CA1225183A - Composition - Google Patents
CompositionInfo
- Publication number
- CA1225183A CA1225183A CA000470166A CA470166A CA1225183A CA 1225183 A CA1225183 A CA 1225183A CA 000470166 A CA000470166 A CA 000470166A CA 470166 A CA470166 A CA 470166A CA 1225183 A CA1225183 A CA 1225183A
- Authority
- CA
- Canada
- Prior art keywords
- composition
- accordance
- polycarbonate
- weight percent
- aromatic polycarbonate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 40
- 125000003118 aryl group Chemical group 0.000 claims abstract description 29
- 239000004417 polycarbonate Substances 0.000 claims abstract description 26
- 229920000515 polycarbonate Polymers 0.000 claims abstract description 25
- 150000002148 esters Chemical class 0.000 claims abstract description 12
- 229920000728 polyester Polymers 0.000 claims abstract description 11
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 claims abstract description 9
- 229920001577 copolymer Polymers 0.000 claims abstract description 9
- 239000004609 Impact Modifier Substances 0.000 claims abstract description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229920005989 resin Polymers 0.000 claims abstract description 3
- 239000011347 resin Substances 0.000 claims abstract description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 8
- -1 acrylate ester Chemical class 0.000 claims description 5
- QLZJUIZVJLSNDD-UHFFFAOYSA-N 2-(2-methylidenebutanoyloxy)ethyl 2-methylidenebutanoate Chemical compound CCC(=C)C(=O)OCCOC(=O)C(=C)CC QLZJUIZVJLSNDD-UHFFFAOYSA-N 0.000 claims description 4
- 229920006244 ethylene-ethyl acrylate Polymers 0.000 claims description 4
- 239000005042 ethylene-ethyl acrylate Substances 0.000 claims description 4
- 125000004185 ester group Chemical group 0.000 claims description 3
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 claims description 3
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical group [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 claims description 2
- 229920000402 bisphenol A polycarbonate polymer Polymers 0.000 claims 5
- 125000000217 alkyl group Chemical group 0.000 claims 2
- 239000004711 α-olefin Substances 0.000 claims 2
- 239000003365 glass fiber Substances 0.000 claims 1
- 239000000243 solution Substances 0.000 abstract 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 37
- 229920000642 polymer Polymers 0.000 description 13
- 239000002253 acid Substances 0.000 description 12
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 12
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 8
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 8
- 238000006116 polymerization reaction Methods 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 229920001634 Copolyester Polymers 0.000 description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 229920000180 alkyd Polymers 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 5
- 208000037062 Polyps Diseases 0.000 description 4
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 150000002989 phenols Chemical class 0.000 description 4
- 239000007790 solid phase Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 229920000298 Cellophane Polymers 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000006482 condensation reaction Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 150000002334 glycols Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 3
- 239000002952 polymeric resin Substances 0.000 description 3
- 239000001294 propane Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 229920003002 synthetic resin Polymers 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 244000007853 Sarothamnus scoparius Species 0.000 description 2
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 229940106691 bisphenol a Drugs 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 239000012763 reinforcing filler Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- HCNHNBLSNVSJTJ-UHFFFAOYSA-N 1,1-Bis(4-hydroxyphenyl)ethane Chemical compound C=1C=C(O)C=CC=1C(C)C1=CC=C(O)C=C1 HCNHNBLSNVSJTJ-UHFFFAOYSA-N 0.000 description 1
- MQCPOLNSJCWPGT-UHFFFAOYSA-N 2,2'-Bisphenol F Chemical compound OC1=CC=CC=C1CC1=CC=CC=C1O MQCPOLNSJCWPGT-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- JHOPNNNTBHXSHY-UHFFFAOYSA-N 2-(4-hydroxyphenyl)phenol Chemical group C1=CC(O)=CC=C1C1=CC=CC=C1O JHOPNNNTBHXSHY-UHFFFAOYSA-N 0.000 description 1
- BXGYYDRIMBPOMN-UHFFFAOYSA-N 2-(hydroxymethoxy)ethoxymethanol Chemical compound OCOCCOCO BXGYYDRIMBPOMN-UHFFFAOYSA-N 0.000 description 1
- RKSBPFMNOJWYSB-UHFFFAOYSA-N 3,3-Bis(4-hydroxyphenyl)pentane Chemical compound C=1C=C(O)C=CC=1C(CC)(CC)C1=CC=C(O)C=C1 RKSBPFMNOJWYSB-UHFFFAOYSA-N 0.000 description 1
- GRBSHVCIKYLDAO-UHFFFAOYSA-N 4-(3,5-diethyl-4-hydroxyphenyl)sulfonyl-2,6-diethylphenol Chemical compound CCC1=C(O)C(CC)=CC(S(=O)(=O)C=2C=C(CC)C(O)=C(CC)C=2)=C1 GRBSHVCIKYLDAO-UHFFFAOYSA-N 0.000 description 1
- NZGQHKSLKRFZFL-UHFFFAOYSA-N 4-(4-hydroxyphenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(O)C=C1 NZGQHKSLKRFZFL-UHFFFAOYSA-N 0.000 description 1
- WCUDAIJOADOKAW-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)pentan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(CCC)C1=CC=C(O)C=C1 WCUDAIJOADOKAW-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241000282320 Panthera leo Species 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 150000002531 isophthalic acids Chemical class 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- MNZMMCVIXORAQL-UHFFFAOYSA-N naphthalene-2,6-diol Chemical compound C1=C(O)C=CC2=CC(O)=CC=C21 MNZMMCVIXORAQL-UHFFFAOYSA-N 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 101150021143 rplW gene Proteins 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/563,183 US4536538A (en) | 1983-12-19 | 1983-12-19 | Impact modified polycarbonate composition |
| US563,183 | 1983-12-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1225183A true CA1225183A (en) | 1987-08-04 |
Family
ID=24249450
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000470166A Expired CA1225183A (en) | 1983-12-19 | 1984-12-14 | Composition |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4536538A (en:Method) |
| EP (1) | EP0153470B1 (en:Method) |
| JP (1) | JPS60168753A (en:Method) |
| AU (1) | AU567993B2 (en:Method) |
| CA (1) | CA1225183A (en:Method) |
| DE (1) | DE3480550D1 (en:Method) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4604423A (en) * | 1983-12-19 | 1986-08-05 | General Electric Company | Composition |
| EP0186050B1 (en) * | 1984-12-19 | 1990-01-31 | General Electric Company | Copolyester-carbonate composition |
| US4559388A (en) * | 1984-12-19 | 1985-12-17 | General Electric Company | Copolyester-carbonate composition |
| US4629760A (en) * | 1985-11-01 | 1986-12-16 | General Electric Company | Composition of polycarbonate, polyester, acrylate elastomeric copolymer and a phenoxy resin |
| US4707511A (en) * | 1985-12-17 | 1987-11-17 | General Electric Company | Thermoplastically moldable compositions |
| EP0273151A3 (en) * | 1986-12-30 | 1989-10-25 | General Electric Company | Low temperature impact resistant polycarbonate/poly (cyclohexane-dimethylene terephthalate)/core-shell acrylate copolymer compositions |
| EP0320648A3 (en) * | 1987-12-16 | 1990-09-19 | General Electric Company | Flame retardant-low heat distortion polycarbonates with low gloss |
| EP0320647A3 (en) * | 1987-12-16 | 1990-09-19 | General Electric Company | Polycarbonate composition with low heat distortion |
| US4897448A (en) * | 1988-04-01 | 1990-01-30 | Eastman Kodak Company | Polyester/polycarbonate blends |
| US5189091A (en) * | 1989-05-04 | 1993-02-23 | The Dow Chemical Company | Polycarbonate/aromatic polyester blends modified with a grafted olefin copolymer |
| US5187230A (en) * | 1989-12-15 | 1993-02-16 | Monsanto Company | Rubber-modified polymer blends of polycarbonate and PETG |
| EP0440008A1 (en) * | 1989-12-15 | 1991-08-07 | Monsanto Company | Polymer blends of polycarbonate, polyester and graft rubber compositions |
| US5104934A (en) * | 1989-12-15 | 1992-04-14 | Monsanto Company | Polymer blends of polycarbonate, PETG and ABS |
| EP0442861A3 (en) * | 1990-02-15 | 1992-04-01 | Monsanto Company | Rubber-modified blends of polycarbonate and polyester |
| JP3876141B2 (ja) * | 2001-03-28 | 2007-01-31 | 東レ株式会社 | ポリエステル系樹脂組成物およびその成形品 |
| DE10260215A1 (de) * | 2002-12-20 | 2004-07-01 | Pro-Tech Beratungs- Und Entwicklungs Gmbh | Maskierungsmittel und Beschichtungsverfahren |
| US7686906B2 (en) * | 2005-06-30 | 2010-03-30 | Solutia Inc. | Methods of making polymer interlayers comprising poly(cyclohexanedimethylene terephthalate-co-ethylene terephthalate) copolyester |
| US20070003746A1 (en) * | 2005-06-30 | 2007-01-04 | Solutia, Inc. | Polymer interlayers comprising poly(cyclohexanedimethylene terephthalate-co-ethylene terephthalate) copolyester |
| US7901780B2 (en) * | 2008-06-25 | 2011-03-08 | Solutia Inc. | Polymer interlayers comprising blends of plasticized poly(vinyl butyral) and poly(cyclohexanedimethylene terephthalate-co-ethylene terephthalate) copolyester |
| KR101134012B1 (ko) * | 2008-12-29 | 2012-04-05 | 제일모직주식회사 | 난연성 열가소성 수지 조성물 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE634842A (en:Method) * | 1962-07-11 | |||
| DE1694170A1 (de) * | 1967-07-20 | 1971-06-09 | Hoechst Ag | Thermoplastische Polyesterformmassen |
| US4125572A (en) * | 1976-12-14 | 1978-11-14 | General Electric Company | Thermoplastic molding composition |
| US4391954A (en) * | 1976-12-14 | 1983-07-05 | General Electric Company | Thermoplastic molding composition |
| US4124652A (en) * | 1976-12-14 | 1978-11-07 | General Electric Company | Thermoplastic molding composition |
| US4226950A (en) * | 1978-07-06 | 1980-10-07 | General Electric Company | Plasticized, impact modified polycarbonates |
| US4260693A (en) * | 1979-08-27 | 1981-04-07 | General Electric Company | Polycarbonate compositions |
| US4267096A (en) * | 1979-11-09 | 1981-05-12 | General Electric Company | Composition of a selectively hydrogenated block copolymer of a vinyl aromatic compound and a diolefin, a polycarbonate and an amorphous polyester |
| US4320212A (en) * | 1980-03-20 | 1982-03-16 | General Electric Co. | Ternary polycarbonate compositions containing polyacrylate and thermoplastic polyester |
| DE3234174A1 (de) * | 1982-09-15 | 1984-03-15 | Basf Ag, 6700 Ludwigshafen | Schlagzaehe thermoplastische formmassen mit hoher waermeformbestaendigkeit |
| US4481331A (en) * | 1983-03-22 | 1984-11-06 | Gen Electric | Polycarbonate resin mixture |
| AU3369484A (en) * | 1983-10-03 | 1985-04-18 | General Electric Company | Polycarbonate compositions |
-
1983
- 1983-12-19 US US06/563,183 patent/US4536538A/en not_active Expired - Lifetime
-
1984
- 1984-12-12 EP EP84115248A patent/EP0153470B1/en not_active Expired
- 1984-12-12 AU AU36586/84A patent/AU567993B2/en not_active Ceased
- 1984-12-12 DE DE8484115248T patent/DE3480550D1/de not_active Expired
- 1984-12-14 CA CA000470166A patent/CA1225183A/en not_active Expired
- 1984-12-19 JP JP59266547A patent/JPS60168753A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| AU567993B2 (en) | 1987-12-10 |
| EP0153470A3 (en) | 1986-06-11 |
| AU3658684A (en) | 1985-06-27 |
| EP0153470B1 (en) | 1989-11-23 |
| US4536538A (en) | 1985-08-20 |
| JPS60168753A (ja) | 1985-09-02 |
| EP0153470A2 (en) | 1985-09-04 |
| DE3480550D1 (en) | 1989-12-28 |
| JPS6244021B2 (en:Method) | 1987-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1225183A (en) | Composition | |
| EP1124878B1 (en) | Weatherable block copolyestercarbonates and blends containing them | |
| US4994532A (en) | Polycarbonate-silicone block copolymer compositions | |
| US4352907A (en) | Polyethyleneterephthalate ternary blends | |
| JPS62187761A (ja) | ポリアミドとエポキシ官能性化合物を含有する熱可塑性ブレンド | |
| US4436879A (en) | Copolyester-carbonate blends | |
| US4628074A (en) | Polycarbonate compositions | |
| EP0094585B1 (en) | A process for making ordered ester/carbonate copolymers | |
| EP0386549B1 (en) | Aromatic polyester-siloxane block copolymers and method for making | |
| CA2074961A1 (en) | Solvent-resistant polycarbonate-polyester blends with improved impact properties | |
| US5055531A (en) | Process for the preparation of polyester/polycarbonate copolymers | |
| EP0235384A2 (en) | Thermoplastic blends with amorphous polyamide | |
| WO1987005920A1 (en) | Polymer mixture which comprises an aromatic polycarbonate, a polyalkylene terephthalate and an agent to improve the impact strength | |
| US5045610A (en) | Blend of copolyestercarbonate polymer derived from diaryl dicarboxylic acid | |
| EP0320655B1 (en) | Molding resins | |
| US4877848A (en) | Thermoplastic blends containing polyamide and epoxy functional compound | |
| US4604423A (en) | Composition | |
| EP0113870B1 (en) | Copolyester-carbonate blends exhibiting improved processability | |
| US4448950A (en) | Polycarbonate having improved critical thickness | |
| AU734417B2 (en) | Method for preparing brominated polycarbonates, and process obtained thereby | |
| US4520208A (en) | Aromatic polyester containing phenolphthalein unit and bis-phenol unit | |
| US4603170A (en) | Moulding compositions comprising an aromatic polycarbonate and a sulfone group containing polyester | |
| US4798874A (en) | Thermoplastic blends comprising polycarbonate resin and amorphous polyamide | |
| US4645804A (en) | Polycarbonate/imide hetero group condensation polymer blends | |
| JPS5883050A (ja) | 耐熱性樹脂組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |