CA1217196A - Process for the production of 7-alkyl indoles - Google Patents
Process for the production of 7-alkyl indolesInfo
- Publication number
- CA1217196A CA1217196A CA000450289A CA450289A CA1217196A CA 1217196 A CA1217196 A CA 1217196A CA 000450289 A CA000450289 A CA 000450289A CA 450289 A CA450289 A CA 450289A CA 1217196 A CA1217196 A CA 1217196A
- Authority
- CA
- Canada
- Prior art keywords
- catalyst
- aniline
- ethyl
- percent
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 31
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 6
- 239000003054 catalyst Substances 0.000 claims abstract description 39
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 claims abstract description 21
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims abstract description 18
- 238000005984 hydrogenation reaction Methods 0.000 claims abstract description 11
- QDOXWKRWXJOMAK-UHFFFAOYSA-N dichromium trioxide Chemical compound O=[Cr]O[Cr]=O QDOXWKRWXJOMAK-UHFFFAOYSA-N 0.000 claims abstract description 10
- -1 BaCrO4 Chemical compound 0.000 claims abstract description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 7
- 239000001301 oxygen Substances 0.000 claims abstract description 7
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 7
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 claims abstract description 6
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims abstract description 6
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 claims abstract description 6
- 150000001875 compounds Chemical class 0.000 claims abstract description 6
- GNTDGMZSJNCJKK-UHFFFAOYSA-N divanadium pentaoxide Chemical compound O=[V](=O)O[V](=O)=O GNTDGMZSJNCJKK-UHFFFAOYSA-N 0.000 claims abstract description 6
- 239000007789 gas Substances 0.000 claims abstract description 6
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims abstract description 5
- 230000003197 catalytic effect Effects 0.000 claims abstract description 4
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 claims abstract description 4
- 239000000203 mixture Substances 0.000 claims abstract description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims abstract description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims abstract description 3
- UBEWDCMIDFGDOO-UHFFFAOYSA-N cobalt(II,III) oxide Inorganic materials [O-2].[O-2].[O-2].[O-2].[Co+2].[Co+3].[Co+3] UBEWDCMIDFGDOO-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052593 corundum Inorganic materials 0.000 claims abstract description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims abstract description 3
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910001845 yogo sapphire Inorganic materials 0.000 claims abstract description 3
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims abstract 4
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims abstract 3
- 150000008041 alkali metal carbonates Chemical class 0.000 claims abstract 3
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims abstract 2
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 claims abstract 2
- 125000000217 alkyl group Chemical group 0.000 claims abstract 2
- 239000000470 constituent Substances 0.000 claims abstract 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N benzopyrrole Natural products C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 claims description 16
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 claims description 13
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 claims description 9
- 229910052751 metal Inorganic materials 0.000 claims description 8
- 239000002184 metal Substances 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical group [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 5
- WKBALTUBRZPIPZ-UHFFFAOYSA-N 2,6-di(propan-2-yl)aniline Chemical compound CC(C)C1=CC=CC(C(C)C)=C1N WKBALTUBRZPIPZ-UHFFFAOYSA-N 0.000 claims description 4
- ZUVBCDVLPGKKTF-UHFFFAOYSA-N 3-methyl-7-propan-2-yl-1h-indole Chemical compound CC(C)C1=CC=CC2=C1NC=C2C ZUVBCDVLPGKKTF-UHFFFAOYSA-N 0.000 claims description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 claims description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 4
- OZLRLDOVFYRDIL-UHFFFAOYSA-N 7-ethyl-5-methyl-1h-indole Chemical compound CCC1=CC(C)=CC2=C1NC=C2 OZLRLDOVFYRDIL-UHFFFAOYSA-N 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- OIXUMNZGNCAOKY-UHFFFAOYSA-N 2,6-diethyl-4-methylaniline Chemical group CCC1=CC(C)=CC(CC)=C1N OIXUMNZGNCAOKY-UHFFFAOYSA-N 0.000 claims description 2
- 239000007868 Raney catalyst Substances 0.000 claims description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims description 2
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 229910052786 argon Inorganic materials 0.000 claims description 2
- 239000001569 carbon dioxide Substances 0.000 claims description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 2
- 235000015320 potassium carbonate Nutrition 0.000 claims description 2
- 239000003701 inert diluent Substances 0.000 claims 2
- FOYHNROGBXVLLX-KHWBWMQUSA-N 2,6-diethylaniline Chemical group CCC1=CC=CC(CC)=C1[15NH2] FOYHNROGBXVLLX-KHWBWMQUSA-N 0.000 claims 1
- JJVKJJNCIILLRP-UHFFFAOYSA-N 2-ethyl-6-methylaniline Chemical compound CCC1=CC=CC(C)=C1N JJVKJJNCIILLRP-UHFFFAOYSA-N 0.000 claims 1
- OTZUSNPBNWUXCQ-UHFFFAOYSA-N 2-ethyl-6-propan-2-ylaniline Chemical compound CCC1=CC=CC(C(C)C)=C1N OTZUSNPBNWUXCQ-UHFFFAOYSA-N 0.000 claims 1
- DDTKYVBFPULMGN-UHFFFAOYSA-N 2-methyl-6-propan-2-ylaniline Chemical compound CC(C)C1=CC=CC(C)=C1N DDTKYVBFPULMGN-UHFFFAOYSA-N 0.000 claims 1
- VSHTWPWTCXQLQN-UHFFFAOYSA-N n-butylaniline Chemical compound CCCCNC1=CC=CC=C1 VSHTWPWTCXQLQN-UHFFFAOYSA-N 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 1
- 229910052757 nitrogen Inorganic materials 0.000 claims 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims 1
- 239000010970 precious metal Substances 0.000 claims 1
- 229930195734 saturated hydrocarbon Natural products 0.000 claims 1
- 150000001448 anilines Chemical class 0.000 abstract 1
- 239000007858 starting material Substances 0.000 abstract 1
- 239000000047 product Substances 0.000 description 26
- PIIZLMYXLGYWTN-UHFFFAOYSA-N 7-ethyl-1h-indole Chemical compound CCC1=CC=CC2=C1NC=C2 PIIZLMYXLGYWTN-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- KGWPHCDTOLQQEP-UHFFFAOYSA-N 7-methylindole Chemical compound CC1=CC=CC2=C1NC=C2 KGWPHCDTOLQQEP-UHFFFAOYSA-N 0.000 description 4
- 241001163743 Perlodes Species 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- FOYHNROGBXVLLX-UHFFFAOYSA-N 2,6-diethylaniline Chemical compound CCC1=CC=CC(CC)=C1N FOYHNROGBXVLLX-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- 239000011398 Portland cement Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ICJCWNDTSJPBDL-UHFFFAOYSA-N 2-ethenyl-6-ethylaniline Chemical compound CCC1=CC=CC(C=C)=C1N ICJCWNDTSJPBDL-UHFFFAOYSA-N 0.000 description 2
- BBXYPUKBKQVENX-UHFFFAOYSA-N 7-ethenyl-1h-indole Chemical compound C=CC1=CC=CC2=C1NC=C2 BBXYPUKBKQVENX-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- HUCVOHYBFXVBRW-UHFFFAOYSA-M caesium hydroxide Chemical compound [OH-].[Cs+] HUCVOHYBFXVBRW-UHFFFAOYSA-M 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- CPRMKOQKXYSDML-UHFFFAOYSA-M rubidium hydroxide Chemical compound [OH-].[Rb+] CPRMKOQKXYSDML-UHFFFAOYSA-M 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- QIVUCLWGARAQIO-OLIXTKCUSA-N (3s)-n-[(3s,5s,6r)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]-2-oxospiro[1h-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxamide Chemical compound C1([C@H]2[C@H](N(C(=O)[C@@H](NC(=O)C=3C=C4C[C@]5(CC4=NC=3)C3=CC=CN=C3NC5=O)C2)CC(F)(F)F)C)=C(F)C=CC(F)=C1F QIVUCLWGARAQIO-OLIXTKCUSA-N 0.000 description 1
- QBNMSFIOEZARAJ-UHFFFAOYSA-N 2-propan-2-yl-6-prop-1-en-2-ylaniline Chemical compound CC(C)C1=CC=CC(C(C)=C)=C1N QBNMSFIOEZARAJ-UHFFFAOYSA-N 0.000 description 1
- WQJJAQXIXFDBDI-UHFFFAOYSA-N 7-ethyl-2-methyl-1h-indole Chemical compound CCC1=CC=CC2=C1NC(C)=C2 WQJJAQXIXFDBDI-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- RPFGCUFAJAQNLJ-UHFFFAOYSA-N n-phenylcyclohexanimine Chemical compound C1CCCCC1=NC1=CC=CC=C1 RPFGCUFAJAQNLJ-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229910000026 rubidium carbonate Inorganic materials 0.000 description 1
- WPFGFHJALYCVMO-UHFFFAOYSA-L rubidium carbonate Chemical compound [Rb+].[Rb+].[O-]C([O-])=O WPFGFHJALYCVMO-UHFFFAOYSA-L 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000002912 waste gas Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1584/83 | 1983-03-23 | ||
| CH158483 | 1983-03-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1217196A true CA1217196A (en) | 1987-01-27 |
Family
ID=4213826
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000450289A Expired CA1217196A (en) | 1983-03-23 | 1984-03-22 | Process for the production of 7-alkyl indoles |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4703126A (enExample) |
| EP (1) | EP0120221B1 (enExample) |
| JP (1) | JPS6122066A (enExample) |
| AT (1) | ATE28325T1 (enExample) |
| CA (1) | CA1217196A (enExample) |
| DE (1) | DE3464756D1 (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1996032391A1 (de) * | 1995-04-11 | 1996-10-17 | Lonza Ag | Verfahren zur herstellung von azaindolen mit aktiviertem kupferchromit katalysator durch katalytische dehydrocyclisierung von alkyl-pyridylaminen (pyridopyridinen) |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2953575A (en) * | 1955-11-08 | 1960-09-20 | Houdry Process Corp | Preparation of indole |
| US2891965A (en) * | 1956-10-03 | 1959-06-23 | Houdry Process Corp | Preparation of heterocyclic compounds |
| US3206471A (en) * | 1963-10-11 | 1965-09-14 | American Cyanamid Co | Novel substituted 3-(alpha-alkoxycarbonyloxy-lower alkyl)-and 3-(alpha-phenoxycarbonyloxy-lower alkyl)-4, 7-indoloquinones and novel methods of preparing the same |
| US3441569A (en) * | 1966-05-31 | 1969-04-29 | Eastman Kodak Co | Method for preparing polycyclic heterocyclic compounds |
| US3411569A (en) * | 1966-11-02 | 1968-11-19 | Johnson Corp | Pull-out cooling section for combined heating-cooling unit |
| BE757422A (fr) * | 1969-10-16 | 1971-03-16 | Snam Progetti | Procede catalytique de deshydrocyclisation oxydante de composesaromatiques substitues et produits ainsi obtenus |
| CS174823B2 (enExample) * | 1970-09-07 | 1977-04-29 | Snam Progetti | |
| CA935819A (en) * | 1970-09-30 | 1973-10-23 | Snamprogetti S.P.A. | Process for producing di-or polynuclear heterocyclic compounds |
| US3894042A (en) * | 1972-01-25 | 1975-07-08 | Teijin Ltd | Preparation of indoles and catalyst compositions used in their preparation |
| DE2224556C2 (de) * | 1972-05-19 | 1974-08-01 | Ruetgerswerke Ag, 6000 Frankfurt | Verfahren zur Herstellung von Indol aus o Äthyl anilin |
| CH589054A5 (enExample) * | 1973-09-12 | 1977-06-30 | Lonza Ag | |
| CH590229A5 (enExample) * | 1974-01-10 | 1977-07-29 | Ruetgerswerke Ag | |
| CA1149395A (en) * | 1981-04-21 | 1983-07-05 | Mitsui Toatsu Chemicals, Inc. | Process for the preparation of indole and derivatives thereof |
| US4443615A (en) * | 1981-11-10 | 1984-04-17 | Tanabe Seiyaku Co., Ltd. | Process for preparing indoles |
-
1984
- 1984-01-31 DE DE8484100966T patent/DE3464756D1/de not_active Expired
- 1984-01-31 EP EP84100966A patent/EP0120221B1/de not_active Expired
- 1984-01-31 AT AT84100966T patent/ATE28325T1/de not_active IP Right Cessation
- 1984-03-22 JP JP59055189A patent/JPS6122066A/ja active Granted
- 1984-03-22 CA CA000450289A patent/CA1217196A/en not_active Expired
-
1986
- 1986-08-13 US US06/896,109 patent/US4703126A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4703126A (en) | 1987-10-27 |
| DE3464756D1 (en) | 1987-08-20 |
| EP0120221A1 (de) | 1984-10-03 |
| EP0120221B1 (de) | 1987-07-15 |
| ATE28325T1 (de) | 1987-08-15 |
| JPH049780B2 (enExample) | 1992-02-21 |
| JPS6122066A (ja) | 1986-01-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US7355083B2 (en) | Process | |
| US5276181A (en) | Catalytic method of hydrogenating glycerol | |
| US5883266A (en) | Hydrogenated 5-carbon compound and method of making | |
| JPS59112946A (ja) | ジ(4−アミノフエニル)メタンの接触的水素化法 | |
| Armstrong et al. | Exocyclic iminium salts as catalysts for alkene epoxidation by Oxone® | |
| CN105541664B (zh) | 一种合成氰基丙烯酸酯的方法 | |
| CA2650550C (en) | Method for producing 3-methyl-1,5-pentanediol | |
| CA1217196A (en) | Process for the production of 7-alkyl indoles | |
| US5395972A (en) | Process for producing amines | |
| US6166269A (en) | Process for the preparation of 2-phenyl ethanol | |
| US20030114715A1 (en) | Method for producing alkenyl ethers | |
| US4263460A (en) | Process for preparing methyl-nonyl-acetaldehyde | |
| EP0409517A1 (en) | Process for decomposition of methanol | |
| US3819719A (en) | Production of alkoxy phenolic compounds | |
| US4261926A (en) | Reductive alkylation of substituted anilines | |
| CA2083650A1 (en) | Preparation of 4-hydroxymethyltetrahydropyrans | |
| US4134919A (en) | Process for producing menthone | |
| JP3672441B2 (ja) | 脂環式モノケトン類の製造方法および脂環式ジケトン類の製造方法 | |
| KR910002508B1 (ko) | 4-(4-히드록시페닐)-시클로헥산올의 제조방법 | |
| US4990682A (en) | Process for the preparation of 5-chloro-2-pentanone | |
| CN101215217A (zh) | 环戊二烯三聚体的合成方法 | |
| JP2011231048A (ja) | アルキルアリールケトンの水素化法 | |
| WO1998017657A2 (en) | Preparation of 3-alkyltetrahydrofurans | |
| GB2080285A (en) | Process for the Preparation of Cyclopropylmethyl-n-Propylamine | |
| JPH0395136A (ja) | メチルイソブチルケトンの製造法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |