CA1237548A - Method for increasing the molecular weight of diorganopolysiloxanes - Google Patents
Method for increasing the molecular weight of diorganopolysiloxanesInfo
- Publication number
- CA1237548A CA1237548A CA000495715A CA495715A CA1237548A CA 1237548 A CA1237548 A CA 1237548A CA 000495715 A CA000495715 A CA 000495715A CA 495715 A CA495715 A CA 495715A CA 1237548 A CA1237548 A CA 1237548A
- Authority
- CA
- Canada
- Prior art keywords
- carbon
- radicals
- molecular weight
- diorganopolysiloxanes
- quaternary phosphonium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 34
- 229920005645 diorganopolysiloxane polymer Polymers 0.000 title claims abstract description 30
- 230000001965 increasing effect Effects 0.000 title claims abstract description 14
- DJFBJKSMACBYBD-UHFFFAOYSA-N phosphane;hydrate Chemical group O.P DJFBJKSMACBYBD-UHFFFAOYSA-N 0.000 claims abstract description 22
- 238000010438 heat treatment Methods 0.000 claims abstract description 12
- 239000004215 Carbon black (E152) Substances 0.000 claims abstract description 11
- 229930195733 hydrocarbon Natural products 0.000 claims abstract description 11
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims abstract description 9
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 9
- 125000004437 phosphorous atom Chemical group 0.000 claims abstract description 9
- 229910052698 phosphorus Inorganic materials 0.000 claims abstract description 9
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 claims abstract description 8
- 239000011203 carbon fibre reinforced carbon Substances 0.000 claims abstract description 8
- 125000001424 substituent group Chemical group 0.000 claims abstract description 8
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 7
- 239000001257 hydrogen Substances 0.000 claims abstract description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 6
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 claims abstract description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052710 silicon Inorganic materials 0.000 claims abstract description 5
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 claims abstract description 3
- -1 hydrocarbon radicals Chemical class 0.000 claims description 54
- 150000003254 radicals Chemical class 0.000 claims description 23
- 150000003961 organosilicon compounds Chemical class 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 7
- 239000010703 silicon Substances 0.000 claims description 3
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 claims 1
- 229920001296 polysiloxane Polymers 0.000 description 14
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 12
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 11
- 239000004205 dimethyl polysiloxane Substances 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical group CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 8
- 230000000379 polymerizing effect Effects 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 5
- 125000005496 phosphonium group Chemical group 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000011369 resultant mixture Substances 0.000 description 3
- IIVWHGMLFGNMOW-UHFFFAOYSA-N 2-methylpropane Chemical compound C[C](C)C IIVWHGMLFGNMOW-UHFFFAOYSA-N 0.000 description 2
- PIYVNGWKHNMMAU-UHFFFAOYSA-N [O].O Chemical compound [O].O PIYVNGWKHNMMAU-UHFFFAOYSA-N 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910000108 silver(I,III) oxide Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical group CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- MMWCHSBIWFYBBL-UHFFFAOYSA-N 3-chloropropyl-tris(trimethylsilyloxy)silane Chemical compound C[Si](C)(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)CCCCl MMWCHSBIWFYBBL-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 102220475007 Integrator complex subunit 2_R32P_mutation Human genes 0.000 description 1
- JXBAVRIYDKLCOE-UHFFFAOYSA-N [C].[P] Chemical group [C].[P] JXBAVRIYDKLCOE-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- BITPLIXHRASDQB-UHFFFAOYSA-N ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane Chemical compound C=C[Si](C)(C)O[Si](C)(C)C=C BITPLIXHRASDQB-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000011630 iodine Chemical group 0.000 description 1
- 229910052740 iodine Chemical group 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/06—Preparatory processes
- C08G77/08—Preparatory processes characterised by the catalysts used
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Silicon Polymers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP3504185.4 | 1985-02-07 | ||
| DE19853504185 DE3504185A1 (de) | 1985-02-07 | 1985-02-07 | Verfahren zur erhoehung des molekulargewichts von diorgano(poly)-siloxan |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1237548A true CA1237548A (en) | 1988-05-31 |
Family
ID=6261929
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000495715A Expired CA1237548A (en) | 1985-02-07 | 1985-11-19 | Method for increasing the molecular weight of diorganopolysiloxanes |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4607115A (oth) |
| EP (1) | EP0193748B1 (oth) |
| JP (1) | JPS61183323A (oth) |
| AT (1) | ATE44971T1 (oth) |
| CA (1) | CA1237548A (oth) |
| DE (1) | DE3504185A1 (oth) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8622046D0 (en) * | 1986-09-12 | 1986-10-22 | Reckitt & Colmann Prod Ltd | Emanator for volatile liquids |
| US5654374A (en) * | 1995-08-28 | 1997-08-05 | Minnesota Mining And Manufacturing Company | Curable compositions containing silyl-functional onium cure accelerators and method of curing using same |
| DE19533892A1 (de) * | 1995-09-13 | 1997-06-12 | Bayer Ag | Verfahren zur Kettenverlängerung von alpha,omega-Dihydroxy-poly(diorganosiloxanen), vernetzbare Mischungen, enthaltend kettenverlängerte alpha,omega-Dihydroxypoly(diorganosiloxane) und die Verwendung der hergestellten alpha,omega-Dihydroxypoly(diorganosiloxane |
| JP3832685B2 (ja) * | 1997-06-30 | 2006-10-11 | 日本化学工業株式会社 | 抗菌性吸水性樹脂、その製造方法および抗菌性吸水性樹脂組成物 |
| US20030225236A1 (en) * | 2002-06-03 | 2003-12-04 | Masaharu Takahashi | Preparation of organopolysiloxane |
| US7679884B2 (en) * | 2008-07-29 | 2010-03-16 | Wisconsin Alumni Research Foundation | Organosilicon phosphorus-based electrolytes |
| GB0905204D0 (en) * | 2009-03-26 | 2009-05-13 | Dow Corning | Preparation of organosiloxane polymers |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2759008A (en) * | 1953-06-10 | 1956-08-14 | Union Carbide & Carbon Corp | High pressure polymerization of alkylcyclosiloxanes in the presence of an acid catalyst |
| US2883366A (en) * | 1954-12-10 | 1959-04-21 | Gen Electric | Quaternary phosphonium compounds as polymerization catalysts for siloxanes |
| NL127441C (oth) * | 1966-02-11 | |||
| NL131011C (oth) * | 1966-11-02 | |||
| US3518292A (en) * | 1967-03-27 | 1970-06-30 | Dow Corning | Quaternary phosphonium silicon complexes |
| US4008261A (en) * | 1975-01-02 | 1977-02-15 | Dow Corning Corporation | Method of preparing phosphonium siloxanes and products thereof |
| US4433096A (en) * | 1983-03-14 | 1984-02-21 | Dow Corning Corporation | Polymerization of polydiorganosiloxane in the presence of filler |
-
1985
- 1985-02-07 DE DE19853504185 patent/DE3504185A1/de not_active Withdrawn
- 1985-11-18 US US06/799,067 patent/US4607115A/en not_active Expired - Fee Related
- 1985-11-19 CA CA000495715A patent/CA1237548A/en not_active Expired
-
1986
- 1986-02-05 JP JP61022234A patent/JPS61183323A/ja active Granted
- 1986-02-06 EP EP86101519A patent/EP0193748B1/de not_active Expired
- 1986-02-06 AT AT86101519T patent/ATE44971T1/de active
Also Published As
| Publication number | Publication date |
|---|---|
| EP0193748A1 (de) | 1986-09-10 |
| JPS6340813B2 (oth) | 1988-08-12 |
| DE3504185A1 (de) | 1986-08-07 |
| JPS61183323A (ja) | 1986-08-16 |
| EP0193748B1 (en) | 1989-07-26 |
| US4607115A (en) | 1986-08-19 |
| ATE44971T1 (de) | 1989-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5354830A (en) | Vulcanizable one-component polysiloxanes | |
| DE69117094T2 (de) | Verfahren zur Herstellung von Kopolymeren mit Diphenyl- und Dimethylsiloxankettensegmenten | |
| US4157337A (en) | Process for the polymerization of cyclic diorganopolysiloxanes with cation-complex catalysts | |
| US4122247A (en) | Process for the polymerization of cyclic diorganopolysiloxanes with cation-complex catalysts | |
| EP0586240B1 (en) | Alkoxy endblocked polydiorganosiloxane and room temperature vulcanizable silicone elastomers made therefrom | |
| US4725643A (en) | Process for preparing linear organopolysiloxanes having terminal triorganosiloxy groups | |
| US4564693A (en) | Process for stabilizing organopolysiloxanes | |
| US5254645A (en) | Cluster azasilacycloalkyl functional polysiloxanes | |
| US4975510A (en) | Process for preparing diorganopolysiloxanes having terminal triorganosiloxy units | |
| US4267298A (en) | Process for preparing M-stopped silicone fluids from silanol fluids | |
| CA1048521A (en) | Process for producing low and high molecular weight diorganopolysiloxanes for use in heat vulcanizable silicone rubber compositions | |
| US5110967A (en) | Crosslinkers and chain extenders for room temperature vulcanization or crosslinking of polymers | |
| US4835237A (en) | Process for preparing diorganopolysiloxanes containing triorganosiloxy terminal groups | |
| CA1237548A (en) | Method for increasing the molecular weight of diorganopolysiloxanes | |
| US3960802A (en) | Process for the manufacture of a one-component room-temperature vulcanizable silicone composition | |
| US2883366A (en) | Quaternary phosphonium compounds as polymerization catalysts for siloxanes | |
| US5122585A (en) | One part heat curable organopolysiloxane compositions | |
| US3234180A (en) | Siloxy polymers | |
| CA1285689C (en) | Process for chain stabilization of organopolysiloxanes | |
| KR970006899B1 (ko) | 플루오로실리콘 중합체 제조용 촉매 | |
| US4530989A (en) | Room temperature stable organopolysiloxane compositions | |
| US4460726A (en) | Method for stabilizing organopolysiloxanes | |
| US3350350A (en) | Method for preparing polysilarylene-polysiloxane copolymers | |
| US4242486A (en) | Process for preparing organopolysiloxane resins containing Si-bonded vinyl groups | |
| US3398117A (en) | Process for the preparation of organopolysiloxanes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |