CA2074292A1 - Non-toxic polymeric compositions stabilized with organosulfide antioxidants - Google Patents
Non-toxic polymeric compositions stabilized with organosulfide antioxidantsInfo
- Publication number
- CA2074292A1 CA2074292A1 CA002074292A CA2074292A CA2074292A1 CA 2074292 A1 CA2074292 A1 CA 2074292A1 CA 002074292 A CA002074292 A CA 002074292A CA 2074292 A CA2074292 A CA 2074292A CA 2074292 A1 CA2074292 A1 CA 2074292A1
- Authority
- CA
- Canada
- Prior art keywords
- carbons
- group
- alkyl group
- organosulfide
- composition according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000003963 antioxidant agent Substances 0.000 title claims abstract description 62
- 239000000203 mixture Substances 0.000 title claims abstract description 56
- 231100000252 nontoxic Toxicity 0.000 title claims abstract description 34
- 230000003000 nontoxic effect Effects 0.000 title claims abstract description 34
- 235000013305 food Nutrition 0.000 claims abstract description 43
- 230000003078 antioxidant effect Effects 0.000 claims abstract description 40
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical group SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims abstract description 23
- 235000013361 beverage Nutrition 0.000 claims abstract description 11
- 238000004806 packaging method and process Methods 0.000 claims abstract description 9
- 239000003814 drug Substances 0.000 claims abstract description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 61
- -1 polypropylene, ethylene-propylene copolymers Polymers 0.000 claims description 42
- 125000000217 alkyl group Chemical group 0.000 claims description 39
- 238000000034 method Methods 0.000 claims description 32
- 229910052799 carbon Inorganic materials 0.000 claims description 25
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims description 24
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 19
- 229920001155 polypropylene Polymers 0.000 claims description 19
- 239000004743 Polypropylene Substances 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 18
- 239000002904 solvent Substances 0.000 claims description 16
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 15
- 235000006486 human diet Nutrition 0.000 claims description 15
- 239000002952 polymeric resin Substances 0.000 claims description 11
- 229920003002 synthetic resin Polymers 0.000 claims description 11
- 125000001931 aliphatic group Chemical group 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 229920005989 resin Polymers 0.000 claims description 10
- 239000011347 resin Substances 0.000 claims description 10
- 239000000243 solution Substances 0.000 claims description 10
- 229910052717 sulfur Inorganic materials 0.000 claims description 10
- 125000002723 alicyclic group Chemical group 0.000 claims description 9
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 8
- 125000005842 heteroatom Chemical group 0.000 claims description 8
- 229920001684 low density polyethylene Polymers 0.000 claims description 8
- 239000004702 low-density polyethylene Substances 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 229920000573 polyethylene Polymers 0.000 claims description 8
- 239000004698 Polyethylene Substances 0.000 claims description 7
- 230000001590 oxidative effect Effects 0.000 claims description 7
- 229920005672 polyolefin resin Polymers 0.000 claims description 7
- 150000001721 carbon Chemical group 0.000 claims description 6
- 229920001903 high density polyethylene Polymers 0.000 claims description 6
- 239000004700 high-density polyethylene Substances 0.000 claims description 6
- 229920001187 thermosetting polymer Polymers 0.000 claims description 6
- 241000700159 Rattus Species 0.000 claims description 5
- 125000002619 bicyclic group Chemical group 0.000 claims description 5
- 125000002950 monocyclic group Chemical group 0.000 claims description 5
- 229920000098 polyolefin Polymers 0.000 claims description 5
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 claims description 4
- 239000004793 Polystyrene Substances 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 229920000092 linear low density polyethylene Polymers 0.000 claims description 4
- 239000004707 linear low-density polyethylene Substances 0.000 claims description 4
- 229920000515 polycarbonate Polymers 0.000 claims description 4
- 239000004417 polycarbonate Substances 0.000 claims description 4
- 229920002223 polystyrene Polymers 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 229920001169 thermoplastic Polymers 0.000 claims description 4
- 239000004416 thermosoftening plastic Substances 0.000 claims description 4
- 239000012965 benzophenone Substances 0.000 claims description 3
- 210000004369 blood Anatomy 0.000 claims description 3
- 239000008280 blood Substances 0.000 claims description 3
- 229920002678 cellulose Polymers 0.000 claims description 3
- 238000000576 coating method Methods 0.000 claims description 3
- 229920001519 homopolymer Polymers 0.000 claims description 3
- 238000012856 packing Methods 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 2
- 239000000835 fiber Substances 0.000 claims description 2
- 238000003860 storage Methods 0.000 claims description 2
- 239000004611 light stabiliser Substances 0.000 claims 6
- 239000003017 thermal stabilizer Substances 0.000 claims 6
- 125000003354 benzotriazolyl group Chemical class N1N=NC2=C1C=CC=C2* 0.000 claims 3
- 150000002989 phenols Chemical class 0.000 claims 3
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 claims 3
- 150000008366 benzophenones Chemical class 0.000 claims 2
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 claims 2
- 229920000728 polyester Polymers 0.000 claims 2
- 229920006132 styrene block copolymer Polymers 0.000 claims 2
- 230000015556 catabolic process Effects 0.000 claims 1
- 238000006731 degradation reaction Methods 0.000 claims 1
- 239000000825 pharmaceutical preparation Substances 0.000 claims 1
- 229940127557 pharmaceutical product Drugs 0.000 claims 1
- 238000010525 oxidative degradation reaction Methods 0.000 abstract description 4
- 239000000047 product Substances 0.000 description 42
- 229920000642 polymer Polymers 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 238000000605 extraction Methods 0.000 description 16
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 16
- 150000002500 ions Chemical class 0.000 description 15
- WCVOGSZTONGSQY-UHFFFAOYSA-N 2,4,6-trichloroanisole Chemical compound COC1=C(Cl)C=C(Cl)C=C1Cl WCVOGSZTONGSQY-UHFFFAOYSA-N 0.000 description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 231100000419 toxicity Toxicity 0.000 description 11
- 230000001988 toxicity Effects 0.000 description 11
- 238000007792 addition Methods 0.000 description 10
- 235000019645 odor Nutrition 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 9
- 238000002360 preparation method Methods 0.000 description 9
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 8
- 150000002978 peroxides Chemical class 0.000 description 8
- 239000000654 additive Substances 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 238000013508 migration Methods 0.000 description 7
- 230000005012 migration Effects 0.000 description 7
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 6
- 239000005977 Ethylene Substances 0.000 description 6
- 230000000996 additive effect Effects 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 125000000962 organic group Chemical group 0.000 description 6
- 230000001476 alcoholic effect Effects 0.000 description 5
- 239000008188 pellet Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 4
- 230000001154 acute effect Effects 0.000 description 4
- 230000007059 acute toxicity Effects 0.000 description 4
- 231100000403 acute toxicity Toxicity 0.000 description 4
- 229920001400 block copolymer Polymers 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 235000021149 fatty food Nutrition 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 4
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 4
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- QXAITBQSYVNQDR-UHFFFAOYSA-N amitraz Chemical compound C=1C=C(C)C=C(C)C=1N=CN(C)C=NC1=CC=C(C)C=C1C QXAITBQSYVNQDR-UHFFFAOYSA-N 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 230000007665 chronic toxicity Effects 0.000 description 3
- 231100000160 chronic toxicity Toxicity 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 238000012937 correction Methods 0.000 description 3
- PWWSSIYVTQUJQQ-UHFFFAOYSA-N distearyl thiodipropionate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCSCCC(=O)OCCCCCCCCCCCCCCCCCC PWWSSIYVTQUJQQ-UHFFFAOYSA-N 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229920005669 high impact polystyrene Polymers 0.000 description 3
- 239000004797 high-impact polystyrene Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 239000011115 styrene butadiene Substances 0.000 description 3
- 150000003568 thioethers Chemical class 0.000 description 3
- 125000003396 thiol group Chemical class [H]S* 0.000 description 3
- 229940084778 1,4-sorbitan Drugs 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- ODJQKYXPKWQWNK-UHFFFAOYSA-L 3-(2-carboxylatoethylsulfanyl)propanoate Chemical compound [O-]C(=O)CCSCCC([O-])=O ODJQKYXPKWQWNK-UHFFFAOYSA-L 0.000 description 2
- ATVJXMYDOSMEPO-UHFFFAOYSA-N 3-prop-2-enoxyprop-1-ene Chemical compound C=CCOCC=C ATVJXMYDOSMEPO-UHFFFAOYSA-N 0.000 description 2
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- AIKKULXCBHRFOS-UHFFFAOYSA-N Formothion Chemical compound COP(=S)(OC)SCC(=O)N(C)C=O AIKKULXCBHRFOS-UHFFFAOYSA-N 0.000 description 2
- 101000852483 Homo sapiens Interleukin-1 receptor-associated kinase 1 Proteins 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 102100036342 Interleukin-1 receptor-associated kinase 1 Human genes 0.000 description 2
- 101100536883 Legionella pneumophila subsp. pneumophila (strain Philadelphia 1 / ATCC 33152 / DSM 7513) thi5 gene Proteins 0.000 description 2
- DBTDEFJAFBUGPP-UHFFFAOYSA-N Methanethial Chemical compound S=C DBTDEFJAFBUGPP-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 101100240664 Schizosaccharomyces pombe (strain 972 / ATCC 24843) nmt1 gene Proteins 0.000 description 2
- 239000002174 Styrene-butadiene Substances 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000005003 food packaging material Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 231100000518 lethal Toxicity 0.000 description 2
- 230000001665 lethal effect Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- CCCMONHAUSKTEQ-UHFFFAOYSA-N octadec-1-ene Chemical compound CCCCCCCCCCCCCCCCC=C CCCMONHAUSKTEQ-UHFFFAOYSA-N 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229920003048 styrene butadiene rubber Polymers 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical compound [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229920001897 terpolymer Polymers 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 229920006305 unsaturated polyester Polymers 0.000 description 2
- MCHWWJLLPNDHGL-UNTFVMJOSA-N (2s,3s,4s,5s)-2,5-bis(hydroxymethyl)oxolane-3,4-diol Chemical compound OC[C@@H]1O[C@@H](CO)[C@@H](O)[C@@H]1O MCHWWJLLPNDHGL-UNTFVMJOSA-N 0.000 description 1
- TYMYJUHDFROXOO-UHFFFAOYSA-N 1,3-bis(prop-2-enoxy)-2,2-bis(prop-2-enoxymethyl)propane Chemical compound C=CCOCC(COCC=C)(COCC=C)COCC=C TYMYJUHDFROXOO-UHFFFAOYSA-N 0.000 description 1
- PNSYJCQRMKBFPO-UHFFFAOYSA-N 1-[3-[3-(3-hexadecylsulfanylpropoxy)-2,2-bis(3-hexadecylsulfanylpropoxymethyl)propoxy]propylsulfanyl]hexadecane Chemical compound CCCCCCCCCCCCCCCCSCCCOCC(COCCCSCCCCCCCCCCCCCCCC)(COCCCSCCCCCCCCCCCCCCCC)COCCCSCCCCCCCCCCCCCCCC PNSYJCQRMKBFPO-UHFFFAOYSA-N 0.000 description 1
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 1
- SUNXFMPZAFGPFW-UHFFFAOYSA-N 2-methyl-5-(1-sulfanylpropan-2-yl)cyclohexane-1-thiol Chemical compound SCC(C)C1CCC(C)C(S)C1 SUNXFMPZAFGPFW-UHFFFAOYSA-N 0.000 description 1
- BWEKDYGHDCHWEN-UHFFFAOYSA-N 2-methylhex-2-ene Chemical compound CCCC=C(C)C BWEKDYGHDCHWEN-UHFFFAOYSA-N 0.000 description 1
- VOXXWSYKYCBWHO-UHFFFAOYSA-N 3-phenyllactic acid Chemical compound OC(=O)C(O)CC1=CC=CC=C1 VOXXWSYKYCBWHO-UHFFFAOYSA-N 0.000 description 1
- HFGHRUCCKVYFKL-UHFFFAOYSA-N 4-ethoxy-2-piperazin-1-yl-7-pyridin-4-yl-5h-pyrimido[5,4-b]indole Chemical compound C1=C2NC=3C(OCC)=NC(N4CCNCC4)=NC=3C2=CC=C1C1=CC=NC=C1 HFGHRUCCKVYFKL-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- BSFODEXXVBBYOC-UHFFFAOYSA-N 8-[4-(dimethylamino)butan-2-ylamino]quinolin-6-ol Chemical compound C1=CN=C2C(NC(CCN(C)C)C)=CC(O)=CC2=C1 BSFODEXXVBBYOC-UHFFFAOYSA-N 0.000 description 1
- 241000272522 Anas Species 0.000 description 1
- 101100072645 Arabidopsis thaliana IPS3 gene Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 102100025597 Caspase-4 Human genes 0.000 description 1
- FBPFZTCFMRRESA-ZXXMMSQZSA-N D-iditol Chemical compound OC[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-ZXXMMSQZSA-N 0.000 description 1
- GHKOFFNLGXMVNJ-UHFFFAOYSA-N Didodecyl thiobispropanoate Chemical compound CCCCCCCCCCCCOC(=O)CCSCCC(=O)OCCCCCCCCCCCC GHKOFFNLGXMVNJ-UHFFFAOYSA-N 0.000 description 1
- 239000003508 Dilauryl thiodipropionate Substances 0.000 description 1
- 101100536354 Drosophila melanogaster tant gene Proteins 0.000 description 1
- 241001517310 Eria Species 0.000 description 1
- 101000582396 Escherichia phage D108 Repressor c protein Proteins 0.000 description 1
- 101000582397 Escherichia phage Mu Repressor protein c Proteins 0.000 description 1
- 101100273284 Homo sapiens CASP4 gene Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 241000976924 Inca Species 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- POSKOXIJDWDKPH-UHFFFAOYSA-N Kelevan Chemical compound ClC1(Cl)C2(Cl)C3(Cl)C4(Cl)C(CC(=O)CCC(=O)OCC)(O)C5(Cl)C3(Cl)C1(Cl)C5(Cl)C42Cl POSKOXIJDWDKPH-UHFFFAOYSA-N 0.000 description 1
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 1
- 101100328463 Mus musculus Cmya5 gene Proteins 0.000 description 1
- 101100494762 Mus musculus Nedd9 gene Proteins 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 238000011887 Necropsy Methods 0.000 description 1
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 description 1
- 229930182556 Polyacetal Natural products 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 208000037062 Polyps Diseases 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 244000166490 Tetrameles nudiflora Species 0.000 description 1
- 241000011102 Thera Species 0.000 description 1
- 241000613130 Tima Species 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- PQYJRMFWJJONBO-UHFFFAOYSA-N Tris(2,3-dibromopropyl) phosphate Chemical compound BrCC(Br)COP(=O)(OCC(Br)CBr)OCC(Br)CBr PQYJRMFWJJONBO-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 229940086737 allyl sucrose Drugs 0.000 description 1
- 125000000746 allylic group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- UOCJDOLVGGIYIQ-PBFPGSCMSA-N cefatrizine Chemical group S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)[C@H](N)C=2C=CC(O)=CC=2)CC=1CSC=1C=NNN=1 UOCJDOLVGGIYIQ-PBFPGSCMSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 229920003211 cis-1,4-polyisoprene Polymers 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000002844 continuous effect Effects 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- DDTBPAQBQHZRDW-UHFFFAOYSA-N cyclododecane Chemical group C1CCCCCCCCCCC1 DDTBPAQBQHZRDW-UHFFFAOYSA-N 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- ZJIPHXXDPROMEF-UHFFFAOYSA-N dihydroxyphosphanyl dihydrogen phosphite Chemical compound OP(O)OP(O)O ZJIPHXXDPROMEF-UHFFFAOYSA-N 0.000 description 1
- 235000019304 dilauryl thiodipropionate Nutrition 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 1
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000004794 expanded polystyrene Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- ORTRWBYBJVGVQC-UHFFFAOYSA-N hexadecane-1-thiol Chemical compound CCCCCCCCCCCCCCCCS ORTRWBYBJVGVQC-UHFFFAOYSA-N 0.000 description 1
- 239000012943 hotmelt Substances 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 235000019531 indirect food additive Nutrition 0.000 description 1
- 230000000266 injurious effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 150000004972 metal peroxides Chemical class 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- QKWLEZCBHBKUDK-UHFFFAOYSA-N methaneselone Chemical compound [Se]=C QKWLEZCBHBKUDK-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- QJAOYSPHSNGHNC-UHFFFAOYSA-N octadecane-1-thiol Chemical compound CCCCCCCCCCCCCCCCCCS QJAOYSPHSNGHNC-UHFFFAOYSA-N 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229920006280 packaging film Polymers 0.000 description 1
- 239000012785 packaging film Substances 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000090 poly(aryl ether) Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920001083 polybutene Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920006254 polymer film Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- LMDKAEWBVKHXMN-QAMPPYGQSA-N rapx Chemical compound C([C@@H](C)[C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@@]2(O)[C@H](C)CC[C@H](O2)C[C@@H](C(=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)C(C)C[C@@H](C)C(=O)C1)/C)OCC)C1=CC=C(O)C(OC)=C1 LMDKAEWBVKHXMN-QAMPPYGQSA-N 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 102200005926 rs121434292 Human genes 0.000 description 1
- 150000003902 salicylic acid esters Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 231100000161 signs of toxicity Toxicity 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical class [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000002798 spectrophotometry method Methods 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 238000012453 sprague-dawley rat model Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- 238000002411 thermogravimetry Methods 0.000 description 1
- 239000004634 thermosetting polymer Substances 0.000 description 1
- 210000001835 viscera Anatomy 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/14—Peroxides
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/37—Thiols
- C08K5/372—Sulfides, e.g. R-(S)x-R'
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/735,140 US5284886A (en) | 1989-10-31 | 1991-07-24 | Non-toxic polymeric compositions stabilized with organosulfide antioxidants |
| US735,140 | 1991-07-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2074292A1 true CA2074292A1 (en) | 1993-01-25 |
Family
ID=24954540
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002074292A Abandoned CA2074292A1 (en) | 1991-07-24 | 1992-07-21 | Non-toxic polymeric compositions stabilized with organosulfide antioxidants |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US5284886A (enExample) |
| EP (1) | EP0525664A1 (enExample) |
| JP (1) | JPH05194785A (enExample) |
| BR (1) | BR9202838A (enExample) |
| CA (1) | CA2074292A1 (enExample) |
| TW (1) | TW221451B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5284886A (en) * | 1989-10-31 | 1994-02-08 | Elf Atochem North America, Inc. | Non-toxic polymeric compositions stabilized with organosulfide antioxidants |
| US6812314B2 (en) | 2001-10-17 | 2004-11-02 | University Of Florida | Thermally responsive polymer materials and uses thereof |
| US8147769B1 (en) | 2007-05-16 | 2012-04-03 | Abbott Cardiovascular Systems Inc. | Stent and delivery system with reduced chemical degradation |
| FR2917381B1 (fr) * | 2007-06-15 | 2009-10-16 | Ceva Sante Animale Sa | Conditionnement plastique multicouche pour la conservation d'une composition pharmaceutique |
| US20090319031A1 (en) * | 2008-06-19 | 2009-12-24 | Yunbing Wang | Bioabsorbable Polymeric Stent With Improved Structural And Molecular Weight Integrity |
| US9539587B1 (en) * | 2016-04-05 | 2017-01-10 | Chevron Phillips Chemical Company Lp | Mercaptanized dicyclopentadiene compositions and use thereof as a mining chemical collector |
Family Cites Families (106)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA720507A (en) * | 1965-10-26 | Imperial Chemical Industries Limited | Stabilised solid olefine polymer compositions and articles shaped therefrom | |
| US2522590A (en) * | 1945-03-28 | 1950-09-19 | Shell Dev | Photochemical reaction of unsaturated ethers with aliphatic mercaptans |
| FR1042507A (fr) | 1951-10-18 | 1953-11-02 | Dow Chemical Co | Procédé perfectionné de stabilisation des polymères |
| US2809956A (en) * | 1953-10-05 | 1957-10-15 | Carlisle Chemical Works | Polymeric organo-tin mercapto compounds, method of making same, and halogen-containing resins stabilized therewith |
| US2868765A (en) * | 1955-07-06 | 1959-01-13 | Ethyl Corp | Polyvinyl chloride with alkali metal phosphate and organotin salt |
| US2995539A (en) * | 1956-03-01 | 1961-08-08 | Du Pont | Ethylene polymer composition containing alkanol sulfide polymer |
| US3063963A (en) * | 1958-10-13 | 1962-11-13 | Eastman Kodak Co | Stabilized polymers of vinylidene chloride or vinyl chloride containing a sulfur compound and a tin compound |
| US2972597A (en) * | 1958-11-13 | 1961-02-21 | Eastman Kodak Co | Stabilized poly-alpha-olefin compositions |
| US3010937A (en) * | 1958-12-19 | 1961-11-28 | Bayer Ag | Process for stabilizing polymers of monoolefins |
| DE1265409B (de) * | 1959-06-10 | 1968-04-04 | Hoechst Ag | Verfahren zum Stabilisieren von Polyolefinen |
| NL255155A (enExample) * | 1959-08-28 | |||
| US3067166A (en) * | 1959-09-17 | 1962-12-04 | Ferro Corp | Stabilized halogen containing vinyl resins |
| NL252487A (enExample) * | 1960-06-10 | |||
| BE613012A (enExample) * | 1961-01-26 | |||
| NL276273A (enExample) * | 1961-04-04 | |||
| GB1002431A (en) * | 1961-05-30 | 1965-08-25 | Ici Ltd | Solid olefine polymer compositions |
| BE621580A (enExample) | 1961-08-22 | |||
| GB1001344A (en) | 1962-02-13 | 1965-08-18 | Bx Plastics Ltd | Improvements in and relating to halogen-containing polymer compositions |
| US3248403A (en) | 1962-03-27 | 1966-04-26 | Du Pont | Alpha, omega-bifunctional polythiomethylene compounds |
| US3258493A (en) * | 1962-09-11 | 1966-06-28 | Nat Distillers Chem Corp | alpha, alpha'-bis(laurylthio)-p-xylene |
| BE636248A (enExample) * | 1962-10-24 | |||
| US3223738A (en) * | 1963-03-15 | 1965-12-14 | Phillips Petroleum Co | Cyclododecadienyl mercaptans and thioethers |
| US3277181A (en) | 1963-07-10 | 1966-10-04 | Carlisle Chemical Works | Cyclic saturated thioethers |
| BE658003A (enExample) * | 1964-01-10 | 1965-07-07 | Argus Chem | |
| DE1545155A1 (de) * | 1964-01-31 | 1970-01-22 | Glanzstoff Ag | Verfahren zur Verbesserung der Stabilitaet von Polyolefinen |
| NL132370C (enExample) * | 1965-01-22 | 1900-01-01 | ||
| CH476775A (de) * | 1966-02-08 | 1969-08-15 | Geigy Ag J R | Verfahren zum SchĂĽtzen von oxydationsempfindlichem organischem Material |
| DE1669899B2 (de) * | 1966-05-24 | 1973-04-12 | CIBA GEIGY Manenberg GmbH, 6141 Lautern | Stabilisatormischungen fuer halogenhaltige polymerisate |
| US3442806A (en) * | 1966-12-22 | 1969-05-06 | Ethyl Corp | Stabilized organic material |
| US3507827A (en) * | 1967-01-27 | 1970-04-21 | Argus Chem | Stabilizer composition for lessening early discoloration of polyvinyl chloride resins when heated |
| US3483159A (en) * | 1967-05-22 | 1969-12-09 | Argus Chem | Rigid polyvinyl chloride resins having enhanced resistance to deterioration due to the presence of an organotin unsaturated half ester and an unhindered phenol |
| US3538044A (en) * | 1967-08-11 | 1970-11-03 | Pennwalt Corp | Dimercaptan derivatives as synergists for polyolefin stabilization |
| US3574165A (en) * | 1967-11-22 | 1971-04-06 | Nat Distillers Chem Corp | Stabilizing of organic materials |
| US3542825A (en) * | 1967-12-12 | 1970-11-24 | Albright & Wilson Mfg Ltd | Organo(chloro) tin mercaptides |
| US3565931A (en) * | 1967-12-19 | 1971-02-23 | Lawrence Robert Brecker | Process for preparing organotin mercapto carboxylic acid ester sulfides containing more than 18% tin |
| US3640950A (en) * | 1969-02-27 | 1972-02-08 | Cincinnati Milacron Chem | Halogenated resins stabilized with novel compositions |
| US3594448A (en) * | 1969-04-16 | 1971-07-20 | Allied Chem | Filament comprising a polymer blend of polyester and polyamide containing a sterically hindered phenolic compound |
| US3772246A (en) * | 1969-08-08 | 1973-11-13 | Pennwalt Corp | Cycloaliphatic sulfides for stabilizing polyolefins |
| BE754216A (fr) * | 1969-08-08 | 1971-02-01 | Pennwalt Corp | Sulfures cycloaliphatiques pour la stabilisation de polyolefines |
| US3715333A (en) * | 1969-11-13 | 1973-02-06 | M & T Chemicals Inc | Polyvinylchloride stabilization with mixtures of tin salts |
| US4255321A (en) * | 1970-01-02 | 1981-03-10 | General Electric Company | Stabilized polyphenylene ether |
| US3772390A (en) * | 1970-06-04 | 1973-11-13 | American Cyanamid Co | Hindered phenol sulfides |
| US3758341A (en) * | 1970-06-15 | 1973-09-11 | M & T Chemicals Inc | Halo(organo) tin thiocarboxylates |
| DE2036305A1 (de) | 1970-07-22 | 1972-01-27 | Advance Prod Gmbh | Stabilisierte Formmassen aus vinylchloridhaltigen Polymerisaten |
| US3932353A (en) * | 1970-09-28 | 1976-01-13 | Aerojet-General Corporation | Stabilizers for functionally terminated butadiene polymers |
| US3823191A (en) * | 1970-10-06 | 1974-07-09 | Grace W R & Co | Tetrakis(3-mercaptopropyl)ether of pentaerythritol,c(ch2och2ch2ch2sh)4 |
| US3674737A (en) * | 1971-01-22 | 1972-07-04 | Argus Chem | Reaction products of dialkyltin oxides and higher dialkyltin monohydric aliphatic saturated alcohol esters of thiomalic and thiolactic acids |
| US3758537A (en) * | 1971-06-24 | 1973-09-11 | M & T Chemicals Inc | Bis{8 hydrocarbyl(halo)(mercapto)tin{9 oxide |
| US3758536A (en) * | 1971-07-16 | 1973-09-11 | M & T Chemicals Inc | Process for preparing polymeric halo tin thiohydrocarbyl carboxylates |
| US3810868A (en) * | 1971-09-02 | 1974-05-14 | Cincinnati Milacron Chem | Dimethyltin mercapto ester stabilizers for halogenated resins |
| US3887519A (en) * | 1971-09-02 | 1975-06-03 | Cincinnati Milacron Chem | Dimethyltin ester stabilizers for vinyl-halide polymers |
| US3773723A (en) * | 1971-11-24 | 1973-11-20 | Dexter Corp | Thermosetting resins color stabilized with dialkyl thiodipropionates |
| BE793547A (fr) * | 1971-12-29 | 1973-04-16 | Southwire Co | Composition murissable a base de polyethylene stabilise par un di(1-methylheptadecyl)-4-alkylphenol et son procede de production |
| GB1456368A (en) * | 1972-11-29 | 1976-11-24 | Albright & Wilson | Organotin compounds |
| US3876613A (en) * | 1972-12-27 | 1975-04-08 | Phillips Petroleum Co | Rotational molding and compositions therefor |
| US3985705A (en) * | 1973-04-05 | 1976-10-12 | National Starch And Chemical Corporation | Stabilized polyester compositions |
| US4021468A (en) * | 1973-09-06 | 1977-05-03 | Ciba-Geigy Corporation | Thiaalkyl phenols |
| US3890277A (en) * | 1973-09-24 | 1975-06-17 | Cincinnati Milacron Chem | Alkyltin polysulfide thioester stabilized composition |
| FR2246571B1 (enExample) * | 1973-10-05 | 1976-06-18 | Rhone Poulenc Ind | |
| NL90598C (enExample) * | 1973-11-14 | |||
| US3988378A (en) * | 1974-01-10 | 1976-10-26 | Ciba-Geigy Corporation | Reaction product of mercaptans, alkylene oxides and glycidol |
| CH602906A5 (enExample) * | 1974-01-21 | 1978-08-15 | Ciba Geigy Ag | |
| US3970678A (en) * | 1974-03-08 | 1976-07-20 | Cincinnati Milacron Chemicals, Inc. | Organotin mercaptide process |
| US3919168A (en) * | 1974-04-19 | 1975-11-11 | Dart Ind Inc | Vinyl halide resin stabilizer compositions of organotin or antimony organic sulfur-containing compounds and tri-alkali metal phosphates |
| US3953519A (en) * | 1974-07-01 | 1976-04-27 | General Electric Company | Process for the preparation of a thiobis-2,6-disubstituted phenol from sulfur and a phenol |
| US4062881A (en) * | 1974-07-26 | 1977-12-13 | Cincinnati Milacron Chemicals, Inc. | Sulfide containing tin stabilizers |
| US4059570A (en) * | 1974-10-18 | 1977-11-22 | Exxon Research & Engineering Co. | Polythioether polyurethanes and their preparation |
| US3979359A (en) * | 1974-11-15 | 1976-09-07 | Cincinnati Milacron Chemicals, Inc. | Carbofunctional sulfur and carboxylate bridged tin compounds |
| US3928285A (en) * | 1975-01-16 | 1975-12-23 | Cincinnati Milacron Inc | Synergistic organotin borate stabilizer composition and resins containing same |
| US4029618A (en) * | 1975-06-30 | 1977-06-14 | Dart Industries Inc. | Vinyl halide stabilizer compositions of antimony organic sulfur-containing compounds and ortho-dihydric phenols |
| US4028332A (en) * | 1975-10-14 | 1977-06-07 | Phillips Petroleum Company | Stabilization of cross-linked polyolefins |
| DE2559201B2 (de) * | 1975-12-30 | 1978-06-15 | Hoechst Ag, 6000 Frankfurt | Organozinnverbindungen und ihre Verwendung als Stabilisatoren |
| US4111903A (en) * | 1976-05-03 | 1978-09-05 | Tenneco Chemicals, Inc. | Organotin compounds and vinyl halide resin compositions stabilized therewith |
| US4144154A (en) * | 1977-02-22 | 1979-03-13 | Zapp Robert L | Polythiol accelerated radiation crosslinking of olefinically unsaturated polymers |
| US4118371A (en) * | 1977-04-29 | 1978-10-03 | Cincinnati Milacron Chemicals Inc. | Organotin mercaptoalkanol ester sulfide stabilizers for PVC resins |
| US4221699A (en) * | 1977-06-14 | 1980-09-09 | Societe Anonyme De Telecommunications | Production of extruded polyolefin products |
| US4255320A (en) * | 1978-06-08 | 1981-03-10 | Argus Chemical Corporation | Mixtures of alkyltin sulfides and alkyltin 2-acyloxyethlymecaptides as stabilizer compositons for polyvinyl chloride resin compositions |
| US4220805A (en) * | 1978-09-18 | 1980-09-02 | General Electric Company | Linear dimers of bisphenols and method for making |
| US4254017A (en) * | 1978-11-13 | 1981-03-03 | M&T Chemicals Inc. | Organotin mercaptoalkanol esters and alkoxides containing sulfide groups |
| JPS5594944A (en) * | 1979-01-10 | 1980-07-18 | Adeka Argus Chem Co Ltd | Stabilized polymer composition |
| GB2046762A (en) * | 1979-04-17 | 1980-11-19 | Akzo Chemie Uk Ltd | Resin stabilizer compositions containing sulphur-containing ester tin compounds and ortho-dihydric phenols |
| US4273942A (en) * | 1979-05-09 | 1981-06-16 | General Electric Company | Plasticized polycarbonate composition |
| US4330462A (en) * | 1980-05-12 | 1982-05-18 | The Goodyear Tire & Rubber Company | Stabilized polyester composition |
| US4345040A (en) * | 1980-06-16 | 1982-08-17 | The B. F. Goodrich Company | Stabilization of post-chlorinated vinyl chloride polymers by phosphate salts |
| US4374205A (en) * | 1980-06-16 | 1983-02-15 | The B. F. Goodrich Company | Stabilization of post-chlorinated vinyl chloride polymers by phosphate salts |
| US4303759A (en) * | 1980-09-12 | 1981-12-01 | Air Products And Chemicals, Inc. | Polyalkylenecarbonate compositions with improved thermal stability and method for making same |
| US4360619A (en) * | 1981-02-26 | 1982-11-23 | Carstab Corporation | Stabilizer compositions and polymers containing same |
| US4314934A (en) * | 1981-02-26 | 1982-02-09 | Carstab Corporation | Organohalide polymers stabilized with an organotin compound and an ortho mercapto phenol compound |
| US4576984A (en) * | 1982-02-04 | 1986-03-18 | Morton Thiokol, Inc. | Stabilizer compositions for PVC resins |
| CA1190692A (en) * | 1982-02-09 | 1985-07-16 | Du Pont Canada Inc. | Polyethylene compositions for rotational moulding processes |
| US4515916A (en) * | 1982-05-18 | 1985-05-07 | Morton Thiokol Inc. | Stabilizers for halogen containing polymers comprising zinc mercaptoesters, basic inorganic alkali or alkaline earth metal compounds and, substituted dihydropyridines |
| US4711921A (en) * | 1982-11-12 | 1987-12-08 | The B. F. Goodrich Company | Stabilization of vinyl chloride polymers |
| US4514539A (en) * | 1983-05-05 | 1985-04-30 | Reichhold Chemicals, Inc. | Stain resistant polymeric insulating compositions |
| US4611023A (en) * | 1984-02-03 | 1986-09-09 | Ciba-Geigy Corporation | Di-(substituted hydroxyphenylthio) alkane and cycloalkane stabilizers and stabilized compositions |
| US4880856A (en) * | 1987-12-22 | 1989-11-14 | General Electric Company | Enhancing color stability of sterilizing radiation of polymer compositions |
| CA1272827A (en) * | 1984-10-10 | 1990-08-14 | James Leo Reilly | Compositions and methods using organosulfides for stabilization of polyolefins against photodegradation |
| US4774293A (en) * | 1985-06-26 | 1988-09-27 | Akzo N.V. | Process for cross-linking or degrading polymers and shaped articles obtained by this process |
| US5904717A (en) * | 1986-01-28 | 1999-05-18 | Thm Biomedical, Inc. | Method and device for reconstruction of articular cartilage |
| US4659762A (en) * | 1986-07-25 | 1987-04-21 | Ciba-Geigy Corporation | Tris (substituted hydroxyphenylthio) trithioorthoester stabilizers for polymers |
| US5013782A (en) * | 1988-04-22 | 1991-05-07 | Nippon Carbide Kogyo Kabushiki Kaisha | Flame retardant rigid or flexible chlorine-containing resin composition |
| US5081169A (en) * | 1989-10-31 | 1992-01-14 | Atochem North America, Inc. | Organic sulfide stabilized polymeric engineering resins |
| US5030679A (en) * | 1989-10-31 | 1991-07-09 | Atochem North America, Inc. | Organic sulfide antioxidants and polymers stabilized therewith |
| CA2026183A1 (en) * | 1989-10-31 | 1991-05-01 | Joseph M. Bohen | Organic peroxides and organic sulfide antioxidant compositions |
| US5284886A (en) * | 1989-10-31 | 1994-02-08 | Elf Atochem North America, Inc. | Non-toxic polymeric compositions stabilized with organosulfide antioxidants |
| US5070124A (en) * | 1989-10-31 | 1991-12-03 | Atochem North America, Inc. | Sulfide antioxidants for stabilizing crosslinked polyolefins |
| US5096947A (en) * | 1989-10-31 | 1992-03-17 | Atochem North America, Inc. | Organic peroxide and organic sulfide antioxidant composition |
-
1991
- 1991-07-24 US US07/735,140 patent/US5284886A/en not_active Expired - Lifetime
-
1992
- 1992-07-03 TW TW081105282A patent/TW221451B/zh active
- 1992-07-21 CA CA002074292A patent/CA2074292A1/en not_active Abandoned
- 1992-07-21 JP JP4214804A patent/JPH05194785A/ja not_active Withdrawn
- 1992-07-23 BR BR929202838A patent/BR9202838A/pt not_active Application Discontinuation
- 1992-07-24 EP EP92112679A patent/EP0525664A1/en not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| US5284886A (en) | 1994-02-08 |
| EP0525664A1 (en) | 1993-02-03 |
| BR9202838A (pt) | 1993-03-23 |
| JPH05194785A (ja) | 1993-08-03 |
| TW221451B (enExample) | 1994-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1150874A (en) | Bleed-free transparent polypropylene molding composition | |
| EP0079806B1 (en) | Stabilized polymers and their production and stabilizers therefor | |
| CA1337699C (en) | Polyolefin compositions of high clarity and resistance to oxidation | |
| US3723427A (en) | Hindered tris(meta-hydroxybenzyl)cyanurate antioxidants | |
| US8865809B2 (en) | Slip and antiblocking agent | |
| DE69023937T2 (de) | Gammastrahlung widerstandsfähige Polycarbonat-Zusammensetzung. | |
| US3536661A (en) | Stabilization of polyolefins and novel stabilizer compounds | |
| CA2074292A1 (en) | Non-toxic polymeric compositions stabilized with organosulfide antioxidants | |
| US4134879A (en) | Thioether-containing phenolic antioxidant stabilized polymers | |
| CA1137996A (en) | Polynuclear hindered phenols | |
| CA1272827A (en) | Compositions and methods using organosulfides for stabilization of polyolefins against photodegradation | |
| DE68922931T2 (de) | Gammastrahlenbeständige Polycarbonatzusammensetzungen. | |
| US4254020A (en) | Synergistic antioxidant mixtures | |
| DE2522833A1 (de) | Gehinderte phenolische derivate von cyclischen thioalkoholen und damit stabilisierte mischungen | |
| CA1277665C (en) | Selected 2,2,6,6-tetramethyl-4-piperidinyl derivatives and their use as light stabilizers | |
| CA1124677A (en) | Radiation treated propylene polymers | |
| US2910454A (en) | Hydrocarbon polymers stabilized with b-resorcylic acid diesters | |
| US3862053A (en) | Hindered tris (meta-hydroxybenzyl)cyanurate antioxidants | |
| US4146530A (en) | Dicyclophosphites and organic polymers stabilized with said phosphites and their use as stabilizers | |
| EP0140362B1 (de) | Alkylierte S-(2-Hydroxyphenylthio)-carbonsäureester | |
| US4125501A (en) | Phosphites of sugar alcohols and polymers stabilized therewith | |
| EP0522558A2 (en) | Process for stabilizing dibenzylidenesorbitols and composition thereof | |
| US2925400A (en) | Poly-alpha-olefins stabilized with long chain alkyl gallates | |
| JPH0513181B2 (enExample) | ||
| US3450671A (en) | Poly-alpha-olefin compositions containing dialkyl - 3,3' - thiodipropionates and polyphenols |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |