CA1268183C - Intermediaires du phosphorane utilises dans la preparation de penems antibiotiques - Google Patents
Intermediaires du phosphorane utilises dans la preparation de penems antibiotiquesInfo
- Publication number
- CA1268183C CA1268183C CA423146 CA1268183C CA 1268183 C CA1268183 C CA 1268183C CA 423146 CA423146 CA 423146 CA 1268183 C CA1268183 C CA 1268183C
- Authority
- CA
- Canada
- Prior art keywords
- alkyl
- phenyl
- alkylamino
- heterocyclic
- amino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- HHXMXAQDOUCLDN-RXMQYKEDSA-N penem Chemical compound S1C=CN2C(=O)C[C@H]21 HHXMXAQDOUCLDN-RXMQYKEDSA-N 0.000 title claims description 21
- 239000000543 intermediate Substances 0.000 title abstract description 19
- VBQCHPIMZGQLAZ-UHFFFAOYSA-N phosphorane Chemical compound [PH5] VBQCHPIMZGQLAZ-UHFFFAOYSA-N 0.000 title abstract 2
- 239000003242 anti bacterial agent Substances 0.000 title description 3
- 230000003115 biocidal Effects 0.000 title description 2
- 229940064005 Antibiotic throat preparations Drugs 0.000 title 1
- 229940083879 Antibiotics FOR TREATMENT OF HEMORRHOIDS AND ANAL FISSURES FOR TOPICAL USE Drugs 0.000 title 1
- 229940042052 Antibiotics for systemic use Drugs 0.000 title 1
- 229940042786 Antitubercular Antibiotics Drugs 0.000 title 1
- 229940093922 Gynecological Antibiotics Drugs 0.000 title 1
- 229940024982 Topical Antifungal Antibiotics Drugs 0.000 title 1
- 229940079866 intestinal antibiotics Drugs 0.000 title 1
- 229940005935 ophthalmologic Antibiotics Drugs 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 198
- 150000001875 compounds Chemical class 0.000 claims abstract description 181
- -1 hydroxyethyl Chemical group 0.000 claims abstract description 122
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 106
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 102
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 84
- 239000001257 hydrogen Substances 0.000 claims abstract description 57
- 125000001424 substituent group Chemical group 0.000 claims abstract description 35
- 125000004435 hydrogen atoms Chemical group [H]* 0.000 claims abstract description 29
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 26
- 238000002360 preparation method Methods 0.000 claims abstract description 14
- 125000004185 ester group Chemical group 0.000 claims abstract description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 209
- 239000002253 acid Substances 0.000 claims description 85
- 238000000034 method Methods 0.000 claims description 81
- 125000000623 heterocyclic group Chemical class 0.000 claims description 70
- 125000003282 alkyl amino group Chemical group 0.000 claims description 59
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 53
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 46
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 37
- 125000003545 alkoxy group Chemical group 0.000 claims description 34
- 229910052757 nitrogen Inorganic materials 0.000 claims description 23
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 21
- 125000001931 aliphatic group Chemical group 0.000 claims description 19
- UFHFLCQGNIYNRP-UHFFFAOYSA-N hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 19
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 13
- 239000003795 chemical substances by application Substances 0.000 claims description 11
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 10
- 150000002431 hydrogen Chemical group 0.000 claims description 10
- 125000004414 alkyl thio group Chemical group 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 9
- 125000004043 oxo group Chemical group O=* 0.000 claims description 8
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 7
- 239000012442 inert solvent Substances 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 125000005466 alkylenyl group Chemical group 0.000 claims description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 5
- 150000004820 halides Chemical class 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 150000008064 anhydrides Chemical class 0.000 claims description 4
- JPVYNHNXODAKFH-UHFFFAOYSA-N cu2+ Chemical group [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 claims description 4
- BQPIGGFYSBELGY-UHFFFAOYSA-N mercury(2+) Chemical compound [Hg+2] BQPIGGFYSBELGY-UHFFFAOYSA-N 0.000 claims description 4
- 229910004664 ORa Inorganic materials 0.000 claims description 3
- 229910004727 OSO3H Inorganic materials 0.000 claims description 3
- 125000001475 halogen functional group Chemical group 0.000 claims 6
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 2
- 229910004755 ORb Inorganic materials 0.000 claims 2
- 229910006074 SO2NH2 Inorganic materials 0.000 claims 2
- 229910006069 SO3H Inorganic materials 0.000 claims 2
- 239000011780 sodium chloride Substances 0.000 abstract description 46
- 150000003839 salts Chemical class 0.000 abstract description 42
- 150000002961 penems Chemical class 0.000 abstract description 11
- 230000003389 potentiating Effects 0.000 abstract description 4
- 230000000844 anti-bacterial Effects 0.000 abstract description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 427
- 239000000243 solution Substances 0.000 description 349
- 239000000203 mixture Substances 0.000 description 249
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 227
- 229910001868 water Inorganic materials 0.000 description 218
- XEKOWRVHYACXOJ-UHFFFAOYSA-N acetic acid ethyl ester Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 211
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 180
- YMWUJEATGCHHMB-UHFFFAOYSA-N methylene dichloride Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 179
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 170
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 159
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 144
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 118
- 239000007787 solid Substances 0.000 description 114
- UIIMBOGNXHQVGW-UHFFFAOYSA-M NaHCO3 Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 109
- 239000012267 brine Substances 0.000 description 109
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 95
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 86
- 239000003921 oil Substances 0.000 description 80
- 235000019198 oils Nutrition 0.000 description 80
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 76
- 235000019439 ethyl acetate Nutrition 0.000 description 74
- 239000011541 reaction mixture Substances 0.000 description 65
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 65
- 150000002148 esters Chemical group 0.000 description 63
- 239000002904 solvent Substances 0.000 description 62
- 239000000741 silica gel Substances 0.000 description 61
- 229910002027 silica gel Inorganic materials 0.000 description 61
- 229960001866 silicon dioxide Drugs 0.000 description 61
- 229940093499 ethyl acetate Drugs 0.000 description 60
- 230000035969 Vmax Effects 0.000 description 55
- CSNNHWWHGAXBCP-UHFFFAOYSA-L mgso4 Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 51
- 235000017557 sodium bicarbonate Nutrition 0.000 description 51
- 239000000047 product Substances 0.000 description 50
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-Lutidine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 49
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(I) nitrate Inorganic materials [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 49
- 125000003118 aryl group Chemical group 0.000 description 48
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 48
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 48
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N Triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 47
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 47
- 238000006243 chemical reaction Methods 0.000 description 46
- XYFCBTPGUUZFHI-UHFFFAOYSA-N phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 46
- 238000001704 evaporation Methods 0.000 description 42
- 239000000460 chlorine Substances 0.000 description 41
- 229910052709 silver Inorganic materials 0.000 description 41
- 239000004332 silver Substances 0.000 description 41
- 239000011734 sodium Substances 0.000 description 40
- FYSNRJHAOHDILO-UHFFFAOYSA-N Thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 38
- 239000000706 filtrate Substances 0.000 description 38
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 38
- BQCADISMDOOEFD-UHFFFAOYSA-N silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 38
- 238000003756 stirring Methods 0.000 description 37
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 35
- 239000002585 base Substances 0.000 description 33
- UAOMVDZJSHZZME-UHFFFAOYSA-N Diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 30
- 239000010410 layer Substances 0.000 description 29
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 29
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 28
- 238000010992 reflux Methods 0.000 description 28
- 238000001914 filtration Methods 0.000 description 26
- 235000019341 magnesium sulphate Nutrition 0.000 description 26
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 26
- 239000000377 silicon dioxide Substances 0.000 description 25
- 229940086542 triethylamine Drugs 0.000 description 25
- 229960001407 sodium bicarbonate Drugs 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 239000008079 hexane Substances 0.000 description 23
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 22
- 238000007792 addition Methods 0.000 description 21
- 239000000284 extract Substances 0.000 description 21
- 229910052708 sodium Inorganic materials 0.000 description 21
- MNFORVFSTILPAW-UHFFFAOYSA-N Β-Lactam Chemical compound O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 description 21
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 20
- ZCSHNCUQKCANBX-UHFFFAOYSA-N Lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 19
- IKHGUXGNUITLKF-UHFFFAOYSA-N acetaldehyde Chemical group CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 19
- 239000003610 charcoal Substances 0.000 description 19
- 229910052681 coesite Inorganic materials 0.000 description 19
- 229910052906 cristobalite Inorganic materials 0.000 description 19
- 229910052904 quartz Inorganic materials 0.000 description 19
- 235000012239 silicon dioxide Nutrition 0.000 description 19
- 229910052682 stishovite Inorganic materials 0.000 description 19
- 229910052905 tridymite Inorganic materials 0.000 description 19
- 239000003054 catalyst Substances 0.000 description 18
- 229910052938 sodium sulfate Inorganic materials 0.000 description 18
- 235000011152 sodium sulphate Nutrition 0.000 description 18
- 239000007858 starting material Substances 0.000 description 18
- 229910052799 carbon Inorganic materials 0.000 description 17
- 238000004440 column chromatography Methods 0.000 description 17
- 238000000746 purification Methods 0.000 description 17
- 239000012346 acetyl chloride Substances 0.000 description 16
- WPUJEWVVTKLMQI-UHFFFAOYSA-N benzene;ethoxyethane Chemical compound CCOCC.C1=CC=CC=C1 WPUJEWVVTKLMQI-UHFFFAOYSA-N 0.000 description 16
- 238000004587 chromatography analysis Methods 0.000 description 16
- 239000003480 eluent Substances 0.000 description 16
- 239000012074 organic phase Substances 0.000 description 16
- NLXLAEXVIDQMFP-UHFFFAOYSA-N ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 15
- 229940043279 diisopropylamine Drugs 0.000 description 15
- 239000006260 foam Substances 0.000 description 15
- 125000005843 halogen group Chemical group 0.000 description 15
- OFBQJSOFQDEBGM-UHFFFAOYSA-N pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 15
- 239000002244 precipitate Substances 0.000 description 15
- 238000000935 solvent evaporation Methods 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 14
- 125000004432 carbon atoms Chemical group C* 0.000 description 14
- 238000002425 crystallisation Methods 0.000 description 14
- 230000005712 crystallization Effects 0.000 description 14
- 239000000463 material Substances 0.000 description 14
- 239000012299 nitrogen atmosphere Substances 0.000 description 14
- 229910052763 palladium Inorganic materials 0.000 description 14
- 239000000725 suspension Substances 0.000 description 14
- WRJWRGBVPUUDLA-UHFFFAOYSA-N Chlorosulfonyl isocyanate Chemical compound ClS(=O)(=O)N=C=O WRJWRGBVPUUDLA-UHFFFAOYSA-N 0.000 description 13
- GNOIPBMMFNIUFM-UHFFFAOYSA-N Hexamethylphosphoramide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 13
- 238000001816 cooling Methods 0.000 description 13
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 13
- HPQVWDOOUQVBTO-UHFFFAOYSA-N lithium aluminum hydride Chemical compound [Li+].[Al-] HPQVWDOOUQVBTO-UHFFFAOYSA-N 0.000 description 13
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 13
- 239000002808 molecular sieve Substances 0.000 description 13
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 13
- 229910001961 silver nitrate Inorganic materials 0.000 description 13
- KEAYESYHFKHZAL-UHFFFAOYSA-N sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 13
- ZCTHWZKWCUEIHN-UHFFFAOYSA-N 4-tritylsulfanylazetidin-2-one Chemical compound N1C(=O)CC1SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 ZCTHWZKWCUEIHN-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 239000007832 Na2SO4 Substances 0.000 description 12
- 150000002500 ions Chemical class 0.000 description 12
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 12
- 101710027499 Os03g0268000 Proteins 0.000 description 11
- 238000001035 drying Methods 0.000 description 11
- 239000006188 syrup Substances 0.000 description 11
- 235000020357 syrup Nutrition 0.000 description 11
- WETWJCDKMRHUPV-UHFFFAOYSA-N Acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 10
- 235000019270 ammonium chloride Nutrition 0.000 description 10
- HHLFWLYXYJOTON-UHFFFAOYSA-M glyoxylate Chemical compound [O-]C(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-M 0.000 description 10
- 238000005917 acylation reaction Methods 0.000 description 9
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 9
- QDHHCQZDFGDHMP-UHFFFAOYSA-N monochloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- BZKBCQXYZZXSCO-UHFFFAOYSA-N sodium hydride Chemical compound [H-].[Na+] BZKBCQXYZZXSCO-UHFFFAOYSA-N 0.000 description 9
- 150000001450 anions Chemical class 0.000 description 8
- 239000008346 aqueous phase Substances 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 8
- 229910052744 lithium Inorganic materials 0.000 description 8
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 8
- 239000012071 phase Substances 0.000 description 8
- 150000003254 radicals Chemical class 0.000 description 8
- 150000001298 alcohols Chemical class 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 7
- 239000000538 analytical sample Substances 0.000 description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 7
- 230000000875 corresponding Effects 0.000 description 7
- 239000012039 electrophile Substances 0.000 description 7
- 238000010828 elution Methods 0.000 description 7
- 238000005755 formation reaction Methods 0.000 description 7
- WHXSMMKQMYFTQS-UHFFFAOYSA-N lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 7
- AFVFQIVMOAPDHO-UHFFFAOYSA-N methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 7
- 239000003960 organic solvent Substances 0.000 description 7
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 7
- 239000011591 potassium Substances 0.000 description 7
- 229910052700 potassium Inorganic materials 0.000 description 7
- 159000000000 sodium salts Chemical class 0.000 description 7
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 7
- HVRMNEPIBIGCNZ-UHFFFAOYSA-N (4-nitrophenyl)methyl 2-oxoacetate Chemical compound [O-][N+](=O)C1=CC=C(COC(=O)C=O)C=C1 HVRMNEPIBIGCNZ-UHFFFAOYSA-N 0.000 description 6
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 6
- AGPKZVBTJJNPAG-CRCLSJGQSA-N D-allo-isoleucine Chemical compound CC[C@H](C)[C@@H](N)C(O)=O AGPKZVBTJJNPAG-CRCLSJGQSA-N 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N Imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 125000004423 acyloxy group Chemical group 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 6
- 238000010348 incorporation Methods 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L na2so4 Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- UKNAYQWNMMGCNX-UHFFFAOYSA-N sodium;[hydroxy(phenyl)methyl]-oxido-oxophosphanium Chemical compound [Na+].[O-][P+](=O)C(O)C1=CC=CC=C1 UKNAYQWNMMGCNX-UHFFFAOYSA-N 0.000 description 6
- 238000005406 washing Methods 0.000 description 6
- MNVCCKVPSGWSCN-RXMQYKEDSA-N (5R)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound S1C(C)=C(C(O)=O)N2C(=O)C[C@H]21 MNVCCKVPSGWSCN-RXMQYKEDSA-N 0.000 description 5
- AFABGHUZZDYHJO-UHFFFAOYSA-N 2-Methylpentane Chemical class CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 5
- SUHXTVABLHHRST-UHFFFAOYSA-N 2-azidoacetyl chloride Chemical compound ClC(=O)CN=[N+]=[N-] SUHXTVABLHHRST-UHFFFAOYSA-N 0.000 description 5
- 241000287523 Ara Species 0.000 description 5
- 239000005909 Kieselgur Substances 0.000 description 5
- IJOOHPMOJXWVHK-UHFFFAOYSA-N Trimethylsilyl chloride Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-M acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 5
- 235000011089 carbon dioxide Nutrition 0.000 description 5
- HEDRZPFGACZZDS-MICDWDOJSA-N deuterated chloroform Substances [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 5
- 239000000499 gel Substances 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- YOQDYZUWIQVZSF-UHFFFAOYSA-N sodium borohydride Substances [BH4-].[Na+] YOQDYZUWIQVZSF-UHFFFAOYSA-N 0.000 description 5
- OEYMQQDJCUHKQS-UHFFFAOYSA-N (4-oxoazetidin-2-yl) acetate Chemical compound CC(=O)OC1CC(=O)N1 OEYMQQDJCUHKQS-UHFFFAOYSA-N 0.000 description 4
- DWDDFMFCVGDERN-UHFFFAOYSA-N 1-chloroazetidin-2-one Chemical compound ClN1CCC1=O DWDDFMFCVGDERN-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Carbodicyclohexylimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N DMSO-d6 Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 4
- 101700037397 MAX2 Proteins 0.000 description 4
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 4
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 4
- 150000001780 cephalosporins Chemical class 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- LKYXEULZVGJVTG-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH] LKYXEULZVGJVTG-UHFFFAOYSA-N 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- RWSOTUBLDIXVET-UHFFFAOYSA-N dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- 229910001385 heavy metal Inorganic materials 0.000 description 4
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 4
- 230000003000 nontoxic Effects 0.000 description 4
- 231100000252 nontoxic Toxicity 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 159000000001 potassium salts Chemical class 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- 150000007970 thio esters Chemical class 0.000 description 4
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- 238000001665 trituration Methods 0.000 description 4
- MHSAHSIRYJHQNP-UHFFFAOYSA-M (4-nitrophenyl)methylchloranuidylformate Chemical compound [O-]C(=O)[Cl-]CC1=CC=C([N+]([O-])=O)C=C1 MHSAHSIRYJHQNP-UHFFFAOYSA-M 0.000 description 3
- BXAYZTQAPBVIJI-UHFFFAOYSA-N 1-(methoxymethyl)-4-tritylsulfanylazetidin-2-one Chemical compound C1C(=O)N(COC)C1SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 BXAYZTQAPBVIJI-UHFFFAOYSA-N 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- VZGDMQKNWNREIO-UHFFFAOYSA-N Carbon tetrachloride Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 3
- 241000283986 Lepus Species 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N Methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 3
- CTSLXHKWHWQRSH-UHFFFAOYSA-N Oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 3
- 229910006124 SOCl2 Inorganic materials 0.000 description 3
- 229910007161 Si(CH3)3 Inorganic materials 0.000 description 3
- GGCZERPQGJTIQP-UHFFFAOYSA-M Sodium 2-anthraquinonesulfonate Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)[O-])=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-M 0.000 description 3
- WXMKPNITSTVMEF-UHFFFAOYSA-M Sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 3
- 230000002378 acidificating Effects 0.000 description 3
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 150000003863 ammonium salts Chemical class 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 3
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide Chemical compound [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 125000001589 carboacyl group Chemical group 0.000 description 3
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 239000010779 crude oil Substances 0.000 description 3
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 3
- 238000006073 displacement reaction Methods 0.000 description 3
- CHDFNIZLAAFFPX-UHFFFAOYSA-N ethoxyethane;oxolane Chemical compound CCOCC.C1CCOC1 CHDFNIZLAAFFPX-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 125000002349 hydroxyamino group Chemical group [H]ON([H])[*] 0.000 description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-M methanoate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 3
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 3
- 150000002960 penicillins Chemical class 0.000 description 3
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 3
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Inorganic materials [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000004299 sodium benzoate Substances 0.000 description 3
- 235000010234 sodium benzoate Nutrition 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- JQZIKLPHXXBMCA-UHFFFAOYSA-N triphenylmethanethiol Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(S)C1=CC=CC=C1 JQZIKLPHXXBMCA-UHFFFAOYSA-N 0.000 description 3
- VJEYNZQEVJGMNB-UHFFFAOYSA-N (1-tert-butyl-2-oxo-4-tritylsulfanylazetidin-3-yl)-dimethylsilicon Chemical compound CC(C)(C)N1C(=O)C([Si](C)C)C1SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 VJEYNZQEVJGMNB-UHFFFAOYSA-N 0.000 description 2
- PQDBYGGYHFHSTO-VPUSJEBWSA-N (3R,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-tritylsulfanylazetidine-3-carbaldehyde Chemical compound O=C[C@@H]1C(=O)N([Si](C)(C)C(C)(C)C)[C@H]1SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 PQDBYGGYHFHSTO-VPUSJEBWSA-N 0.000 description 2
- URRCWJIXJMEOET-UHFFFAOYSA-N 2-(5-methoxythiophen-2-yl)ethanethioic S-acid Chemical compound COC1=CC=C(CC(S)=O)S1 URRCWJIXJMEOET-UHFFFAOYSA-N 0.000 description 2
- KMMHZIBWCXYAAH-UHFFFAOYSA-N 4-bromobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C(Br)C=C1 KMMHZIBWCXYAAH-UHFFFAOYSA-N 0.000 description 2
- 206010060945 Bacterial infection Diseases 0.000 description 2
- SESFRYSPDFLNCH-UHFFFAOYSA-N Benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 2
- 229910001003 C-Si Inorganic materials 0.000 description 2
- WVNMNZIVDPQAEH-JPYJGEKTSA-N ClC(=O)[C@H]1C[C@H](N=[N+]=[N-])C1 Chemical compound ClC(=O)[C@H]1C[C@H](N=[N+]=[N-])C1 WVNMNZIVDPQAEH-JPYJGEKTSA-N 0.000 description 2
- LSXDOTMGLUJQCM-UHFFFAOYSA-M Copper(I) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 2
- HHLFWLYXYJOTON-UHFFFAOYSA-N Glyoxalate, Glyoxylate Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 2
- BRMYZIKAHFEUFJ-UHFFFAOYSA-L Mercury(II) acetate Chemical compound CC(=O)O[Hg]OC(C)=O BRMYZIKAHFEUFJ-UHFFFAOYSA-L 0.000 description 2
- LWJROJCJINYWOX-UHFFFAOYSA-L Mercury(II) chloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 2
- XVDBWWRIXBMVJV-UHFFFAOYSA-N N-[bis(dimethylamino)phosphanyl]-N-methylmethanamine Chemical compound CN(C)P(N(C)C)N(C)C XVDBWWRIXBMVJV-UHFFFAOYSA-N 0.000 description 2
- SLYCYWCVSGPDFR-UHFFFAOYSA-N Octadecyltrimethoxysilane Chemical compound CCCCCCCCCCCCCCCCCC[Si](OC)(OC)OC SLYCYWCVSGPDFR-UHFFFAOYSA-N 0.000 description 2
- 229940049954 Penicillin Drugs 0.000 description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N Phosphoryl chloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229920005654 Sephadex Polymers 0.000 description 2
- 239000012507 Sephadex™ Substances 0.000 description 2
- 229910018540 Si C Inorganic materials 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L Sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M Tetra-n-butylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- 238000006640 acetylation reaction Methods 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N benzohydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 229960000626 benzylpenicillin Drugs 0.000 description 2
- 230000000903 blocking Effects 0.000 description 2
- JAMFGQBENKSWOF-UHFFFAOYSA-N bromo(methoxy)methane Chemical compound COCBr JAMFGQBENKSWOF-UHFFFAOYSA-N 0.000 description 2
- 239000007853 buffer solution Substances 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 150000001734 carboxylic acid salts Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000003197 catalytic Effects 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 239000002178 crystalline material Substances 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- WBKFWQBXFREOFH-UHFFFAOYSA-N dichloromethane;ethyl acetate Chemical compound ClCCl.CCOC(C)=O WBKFWQBXFREOFH-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 201000009910 diseases by infectious agent Diseases 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- TUCNEACPLKLKNU-UHFFFAOYSA-N ethanone Chemical group C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- KVXNKFYSHAUJIA-UHFFFAOYSA-M ethoxyethane;acetate Chemical compound CC([O-])=O.CCOCC KVXNKFYSHAUJIA-UHFFFAOYSA-M 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical class CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 238000004108 freeze drying Methods 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-M glycolate Chemical compound OCC([O-])=O AEMRFAOFKBGASW-UHFFFAOYSA-M 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000005343 heterocyclic alkyl group Chemical group 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229960002523 mercuric chloride Drugs 0.000 description 2
- MRVIVLQUPMJDPA-UHFFFAOYSA-N methyl hexanoate;sodium Chemical compound [Na].CCCCCC(=O)OC MRVIVLQUPMJDPA-UHFFFAOYSA-N 0.000 description 2
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 2
- QMMFVYPAHWMCMS-UHFFFAOYSA-N methyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 2
- 125000006217 methyl sulfide group Chemical group [H]C([H])([H])S* 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000003287 optical Effects 0.000 description 2
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N oxane Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- 125000002217 penem group Chemical group 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-M phenylacetate Chemical compound [O-]C(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-M 0.000 description 2
- 125000003884 phenylalkyl group Chemical group 0.000 description 2
- 125000005633 phthalidyl group Chemical group 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- RWRDLPDLKQPQOW-UHFFFAOYSA-N pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 239000010948 rhodium Substances 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 229910010271 silicon carbide Inorganic materials 0.000 description 2
- 238000006884 silylation reaction Methods 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 230000003595 spectral Effects 0.000 description 2
- 239000004544 spot-on Substances 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N t-BuOH Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical group C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 description 2
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- 239000005051 trimethylchlorosilane Substances 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 239000003643 water by type Substances 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- BFADYHOMNBRADD-UHFFFAOYSA-N (1-tert-butyl-2-oxo-3-propanoyl-4-tritylsulfanylazetidin-3-yl)-dimethylsilicon Chemical compound CC(C)(C)N1C(=O)C(C(=O)CC)([Si](C)C)C1SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 BFADYHOMNBRADD-UHFFFAOYSA-N 0.000 description 1
- JXUNCBAJHROGMG-CWTKIQHKSA-N (3R,4S)-1-[tert-butyl(dimethyl)silyl]-3-(2-phenylacetyl)-4-tritylsulfanylazetidin-2-one Chemical compound S([C@@H]1N(C([C@H]1C(=O)CC=1C=CC=CC=1)=O)[Si](C)(C)C(C)(C)C)C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 JXUNCBAJHROGMG-CWTKIQHKSA-N 0.000 description 1
- QRGUMYSNVUUBFS-IRLDBZIGSA-N (3R,4S)-3-(aminomethyl)-4-tritylsulfanylazetidin-2-one Chemical compound N1C(=O)[C@@H](CN)[C@@H]1SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 QRGUMYSNVUUBFS-IRLDBZIGSA-N 0.000 description 1
- YSWZSSQOLIDWJA-IRLDBZIGSA-N (3R,4S)-3-(azidomethyl)-4-tritylsulfanylazetidin-2-one Chemical compound N1C(=O)[C@@H](CN=[N+]=[N-])[C@@H]1SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 YSWZSSQOLIDWJA-IRLDBZIGSA-N 0.000 description 1
- OIHLWKOVIJPVHC-UHFFFAOYSA-N (4-nitrophenyl)methyl 2-oxoacetate;hydrate Chemical compound O.[O-][N+](=O)C1=CC=C(COC(=O)C=O)C=C1 OIHLWKOVIJPVHC-UHFFFAOYSA-N 0.000 description 1
- IGHQXSRBOGGVKI-YJEMDFIKSA-N (5R)-3-(aminomethyl)-6-ethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound S1C(CN)=C(C(O)=O)N2C(=O)C(CC)[C@H]21 IGHQXSRBOGGVKI-YJEMDFIKSA-N 0.000 description 1
- XADKNNOZGYWLDQ-LLVKDONJSA-N (5R)-3-(anilinomethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C([C@H]1S2)C(=O)N1C(C(=O)O)=C2CNC1=CC=CC=C1 XADKNNOZGYWLDQ-LLVKDONJSA-N 0.000 description 1
- JKCWUGGZDVEUGU-LLVKDONJSA-N (5R)-3-(benzenesulfonamidomethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C([C@H]1S2)C(=O)N1C(C(=O)O)=C2CNS(=O)(=O)C1=CC=CC=C1 JKCWUGGZDVEUGU-LLVKDONJSA-N 0.000 description 1
- MXKAAJUZYWCVFA-SSDOTTSWSA-N (5R)-3-(ethylaminomethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound S1C(CNCC)=C(C(O)=O)N2C(=O)C[C@H]21 MXKAAJUZYWCVFA-SSDOTTSWSA-N 0.000 description 1
- VMYWEBDEMIQKPG-ZCFIWIBFSA-N (5R)-3-(methoxymethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound S1C(COC)=C(C(O)=O)N2C(=O)C[C@H]21 VMYWEBDEMIQKPG-ZCFIWIBFSA-N 0.000 description 1
- XIEGEOOFZDAWOO-MRVPVSSYSA-N (5R)-3-[2-(ethylamino)ethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound S1C(CCNCC)=C(C(O)=O)N2C(=O)C[C@H]21 XIEGEOOFZDAWOO-MRVPVSSYSA-N 0.000 description 1
- ILGKYPCEZZHSJT-SNVBAGLBSA-N (5R)-3-[3-[acetyl(methyl)amino]propyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound S1C(CCCN(C)C(C)=O)=C(C(O)=O)N2C(=O)C[C@H]21 ILGKYPCEZZHSJT-SNVBAGLBSA-N 0.000 description 1
- BGNITPONBRZOFU-SNVBAGLBSA-N (5R)-3-[4-(aminomethyl)phenyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1=CC(CN)=CC=C1C1=C(C(O)=O)N2C(=O)C[C@H]2S1 BGNITPONBRZOFU-SNVBAGLBSA-N 0.000 description 1
- IYJJXDZANMNUKV-SECBINFHSA-N (5R)-3-[4-(methoxyamino)butyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound S1C(CCCCNOC)=C(C(O)=O)N2C(=O)C[C@H]21 IYJJXDZANMNUKV-SECBINFHSA-N 0.000 description 1
- LPEDYPZPWFVFSW-SECBINFHSA-N (5R)-3-[4-(methylamino)butyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound S1C(CCCCNC)=C(C(O)=O)N2C(=O)C[C@H]21 LPEDYPZPWFVFSW-SECBINFHSA-N 0.000 description 1
- WYWWJDXUIKEGOS-SECBINFHSA-N (5R)-3-[4-(methylcarbamothioylamino)butyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound S1C(CCCCNC(=S)NC)=C(C(O)=O)N2C(=O)C[C@H]21 WYWWJDXUIKEGOS-SECBINFHSA-N 0.000 description 1
- SQGPFGNQQFQGAT-ZCFIWIBFSA-N (5R)-3-ethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound S1C(CC)=C(C(O)=O)N2C(=O)C[C@H]21 SQGPFGNQQFQGAT-ZCFIWIBFSA-N 0.000 description 1
- 125000005869 (methoxyethoxy)methanyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- RHUYHJGZWVXEHW-UHFFFAOYSA-N 1,1-dimethyhydrazine Chemical compound CN(C)N RHUYHJGZWVXEHW-UHFFFAOYSA-N 0.000 description 1
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- BIAAQBNMRITRDV-UHFFFAOYSA-N 1-(chloromethoxy)-2-methoxyethane Chemical compound COCCOCCl BIAAQBNMRITRDV-UHFFFAOYSA-N 0.000 description 1
- XKXOALPYJCFNPZ-UHFFFAOYSA-N 1-acetyloxyprop-1-enyl acetate Chemical compound CC(=O)OC(=CC)OC(C)=O XKXOALPYJCFNPZ-UHFFFAOYSA-N 0.000 description 1
- GUWWSVMOVFBYII-UHFFFAOYSA-N 1-benzyl-2-(4-methoxyphenyl)piperidin-4-one Chemical compound C1=CC(OC)=CC=C1C1N(CC=2C=CC=CC=2)CCC(=O)C1 GUWWSVMOVFBYII-UHFFFAOYSA-N 0.000 description 1
- QNEPMWHGMQRTRL-UHFFFAOYSA-N 1-trimethylsilyl-4-tritylsulfanylazetidin-2-one Chemical compound C1C(=O)N([Si](C)(C)C)C1SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 QNEPMWHGMQRTRL-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- HEWZVZIVELJPQZ-UHFFFAOYSA-N 2,2-Dimethoxypropane Chemical compound COC(C)(C)OC HEWZVZIVELJPQZ-UHFFFAOYSA-N 0.000 description 1
- SUJBUFGFNUEIRB-UHFFFAOYSA-N 2,6-dimethylpyridin-1-ium;chloride Chemical compound Cl.CC1=CC=CC(C)=N1 SUJBUFGFNUEIRB-UHFFFAOYSA-N 0.000 description 1
- YOWQWFMSQCOSBA-UHFFFAOYSA-N 2-Methoxypropene Chemical compound COC(C)=C YOWQWFMSQCOSBA-UHFFFAOYSA-N 0.000 description 1
- QHNPRUDVBQYFHB-IAPPQJPRSA-N 2-[[(3R,4S)-2-oxo-4-tritylsulfanylazetidin-3-yl]methyl]isoindole-1,3-dione Chemical compound S([C@@H]1NC([C@H]1CN1C(C2=CC=CC=C2C1=O)=O)=O)C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 QHNPRUDVBQYFHB-IAPPQJPRSA-N 0.000 description 1
- QRECIVPUECYDDM-UHFFFAOYSA-N 2-chlorooxane Chemical compound ClC1CCCCO1 QRECIVPUECYDDM-UHFFFAOYSA-N 0.000 description 1
- 125000006022 2-methyl-2-propenyl group Chemical group 0.000 description 1
- HSJKGGMUJITCBW-UHFFFAOYSA-N 3-Hydroxybutanal Chemical compound CC(O)CC=O HSJKGGMUJITCBW-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- VGKZBAMIYUHSMU-UHFFFAOYSA-N 4-[[2-chloroethyl(nitroso)carbamoyl]amino]cyclohexane-1-carboxylic acid Chemical compound OC(=O)C1CCC(NC(=O)N(CCCl)N=O)CC1 VGKZBAMIYUHSMU-UHFFFAOYSA-N 0.000 description 1
- BHEYXIGGNVYACW-UHFFFAOYSA-N 4-aminobutanoyl chloride Chemical compound NCCCC(Cl)=O BHEYXIGGNVYACW-UHFFFAOYSA-N 0.000 description 1
- HHXMXAQDOUCLDN-UHFFFAOYSA-N 4-thia-1-azabicyclo[3.2.0]hept-2-en-7-one Chemical compound S1C=CN2C(=O)CC21 HHXMXAQDOUCLDN-UHFFFAOYSA-N 0.000 description 1
- JPLZLXLDDYKNPT-UHFFFAOYSA-N 5-[[3-[(3,3-dimethylpiperidin-1-ium-1-yl)methyl]-4-methoxyphenyl]-[6-hydroxy-1-(2-methylphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methyl]-3-(2-methylphenyl)-6-oxo-2-sulfanylidenepyrimidin-4-olate Chemical compound COC1=CC=C(C(C=2C(NC(=S)N(C=3C(=CC=CC=3)C)C=2O)=O)C=2C(NC(=S)N(C=3C(=CC=CC=3)C)C=2[O-])=O)C=C1C[NH+]1CCCC(C)(C)C1 JPLZLXLDDYKNPT-UHFFFAOYSA-N 0.000 description 1
- 235000009825 Annona senegalensis Nutrition 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N Benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N Boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- UKNRZTAKMLPCRX-ZCFIWIBFSA-N C(=N)NCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O Chemical compound C(=N)NCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O UKNRZTAKMLPCRX-ZCFIWIBFSA-N 0.000 description 1
- BXNDYAPQGOPSAC-SECBINFHSA-N C(=N)NCCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O Chemical compound C(=N)NCCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O BXNDYAPQGOPSAC-SECBINFHSA-N 0.000 description 1
- DKHXECLUMHERRE-ZCFIWIBFSA-N C(=O)(OC)NC(=O)NCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O Chemical compound C(=O)(OC)NC(=O)NCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O DKHXECLUMHERRE-ZCFIWIBFSA-N 0.000 description 1
- DQKULZCGPAGMTQ-MRVPVSSYSA-N C(=O)(OC)NC(=O)NCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O Chemical compound C(=O)(OC)NC(=O)NCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O DQKULZCGPAGMTQ-MRVPVSSYSA-N 0.000 description 1
- CKFOVMBKZBASNY-SNVBAGLBSA-N C(C)(=O)NCCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O Chemical compound C(C)(=O)NCCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O CKFOVMBKZBASNY-SNVBAGLBSA-N 0.000 description 1
- QYEXMAIYFOWTBB-SNVBAGLBSA-N C(C)(=O)NNCCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O Chemical compound C(C)(=O)NNCCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O QYEXMAIYFOWTBB-SNVBAGLBSA-N 0.000 description 1
- MFJBTVRAJXECBD-IAPPQJPRSA-N C(C)(C)(C)[Si](N1C([C@H]([C@@H]1SC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)CS(=O)(=O)C)=O)(C)C Chemical compound C(C)(C)(C)[Si](N1C([C@H]([C@@H]1SC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)CS(=O)(=O)C)=O)(C)C MFJBTVRAJXECBD-IAPPQJPRSA-N 0.000 description 1
- MNSKJVXAGAIFBU-CYBMUJFWSA-N C(C1=CC=CC=C1)(=O)NC(=O)NCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O Chemical compound C(C1=CC=CC=C1)(=O)NC(=O)NCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O MNSKJVXAGAIFBU-CYBMUJFWSA-N 0.000 description 1
- RALMZMHAHIJTRO-CQSZACIVSA-N C(C1=CC=CC=C1)(=O)NC(=O)NCCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O Chemical compound C(C1=CC=CC=C1)(=O)NC(=O)NCCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O RALMZMHAHIJTRO-CQSZACIVSA-N 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- ILYBIODTWGQHMM-CQSZACIVSA-N C1(=CC=CC=C1)NC(=O)NCCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O Chemical compound C1(=CC=CC=C1)NC(=O)NCCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O ILYBIODTWGQHMM-CQSZACIVSA-N 0.000 description 1
- 101700011562 CASP4 Proteins 0.000 description 1
- 102100014427 CASP4 Human genes 0.000 description 1
- 101700077251 CASP5 Proteins 0.000 description 1
- 102100006337 CASP5 Human genes 0.000 description 1
- ORCZYWLJESFEIF-SVRRBLITSA-N CC(=O)OC[C@H]1[C@H](OC(C)=O)NC1=O Chemical compound CC(=O)OC[C@H]1[C@H](OC(C)=O)NC1=O ORCZYWLJESFEIF-SVRRBLITSA-N 0.000 description 1
- NJYOSIIAICMNNZ-UHFFFAOYSA-L CC([O-])=O.CC([O-])=O.COC([Hg+2])=O Chemical compound CC([O-])=O.CC([O-])=O.COC([Hg+2])=O NJYOSIIAICMNNZ-UHFFFAOYSA-L 0.000 description 1
- MNVCCKVPSGWSCN-RXMQYKEDSA-M CC=1S[C@H]2N(C=1C(=O)[O-])C(C2)=O Chemical compound CC=1S[C@H]2N(C=1C(=O)[O-])C(C2)=O MNVCCKVPSGWSCN-RXMQYKEDSA-M 0.000 description 1
- 101700065604 CDC12 Proteins 0.000 description 1
- QVPOBYAPHBSSAU-HZGVNTEJSA-N CN(C)C[C@H]1[C@@H]2N(C(=C(S2)C)C(=O)O)C1=O Chemical compound CN(C)C[C@H]1[C@@H]2N(C(=C(S2)C)C(=O)O)C1=O QVPOBYAPHBSSAU-HZGVNTEJSA-N 0.000 description 1
- TWOJQSAIQCMVDY-ZCFIWIBFSA-N CS(=O)(=O)NCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O Chemical compound CS(=O)(=O)NCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O TWOJQSAIQCMVDY-ZCFIWIBFSA-N 0.000 description 1
- AUPXBVDHVRZMIB-UHFFFAOYSA-M C[Mg]I Chemical compound C[Mg]I AUPXBVDHVRZMIB-UHFFFAOYSA-M 0.000 description 1
- TVRMYCWNLPBKSX-SNVBAGLBSA-N C[Si](CCOC(=O)NC(=O)NCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O)(C)C Chemical compound C[Si](CCOC(=O)NC(=O)NCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O)(C)C TVRMYCWNLPBKSX-SNVBAGLBSA-N 0.000 description 1
- 229960004424 Carbon Dioxide Drugs 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate dianion Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 230000036536 Cave Effects 0.000 description 1
- 230000036849 Clc Effects 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N DMSO dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 241000896693 Disa Species 0.000 description 1
- 241001547070 Eriodes Species 0.000 description 1
- OJCSPXHYDFONPU-UHFFFAOYSA-N EtOAc EtOAc Chemical compound CCOC(C)=O.CCOC(C)=O OJCSPXHYDFONPU-UHFFFAOYSA-N 0.000 description 1
- 241000982822 Ficus obtusifolia Species 0.000 description 1
- 241001415961 Gaviidae Species 0.000 description 1
- 235000008100 Ginkgo biloba Nutrition 0.000 description 1
- 240000002883 Ginkgo biloba Species 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- 229920002456 HOTAIR Polymers 0.000 description 1
- UQEAIHBTYFGYIE-UHFFFAOYSA-N Hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 1
- 241000282619 Hylobates lar Species 0.000 description 1
- 229940087671 Icar Drugs 0.000 description 1
- 241000229754 Iva xanthiifolia Species 0.000 description 1
- 229940017219 METHYL PROPIONATE Drugs 0.000 description 1
- 208000004396 Mastitis Diseases 0.000 description 1
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N Methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- QXTCFDCJXWLNAP-UHFFFAOYSA-N Mononitrogen monosulfide Chemical compound S=[N] QXTCFDCJXWLNAP-UHFFFAOYSA-N 0.000 description 1
- SJZANTILQPJNDI-UHFFFAOYSA-N N(=[N+]=[N-])[PH4] Chemical compound N(=[N+]=[N-])[PH4] SJZANTILQPJNDI-UHFFFAOYSA-N 0.000 description 1
- WJTRBCAZKULNTI-ZCFIWIBFSA-N N(C(=O)N)CCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O Chemical compound N(C(=O)N)CCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O WJTRBCAZKULNTI-ZCFIWIBFSA-N 0.000 description 1
- NJGWKMMSSWZIKF-MRVPVSSYSA-N N(C(=O)N)CCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O Chemical compound N(C(=O)N)CCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O NJGWKMMSSWZIKF-MRVPVSSYSA-N 0.000 description 1
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N N,N-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 1
- VMWJCFLUSKZZDX-UHFFFAOYSA-N N,N-dimethylmethanamine Chemical group [CH2]N(C)C VMWJCFLUSKZZDX-UHFFFAOYSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N N-benzyl-1-phenylmethanamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- JNUJCLAPGHAMHY-VWNXMTODSA-N N1C(=O)[C@@H](CN(C)C)[C@@H]1SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 Chemical compound N1C(=O)[C@@H](CN(C)C)[C@@H]1SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 JNUJCLAPGHAMHY-VWNXMTODSA-N 0.000 description 1
- HNEZLOQPLGDBFK-SSDOTTSWSA-N NCC(=O)NCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O Chemical compound NCC(=O)NCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O HNEZLOQPLGDBFK-SSDOTTSWSA-N 0.000 description 1
- OCIXSIOMULTTKH-MRVPVSSYSA-N NCC(=O)NCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O Chemical compound NCC(=O)NCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O OCIXSIOMULTTKH-MRVPVSSYSA-N 0.000 description 1
- PBQCZLSPBUTYME-SECBINFHSA-N NCC(=O)NCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O Chemical compound NCC(=O)NCCCC=1S[C@H]2N(C=1C(=O)O)C(C2)=O PBQCZLSPBUTYME-SECBINFHSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- ADBCTWDHWVRUDR-UHFFFAOYSA-N N[PH4] Chemical compound N[PH4] ADBCTWDHWVRUDR-UHFFFAOYSA-N 0.000 description 1
- 229910003849 O-Si Inorganic materials 0.000 description 1
- UJTMLNARSPORHR-UHFFFAOYSA-N OC2H5 Chemical compound C=C=[O+] UJTMLNARSPORHR-UHFFFAOYSA-N 0.000 description 1
- 241000658540 Ora Species 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 229910003872 O—Si Inorganic materials 0.000 description 1
- 241001307210 Pene Species 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N Phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- 241000206607 Porphyra umbilicalis Species 0.000 description 1
- ZUFQCVZBBNZMKD-UHFFFAOYSA-M Potassium 2-ethylhexanoate Chemical compound [K+].CCCCC(CC)C([O-])=O ZUFQCVZBBNZMKD-UHFFFAOYSA-M 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N Procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 101700019128 ROM1 Proteins 0.000 description 1
- ZADZMOWCAUMICY-UHFFFAOYSA-N S-(2-oxoazetidin-1-yl) ethanethioate Chemical compound CC(=O)SN1CCC1=O ZADZMOWCAUMICY-UHFFFAOYSA-N 0.000 description 1
- 235000015076 Shorea robusta Nutrition 0.000 description 1
- 229910008338 Si—(CH3) Inorganic materials 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N Sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N Sodium sulfide Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 241000282890 Sus Species 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M Tetra-n-butylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- 229940035295 Ting Drugs 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N Tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N Tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N Trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- SEDZOYHHAIAQIW-UHFFFAOYSA-N Trimethylsilyl azide Chemical compound C[Si](C)(C)N=[N+]=[N-] SEDZOYHHAIAQIW-UHFFFAOYSA-N 0.000 description 1
- 241000822135 Ula Species 0.000 description 1
- 229920001567 Vinyl ester Polymers 0.000 description 1
- 102100002917 XAB2 Human genes 0.000 description 1
- 101710019504 XAB2 Proteins 0.000 description 1
- ASCUXPQGEXGEMJ-GPLGTHOPSA-N [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylanilino)oxan-2-yl]methoxy]oxan-2-yl]methyl acetate Chemical compound CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(=O)C)O[C@@H]1OC[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](NC=2C=CC(C)=CC=2)O1 ASCUXPQGEXGEMJ-GPLGTHOPSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K [O-]P([O-])([O-])=O Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- RAFKCLFWELPONH-UHFFFAOYSA-N acetonitrile;dichloromethane Chemical compound CC#N.ClCCl RAFKCLFWELPONH-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- HGINCPLSRVDWNT-UHFFFAOYSA-N acrylaldehyde Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 125000005042 acyloxymethyl group Chemical group 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000005360 alkyl sulfoxide group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminum Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 1
- IMNRJGSQCGFPHL-UHFFFAOYSA-N benzene;oxolane Chemical compound C1CCOC1.C1=CC=CC=C1 IMNRJGSQCGFPHL-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- PUJDIJCNWFYVJX-UHFFFAOYSA-N benzyl carbamate Chemical compound NC(=O)OCC1=CC=CC=C1 PUJDIJCNWFYVJX-UHFFFAOYSA-N 0.000 description 1
- 239000003782 beta lactam antibiotic agent Substances 0.000 description 1
- 125000002618 bicyclic heterocycle group Chemical group 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- CROBTXVXNQNKKO-UHFFFAOYSA-N borohydride Chemical compound [BH4-] CROBTXVXNQNKKO-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- DNSISZSEWVHGLH-UHFFFAOYSA-M butanimidate Chemical compound CCCC([NH-])=O DNSISZSEWVHGLH-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- 235000012970 cakes Nutrition 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000099 calcium monohydride Inorganic materials 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-M caproate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-M chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 1
- 229940005991 chloric acid Drugs 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 125000002340 chlorooxy group Chemical group ClO[*] 0.000 description 1
- AQIXAKUUQRKLND-UHFFFAOYSA-N cimetidine Chemical compound N#C/N=C(/NC)NCCSCC=1N=CNC=1C AQIXAKUUQRKLND-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 238000006352 cycloaddition reaction Methods 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- PEMWUGPZTRDXFZ-UHFFFAOYSA-N cyclohexa-1,4-diyne Chemical group C1C#C[C+]C#C1 PEMWUGPZTRDXFZ-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000003247 decreasing Effects 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 230000001419 dependent Effects 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 235000015872 dietary supplement Nutrition 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- WXQSFECXTRCYSG-UHFFFAOYSA-N dimethyl-[methyl(trimethylsilyl)amino]silicon;lithium Chemical compound [Li].C[Si](C)N(C)[Si](C)(C)C WXQSFECXTRCYSG-UHFFFAOYSA-N 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- DLLJVQNYBYOKGS-UHFFFAOYSA-N ethoxyethane;pentane Chemical compound CCCCC.CCOCC DLLJVQNYBYOKGS-UHFFFAOYSA-N 0.000 description 1
- ZANNOFHADGWOLI-UHFFFAOYSA-N ethyl 2-hydroxyacetate Chemical compound CCOC(=O)CO ZANNOFHADGWOLI-UHFFFAOYSA-N 0.000 description 1
- QVDYYQXUNAQSNI-UHFFFAOYSA-N ethyl acetate;pentane Chemical compound CCCCC.CCOC(C)=O QVDYYQXUNAQSNI-UHFFFAOYSA-N 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 125000004005 formimidoyl group Chemical group [H]\N=C(/[H])* 0.000 description 1
- 239000000295 fuel oil Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000005842 heteroatoms Chemical group 0.000 description 1
- 150000004677 hydrates Chemical group 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XNXVOSBNFZWHBV-UHFFFAOYSA-N hydron;O-methylhydroxylamine;chloride Chemical compound Cl.CON XNXVOSBNFZWHBV-UHFFFAOYSA-N 0.000 description 1
- 125000001867 hydroperoxy group Chemical group [*]OO[H] 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000006289 hydroxybenzyl group Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxyl anion Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- OCZDCIYGECBNKL-UHFFFAOYSA-N lithium;alumanuide Chemical compound [Li+].[AlH4-] OCZDCIYGECBNKL-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 125000006357 methylene carbonyl group Chemical group [H]C([H])([*:1])C([*:2])=O 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 1
- 125000002004 n-butylamino group Chemical group [H]N(*)C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004708 n-butylthio group Chemical group C(CCC)S* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N o-xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000004533 oil dispersion Substances 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 150000007530 organic bases Chemical group 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-M oxalate(1-) Chemical compound OC(=O)C([O-])=O MUBZPKHOEPUJKR-UHFFFAOYSA-M 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical group O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 238000006303 photolysis reaction Methods 0.000 description 1
- 230000015843 photosynthesis, light reaction Effects 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 238000004237 preparative chromatography Methods 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- VHWJSJBTUWUEAL-UHFFFAOYSA-N propanamide;hydrochloride Chemical compound Cl.CCC(N)=O VHWJSJBTUWUEAL-UHFFFAOYSA-N 0.000 description 1
- 230000002633 protecting Effects 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching Effects 0.000 description 1
- 239000003638 reducing agent Substances 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 150000003378 silver Chemical class 0.000 description 1
- 239000001187 sodium carbonate Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- VYPDUQYOLCLEGS-UHFFFAOYSA-M sodium;2-ethylhexanoate Chemical compound [Na+].CCCCC(CC)C([O-])=O VYPDUQYOLCLEGS-UHFFFAOYSA-M 0.000 description 1
- VWMRHWQOUZWXNN-UHFFFAOYSA-M sodium;5-methyl-1,3-thiazole-4-carboxylate Chemical compound [Na+].CC=1SC=NC=1C([O-])=O VWMRHWQOUZWXNN-UHFFFAOYSA-M 0.000 description 1
- NCFTXMQPRQZFMZ-UHFFFAOYSA-M sodium;7-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound [Na+].O=C1C(=O)N(CC)CCN1C(=O)NC(C=1C=CC(O)=CC=1)C(=O)NC1C(=O)N2C(C([O-])=O)=C(CSC=3N(N=NN=3)C)CSC21 NCFTXMQPRQZFMZ-UHFFFAOYSA-M 0.000 description 1
- ODGROJYWQXFQOZ-UHFFFAOYSA-N sodium;boron(1-) Chemical compound [B-].[Na+] ODGROJYWQXFQOZ-UHFFFAOYSA-N 0.000 description 1
- RBBWNXJFTBCLKT-UHFFFAOYSA-M sodium;ethanethioate Chemical compound [Na+].CC([S-])=O RBBWNXJFTBCLKT-UHFFFAOYSA-M 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 238000007614 solvation Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- QXKXDIKCIPXUPL-UHFFFAOYSA-N sulfanylidenemercury Chemical compound [Hg]=S QXKXDIKCIPXUPL-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 230000002194 synthesizing Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 1
- 230000017105 transposition Effects 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
- RXJKFRMDXUJTEX-UHFFFAOYSA-N triethylphosphine Chemical compound CCP(CC)CC RXJKFRMDXUJTEX-UHFFFAOYSA-N 0.000 description 1
- QXTIBZLKQPJVII-UHFFFAOYSA-N triethylsilicon Chemical group CC[Si](CC)CC QXTIBZLKQPJVII-UHFFFAOYSA-N 0.000 description 1
- 238000005866 tritylation reaction Methods 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US968,663 | 1978-12-18 |
Publications (1)
Publication Number | Publication Date |
---|---|
CA1268183C true CA1268183C (fr) | 1990-04-25 |
Family
ID=
Similar Documents
Publication | Publication Date | Title |
---|---|---|
GB2042515A (en) | Antibacterial agents | |
EP0010316B1 (fr) | Acides 1-carba-2-pénem-3-carboxyliques 1-, 6- et 2-substitués, procédé pour leur préparation et compositions pharmaceutiques les contenant | |
US4255330A (en) | Process for preparing 6-substituted amino-2-substituted-pen-2-em-3-carboxylic acid | |
CA1221356A (fr) | COMPOSES DE .beta.-LACTAM, PREPARATION ET UTILISATION | |
US4631150A (en) | Process for the preparation of penems | |
JPH0314037B2 (fr) | ||
SE436130B (sv) | Sett att framstella 1-karba-2-penem-3-karboxylsyror | |
US4262009A (en) | 6- And 1,1-disubstituted-1-carbadethiapen-2-em-3-carboxylic acid | |
US4218459A (en) | 6-Amido-1-carba-2-penem-3-carboxylic acid | |
CA1136617A (fr) | Composes penem substitues en positions 2 et 6 | |
CA1286661C (fr) | Composes de type penem disubstitues en 2,6 | |
US4267188A (en) | 5-Substituted-1-carba-pen-2-em-3-carboxylic acid | |
CA1268183C (fr) | Intermediaires du phosphorane utilises dans la preparation de penems antibiotiques | |
CA1227194A (fr) | Derives penem antibacteriens | |
US4600713A (en) | 1-, 6- and 2-substituted-1-carba-2-penem-3-carboxylic acids | |
US4684724A (en) | 4-Cyano-2-azetidinones and production thereof | |
JPS588085A (ja) | 光学活性トランス−6−置換−5(r)−2−ペネム−3−カルボン酸誘導体の製造法及びこうして得られた化合物 | |
US4374065A (en) | Antibacterial agents of the β-lactam type | |
US4461727A (en) | 4-Acylthioazetidinone intermediates for antibacterial agents | |
IE50596B1 (en) | Penem compounds | |
US4406834A (en) | 2,6 Disubstituted penems and intermediates therefor | |
CA1128531A (fr) | Agents antibacteriens | |
EP0091755A1 (fr) | Dérivés de pénicilline, un procédé pour leur préparation et compositions les contenant | |
JPH07109282A (ja) | ヒドロキシシクロペンタノン誘導体及びその製造法 | |
EP0187500A1 (fr) | Monobactames |