1
239000001257 hydrogen Substances 0.000 description 1
229910052739 hydrogen Inorganic materials 0.000 description 1
230000002209 hydrophobic effect Effects 0.000 description 1
229920003063 hydroxymethyl cellulose Polymers 0.000 description 1
229940031574 hydroxymethyl cellulose Drugs 0.000 description 1
238000000099 in vitro assay Methods 0.000 description 1
238000005462 in vivo assay Methods 0.000 description 1
230000002779 inactivation Effects 0.000 description 1
239000005414 inactive ingredient Substances 0.000 description 1
238000011534 incubation Methods 0.000 description 1
208000027866 inflammatory disease Diseases 0.000 description 1
230000004054 inflammatory process Effects 0.000 description 1
230000002401 inhibitory effect Effects 0.000 description 1
ZPNFWUPYTFPOJU-LPYSRVMUSA-N iniprol Chemical compound C([C@H]1C(=O)NCC(=O)NCC(=O)N[C@H]2CSSC[C@H]3C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H](C(N[C@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC=4C=CC=CC=4)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC=4C=CC=CC=4)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC2=O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC=2C=CC=CC=2)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]2N(CCC2)C(=O)[C@@H](N)CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N2[C@@H](CCC2)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N3)C(=O)NCC(=O)NCC(=O)N[C@@H](C)C(O)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@H](C(=O)N1)C(C)C)[C@@H](C)O)[C@@H](C)CC)=O)[C@@H](C)CC)C1=CC=C(O)C=C1 ZPNFWUPYTFPOJU-LPYSRVMUSA-N 0.000 description 1
229960002869 insulin glargine Drugs 0.000 description 1
102000002467 interleukin receptors Human genes 0.000 description 1
108010093036 interleukin receptors Proteins 0.000 description 1
208000036971 interstitial lung disease 2 Diseases 0.000 description 1
238000004255 ion exchange chromatography Methods 0.000 description 1
239000003456 ion exchange resin Substances 0.000 description 1
229920003303 ion-exchange polymer Polymers 0.000 description 1
235000013980 iron oxide Nutrition 0.000 description 1
229960000310 isoleucine Drugs 0.000 description 1
AGPKZVBTJJNPAG-UHFFFAOYSA-N isoleucine Natural products CCC(C)C(N)C(O)=O AGPKZVBTJJNPAG-UHFFFAOYSA-N 0.000 description 1
125000000741 isoleucyl group Chemical group [H]N([H])C(C(C([H])([H])[H])C([H])([H])C([H])([H])[H])C(=O)O* 0.000 description 1
NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
150000002596 lactones Chemical class 0.000 description 1
229960001375 lactose Drugs 0.000 description 1
239000008101 lactose Substances 0.000 description 1
229940060975 lantus Drugs 0.000 description 1
210000000867 larynx Anatomy 0.000 description 1
239000007788 liquid Substances 0.000 description 1
239000012669 liquid formulation Substances 0.000 description 1
230000001926 lymphatic effect Effects 0.000 description 1
239000006166 lysate Substances 0.000 description 1
125000003588 lysine group Chemical group [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
102220514679 mRNA cap guanine-N7 methyltransferase_K39R_mutation Human genes 0.000 description 1
102220514666 mRNA cap guanine-N7 methyltransferase_N36D_mutation Human genes 0.000 description 1
210000002540 macrophage Anatomy 0.000 description 1
239000000594 mannitol Substances 0.000 description 1
235000010355 mannitol Nutrition 0.000 description 1
150000002739 metals Chemical class 0.000 description 1
125000001360 methionine group Chemical group N[C@@H](CCSC)C(=O)* 0.000 description 1
CWWARWOPSKGELM-SARDKLJWSA-N methyl (2s)-2-[[(2s)-2-[[2-[[(2s)-2-[[(2s)-2-[[(2s)-5-amino-2-[[(2s)-5-amino-2-[[(2s)-1-[(2s)-6-amino-2-[[(2s)-1-[(2s)-2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-5 Chemical compound C([C@@H](C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)OC)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](N)CCCN=C(N)N)C1=CC=CC=C1 CWWARWOPSKGELM-SARDKLJWSA-N 0.000 description 1
229940016286 microcrystalline cellulose Drugs 0.000 description 1
235000019813 microcrystalline cellulose Nutrition 0.000 description 1
239000008108 microcrystalline cellulose Substances 0.000 description 1
239000004005 microsphere Substances 0.000 description 1
230000003278 mimic effect Effects 0.000 description 1
SLZIZIJTGAYEKK-CIJSCKBQSA-N molport-023-220-247 Chemical compound C([C@@H](C(=O)N[C@@H](C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=1N=CNC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1N=CNC=1)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(N)=O)NC(=O)[C@H]1N(CCC1)C(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)CN)[C@@H](C)O)C1=CNC=N1 SLZIZIJTGAYEKK-CIJSCKBQSA-N 0.000 description 1
230000000921 morphogenic effect Effects 0.000 description 1
210000004877 mucosa Anatomy 0.000 description 1
YOHYSYJDKVYCJI-UHFFFAOYSA-N n-[3-[[6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide Chemical compound FC(F)(F)C1=CC=CC(NC=2N=CN=C(NC=3C=C(NC(=O)C4CC4)C=CC=3)C=2)=C1 YOHYSYJDKVYCJI-UHFFFAOYSA-N 0.000 description 1
230000001537 neural effect Effects 0.000 description 1
PCJGZPGTCUMMOT-ISULXFBGSA-N neurotensin Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]1NC(=O)CC1)C1=CC=C(O)C=C1 PCJGZPGTCUMMOT-ISULXFBGSA-N 0.000 description 1
210000001331 nose Anatomy 0.000 description 1
229940098893 novolin r Drugs 0.000 description 1
URPYMXQQVHTUDU-OFGSCBOVSA-N nucleopeptide y Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(N)=O)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](N)CC=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 URPYMXQQVHTUDU-OFGSCBOVSA-N 0.000 description 1
230000000269 nucleophilic effect Effects 0.000 description 1
235000020824 obesity Nutrition 0.000 description 1
239000007935 oral tablet Substances 0.000 description 1
229940096978 oral tablet Drugs 0.000 description 1
239000002357 osmotic agent Substances 0.000 description 1
XNOPRXBHLZRZKH-DSZYJQQASA-N oxytocin Chemical compound C([C@H]1C(=O)N[C@H](C(N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CSSC[C@H](N)C(=O)N1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O)=O)[C@@H](C)CC)C1=CC=C(O)C=C1 XNOPRXBHLZRZKH-DSZYJQQASA-N 0.000 description 1
229960001723 oxytocin Drugs 0.000 description 1
238000004806 packaging method and process Methods 0.000 description 1
238000012856 packing Methods 0.000 description 1
210000000496 pancreas Anatomy 0.000 description 1
239000004177 patent blue V Substances 0.000 description 1
235000010987 pectin Nutrition 0.000 description 1
229920001277 pectin Polymers 0.000 description 1
239000001814 pectin Substances 0.000 description 1
239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
230000035699 permeability Effects 0.000 description 1
COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 1
230000004962 physiological condition Effects 0.000 description 1
229920000573 polyethylene Polymers 0.000 description 1
229920005606 polypropylene copolymer Polymers 0.000 description 1
229920002744 polyvinyl acetate phthalate Polymers 0.000 description 1
235000013809 polyvinylpolypyrrolidone Nutrition 0.000 description 1
229920000523 polyvinylpolypyrrolidone Polymers 0.000 description 1
230000004481 post-translational protein modification Effects 0.000 description 1
108010066381 preproinsulin Proteins 0.000 description 1
108010090955 preprorelaxin Proteins 0.000 description 1
239000013615 primer Substances 0.000 description 1
238000012545 processing Methods 0.000 description 1
229940097325 prolactin Drugs 0.000 description 1
230000002062 proliferating effect Effects 0.000 description 1
230000035755 proliferation Effects 0.000 description 1
229940048914 protamine Drugs 0.000 description 1
125000006239 protecting group Chemical group 0.000 description 1
XNSAINXGIQZQOO-SRVKXCTJSA-N protirelin Chemical compound NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@H]1NC(=O)CC1)CC1=CN=CN1 XNSAINXGIQZQOO-SRVKXCTJSA-N 0.000 description 1
238000000746 purification Methods 0.000 description 1
238000011552 rat model Methods 0.000 description 1
230000035484 reaction time Effects 0.000 description 1
230000009257 reactivity Effects 0.000 description 1
229940044551 receptor antagonist Drugs 0.000 description 1
239000002464 receptor antagonist Substances 0.000 description 1
210000000664 rectum Anatomy 0.000 description 1
201000002793 renal fibrosis Diseases 0.000 description 1
201000006409 renal osteodystrophy Diseases 0.000 description 1
208000023504 respiratory system disease Diseases 0.000 description 1
230000000717 retained effect Effects 0.000 description 1
102200012170 rs10084168 Human genes 0.000 description 1
102220319049 rs1032793565 Human genes 0.000 description 1
102220277176 rs1039603215 Human genes 0.000 description 1
102220115734 rs1040079072 Human genes 0.000 description 1
102220297983 rs1042393529 Human genes 0.000 description 1
102220226904 rs1045644394 Human genes 0.000 description 1
102200096294 rs104894483 Human genes 0.000 description 1
102200110327 rs104894510 Human genes 0.000 description 1
102220032360 rs104895237 Human genes 0.000 description 1
102220195737 rs1057518115 Human genes 0.000 description 1
102220198346 rs1057519988 Human genes 0.000 description 1
102220220120 rs1060500786 Human genes 0.000 description 1
102220220424 rs1060500863 Human genes 0.000 description 1
102220214681 rs1060502012 Human genes 0.000 description 1
102220214669 rs1060502015 Human genes 0.000 description 1
102220212659 rs1060502216 Human genes 0.000 description 1
102220220587 rs1060503085 Human genes 0.000 description 1
102220220520 rs1060503090 Human genes 0.000 description 1
102220278705 rs1060504843 Human genes 0.000 description 1
102220228198 rs1064793030 Human genes 0.000 description 1
102220226382 rs1064794788 Human genes 0.000 description 1
102220228882 rs1064797006 Human genes 0.000 description 1
102220233125 rs1085307708 Human genes 0.000 description 1
102220005359 rs111033605 Human genes 0.000 description 1
102200012531 rs111033829 Human genes 0.000 description 1
102220333986 rs112355069 Human genes 0.000 description 1
102200048183 rs113560320 Human genes 0.000 description 1
102220099739 rs113612866 Human genes 0.000 description 1
102220215123 rs113612866 Human genes 0.000 description 1
102200006183 rs11552822 Human genes 0.000 description 1
102220017575 rs118203363 Human genes 0.000 description 1
102200089609 rs119103277 Human genes 0.000 description 1
102200009843 rs121434498 Human genes 0.000 description 1
102200122316 rs121434582 Human genes 0.000 description 1
102200072407 rs121917982 Human genes 0.000 description 1
102200115311 rs121918100 Human genes 0.000 description 1
102220004397 rs121964856 Human genes 0.000 description 1
102200074332 rs122457137 Human genes 0.000 description 1
102220281558 rs1229828972 Human genes 0.000 description 1
102220310972 rs1234894476 Human genes 0.000 description 1
102220253319 rs1307934269 Human genes 0.000 description 1
102200108547 rs1327414828 Human genes 0.000 description 1
102220327923 rs1331918329 Human genes 0.000 description 1
102220273799 rs1357844466 Human genes 0.000 description 1
102200081903 rs137854519 Human genes 0.000 description 1
102220010983 rs138272051 Human genes 0.000 description 1
102220278863 rs1395998044 Human genes 0.000 description 1
102220006185 rs140814100 Human genes 0.000 description 1
102220267876 rs1408600144 Human genes 0.000 description 1
102220142406 rs141137691 Human genes 0.000 description 1
102220332590 rs1417905777 Human genes 0.000 description 1
102220040616 rs142923780 Human genes 0.000 description 1
102220274413 rs143950084 Human genes 0.000 description 1
102220011819 rs143985153 Human genes 0.000 description 1
102220257894 rs143985153 Human genes 0.000 description 1
102200001736 rs144020613 Human genes 0.000 description 1
102220285813 rs1442559963 Human genes 0.000 description 1
102220277057 rs1445690889 Human genes 0.000 description 1
102200016463 rs1449216377 Human genes 0.000 description 1
102200025123 rs145047094 Human genes 0.000 description 1
102220066049 rs146636139 Human genes 0.000 description 1
102220259596 rs146705057 Human genes 0.000 description 1
102220249873 rs147342421 Human genes 0.000 description 1
102220076035 rs147623032 Human genes 0.000 description 1
102220330967 rs148038936 Human genes 0.000 description 1
102200059271 rs150244667 Human genes 0.000 description 1
102220256970 rs1553348786 Human genes 0.000 description 1
102200089608 rs1553619431 Human genes 0.000 description 1
102220258451 rs1553659648 Human genes 0.000 description 1
102220334449 rs1554010636 Human genes 0.000 description 1
102220344288 rs1554032090 Human genes 0.000 description 1
102220279013 rs1554568371 Human genes 0.000 description 1
102220286736 rs1554656491 Human genes 0.000 description 1
102220278959 rs1554659193 Human genes 0.000 description 1
102220265863 rs1554897255 Human genes 0.000 description 1
102220298213 rs1555123639 Human genes 0.000 description 1
102220242995 rs1555187010 Human genes 0.000 description 1
102220340187 rs1555191626 Human genes 0.000 description 1
102220268351 rs1555201383 Human genes 0.000 description 1
102220272986 rs1555526589 Human genes 0.000 description 1
102220271531 rs1555570486 Human genes 0.000 description 1
102200123127 rs1555621454 Human genes 0.000 description 1
102200145684 rs16999593 Human genes 0.000 description 1
102200009109 rs17025864 Human genes 0.000 description 1
102220020898 rs1800062 Human genes 0.000 description 1
102200072914 rs1801265 Human genes 0.000 description 1
102220064394 rs180943300 Human genes 0.000 description 1
102220008795 rs193922245 Human genes 0.000 description 1
102200084990 rs199422124 Human genes 0.000 description 1
102220039277 rs199473352 Human genes 0.000 description 1
102220034819 rs199475678 Human genes 0.000 description 1
102200160521 rs199476301 Human genes 0.000 description 1
102220008317 rs199476305 Human genes 0.000 description 1
102220008319 rs199476307 Human genes 0.000 description 1
102220260185 rs202005786 Human genes 0.000 description 1
102220058215 rs202168814 Human genes 0.000 description 1
102200151659 rs2276118 Human genes 0.000 description 1
102220025547 rs267602038 Human genes 0.000 description 1
102220011344 rs267606539 Human genes 0.000 description 1
102200115309 rs267607160 Human genes 0.000 description 1
102220005504 rs281860657 Human genes 0.000 description 1
102200068706 rs281865212 Human genes 0.000 description 1
102200068610 rs281865225 Human genes 0.000 description 1
102200109609 rs281875332 Human genes 0.000 description 1
102220005544 rs28928886 Human genes 0.000 description 1
102200058972 rs28940576 Human genes 0.000 description 1
102200052312 rs3218773 Human genes 0.000 description 1
102220005321 rs33918131 Human genes 0.000 description 1
102220005397 rs33926206 Human genes 0.000 description 1
102220004762 rs33932070 Human genes 0.000 description 1
102220005489 rs33935328 Human genes 0.000 description 1
102200082921 rs33948615 Human genes 0.000 description 1
102220005289 rs33948615 Human genes 0.000 description 1
102200117913 rs33949869 Human genes 0.000 description 1
102220005255 rs33956555 Human genes 0.000 description 1
102200082883 rs33959855 Human genes 0.000 description 1
102200082884 rs33959855 Human genes 0.000 description 1
102220005319 rs33970699 Human genes 0.000 description 1
102220005408 rs33984024 Human genes 0.000 description 1
102220005394 rs33984621 Human genes 0.000 description 1
102200067545 rs33985574 Human genes 0.000 description 1
102220005180 rs33987903 Human genes 0.000 description 1
102200118171 rs33991993 Human genes 0.000 description 1
102220005309 rs33995148 Human genes 0.000 description 1
102220026210 rs34014629 Human genes 0.000 description 1
102220257194 rs34014629 Human genes 0.000 description 1
102220005546 rs34273731 Human genes 0.000 description 1
102220005134 rs35020585 Human genes 0.000 description 1
102220005464 rs35203445 Human genes 0.000 description 1
102200069457 rs35211634 Human genes 0.000 description 1
102200118285 rs35353749 Human genes 0.000 description 1
102200117967 rs35461710 Human genes 0.000 description 1
102220005495 rs35511459 Human genes 0.000 description 1
102220005455 rs35548338 Human genes 0.000 description 1
102200118286 rs35747961 Human genes 0.000 description 1
102200118234 rs36038739 Human genes 0.000 description 1
102220057740 rs368161489 Human genes 0.000 description 1
102200127073 rs368178632 Human genes 0.000 description 1
102200107859 rs368771578 Human genes 0.000 description 1
102220064451 rs368865412 Human genes 0.000 description 1
102220061390 rs369115472 Human genes 0.000 description 1
102220068312 rs369340251 Human genes 0.000 description 1
102220273513 rs373435521 Human genes 0.000 description 1
102220044712 rs373563053 Human genes 0.000 description 1
102200101164 rs373730800 Human genes 0.000 description 1
102220249330 rs373866304 Human genes 0.000 description 1
102200083483 rs387906832 Human genes 0.000 description 1
102220056961 rs397507512 Human genes 0.000 description 1
102200106071 rs397514495 Human genes 0.000 description 1
102220012908 rs397516360 Human genes 0.000 description 1
102220012912 rs397516363 Human genes 0.000 description 1
102220072210 rs397516702 Human genes 0.000 description 1
102220028268 rs398122745 Human genes 0.000 description 1
102220028740 rs398123204 Human genes 0.000 description 1
102220030655 rs398124202 Human genes 0.000 description 1
102220101632 rs5030135 Human genes 0.000 description 1
102200160797 rs5126 Human genes 0.000 description 1
102200044873 rs515726182 Human genes 0.000 description 1
102220227599 rs530501230 Human genes 0.000 description 1
102220220128 rs534552358 Human genes 0.000 description 1
102220210660 rs539992721 Human genes 0.000 description 1
102220171407 rs540737897 Human genes 0.000 description 1
102220322583 rs541461094 Human genes 0.000 description 1
102220281620 rs551111938 Human genes 0.000 description 1
102220018768 rs56091799 Human genes 0.000 description 1
102200131342 rs56694480 Human genes 0.000 description 1
102200091337 rs587777474 Human genes 0.000 description 1
102200153198 rs587777877 Human genes 0.000 description 1
102220039997 rs587778128 Human genes 0.000 description 1
102220040093 rs587778173 Human genes 0.000 description 1
102220277390 rs587779008 Human genes 0.000 description 1
102200057511 rs587779858 Human genes 0.000 description 1
102220036840 rs587780081 Human genes 0.000 description 1
102220044570 rs587781404 Human genes 0.000 description 1
102220277855 rs587781587 Human genes 0.000 description 1
102220046103 rs587782647 Human genes 0.000 description 1
102220049431 rs587784257 Human genes 0.000 description 1
102220016967 rs59040894 Human genes 0.000 description 1
102200076473 rs60095124 Human genes 0.000 description 1
102200032302 rs61736602 Human genes 0.000 description 1
102200028554 rs61754421 Human genes 0.000 description 1
102220078297 rs62000429 Human genes 0.000 description 1
102200027869 rs62517167 Human genes 0.000 description 1
102220005436 rs63749865 Human genes 0.000 description 1
102220005465 rs63749882 Human genes 0.000 description 1
102220104423 rs63749907 Human genes 0.000 description 1
102220093310 rs63750877 Human genes 0.000 description 1
102220094406 rs63751012 Human genes 0.000 description 1
102220011660 rs63751099 Human genes 0.000 description 1
102220277422 rs63751421 Human genes 0.000 description 1
102220032023 rs72554321 Human genes 0.000 description 1
102220054157 rs727504399 Human genes 0.000 description 1
102200021380 rs727504457 Human genes 0.000 description 1
102220112195 rs72807847 Human genes 0.000 description 1
102220011153 rs730880520 Human genes 0.000 description 1
102220011103 rs730881052 Human genes 0.000 description 1
102220057739 rs730881361 Human genes 0.000 description 1
102220282098 rs730881899 Human genes 0.000 description 1
102220058094 rs730881901 Human genes 0.000 description 1
102220057652 rs730881912 Human genes 0.000 description 1
102220320586 rs730881919 Human genes 0.000 description 1
102220086629 rs747315554 Human genes 0.000 description 1
102220081889 rs747956412 Human genes 0.000 description 1
102220086084 rs748196422 Human genes 0.000 description 1
102220097956 rs750596499 Human genes 0.000 description 1
102220143003 rs753997345 Human genes 0.000 description 1
102220296914 rs755805016 Human genes 0.000 description 1
102220291981 rs759100946 Human genes 0.000 description 1
102220279563 rs760471526 Human genes 0.000 description 1
102220291728 rs760920706 Human genes 0.000 description 1
102220062687 rs762382111 Human genes 0.000 description 1
102220218177 rs765321737 Human genes 0.000 description 1
102220086575 rs766203500 Human genes 0.000 description 1
102220232854 rs766277488 Human genes 0.000 description 1
102220316016 rs766411601 Human genes 0.000 description 1
102220277405 rs766608278 Human genes 0.000 description 1
102220064392 rs767384862 Human genes 0.000 description 1
102220014895 rs76757102 Human genes 0.000 description 1
102220224021 rs768328175 Human genes 0.000 description 1
102220221056 rs768859258 Human genes 0.000 description 1
102220321225 rs769070078 Human genes 0.000 description 1
102220229301 rs769666619 Human genes 0.000 description 1
102220321265 rs771110626 Human genes 0.000 description 1
102220075276 rs771805307 Human genes 0.000 description 1
102220298053 rs772216708 Human genes 0.000 description 1
102220060032 rs772591447 Human genes 0.000 description 1
102220272594 rs773065220 Human genes 0.000 description 1
102220285447 rs774229223 Human genes 0.000 description 1
102220162336 rs776815006 Human genes 0.000 description 1
102220094399 rs777971423 Human genes 0.000 description 1
102220062685 rs778201041 Human genes 0.000 description 1
102220273022 rs780581573 Human genes 0.000 description 1
102220093873 rs781163298 Human genes 0.000 description 1
102220233277 rs781433220 Human genes 0.000 description 1
102220218940 rs781647403 Human genes 0.000 description 1
102220340212 rs781846380 Human genes 0.000 description 1
102220059963 rs786201995 Human genes 0.000 description 1
102220062005 rs786202890 Human genes 0.000 description 1
102200102922 rs786203436 Human genes 0.000 description 1
102220000564 rs78778622 Human genes 0.000 description 1
102220022307 rs80357066 Human genes 0.000 description 1
102220021416 rs80357110 Human genes 0.000 description 1
102220272673 rs80357110 Human genes 0.000 description 1
102220018673 rs80358415 Human genes 0.000 description 1
102220035647 rs80358480 Human genes 0.000 description 1
102220085093 rs863225320 Human genes 0.000 description 1
102220219491 rs868819340 Human genes 0.000 description 1
102220091351 rs876657955 Human genes 0.000 description 1
102220097521 rs876658197 Human genes 0.000 description 1
102220094394 rs876659041 Human genes 0.000 description 1
102220095350 rs876659324 Human genes 0.000 description 1
102220094029 rs876659387 Human genes 0.000 description 1
102220388190 rs876661244 Human genes 0.000 description 1
102220105332 rs879254444 Human genes 0.000 description 1
102220106374 rs879255290 Human genes 0.000 description 1
102220114657 rs886038944 Human genes 0.000 description 1
102220120076 rs886042491 Human genes 0.000 description 1
102220128961 rs886045219 Human genes 0.000 description 1
102220137564 rs886055455 Human genes 0.000 description 1
102220138004 rs886055626 Human genes 0.000 description 1
102220157938 rs886063483 Human genes 0.000 description 1
210000003296 saliva Anatomy 0.000 description 1
239000000523 sample Substances 0.000 description 1
238000005070 sampling Methods 0.000 description 1
229960002101 secretin Drugs 0.000 description 1
OWMZNFCDEHGFEP-NFBCVYDUSA-N secretin human Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(O)=O)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(N)=O)[C@@H](C)O)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC=1NC=NC=1)[C@@H](C)O)C1=CC=CC=C1 OWMZNFCDEHGFEP-NFBCVYDUSA-N 0.000 description 1
125000003607 serino group Chemical group [H]N([H])[C@]([H])(C(=O)[*])C(O[H])([H])[H] 0.000 description 1
210000001599 sigmoid colon Anatomy 0.000 description 1
230000011664 signaling Effects 0.000 description 1
230000007781 signaling event Effects 0.000 description 1
239000000377 silicon dioxide Substances 0.000 description 1
IZTQOLKUZKXIRV-YRVFCXMDSA-N sincalide Chemical compound C([C@@H](C(=O)N[C@@H](CCSC)C(=O)NCC(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](N)CC(O)=O)C1=CC=C(OS(O)(=O)=O)C=C1 IZTQOLKUZKXIRV-YRVFCXMDSA-N 0.000 description 1
230000007958 sleep Effects 0.000 description 1
239000011734 sodium Substances 0.000 description 1
229910052708 sodium Inorganic materials 0.000 description 1
235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
159000000000 sodium salts Chemical class 0.000 description 1
235000013875 sodium salts of fatty acid Nutrition 0.000 description 1
239000008109 sodium starch glycolate Substances 0.000 description 1
229940079832 sodium starch glycolate Drugs 0.000 description 1
229920003109 sodium starch glycolate Polymers 0.000 description 1
229940045902 sodium stearyl fumarate Drugs 0.000 description 1
NHXLMOGPVYXJNR-ATOGVRKGSA-N somatostatin Chemical compound C([C@H]1C(=O)N[C@H](C(N[C@@H](CO)C(=O)N[C@@H](CSSC[C@@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CC=2C3=CC=CC=C3NC=2)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N1)[C@@H](C)O)NC(=O)CNC(=O)[C@H](C)N)C(O)=O)=O)[C@H](O)C)C1=CC=CC=C1 NHXLMOGPVYXJNR-ATOGVRKGSA-N 0.000 description 1
229960000553 somatostatin Drugs 0.000 description 1
238000001179 sorption measurement Methods 0.000 description 1
210000005070 sphincter Anatomy 0.000 description 1
239000007921 spray Substances 0.000 description 1
238000005507 spraying Methods 0.000 description 1
230000006641 stabilisation Effects 0.000 description 1
238000011105 stabilization Methods 0.000 description 1
238000011272 standard treatment Methods 0.000 description 1
230000003068 static effect Effects 0.000 description 1
238000003860 storage Methods 0.000 description 1
239000005720 sucrose Substances 0.000 description 1
235000000346 sugar Nutrition 0.000 description 1
239000000375 suspending agent Substances 0.000 description 1
239000000725 suspension Substances 0.000 description 1
230000009747 swallowing Effects 0.000 description 1
239000003765 sweetening agent Substances 0.000 description 1
230000002522 swelling effect Effects 0.000 description 1
239000007916 tablet composition Substances 0.000 description 1
238000012956 testing procedure Methods 0.000 description 1
ZRKFYGHZFMAOKI-QMGMOQQFSA-N tgfbeta Chemical compound C([C@H](NC(=O)[C@H](C(C)C)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CCSC)C(C)C)[C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(O)=O)C1=CC=C(O)C=C1 ZRKFYGHZFMAOKI-QMGMOQQFSA-N 0.000 description 1
229960000103 thrombolytic agent Drugs 0.000 description 1
229960000874 thyrotropin Drugs 0.000 description 1
230000001748 thyrotropin Effects 0.000 description 1
229940034199 thyrotropin-releasing hormone Drugs 0.000 description 1
210000001578 tight junction Anatomy 0.000 description 1
230000036962 time dependent Effects 0.000 description 1
230000014616 translation Effects 0.000 description 1
210000003384 transverse colon Anatomy 0.000 description 1
WEAPVABOECTMGR-UHFFFAOYSA-N triethyl 2-acetyloxypropane-1,2,3-tricarboxylate Chemical compound CCOC(=O)CC(C(=O)OCC)(OC(C)=O)CC(=O)OCC WEAPVABOECTMGR-UHFFFAOYSA-N 0.000 description 1
OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
238000011144 upstream manufacturing Methods 0.000 description 1
VBEQCZHXXJYVRD-GACYYNSASA-N uroanthelone Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CS)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)C(C)C)[C@@H](C)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCSC)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CS)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CS)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC(N)=O)C(C)C)[C@@H](C)CC)C1=CC=C(O)C=C1 VBEQCZHXXJYVRD-GACYYNSASA-N 0.000 description 1
229960003726 vasopressin Drugs 0.000 description 1
239000003981 vehicle Substances 0.000 description 1
238000001262 western blot Methods 0.000 description 1
239000000080 wetting agent Substances 0.000 description 1
235000010493 xanthan gum Nutrition 0.000 description 1
239000000230 xanthan gum Substances 0.000 description 1
229940082509 xanthan gum Drugs 0.000 description 1